Index of /uploads/profile_images
![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | 1450468184Final_blac..> | 2016-01-28 00:00 | 231K | |
![[IMG]](/icons/image2.gif) | 1450517491Logo.png | 2016-01-28 00:00 | 3.9K | |
![[IMG]](/icons/image2.gif) | 1450808814MoodysLogo..> | 2016-01-28 00:00 | 205K | |
![[IMG]](/icons/image2.gif) | 1451276645girl-8.jpg | 2016-01-28 00:00 | 237K | |
![[IMG]](/icons/image2.gif) | 1451423818amber-wave..> | 2016-01-28 00:00 | 172K | |
![[IMG]](/icons/image2.gif) | 1451506790Icon no ty..> | 2016-01-28 00:00 | 44K | |
![[IMG]](/icons/image2.gif) | 1451568891image.jpeg | 2016-01-28 00:00 | 100K | |
![[IMG]](/icons/image2.gif) | 1451706303image.jpg | 2016-01-28 00:00 | 124K | |
![[IMG]](/icons/image2.gif) | 1452043735urban_ladl..> | 2016-01-28 00:00 | 91K | |
![[IMG]](/icons/image2.gif) | 1452192508P1small.jpg | 2016-01-28 00:00 | 49K | |
![[IMG]](/icons/image2.gif) | 1452194850P1small.jpg | 2016-01-28 00:00 | 49K | |
![[IMG]](/icons/image2.gif) | 1453136558logo.jpg | 2016-01-28 00:00 | 23K | |
![[IMG]](/icons/image2.gif) | 1453137428MoodysM.jpg | 2016-01-28 00:00 | 90K | |
![[IMG]](/icons/image2.gif) | 1453305788urban_ladl..> | 2016-01-28 00:00 | 148K | |
![[IMG]](/icons/image2.gif) | 1453408432BlueLotus_..> | 2016-01-28 00:00 | 75K | |
![[IMG]](/icons/image2.gif) | 1455052336caprinicre..> | 2016-02-09 00:00 | 17K | |
![[IMG]](/icons/image2.gif) | 1455066815logo-type ..> | 2016-02-09 00:00 | 104K | |
![[IMG]](/icons/image2.gif) | 1455191263sobro.jpg | 2016-02-11 00:00 | 118K | |
![[IMG]](/icons/image2.gif) | 1455432521image.jpeg | 2016-02-13 00:00 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1455814874freebirdpr..> | 2016-02-18 00:00 | 206K | |
![[IMG]](/icons/image2.gif) | 1455830612feastlogo.jpg | 2016-02-18 00:00 | 11K | |
![[IMG]](/icons/image2.gif) | 1456176855batch no 2..> | 2016-02-22 00:00 | 92K | |
![[IMG]](/icons/image2.gif) | 1456255073gfflogojpe..> | 2016-02-23 00:00 | 9.4K | |
![[IMG]](/icons/image2.gif) | 1456262913headshotbl..> | 2016-02-23 00:00 | 5.7K | |
![[IMG]](/icons/image2.gif) | 1456320059logo-outlo..> | 2016-02-24 00:00 | 16K | |
![[IMG]](/icons/image2.gif) | 1456343217Logo 2.jpg | 2016-02-24 00:00 | 64K | |
![[IMG]](/icons/image2.gif) | 1456362264The_Flying..> | 2016-02-24 00:00 | 364K | |
![[IMG]](/icons/image2.gif) | 1456364437ScatteredB..> | 2016-02-24 00:00 | 15K | |
![[IMG]](/icons/image2.gif) | 1456366549Logo_High ..> | 2016-02-24 00:00 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1456416242image.jpeg | 2016-02-25 00:00 | 44K | |
![[IMG]](/icons/image2.gif) | 1456510002EXTERIOR S..> | 2016-02-26 00:00 | 579K | |
![[IMG]](/icons/image2.gif) | 1456761352image.jpeg | 2016-02-29 00:00 | 13K | |
![[IMG]](/icons/image2.gif) | 1456773623DanielFarm..> | 2016-02-29 00:00 | 926K | |
![[IMG]](/icons/image2.gif) | 1456971909Symphony o..> | 2016-03-02 00:00 | 50K | |
![[IMG]](/icons/image2.gif) | 1457663028fb 2.jpg | 2016-03-10 00:00 | 25K | |
![[IMG]](/icons/image2.gif) | 1458042122launch-fis..> | 2016-03-15 00:00 | 3.7K | |
![[IMG]](/icons/image2.gif) | 1458222571HoneyMaple..> | 2016-03-17 00:00 | 679K | |
![[IMG]](/icons/image2.gif) | 1458698757PRODUCT PI..> | 2016-03-22 00:00 | 126K | |
![[IMG]](/icons/image2.gif) | 1458759723LRCmaster.jpg | 2016-03-23 00:00 | 49K | |
![[IMG]](/icons/image2.gif) | 1458923272PRODUCT PI..> | 2016-03-25 00:00 | 126K | |
![[IMG]](/icons/image2.gif) | 1459357589GH_FullCol..> | 2016-03-30 00:00 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1459438297logo.png | 2016-03-31 00:00 | 42K | |
![[IMG]](/icons/image2.gif) | 1459645743Logo rock.jpg | 2016-04-02 00:00 | 36K | |
![[IMG]](/icons/image2.gif) | 1460487873download.jpg | 2016-04-12 00:00 | 175K | |
![[IMG]](/icons/image2.gif) | 1460496127IMG_5007.JPG | 2016-04-12 00:00 | 289K | |
![[IMG]](/icons/image2.gif) | 1460643321D Chandeli..> | 2016-04-14 00:00 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1460696571tnt 11500.jpg | 2016-04-14 00:00 | 117K | |
![[IMG]](/icons/image2.gif) | 1460829328fragrantbl..> | 2016-04-16 00:00 | 64K | |
![[IMG]](/icons/image2.gif) | 1461187511facebook p..> | 2016-04-20 00:00 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1461296012image.jpeg | 2016-04-21 00:00 | 118K | |
![[IMG]](/icons/image2.gif) | 1461987703logo2.jpg | 2016-04-29 00:00 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1462066486image.jpeg | 2016-04-30 00:00 | 966K | |
![[IMG]](/icons/image2.gif) | 1462070087MFPF Logo ..> | 2016-04-30 00:00 | 398K | |
![[IMG]](/icons/image2.gif) | 1462307352Mathoo's_R..> | 2016-05-03 00:00 | 672K | |
![[IMG]](/icons/image2.gif) | 1462728819Be_Trendy_..> | 2016-05-08 00:00 | 411K | |
![[IMG]](/icons/image2.gif) | 1463139895TShirt.png | 2016-05-13 00:00 | 22K | |
![[IMG]](/icons/image2.gif) | 1463490450SDF_Freeze..> | 2016-05-17 00:00 | 24K | |
![[IMG]](/icons/image2.gif) | 1463497589Denim & Da..> | 2016-05-17 00:00 | 105K | |
![[IMG]](/icons/image2.gif) | 1463502314Scout&Zoes..> | 2016-05-17 00:00 | 7.6K | |
![[IMG]](/icons/image2.gif) | 1463513619tb logo.jpg | 2016-05-17 00:00 | 183K | |
![[IMG]](/icons/image2.gif) | 1463517658honey labe..> | 2016-05-17 00:00 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1463519968ODDA Logo.jpg | 2016-05-17 00:00 | 36K | |
![[IMG]](/icons/image2.gif) | 1463671223image.jpeg | 2016-05-19 00:00 | 225K | |
![[IMG]](/icons/image2.gif) | 1463674885CoolSuppli..> | 2016-05-19 00:00 | 69K | |
![[IMG]](/icons/image2.gif) | 1464025295vintage do..> | 2016-05-23 00:00 | 8.9K | |
![[IMG]](/icons/image2.gif) | 1464114511logo-2.jpg | 2016-05-24 00:00 | 716K | |
![[IMG]](/icons/image2.gif) | 1465262836image.jpeg | 2016-06-06 00:00 | 292K | |
![[IMG]](/icons/image2.gif) | 1465307537rodimel-ho..> | 2016-06-07 00:00 | 90K | |
![[IMG]](/icons/image2.gif) | 1465416826logo.jpg | 2016-06-08 00:00 | 28K | |
![[IMG]](/icons/image2.gif) | 1465823860A new circ..> | 2016-06-13 00:00 | 37K | |
![[IMG]](/icons/image2.gif) | 1465852236Poppin Cob..> | 2016-06-13 00:00 | 57K | |
![[IMG]](/icons/image2.gif) | 1465859512PW logo 3-..> | 2016-06-13 00:00 | 297K | |
![[IMG]](/icons/image2.gif) | 1465925350Logo with ..> | 2016-06-14 00:00 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1465998078baa-circle..> | 2016-06-15 00:00 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1466438432Yogi Gener..> | 2016-06-20 00:00 | 126K | |
![[IMG]](/icons/image2.gif) | 1466454705duck.PNG | 2016-06-20 00:00 | 583K | |
![[IMG]](/icons/image2.gif) | 1467135939apples1-30..> | 2016-06-28 00:00 | 46K | |
![[IMG]](/icons/image2.gif) | 1467140050hoosier po..> | 2016-06-28 00:00 | 55K | |
![[IMG]](/icons/image2.gif) | 1467140558Farm365_09..> | 2016-06-28 00:00 | 333K | |
![[IMG]](/icons/image2.gif) | 1467310255Logo Vecto..> | 2016-06-30 00:00 | 27K | |
![[IMG]](/icons/image2.gif) | 1467836420Logo Vecto..> | 2016-07-06 00:00 | 27K | |
![[IMG]](/icons/image2.gif) | 1468334218barn.jpg | 2016-07-12 00:00 | 111K | |
![[IMG]](/icons/image2.gif) | 1468603811wilson far..> | 2016-07-15 00:00 | 39K | |
![[IMG]](/icons/image2.gif) | 1470860023native bre..> | 2016-08-10 00:00 | 35K | |
![[IMG]](/icons/image2.gif) | 1471043732blue moon.jpg | 2016-08-12 00:00 | 161K | |
![[IMG]](/icons/image2.gif) | 1472479722logo.jpg | 2016-08-29 00:00 | 838K | |
![[IMG]](/icons/image2.gif) | 1473709661logo small..> | 2016-09-12 00:00 | 41K | |
![[IMG]](/icons/image2.gif) | 1474911814Miracle_pr..> | 2016-09-26 00:00 | 675K | |
![[IMG]](/icons/image2.gif) | 1475172362Logo.png | 2016-09-29 00:00 | 30K | |
![[IMG]](/icons/image2.gif) | 1475611561Black Logo..> | 2016-10-04 00:00 | 9.5K | |
![[IMG]](/icons/image2.gif) | 1476416315Chrysanthe..> | 2016-10-13 00:00 | 859K | |
![[IMG]](/icons/image2.gif) | 1477595671TOFI-Sloga..> | 2016-10-27 00:00 | 485K | |
![[IMG]](/icons/image2.gif) | 1478031480SMGlogo.png | 2016-11-01 00:00 | 24K | |
![[IMG]](/icons/image2.gif) | 1478309791Pickling S..> | 2016-11-04 00:00 | 42K | |
![[IMG]](/icons/image2.gif) | 1478640446profile.jpg | 2016-11-08 00:00 | 644K | |
![[IMG]](/icons/image2.gif) | 1479000421image.jpg | 2016-11-12 00:00 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1479095291logo.jpg | 2016-11-13 00:00 | 64K | |
![[IMG]](/icons/image2.gif) | 1479499282Just-Grano..> | 2016-11-18 00:00 | 20K | |
![[IMG]](/icons/image2.gif) | 1481469949IMG_201611..> | 2016-12-11 00:00 | 176K | |
![[IMG]](/icons/image2.gif) | 1481471747WPF LOGO.jpg | 2016-12-11 00:00 | 118K | |
![[IMG]](/icons/image2.gif) | 1483479359Yelp Bazaa..> | 2017-01-03 00:00 | 99K | |
![[IMG]](/icons/image2.gif) | 1483706482Heritage (..> | 2017-01-06 00:00 | 11K | |
![[IMG]](/icons/image2.gif) | 1484358507Tillman Fa..> | 2017-01-13 00:00 | 39K | |
![[IMG]](/icons/image2.gif) | 1484579605Bagel Fair..> | 2017-01-16 00:00 | 33K | |
![[IMG]](/icons/image2.gif) | 1484781748preview.jpg | 2017-01-18 00:00 | 62K | |
![[IMG]](/icons/image2.gif) | 1484847415greatferme..> | 2017-01-19 00:00 | 28K | |
![[IMG]](/icons/image2.gif) | 1485188607bbh_logo.PNG | 2017-01-23 00:00 | 19K | |
![[IMG]](/icons/image2.gif) | 1485194390bbh_logo.PNG | 2017-01-23 00:00 | 19K | |
![[IMG]](/icons/image2.gif) | 1485207949IMG_2235.JPG | 2017-01-23 00:00 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1486133672syrup prof..> | 2017-02-03 00:00 | 300K | |
![[IMG]](/icons/image2.gif) | 1486314524SS_Whiteta..> | 2017-02-05 00:00 | 51K | |
![[IMG]](/icons/image2.gif) | 1486578771Shrimp Log..> | 2017-02-08 00:00 | 85K | |
![[IMG]](/icons/image2.gif) | 1486956750IMG_0294.JPG | 2017-02-12 00:00 | 201K | |
![[IMG]](/icons/image2.gif) | 1487091892healthy ho..> | 2017-02-14 00:00 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1487688135image.png | 2017-02-21 00:00 | 130K | |
![[IMG]](/icons/image2.gif) | 1488297449logo_squar..> | 2017-02-28 00:00 | 17K | |
![[IMG]](/icons/image2.gif) | 1488302202Old Major ..> | 2017-02-28 00:00 | 273K | |
![[IMG]](/icons/image2.gif) | 1488555291BLUEBELL_F..> | 2017-03-03 00:00 | 135K | |
![[IMG]](/icons/image2.gif) | 1489013850A Simple N..> | 2017-03-08 00:00 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1489096798Solful Gar..> | 2017-03-09 00:00 | 199K | |
![[IMG]](/icons/image2.gif) | 1489981050Lockerbean..> | 2017-03-19 00:00 | 25K | |
![[IMG]](/icons/image2.gif) | 1490200415andyandbev..> | 2017-03-22 00:00 | 567K | |
![[IMG]](/icons/image2.gif) | 1490872012IMG_2595.jpg | 2017-03-30 00:00 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1492467918Bohman-Bee..> | 2017-04-17 00:00 | 79K | |
![[IMG]](/icons/image2.gif) | 1492468001cb logo co..> | 2017-04-17 00:00 | 249K | |
![[IMG]](/icons/image2.gif) | 1492601774Hill View ..> | 2017-04-19 00:00 | 30K | |
![[IMG]](/icons/image2.gif) | 1492807702FF_Final_L..> | 2017-04-21 00:00 | 12K | |
![[IMG]](/icons/image2.gif) | 1492874807smittens s..> | 2017-04-22 00:00 | 833K | |
![[IMG]](/icons/image2.gif) | 1493444396Evansville..> | 2017-04-28 00:00 | 313K | |
![[IMG]](/icons/image2.gif) | 1493652845IMG_0152.JPG | 2017-05-01 00:00 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1493911458deb.PNG | 2017-05-04 00:00 | 674K | |
![[IMG]](/icons/image2.gif) | 1493999942eggs.jpg | 2017-05-05 00:00 | 259K | |
![[IMG]](/icons/image2.gif) | 1494007916IMG_398405..> | 2017-05-05 00:00 | 44K | |
![[IMG]](/icons/image2.gif) | 1494130979Logo Pastr..> | 2017-05-06 00:00 | 96K | |
![[IMG]](/icons/image2.gif) | 1494134303Logo Pastr..> | 2017-05-06 00:00 | 96K | |
![[IMG]](/icons/image2.gif) | 1494945515Family Fal..> | 2017-05-16 00:00 | 647K | |
![[IMG]](/icons/image2.gif) | 1495119214Cattles.JPG | 2017-05-18 00:00 | 162K | |
![[IMG]](/icons/image2.gif) | 1495497229image.jpeg | 2017-05-22 00:00 | 67K | |
![[IMG]](/icons/image2.gif) | 1495556372tomato.jpg | 2017-05-23 00:00 | 138K | |
![[IMG]](/icons/image2.gif) | 1495659985logo.jpg | 2017-05-24 00:00 | 723K | |
![[IMG]](/icons/image2.gif) | 1496436075Untitled.jpg | 2017-06-02 00:00 | 40K | |
![[IMG]](/icons/image2.gif) | 1496946209Fruit Blen..> | 2017-06-08 00:00 | 104K | |
![[IMG]](/icons/image2.gif) | 1496946412fbs logo-n..> | 2017-06-08 00:00 | 8.3K | |
![[IMG]](/icons/image2.gif) | 1497883152TNC.jpg | 2017-06-19 00:00 | 91K | |
![[IMG]](/icons/image2.gif) | 1497927147Joy Lane s..> | 2017-06-19 00:00 | 53K | |
![[IMG]](/icons/image2.gif) | 1498098435IMG_0445[1..> | 2017-06-21 00:00 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1498266721IMAG0505.jpg | 2017-06-23 00:00 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1498575257FA_potnote..> | 2017-06-27 00:00 | 887K | |
![[IMG]](/icons/image2.gif) | 1498875334Dandy Logo..> | 2017-06-30 00:00 | 53K | |
![[IMG]](/icons/image2.gif) | 1499272619invoice hd..> | 2017-07-05 00:00 | 31K | |
![[IMG]](/icons/image2.gif) | 1499302125logo.jpg | 2017-07-05 00:00 | 10K | |
![[IMG]](/icons/image2.gif) | 1499436820FB_IMG_149..> | 2017-07-07 00:00 | 69K | |
![[IMG]](/icons/image2.gif) | 1499526098LemonTreeC..> | 2017-07-08 00:00 | 39K | |
![[IMG]](/icons/image2.gif) | 1499540662image.jpeg | 2017-07-08 00:00 | 264K | |
![[IMG]](/icons/image2.gif) | 1499655397HEARTLAND ..> | 2017-07-09 00:00 | 132K | |
![[IMG]](/icons/image2.gif) | 1499797740IMG_0040.PNG | 2017-07-11 00:00 | 174K | |
![[IMG]](/icons/image2.gif) | 1500941424square AF.jpg | 2017-07-24 00:00 | 5.2K | |
![[IMG]](/icons/image2.gif) | 1500993759UFLOGO.png | 2017-07-25 00:00 | 98K | |
![[IMG]](/icons/image2.gif) | 1502107041BarGold201..> | 2017-08-07 00:00 | 58K | |
![[IMG]](/icons/image2.gif) | 1503013684rainfield_..> | 2017-08-17 00:00 | 26K | |
![[IMG]](/icons/image2.gif) | 1503457118Brandywine..> | 2017-08-22 00:00 | 145K | |
![[IMG]](/icons/image2.gif) | 1503618524IMG_1811.JPG | 2017-08-24 00:00 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1503930107Logo042916..> | 2017-08-28 00:00 | 775K | |
![[IMG]](/icons/image2.gif) | 1503936082logo clip ..> | 2017-08-28 00:00 | 89K | |
![[IMG]](/icons/image2.gif) | 1504810644ATT_145322..> | 2017-09-07 00:00 | 24K | |
![[IMG]](/icons/image2.gif) | 1505142983IMG_1510.JPG | 2017-09-11 00:00 | 594K | |
![[IMG]](/icons/image2.gif) | 1505166396Chipsnobac..> | 2017-09-11 00:00 | 725K | |
![[IMG]](/icons/image2.gif) | 1505324173Tuttles-Lo..> | 2017-09-13 00:00 | 16K | |
![[IMG]](/icons/image2.gif) | 1505392741IMG_6776.JPG | 2017-09-14 00:00 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1505498274happy cows..> | 2017-09-15 00:00 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1505697756FullSizeRe..> | 2017-09-17 00:00 | 68K | |
![[IMG]](/icons/image2.gif) | 1505763436IMG_0632.JPG | 2017-09-18 00:00 | 78K | |
![[IMG]](/icons/image2.gif) | 1506082536bnutty-log..> | 2017-09-22 00:00 | 11K | |
![[IMG]](/icons/image2.gif) | 1506516451IMG_2924.JPG | 2017-09-27 00:00 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1506780385Indianapol..> | 2017-09-30 00:00 | 31K | |
![[IMG]](/icons/image2.gif) | 1506862600IMG_201710..> | 2017-10-01 00:00 | 944K | |
![[IMG]](/icons/image2.gif) | 1506877930logo final..> | 2017-10-01 00:00 | 345K | |
![[IMG]](/icons/image2.gif) | 1506879673ss20.png | 2017-10-01 00:00 | 27K | |
![[IMG]](/icons/image2.gif) | 1507141105Abbott's C..> | 2017-10-04 00:00 | 157K | |
![[IMG]](/icons/image2.gif) | 1507211403JakesCount..> | 2017-10-05 00:00 | 43K | |
![[IMG]](/icons/image2.gif) | 1507304237image.png | 2017-10-06 00:00 | 705K | |
![[IMG]](/icons/image2.gif) | 1507514365dotfarm_sh..> | 2017-10-08 00:00 | 169K | |
![[IMG]](/icons/image2.gif) | 1508127440Kingdom Fa..> | 2017-10-15 00:00 | 31K | |
![[IMG]](/icons/image2.gif) | 1508207291Mom and Da..> | 2017-10-16 00:00 | 110K | |
![[IMG]](/icons/image2.gif) | 1508345018The Farmer..> | 2017-10-18 00:00 | 168K | |
![[IMG]](/icons/image2.gif) | 1508872235B57E5F72-F..> | 2017-10-24 00:00 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1509815001logo with ..> | 2017-11-04 00:00 | 8.0K | |
![[IMG]](/icons/image2.gif) | 1509985619Roka Farm ..> | 2017-11-06 00:00 | 300K | |
![[IMG]](/icons/image2.gif) | 1510093669KoyahLogo-..> | 2017-11-07 00:00 | 12K | |
![[IMG]](/icons/image2.gif) | 1510541602logo small..> | 2017-11-12 00:00 | 607K | |
![[IMG]](/icons/image2.gif) | 1511575656honey bear..> | 2017-11-24 00:00 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1511787942lettuce.jpg | 2017-11-27 00:00 | 282K | |
![[IMG]](/icons/image2.gif) | 1511891605Son of a B..> | 2017-11-28 00:00 | 40K | |
![[IMG]](/icons/image2.gif) | 1511981948stutzman.jpg | 2017-11-29 00:00 | 8.4K | |
![[IMG]](/icons/image2.gif) | 1511984446whole whea..> | 2017-11-29 00:00 | 64K | |
![[IMG]](/icons/image2.gif) | 1511985932maple syru..> | 2017-11-29 00:00 | 77K | |
![[IMG]](/icons/image2.gif) | 1512052053Bowser Gre..> | 2017-11-30 00:00 | 235K | |
![[IMG]](/icons/image2.gif) | 1513025077FFF Logo F..> | 2017-12-11 00:00 | 426K | |
![[IMG]](/icons/image2.gif) | 1513524782Local Moti..> | 2017-12-17 00:00 | 48K | |
![[IMG]](/icons/image2.gif) | 1513529360CauldronLo..> | 2017-12-17 00:00 | 150K | |
![[IMG]](/icons/image2.gif) | 1513696772FullSizeRe..> | 2017-12-19 00:00 | 54K | |
![[IMG]](/icons/image2.gif) | 1513904641use this l..> | 2017-12-21 00:00 | 579K | |
![[IMG]](/icons/image2.gif) | 1513964106logo trans..> | 2017-12-22 00:00 | 235K | |
![[IMG]](/icons/image2.gif) | 1514841258MPP.png | 2018-01-01 00:00 | 13K | |
![[IMG]](/icons/image2.gif) | 1515516136MorganArti..> | 2018-01-09 00:00 | 134K | |
![[IMG]](/icons/image2.gif) | 1515535904Local-Food..> | 2018-01-09 00:00 | 317K | |
![[IMG]](/icons/image2.gif) | 1515556311FARM STAND..> | 2018-01-09 00:00 | 135K | |
![[IMG]](/icons/image2.gif) | 1515696308mad-racoon..> | 2018-01-11 00:00 | 89K | |
![[IMG]](/icons/image2.gif) | 1516160898PR Type On..> | 2018-01-16 00:00 | 308K | |
![[IMG]](/icons/image2.gif) | 1516227540IMG_0463.PNG | 2018-01-17 00:00 | 87K | |
![[IMG]](/icons/image2.gif) | 1516377972Rook Image..> | 2018-01-19 00:00 | 43K | |
![[IMG]](/icons/image2.gif) | 1516583037cover pic ..> | 2018-01-21 00:00 | 85K | |
![[IMG]](/icons/image2.gif) | 1516655307pots-and-p..> | 2018-01-22 00:00 | 155K | |
![[IMG]](/icons/image2.gif) | 1516711476biz card (..> | 2018-01-23 00:00 | 69K | |
![[IMG]](/icons/image2.gif) | 1516726674Revival-St..> | 2018-01-23 00:00 | 29K | |
![[IMG]](/icons/image2.gif) | 1516899157GK_Logo-Ma..> | 2018-01-25 00:00 | 265K | |
![[IMG]](/icons/image2.gif) | 1516990531tweety's l..> | 2018-01-26 00:00 | 58K | |
![[IMG]](/icons/image2.gif) | 1517353438MW logo.png | 2018-01-30 00:00 | 78K | |
![[IMG]](/icons/image2.gif) | 1517404595FPS Pink B..> | 2018-01-31 00:00 | 46K | |
![[IMG]](/icons/image2.gif) | 1517405981Header(opt..> | 2018-01-31 00:00 | 197K | |
![[IMG]](/icons/image2.gif) | 1517520313logo-trans..> | 2018-02-01 00:00 | 162K | |
![[IMG]](/icons/image2.gif) | 1517523994ve_logo®_..> | 2018-02-01 00:00 | 363K | |
![[IMG]](/icons/image2.gif) | 1518306784received_1..> | 2018-02-10 00:00 | 14K | |
![[IMG]](/icons/image2.gif) | 1518399306groomsvill..> | 2018-02-11 00:00 | 210K | |
![[IMG]](/icons/image2.gif) | 1518409299logo2.png | 2018-02-11 00:00 | 90K | |
![[IMG]](/icons/image2.gif) | 1518812921cornerston..> | 2018-02-16 00:00 | 203K | |
![[IMG]](/icons/image2.gif) | 1518816636conjure co..> | 2018-02-16 00:00 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1518890126banner log..> | 2018-02-17 00:00 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1519091693fd6eda_035..> | 2018-02-19 00:00 | 52K | |
![[IMG]](/icons/image2.gif) | 1519249254logo pic.jpg | 2018-02-21 00:00 | 721K | |
![[IMG]](/icons/image2.gif) | 1519251186Pembroke_B..> | 2018-02-21 00:00 | 143K | |
![[IMG]](/icons/image2.gif) | 1519282461Picture1.png | 2018-02-21 00:00 | 129K | |
![[IMG]](/icons/image2.gif) | 1519406132logo.jpg | 2018-02-23 00:00 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1519765252LOGO.jpg | 2018-02-27 00:00 | 453K | |
![[IMG]](/icons/image2.gif) | 1519827149PP.jpg | 2018-02-28 00:00 | 894K | |
![[IMG]](/icons/image2.gif) | 1519908647best boy l..> | 2018-03-01 00:00 | 7.0K | |
![[IMG]](/icons/image2.gif) | 1520013258Circadian ..> | 2018-03-02 00:00 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1520294949WB MW.jpeg | 2018-03-05 00:00 | 162K | |
![[IMG]](/icons/image2.gif) | 1520470486roastlogo1..> | 2018-03-07 00:00 | 200K | |
![[IMG]](/icons/image2.gif) | 1520475141SW Logo.jpg | 2018-03-07 00:00 | 522K | |
![[IMG]](/icons/image2.gif) | 1520524954MH Logo Tr..> | 2018-03-08 00:00 | 308K | |
![[IMG]](/icons/image2.gif) | 1520606126Homestead.jpg | 2018-03-09 00:00 | 52K | |
![[IMG]](/icons/image2.gif) | 1520652295Logo_final..> | 2018-03-09 00:00 | 30K | |
![[IMG]](/icons/image2.gif) | 1520825567B084DAED-A..> | 2018-03-11 00:00 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1520885389C5A8E70B-D..> | 2018-03-12 00:00 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1520952386Mylke Logo..> | 2018-03-13 00:00 | 145K | |
![[IMG]](/icons/image2.gif) | 1520983592DE811AFB-5..> | 2018-03-13 00:00 | 19K | |
![[IMG]](/icons/image2.gif) | 1521478890FLOgo.png | 2018-03-19 00:00 | 6.1K | |
![[IMG]](/icons/image2.gif) | 1521553194wj.jpg | 2018-03-20 00:00 | 12K | |
![[IMG]](/icons/image2.gif) | 1521559461TPF-Logo-w..> | 2018-03-20 00:00 | 47K | |
![[IMG]](/icons/image2.gif) | 1522003559IMG_0894.JPG | 2018-03-25 00:00 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1522246776CE0A19A6-7..> | 2018-03-28 00:00 | 184K | |
![[IMG]](/icons/image2.gif) | 1522272571towers.jpg | 2018-03-28 00:00 | 13K | |
![[IMG]](/icons/image2.gif) | 1522356353FTF Logo.jpg | 2018-03-29 00:00 | 87K | |
![[IMG]](/icons/image2.gif) | 1522605634Moonlit mo..> | 2018-04-01 00:00 | 121K | |
![[IMG]](/icons/image2.gif) | 1523299500Uncle Als-..> | 2018-04-09 00:00 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1523727959gabe_belle..> | 2018-04-14 00:00 | 151K | |
![[IMG]](/icons/image2.gif) | 1523824341bubbleLOGO..> | 2018-04-15 00:00 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1523835792Presto Kom..> | 2018-04-15 00:00 | 95K | |
![[IMG]](/icons/image2.gif) | 1523998160Logo jpeg.jpg | 2018-04-17 00:00 | 68K | |
![[IMG]](/icons/image2.gif) | 1524010859cropped lo..> | 2018-04-17 00:00 | 628K | |
![[IMG]](/icons/image2.gif) | 1524061731Color Logo..> | 2018-04-18 00:00 | 115K | |
![[IMG]](/icons/image2.gif) | 1525357962logo1.jpg | 2018-05-03 00:00 | 507K | |
![[IMG]](/icons/image2.gif) | 1525395566SFF Logo C..> | 2018-05-03 00:00 | 177K | |
![[IMG]](/icons/image2.gif) | 1525442179Ray of Lig..> | 2018-05-04 00:00 | 56K | |
![[IMG]](/icons/image2.gif) | 1525455147PW_Logo_li..> | 2018-05-04 00:00 | 14K | |
![[IMG]](/icons/image2.gif) | 1525459220unnamed_e4..> | 2018-05-04 00:00 | 25K | |
![[IMG]](/icons/image2.gif) | 1525527096Hoffman-Or..> | 2018-05-05 00:00 | 357K | |
![[IMG]](/icons/image2.gif) | 1526252807Logo Take ..> | 2018-05-13 00:00 | 173K | |
![[IMG]](/icons/image2.gif) | 1526573535Me.jpg | 2018-05-17 00:00 | 11K | |
![[IMG]](/icons/image2.gif) | 1526585619Pogues Run..> | 2018-05-17 00:00 | 397K | |
![[IMG]](/icons/image2.gif) | 1526948436circle_pig..> | 2018-05-21 00:00 | 280K | |
![[IMG]](/icons/image2.gif) | 1527602789spencer_lo..> | 2018-05-29 00:00 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1527720995new_logo_o..> | 2018-05-30 00:00 | 423K | |
![[IMG]](/icons/image2.gif) | 1527868280logo_growi..> | 2018-06-01 00:00 | 854K | |
![[IMG]](/icons/image2.gif) | 1528216611FB Profile..> | 2018-06-05 00:00 | 8.7K | |
![[IMG]](/icons/image2.gif) | 1528752061IMG_4828[1..> | 2018-06-11 00:00 | 247K | |
![[IMG]](/icons/image2.gif) | 1528949866FBFCC008-8..> | 2018-06-13 00:00 | 58K | |
![[IMG]](/icons/image2.gif) | 1529781869garden fre..> | 2018-06-23 00:00 | 70K | |
![[IMG]](/icons/image2.gif) | 1530065938IMG_0405.jpg | 2018-06-26 00:00 | 801K | |
![[IMG]](/icons/image2.gif) | 1530639135grace and ..> | 2018-07-03 00:00 | 14K | |
![[IMG]](/icons/image2.gif) | 1531096771Screenshot..> | 2018-07-08 00:00 | 105K | |
![[IMG]](/icons/image2.gif) | 1531336488beef2.JPG | 2018-07-11 00:00 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1531833135Hopped Up ..> | 2018-07-17 00:00 | 176K | |
![[IMG]](/icons/image2.gif) | 1531952677PP logo.jpg | 2018-07-18 00:00 | 58K | |
![[IMG]](/icons/image2.gif) | 1532052645stofferfar..> | 2018-07-19 00:00 | 85K | |
![[IMG]](/icons/image2.gif) | 1532140125garden pic..> | 2018-07-20 00:00 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1532207340Screen Sho..> | 2018-07-21 00:00 | 610K | |
![[IMG]](/icons/image2.gif) | 1532286276MITZNERMEA..> | 2018-07-22 00:00 | 76K | |
![[IMG]](/icons/image2.gif) | 1532384656Susie Clip..> | 2018-07-23 00:00 | 17K | |
![[IMG]](/icons/image2.gif) | 1532432245logo.png | 2018-07-24 00:00 | 77K | |
![[IMG]](/icons/image2.gif) | 1532531263FullSizeRe..> | 2018-07-25 00:00 | 144K | |
![[IMG]](/icons/image2.gif) | 1532575182FB3F85DC-4..> | 2018-07-25 00:00 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1532715671windroseur..> | 2018-07-27 00:00 | 789K | |
![[IMG]](/icons/image2.gif) | 1532980544newCup and..> | 2018-07-30 00:00 | 90K | |
![[IMG]](/icons/image2.gif) | 1532998886Front Logo..> | 2018-07-30 00:00 | 40K | |
![[IMG]](/icons/image2.gif) | 1533094359beach baby..> | 2018-07-31 00:00 | 392K | |
![[IMG]](/icons/image2.gif) | 1533499591fungi-fana..> | 2018-08-05 00:00 | 100K | |
![[IMG]](/icons/image2.gif) | 1534169081hops.JPG | 2018-08-13 00:00 | 693K | |
![[IMG]](/icons/image2.gif) | 1534209280Sun Harves..> | 2018-08-13 00:00 | 42K | |
![[IMG]](/icons/image2.gif) | 1534354079original-8..> | 2018-08-15 00:00 | 128K | |
![[IMG]](/icons/image2.gif) | 1534439223IMG_4038 -..> | 2018-08-16 00:00 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1534451107Cecil-Farm..> | 2018-08-16 00:00 | 118K | |
![[IMG]](/icons/image2.gif) | 1534536371A65DF965-7..> | 2018-08-17 00:00 | 308K | |
![[IMG]](/icons/image2.gif) | 1534799022brubrother..> | 2018-08-20 00:00 | 82K | |
![[IMG]](/icons/image2.gif) | 1534964665WaterMark_..> | 2018-08-22 00:00 | 323K | |
![[IMG]](/icons/image2.gif) | 1534976913DB341102-3..> | 2018-08-22 00:00 | 148K | |
![[IMG]](/icons/image2.gif) | 1535120207yHwgdGKYbs..> | 2018-08-24 00:00 | 136K | |
![[IMG]](/icons/image2.gif) | 1535138923ColonelDe ..> | 2018-08-24 00:00 | 275K | |
![[IMG]](/icons/image2.gif) | 1535145783Creekside_..> | 2018-08-24 00:00 | 48K | |
![[IMG]](/icons/image2.gif) | 1535252195Katie's Cl..> | 2018-08-25 00:00 | 16K | |
![[IMG]](/icons/image2.gif) | 1535323088DSC_0029.jpg | 2018-08-26 00:00 | 411K | |
![[IMG]](/icons/image2.gif) | 1535330387ODH_Stamp_..> | 2018-08-26 00:00 | 102K | |
![[IMG]](/icons/image2.gif) | 1535335117wendy logo..> | 2018-08-26 00:00 | 10K | |
![[IMG]](/icons/image2.gif) | 1535508223Wisewood w..> | 2018-08-28 00:00 | 125K | |
![[IMG]](/icons/image2.gif) | 1535576267GRASS FED ..> | 2018-08-29 00:00 | 21K | |
![[IMG]](/icons/image2.gif) | 1535653767IMG_1328.JPG | 2018-08-30 00:00 | 81K | |
![[IMG]](/icons/image2.gif) | 1536160915fb (2).JPG | 2018-09-05 00:00 | 466K | |
![[IMG]](/icons/image2.gif) | 1536184734C6A65325-A..> | 2018-09-05 00:00 | 185K | |
![[IMG]](/icons/image2.gif) | 1536243667Cincy Beef..> | 2018-09-06 00:00 | 246K | |
![[IMG]](/icons/image2.gif) | 1536255655new profil..> | 2018-09-06 00:00 | 99K | |
![[IMG]](/icons/image2.gif) | 1536343711New_KamsLo..> | 2018-09-07 00:00 | 895K | |
![[IMG]](/icons/image2.gif) | 1536613788color_logo..> | 2018-09-10 00:00 | 324K | |
![[IMG]](/icons/image2.gif) | 1536718097Horizontal..> | 2018-09-11 00:00 | 42K | |
![[IMG]](/icons/image2.gif) | 1537029403A9B21D59-9..> | 2018-09-15 00:00 | 249K | |
![[IMG]](/icons/image2.gif) | 1537044790Apricot Su..> | 2018-09-15 00:00 | 39K | |
![[IMG]](/icons/image2.gif) | 1537308859IMG_2116.PNG | 2018-09-18 00:00 | 204K | |
![[IMG]](/icons/image2.gif) | 1537459608logo.jpg | 2018-09-20 00:00 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1537464430Waterfield..> | 2018-09-20 00:00 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1537922077pigs 3 amy..> | 2018-09-25 00:00 | 82K | |
![[IMG]](/icons/image2.gif) | 1538507165Hartke's H..> | 2018-10-02 00:00 | 399K | |
![[IMG]](/icons/image2.gif) | 1538507838social med..> | 2018-10-02 00:00 | 154K | |
![[IMG]](/icons/image2.gif) | 1538575363Ella Bella..> | 2018-10-03 00:00 | 18K | |
![[IMG]](/icons/image2.gif) | 1538588670GBG_Logo_G..> | 2018-10-03 00:00 | 15K | |
![[IMG]](/icons/image2.gif) | 1538663756DarkLogo_N..> | 2018-10-04 00:00 | 278K | |
![[IMG]](/icons/image2.gif) | 1538780695Finished_B..> | 2018-10-05 00:00 | 187K | |
![[IMG]](/icons/image2.gif) | 1539031209GarlicBoss..> | 2018-10-08 00:00 | 761K | |
![[IMG]](/icons/image2.gif) | 1539105562Transparen..> | 2018-10-09 00:00 | 83K | |
![[IMG]](/icons/image2.gif) | 1539108815Aria Logo ..> | 2018-10-09 00:00 | 25K | |
![[IMG]](/icons/image2.gif) | 1539132850midget-gre..> | 2018-10-09 00:00 | 15K | |
![[IMG]](/icons/image2.gif) | 1539609068logo-edit-..> | 2018-10-15 00:00 | 90K | |
![[IMG]](/icons/image2.gif) | 1539635505lsf_logo.png | 2018-10-15 00:00 | 766K | |
![[IMG]](/icons/image2.gif) | 1539722576logo.jpg | 2018-10-16 00:00 | 482K | |
![[IMG]](/icons/image2.gif) | 1539963925YDD-tag-co..> | 2018-10-19 00:00 | 99K | |
![[IMG]](/icons/image2.gif) | 1540209888artisan-lo..> | 2018-10-22 00:00 | 250K | |
![[IMG]](/icons/image2.gif) | 1540481227IMG_9601.jpeg | 2018-10-25 00:00 | 118K | |
![[IMG]](/icons/image2.gif) | 1540525461Edible.Spr..> | 2018-10-25 00:00 | 121K | |
![[IMG]](/icons/image2.gif) | 1540731523SSB LOGO.png | 2018-10-28 00:00 | 303K | |
![[IMG]](/icons/image2.gif) | 1541085438HOFF Produ..> | 2018-11-01 00:00 | 127K | |
![[IMG]](/icons/image2.gif) | 1541097308moo-ville ..> | 2018-11-01 00:00 | 19K | |
![[IMG]](/icons/image2.gif) | 1541106477Bukál..> | 2018-11-01 00:00 | 208K | |
![[IMG]](/icons/image2.gif) | 1541191827farm2.jpg | 2018-11-02 00:00 | 431K | |
![[IMG]](/icons/image2.gif) | 1541639300logo.png | 2018-11-07 00:00 | 9.1K | |
![[IMG]](/icons/image2.gif) | 1541696367Compressed..> | 2018-11-08 00:00 | 30K | |
![[IMG]](/icons/image2.gif) | 1541792703APELogoFin..> | 2018-11-09 00:00 | 255K | |
![[IMG]](/icons/image2.gif) | 1541794687PWG Logo w..> | 2018-11-09 00:00 | 259K | |
![[IMG]](/icons/image2.gif) | 1542806826rmjazlgo.png | 2018-11-21 00:00 | 652K | |
![[IMG]](/icons/image2.gif) | 1542811967beckerfarm..> | 2018-11-21 00:00 | 39K | |
![[IMG]](/icons/image2.gif) | 1543095750received_7..> | 2018-11-24 00:00 | 77K | |
![[IMG]](/icons/image2.gif) | 1543394055Thornburg ..> | 2018-11-28 00:00 | 98K | |
![[IMG]](/icons/image2.gif) | 1543436108YUH Logo w..> | 2018-11-28 00:00 | 243K | |
![[IMG]](/icons/image2.gif) | 1543867896wild food ..> | 2018-12-03 00:00 | 188K | |
![[IMG]](/icons/image2.gif) | 1544153321Angel Fami..> | 2018-12-06 00:00 | 931K | |
![[IMG]](/icons/image2.gif) | 1544462021jumbo-brow..> | 2018-12-10 00:00 | 193K | |
![[IMG]](/icons/image2.gif) | 1544464644ptflogo - ..> | 2018-12-10 00:00 | 65K | |
![[IMG]](/icons/image2.gif) | 1544474608NewKingDav..> | 2018-12-10 00:00 | 68K | |
![[IMG]](/icons/image2.gif) | 1545076533large-new-..> | 2018-12-17 00:00 | 112K | |
![[IMG]](/icons/image2.gif) | 1545155341A494ADA2-8..> | 2018-12-18 00:00 | 155K | |
![[IMG]](/icons/image2.gif) | 1545256530shack.jpg | 2018-12-19 00:00 | 70K | |
![[IMG]](/icons/image2.gif) | 1545836007YellowCupL..> | 2018-12-26 00:00 | 331K | |
![[IMG]](/icons/image2.gif) | 1545918580LogoMakr-5..> | 2018-12-27 00:00 | 31K | |
![[IMG]](/icons/image2.gif) | 1545939212EEF205C1-A..> | 2018-12-27 00:00 | 147K | |
![[IMG]](/icons/image2.gif) | 1545941464logo_circl..> | 2018-12-27 00:00 | 73K | |
![[IMG]](/icons/image2.gif) | 1546457103DPP_0002.JPG | 2019-01-02 00:00 | 878K | |
![[IMG]](/icons/image2.gif) | 1546968786Good.jpg | 2019-01-08 00:00 | 18K | |
![[IMG]](/icons/image2.gif) | 1546988855Vertical G..> | 2019-01-08 00:00 | 19K | |
![[IMG]](/icons/image2.gif) | 1547049355farm sunri..> | 2019-01-09 00:00 | 60K | |
![[IMG]](/icons/image2.gif) | 1547140043preview~2...> | 2019-01-10 00:00 | 16K | |
![[IMG]](/icons/image2.gif) | 1547156086IMG_1378.JPG | 2019-01-10 00:00 | 603K | |
![[IMG]](/icons/image2.gif) | 1547397766IMG_2514.JPG | 2019-01-13 00:00 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1547481670Logo 2019.png | 2019-01-14 00:00 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1547727759IMG_1650.JPG | 2019-01-17 00:00 | 178K | |
![[IMG]](/icons/image2.gif) | 1547752397Fresh mojo..> | 2019-01-17 00:00 | 111K | |
![[IMG]](/icons/image2.gif) | 1547993898phileo log..> | 2019-01-20 00:00 | 552K | |
![[IMG]](/icons/image2.gif) | 1548031507shrocknewl..> | 2019-01-20 00:00 | 96K | |
![[IMG]](/icons/image2.gif) | 1548265984farm logo.png | 2019-01-23 00:00 | 63K | |
![[IMG]](/icons/image2.gif) | 1548343710E34068A0-B..> | 2019-01-24 00:00 | 62K | |
![[IMG]](/icons/image2.gif) | 1548361396ONTHEGOPIC..> | 2019-01-24 00:00 | 107K | |
![[IMG]](/icons/image2.gif) | 1548686228logo.png | 2019-01-28 00:00 | 60K | |
![[IMG]](/icons/image2.gif) | 1548708797freshpop'd..> | 2019-01-28 00:00 | 150K | |
![[IMG]](/icons/image2.gif) | 1548827720Carroll Cr..> | 2019-01-29 00:00 | 593K | |
![[IMG]](/icons/image2.gif) | 1548897886SHF Crest.png | 2019-01-30 00:00 | 323K | |
![[IMG]](/icons/image2.gif) | 1549045456DSC_3047.jpg | 2019-02-01 00:00 | 447K | |
![[IMG]](/icons/image2.gif) | 1549417403kumquat pi..> | 2019-02-05 00:00 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1549489159SIB LOGO N..> | 2019-02-06 00:00 | 202K | |
![[IMG]](/icons/image2.gif) | 1550020790BF FB imag..> | 2019-02-12 00:00 | 54K | |
![[IMG]](/icons/image2.gif) | 1550151703copper-1.jpg | 2019-02-14 00:00 | 47K | |
![[IMG]](/icons/image2.gif) | 1550158474B5A83793-F..> | 2019-02-14 00:00 | 59K | |
![[IMG]](/icons/image2.gif) | 1550439926Circle C A..> | 2019-02-17 00:00 | 147K | |
![[IMG]](/icons/image2.gif) | 1550716015Full Color..> | 2019-02-20 00:00 | 217K | |
![[IMG]](/icons/image2.gif) | 1551127084Logo.jpg | 2019-02-25 00:00 | 294K | |
![[IMG]](/icons/image2.gif) | 1551208776shagbark_l..> | 2019-02-26 00:00 | 121K | |
![[IMG]](/icons/image2.gif) | 1551230882Logo.jpg | 2019-02-26 00:00 | 49K | |
![[IMG]](/icons/image2.gif) | 1551388144IMG_1323-2..> | 2019-02-28 00:00 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1551452591Pigs!.jpg | 2019-03-01 00:00 | 192K | |
![[IMG]](/icons/image2.gif) | 1551672354File Sep 0..> | 2019-03-03 00:00 | 295K | |
![[IMG]](/icons/image2.gif) | 1551713295CIZ-COVER-..> | 2019-03-04 00:00 | 62K | |
![[IMG]](/icons/image2.gif) | 1551727711Tell City ..> | 2019-03-04 00:00 | 23K | |
![[IMG]](/icons/image2.gif) | 1551892744John and I..> | 2019-03-06 00:00 | 18K | |
![[IMG]](/icons/image2.gif) | 1551991265pet wants ..> | 2019-03-07 00:00 | 236K | |
![[IMG]](/icons/image2.gif) | 1552010747logo_color..> | 2019-03-07 00:00 | 25K | |
![[IMG]](/icons/image2.gif) | 1552088882logo.png | 2019-03-08 00:00 | 38K | |
![[IMG]](/icons/image2.gif) | 1552482611_MG_7300.JPG | 2019-03-13 00:00 | 16K | |
![[IMG]](/icons/image2.gif) | 1552520663LoftyhenEg..> | 2019-03-13 00:00 | 456K | |
![[IMG]](/icons/image2.gif) | 1552565481logo.jpg | 2019-03-14 00:00 | 115K | |
![[IMG]](/icons/image2.gif) | 1552584104indiana.JPG | 2019-03-14 00:00 | 179K | |
![[IMG]](/icons/image2.gif) | 1553115686logo2.jpg | 2019-03-20 00:00 | 209K | |
![[IMG]](/icons/image2.gif) | 1553792081IMG_6409.jpg | 2019-03-28 00:00 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1553798312download.jpg | 2019-03-28 00:00 | 9.2K | |
![[IMG]](/icons/image2.gif) | 1553952434Resized_20..> | 2019-03-30 00:00 | 442K | |
![[IMG]](/icons/image2.gif) | 1553963825download.png | 2019-03-30 00:00 | 121K | |
![[IMG]](/icons/image2.gif) | 1554124025favicon-ap..> | 2019-04-01 00:00 | 518K | |
![[IMG]](/icons/image2.gif) | 1554134986Mallory's ..> | 2019-04-01 00:00 | 227K | |
![[IMG]](/icons/image2.gif) | 1554139930Bibb heads..> | 2019-04-01 00:00 | 71K | |
![[IMG]](/icons/image2.gif) | 1554228832small labe..> | 2019-04-02 00:00 | 18K | |
![[IMG]](/icons/image2.gif) | 1554740157flora_001.png | 2019-04-08 00:00 | 53K | |
![[IMG]](/icons/image2.gif) | 1555195174FBCE7725[1..> | 2019-04-13 00:00 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1555437112diamond k ..> | 2019-04-16 00:00 | 9.7K | |
![[IMG]](/icons/image2.gif) | 1555872602image.jpg | 2019-04-21 00:00 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1555963754ICR-Instag..> | 2019-04-22 00:00 | 41K | |
![[IMG]](/icons/image2.gif) | 1556375458Earths Pri..> | 2019-04-27 00:00 | 370K | |
![[IMG]](/icons/image2.gif) | 1556461050Hometown M..> | 2019-04-28 00:00 | 491K | |
![[IMG]](/icons/image2.gif) | 1556564654E5C25DCC-2..> | 2019-04-29 00:00 | 197K | |
![[IMG]](/icons/image2.gif) | 1556648348BLUES ACRE..> | 2019-04-30 00:00 | 61K | |
![[IMG]](/icons/image2.gif) | 1557000767BE 1 Parad..> | 2019-05-04 00:00 | 32K | |
![[IMG]](/icons/image2.gif) | 1557019455logo-trans..> | 2019-05-04 00:00 | 127K | |
![[IMG]](/icons/image2.gif) | 1557759707Logo.jpg | 2019-05-13 00:00 | 131K | |
![[IMG]](/icons/image2.gif) | 1557839149small fami..> | 2019-05-14 00:00 | 30K | |
![[IMG]](/icons/image2.gif) | 1558054507modified l..> | 2019-05-16 00:00 | 20K | |
![[IMG]](/icons/image2.gif) | 1558373675image00000..> | 2019-05-20 00:00 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1558630264OT ORANGE ..> | 2019-05-23 00:00 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1559000562Screen Sho..> | 2019-05-27 00:00 | 41K | |
![[IMG]](/icons/image2.gif) | 1559001429ECO copy s..> | 2019-05-27 00:00 | 314K | |
![[IMG]](/icons/image2.gif) | 1559087502B76C8537-1..> | 2019-05-28 00:00 | 303K | |
![[IMG]](/icons/image2.gif) | 1559676621huberlogo.png | 2019-06-04 00:00 | 33K | |
![[IMG]](/icons/image2.gif) | 1559910039IMG_4422.jpg | 2019-06-07 00:00 | 532K | |
![[IMG]](/icons/image2.gif) | 1560986162logo.jpg | 2019-06-19 00:00 | 586K | |
![[IMG]](/icons/image2.gif) | 1561003428coffee bea..> | 2019-06-19 00:00 | 114K | |
![[IMG]](/icons/image2.gif) | 1561294991bizcard21.png | 2019-06-23 00:00 | 558K | |
![[IMG]](/icons/image2.gif) | 1561560916newLogoPng..> | 2019-06-26 00:00 | 686K | |
![[IMG]](/icons/image2.gif) | 1562003413Julies log..> | 2019-07-01 00:00 | 118K | |
![[IMG]](/icons/image2.gif) | 1562099889Blue-Circl..> | 2019-07-02 00:00 | 85K | |
![[IMG]](/icons/image2.gif) | 1563216628LOGO.jpg | 2019-07-15 00:00 | 17K | |
![[IMG]](/icons/image2.gif) | 1563374707Logo_teal.jpg | 2019-07-17 00:00 | 47K | |
![[IMG]](/icons/image2.gif) | 1563454698Logo2.jpg | 2019-07-18 00:00 | 233K | |
![[IMG]](/icons/image2.gif) | 1563551081FitWoo Log..> | 2019-07-19 00:00 | 180K | |
![[IMG]](/icons/image2.gif) | 1564694328AC85C008-B..> | 2019-08-01 00:00 | 741K | |
![[IMG]](/icons/image2.gif) | 1565707518rangeme 3 ..> | 2019-08-13 00:00 | 133K | |
![[IMG]](/icons/image2.gif) | 1566394340AE0AF994-6..> | 2019-08-21 00:00 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1566499241oldmajor n..> | 2019-08-22 00:00 | 208K | |
![[IMG]](/icons/image2.gif) | 1566851854Screenshot..> | 2019-08-26 00:00 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1567008232FB_IMG_156..> | 2019-08-28 00:00 | 931K | |
![[IMG]](/icons/image2.gif) | 1567971737Dan and Ly..> | 2019-09-08 00:00 | 113K | |
![[IMG]](/icons/image2.gif) | 1568228142Loftus Org..> | 2019-09-11 00:00 | 592K | |
![[IMG]](/icons/image2.gif) | 1568738763GGF logo.png | 2019-09-17 00:00 | 74K | |
![[IMG]](/icons/image2.gif) | 1568993470kklc logo.jpg | 2019-09-20 00:00 | 16K | |
![[IMG]](/icons/image2.gif) | 1569341083fullsizeou..> | 2019-09-24 00:00 | 347K | |
![[IMG]](/icons/image2.gif) | 1569449062BeyondGrai..> | 2019-09-25 00:00 | 293K | |
![[IMG]](/icons/image2.gif) | 1569534772IMG_201908..> | 2019-09-26 00:00 | 33K | |
![[IMG]](/icons/image2.gif) | 1569852734FB_IMG_156..> | 2019-09-30 00:00 | 86K | |
![[IMG]](/icons/image2.gif) | 1569937457received_1..> | 2019-10-01 00:00 | 272K | |
![[IMG]](/icons/image2.gif) | 1570049532Logo_Color..> | 2019-10-02 00:00 | 81K | |
![[IMG]](/icons/image2.gif) | 1570205516AbundantPl..> | 2019-10-04 00:00 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1570743965Dudash-3 c..> | 2019-10-10 00:00 | 18K | |
![[IMG]](/icons/image2.gif) | 1570826034MRC Logo 2..> | 2019-10-11 00:00 | 141K | |
![[IMG]](/icons/image2.gif) | 1571189445Messages I..> | 2019-10-15 00:00 | 141K | |
![[IMG]](/icons/image2.gif) | 1571260584Original.png | 2019-10-16 00:00 | 412K | |
![[IMG]](/icons/image2.gif) | 1571589530logo_black..> | 2019-10-20 00:00 | 53K | |
![[IMG]](/icons/image2.gif) | 1571756596hives 002 ..> | 2019-10-22 00:00 | 154K | |
![[IMG]](/icons/image2.gif) | 1571937348index.jpg | 2019-10-24 00:00 | 13K | |
![[IMG]](/icons/image2.gif) | 1572276440f3farmslog..> | 2019-10-28 00:00 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1572919732IMG_201911..> | 2019-11-04 00:00 | 241K | |
![[IMG]](/icons/image2.gif) | 1573077055Screen Sho..> | 2019-11-06 00:00 | 40K | |
![[IMG]](/icons/image2.gif) | 1573329047IMG_2956 s..> | 2019-11-09 00:00 | 689K | |
![[IMG]](/icons/image2.gif) | 1574192579kombuchabr..> | 2019-11-19 00:00 | 66K | |
![[IMG]](/icons/image2.gif) | 1574260365stolls.jpg | 2019-11-20 00:00 | 248K | |
![[IMG]](/icons/image2.gif) | 1574341309CoasterSto..> | 2019-11-21 00:00 | 10K | |
![[IMG]](/icons/image2.gif) | 1574693723logo2.jpg | 2019-11-25 00:00 | 172K | |
![[IMG]](/icons/image2.gif) | 1574698299Metta Gard..> | 2019-11-25 00:00 | 10K | |
![[IMG]](/icons/image2.gif) | 1575032883Rc Logo 20..> | 2019-11-29 00:00 | 51K | |
![[IMG]](/icons/image2.gif) | 1575159320AbundantPl..> | 2019-11-30 00:00 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1575821548IMG_201904..> | 2019-12-08 00:00 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1575917112Madeleine ..> | 2019-12-09 00:00 | 332K | |
![[IMG]](/icons/image2.gif) | 1576011689D1303B6C-D..> | 2019-12-10 00:00 | 255K | |
![[IMG]](/icons/image2.gif) | 1576612752logo.png | 2019-12-17 00:00 | 456K | |
![[IMG]](/icons/image2.gif) | 1576772479IMG_3059 2..> | 2019-12-19 00:00 | 475K | |
![[IMG]](/icons/image2.gif) | 1576805236Screenshot..> | 2019-12-19 00:00 | 487K | |
![[IMG]](/icons/image2.gif) | 1577080802Cahokia Lo..> | 2019-12-22 00:00 | 127K | |
![[IMG]](/icons/image2.gif) | 1577718139IMG_8623 2..> | 2019-12-30 00:00 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1577721233IMG_6618a.jpg | 2019-12-30 00:00 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1577803683Lotsa past..> | 2019-12-31 00:00 | 7.7K | |
![[IMG]](/icons/image2.gif) | 1578159200Profile Lo..> | 2020-01-04 00:00 | 73K | |
![[IMG]](/icons/image2.gif) | 1578675957Sign close..> | 2020-01-10 00:00 | 44K | |
![[IMG]](/icons/image2.gif) | 1579183967JPEG-HIGH...> | 2020-01-16 00:00 | 42K | |
![[IMG]](/icons/image2.gif) | 1579287286phelpses j..> | 2020-01-17 00:00 | 152K | |
![[IMG]](/icons/image2.gif) | 1579742580indayani b..> | 2020-01-22 00:00 | 362K | |
![[IMG]](/icons/image2.gif) | 1579791263Woodsbrook..> | 2020-01-23 00:00 | 67K | |
![[IMG]](/icons/image2.gif) | 1579917711EmeraldAss..> | 2020-01-24 00:00 | 219K | |
![[IMG]](/icons/image2.gif) | 1580224483AFB1A737-6..> | 2020-01-28 00:00 | 24K | |
![[IMG]](/icons/image2.gif) | 1580299716RR Logo 20..> | 2020-01-29 00:00 | 31K | |
![[IMG]](/icons/image2.gif) | 1580443236Harriet T'..> | 2020-01-30 00:00 | 191K | |
![[IMG]](/icons/image2.gif) | 1580588623Tilly's lo..> | 2020-02-01 00:00 | 143K | |
![[IMG]](/icons/image2.gif) | 1580686258Logo(1).JPG | 2020-02-02 00:00 | 38K | |
![[IMG]](/icons/image2.gif) | 1580838187ZELS_LOGO-..> | 2020-02-04 00:00 | 449K | |
![[IMG]](/icons/image2.gif) | 1581209534Turchettis..> | 2020-02-08 00:00 | 45K | |
![[IMG]](/icons/image2.gif) | 1581368968NCC-logo-4..> | 2020-02-10 00:00 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1581455590white logo..> | 2020-02-11 00:00 | 18K | |
![[IMG]](/icons/image2.gif) | 1581718413Country-Ga..> | 2020-02-14 00:00 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1581821416C58577C4-A..> | 2020-02-15 00:00 | 140K | |
![[IMG]](/icons/image2.gif) | 1581961874Schoentrup..> | 2020-02-17 00:00 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1581965638Logo.png | 2020-02-17 00:00 | 97K | |
![[IMG]](/icons/image2.gif) | 1582035133Picture19 ..> | 2020-02-18 00:00 | 30K | |
![[IMG]](/icons/image2.gif) | 1582061248SayItAintS..> | 2020-02-18 00:00 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1582598276FB_IMG_158..> | 2020-02-24 00:00 | 80K | |
![[IMG]](/icons/image2.gif) | 1583195655profile_im..> | 2020-03-02 00:00 | 40K | |
![[IMG]](/icons/image2.gif) | 1583511644iusa_400x4..> | 2020-03-06 00:00 | 22K | |
![[IMG]](/icons/image2.gif) | 1583949801new circle..> | 2020-03-11 11:03 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1584026533logo-Title..> | 2020-03-12 08:22 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1584391795RuggedMain..> | 2020-03-16 13:49 | 58K | |
![[IMG]](/icons/image2.gif) | 1584462388Logo 2.jpg | 2020-03-17 09:26 | 91K | |
![[IMG]](/icons/image2.gif) | 1584463190Potluck Pi..> | 2020-03-17 09:39 | 693K | |
![[IMG]](/icons/image2.gif) | 1584471548CircleWhit..> | 2020-03-17 11:59 | 161K | |
![[IMG]](/icons/image2.gif) | 1584479684Gomez Fina..> | 2020-03-17 14:14 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1584484456F3EAD04A-A..> | 2020-03-17 15:34 | 180K | |
![[IMG]](/icons/image2.gif) | 1584539220PROX-Icon-..> | 2020-03-18 06:47 | 246K | |
![[IMG]](/icons/image2.gif) | 1584541378DragonWhit..> | 2020-03-18 07:22 | 48K | |
![[IMG]](/icons/image2.gif) | 1584563397jacquies l..> | 2020-03-18 13:29 | 62K | |
![[IMG]](/icons/image2.gif) | 1584614926Logo.jpg | 2020-03-19 03:48 | 38K | |
![[IMG]](/icons/image2.gif) | 1584806786HealthyNat..> | 2020-03-21 09:06 | 755K | |
![[IMG]](/icons/image2.gif) | 1584811544CHESTER HI..> | 2020-03-21 10:25 | 405K | |
![[IMG]](/icons/image2.gif) | 1584930957MIKADO sea..> | 2020-03-22 19:35 | 866K | |
![[IMG]](/icons/image2.gif) | 1585008099IMG_1844.JPG | 2020-03-23 17:01 | 80K | |
![[IMG]](/icons/image2.gif) | 1585023645DBJ Logo w..> | 2020-03-23 21:20 | 33K | |
![[IMG]](/icons/image2.gif) | 1585055898kajers gre..> | 2020-03-24 06:18 | 141K | |
![[IMG]](/icons/image2.gif) | 1585149975Spearmint-..> | 2020-03-25 08:26 | 91K | |
![[IMG]](/icons/image2.gif) | 1585336484JPG Logo.jpg | 2020-03-27 12:14 | 791K | |
![[IMG]](/icons/image2.gif) | 1585405653preview.png | 2020-03-28 07:27 | 17K | |
![[IMG]](/icons/image2.gif) | 1585424118Alcomy_Log..> | 2020-03-28 12:35 | 97K | |
![[IMG]](/icons/image2.gif) | 1585504694NMH2.jpg | 2020-03-29 10:58 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1585505232canola bar..> | 2020-03-29 11:07 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1585530923Copy of FR..> | 2020-03-29 18:15 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1585671225Screen Sho..> | 2020-03-31 09:13 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1585687139Blue Candl..> | 2020-03-31 13:38 | 692K | |
![[IMG]](/icons/image2.gif) | 1585688835logo 1 (2)..> | 2020-03-31 14:07 | 130K | |
![[IMG]](/icons/image2.gif) | 1586040290Screenshot..> | 2020-04-04 15:44 | 207K | |
![[IMG]](/icons/image2.gif) | 1586102926preview-fu..> | 2020-04-05 09:08 | 20K | |
![[IMG]](/icons/image2.gif) | 1586132433ANNOUNCEME..> | 2020-04-05 17:20 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1586205752MyMommasKi..> | 2020-04-06 13:42 | 156K | |
![[IMG]](/icons/image2.gif) | 1586215153Guided-By-..> | 2020-04-06 16:19 | 122K | |
![[IMG]](/icons/image2.gif) | 1586287315GFG-MW.jpg | 2020-04-07 12:21 | 128K | |
![[IMG]](/icons/image2.gif) | 1586616906TGL Logo g..> | 2020-04-11 07:55 | 95K | |
![[IMG]](/icons/image2.gif) | 1586716577B706A420-4..> | 2020-04-12 11:36 | 364K | |
![[IMG]](/icons/image2.gif) | 1586794766logo.jpg | 2020-04-13 09:19 | 759K | |
![[IMG]](/icons/image2.gif) | 1586796039NEWLOGOGho..> | 2020-04-13 09:40 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1586895498clean-logo..> | 2020-04-14 13:18 | 105K | |
![[IMG]](/icons/image2.gif) | 1586900156Black logo..> | 2020-04-14 14:35 | 553K | |
![[IMG]](/icons/image2.gif) | 1587064654DFG White.jpg | 2020-04-16 12:17 | 42K | |
![[IMG]](/icons/image2.gif) | 1587156976logo.jpg | 2020-04-17 13:56 | 8.1K | |
![[IMG]](/icons/image2.gif) | 1587171602ZuzuLogoRG..> | 2020-04-17 18:00 | 549K | |
![[IMG]](/icons/image2.gif) | 1587300698Max at wed..> | 2020-04-19 05:51 | 101K | |
![[IMG]](/icons/image2.gif) | 1587409796ruhterbiso..> | 2020-04-20 12:09 | 424K | |
![[IMG]](/icons/image2.gif) | 1587518843logo alter..> | 2020-04-21 18:27 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1587609715Hilltopfbp..> | 2020-04-22 19:41 | 41K | |
![[IMG]](/icons/image2.gif) | 1587641079logo 3 pet..> | 2020-04-23 04:24 | 113K | |
![[IMG]](/icons/image2.gif) | 1588012810logo 10 (2..> | 2020-04-27 11:40 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1588019799large_thum..> | 2020-04-27 13:36 | 37K | |
![[IMG]](/icons/image2.gif) | 1588075100egg.jpg | 2020-04-28 04:58 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1588119099Rowdy Cow...> | 2020-04-28 17:11 | 273K | |
![[IMG]](/icons/image2.gif) | 1588119791logo.jpg | 2020-04-28 17:23 | 25K | |
![[IMG]](/icons/image2.gif) | 1588185767Logo.png | 2020-04-29 11:42 | 124K | |
![[IMG]](/icons/image2.gif) | 1588269585farm pic.jpg | 2020-04-30 10:59 | 48K | |
![[IMG]](/icons/image2.gif) | 1588339062cropped-Or..> | 2020-05-01 06:17 | 4.3K | |
![[IMG]](/icons/image2.gif) | 1588438255IMG_3424.jpg | 2020-05-02 09:50 | 247K | |
![[IMG]](/icons/image2.gif) | 1588611000Screen Sho..> | 2020-05-04 09:50 | 131K | |
![[IMG]](/icons/image2.gif) | 1588626075logo_white..> | 2020-05-04 14:01 | 297K | |
![[IMG]](/icons/image2.gif) | 1588681300Holcomb's ..> | 2020-05-05 05:21 | 115K | |
![[IMG]](/icons/image2.gif) | 1588688751Oregonia_S..> | 2020-05-05 07:25 | 538K | |
![[IMG]](/icons/image2.gif) | 1588865471FB_IMG_157..> | 2020-05-07 08:31 | 13K | |
![[IMG]](/icons/image2.gif) | 1588874300Silverthor..> | 2020-05-07 10:58 | 46K | |
![[IMG]](/icons/image2.gif) | 1588875887Silverthor..> | 2020-05-07 11:24 | 46K | |
![[IMG]](/icons/image2.gif) | 1588893830Market Wag..> | 2020-05-07 16:23 | 109K | |
![[IMG]](/icons/image2.gif) | 1588943051me.jpg | 2020-05-08 06:04 | 95K | |
![[IMG]](/icons/image2.gif) | 1588967531BOX LOGO_c..> | 2020-05-08 12:52 | 183K | |
![[IMG]](/icons/image2.gif) | 1589217337Boone Cree..> | 2020-05-11 10:15 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1589217927Logo.png | 2020-05-11 10:25 | 528K | |
![[IMG]](/icons/image2.gif) | 1589226580RRG_Logo_4..> | 2020-05-11 12:49 | 242K | |
![[IMG]](/icons/image2.gif) | 1589232550BigLogo.png | 2020-05-11 14:29 | 55K | |
![[IMG]](/icons/image2.gif) | 1589284631DSC_8584.jpg | 2020-05-12 04:57 | 164K | |
![[IMG]](/icons/image2.gif) | 1589292124bears.jpg | 2020-05-12 07:02 | 18K | |
![[IMG]](/icons/image2.gif) | 1589303817PupcakesLo..> | 2020-05-12 10:16 | 68K | |
![[IMG]](/icons/image2.gif) | 1589305190sjsocial_l..> | 2020-05-12 10:39 | 135K | |
![[IMG]](/icons/image2.gif) | 1589357498C2CFC447-5..> | 2020-05-13 01:11 | 86K | |
![[IMG]](/icons/image2.gif) | 1589393531OWOC_Logo_..> | 2020-05-13 11:12 | 145K | |
![[IMG]](/icons/image2.gif) | 1589396852Logo.png | 2020-05-13 12:07 | 55K | |
![[IMG]](/icons/image2.gif) | 1589491044FullColorL..> | 2020-05-14 14:17 | 776K | |
![[IMG]](/icons/image2.gif) | 1589555995Logo.jpg | 2020-05-15 08:19 | 371K | |
![[IMG]](/icons/image2.gif) | 1589566096IMG_0267.JPG | 2020-05-15 11:08 | 40K | |
![[IMG]](/icons/image2.gif) | 1589748260Bike_Black..> | 2020-05-17 13:44 | 578K | |
![[IMG]](/icons/image2.gif) | 1589814010FEA821D4-E..> | 2020-05-18 08:00 | 49K | |
![[IMG]](/icons/image2.gif) | 1589822020logo2.PNG | 2020-05-18 10:13 | 36K | |
![[IMG]](/icons/image2.gif) | 1589834455bf.png | 2020-05-18 13:40 | 549K | |
![[IMG]](/icons/image2.gif) | 1590065297apples pho..> | 2020-05-21 05:48 | 177K | |
![[IMG]](/icons/image2.gif) | 1590074689blands_log..> | 2020-05-21 08:24 | 82K | |
![[IMG]](/icons/image2.gif) | 1590079011Rader Logo..> | 2020-05-21 09:36 | 39K | |
![[IMG]](/icons/image2.gif) | 1590090464OAKart Rea..> | 2020-05-21 12:47 | 49K | |
![[IMG]](/icons/image2.gif) | 1590094738family Pic..> | 2020-05-21 13:58 | 49K | |
![[IMG]](/icons/image2.gif) | 1590172953JulianFINA..> | 2020-05-22 11:42 | 663K | |
![[IMG]](/icons/image2.gif) | 1590173670Teri Pic.jpg | 2020-05-22 11:54 | 472K | |
![[IMG]](/icons/image2.gif) | 1590237702sign.JPG | 2020-05-23 05:41 | 22K | |
![[IMG]](/icons/image2.gif) | 1590511691The Great ..> | 2020-05-26 09:48 | 675K | |
![[IMG]](/icons/image2.gif) | 1590513018thelivepro..> | 2020-05-26 10:10 | 16K | |
![[IMG]](/icons/image2.gif) | 1590516122IMG_202005..> | 2020-05-26 11:02 | 667K | |
![[IMG]](/icons/image2.gif) | 1590685262Birch+Bras..> | 2020-05-28 10:01 | 36K | |
![[IMG]](/icons/image2.gif) | 1590753991Foxxgarden..> | 2020-05-29 05:06 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1590754762IMG_5811.jpg | 2020-05-29 05:19 | 153K | |
![[IMG]](/icons/image2.gif) | 1590951834Circle Syr..> | 2020-05-31 12:03 | 115K | |
![[IMG]](/icons/image2.gif) | 1591019992Roy’s Co..> | 2020-06-01 06:59 | 58K | |
![[IMG]](/icons/image2.gif) | 1591032337LP-Logo-24..> | 2020-06-01 10:25 | 42K | |
![[IMG]](/icons/image2.gif) | 1591038230Rosies Log..> | 2020-06-01 12:03 | 25K | |
![[IMG]](/icons/image2.gif) | 1591112445logo201907..> | 2020-06-02 08:40 | 874K | |
![[IMG]](/icons/image2.gif) | 1591136601Graized Lo..> | 2020-06-02 15:23 | 60K | |
![[IMG]](/icons/image2.gif) | 1591144184LEKColorVe..> | 2020-06-02 17:29 | 58K | |
![[IMG]](/icons/image2.gif) | 1591197194magpiemisc..> | 2020-06-03 08:13 | 172K | |
![[IMG]](/icons/image2.gif) | 1591218055DSF_landin..> | 2020-06-03 14:00 | 225K | |
![[IMG]](/icons/image2.gif) | 1591298792LSCF Logo.jpg | 2020-06-04 12:26 | 203K | |
![[IMG]](/icons/image2.gif) | 1591370282RusticNewW..> | 2020-06-05 08:18 | 390K | |
![[IMG]](/icons/image2.gif) | 1591401175DC7C3C43-3..> | 2020-06-05 16:52 | 341K | |
![[IMG]](/icons/image2.gif) | 1591497283Agapē Apo..> | 2020-06-06 19:34 | 45K | |
![[IMG]](/icons/image2.gif) | 1591549711bluebird p..> | 2020-06-07 10:08 | 24K | |
![[IMG]](/icons/image2.gif) | 1591624466EH logo wi..> | 2020-06-08 06:54 | 116K | |
![[IMG]](/icons/image2.gif) | 1591642041logoheader..> | 2020-06-08 11:47 | 41K | |
![[IMG]](/icons/image2.gif) | 1591644821Facebook.jpg | 2020-06-08 12:33 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1591665642IMG_202005..> | 2020-06-08 18:20 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1591709446Mom&Michel..> | 2020-06-09 06:30 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1591718436Spera-logo..> | 2020-06-09 09:00 | 59K | |
![[IMG]](/icons/image2.gif) | 1591737692thumbnail ..> | 2020-06-09 14:21 | 9.4K | |
![[IMG]](/icons/image2.gif) | 1591801881large logo..> | 2020-06-10 08:11 | 374K | |
![[IMG]](/icons/image2.gif) | 1591836184SA and Bee..> | 2020-06-10 17:43 | 155K | |
![[IMG]](/icons/image2.gif) | 1591887191Thumb_Nail..> | 2020-06-11 07:53 | 528K | |
![[IMG]](/icons/image2.gif) | 1591969054RTHS Logo ..> | 2020-06-12 06:37 | 904K | |
![[IMG]](/icons/image2.gif) | 1592086746bee balm.jpg | 2020-06-13 15:19 | 15K | |
![[IMG]](/icons/image2.gif) | 1592087180truffles.jpg | 2020-06-13 15:26 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1592090918sugar shaq..> | 2020-06-13 16:28 | 99K | |
![[IMG]](/icons/image2.gif) | 1592093934logo.jpg | 2020-06-13 17:18 | 58K | |
![[IMG]](/icons/image2.gif) | 1592152769IMG_2990.jpg | 2020-06-14 09:39 | 78K | |
![[IMG]](/icons/image2.gif) | 1592182542DSC_0005.jpg | 2020-06-14 17:55 | 100K | |
![[IMG]](/icons/image2.gif) | 1592183477Beck Cattl..> | 2020-06-14 18:11 | 5.8K | |
![[IMG]](/icons/image2.gif) | 1592247347MikesBeanD..> | 2020-06-15 11:55 | 361K | |
![[IMG]](/icons/image2.gif) | 1592331075thumbnail_..> | 2020-06-16 11:11 | 58K | |
![[IMG]](/icons/image2.gif) | 1592397054ANE Logo 1..> | 2020-06-17 05:30 | 100K | |
![[IMG]](/icons/image2.gif) | 1592401453CellarDoor..> | 2020-06-17 06:44 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1592430575fghfglogo_..> | 2020-06-17 14:49 | 29K | |
![[IMG]](/icons/image2.gif) | 1592499746EA9A207B-4..> | 2020-06-18 10:02 | 16K | |
![[IMG]](/icons/image2.gif) | 1592503013HumbleHive..> | 2020-06-18 10:56 | 799K | |
![[IMG]](/icons/image2.gif) | 1592586517blue.jpg | 2020-06-19 10:08 | 150K | |
![[IMG]](/icons/image2.gif) | 1592588753square-pro..> | 2020-06-19 10:45 | 46K | |
![[IMG]](/icons/image2.gif) | 1592590363IMG_1096.JPG | 2020-06-19 11:12 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1592749257Group 7.png | 2020-06-21 07:20 | 110K | |
![[IMG]](/icons/image2.gif) | 1592784895jpg.jpg | 2020-06-21 17:14 | 99K | |
![[IMG]](/icons/image2.gif) | 1592852038New Logo- ..> | 2020-06-22 11:53 | 83K | |
![[IMG]](/icons/image2.gif) | 1592939777AA2A6D21-0..> | 2020-06-23 12:16 | 354K | |
![[IMG]](/icons/image2.gif) | 1593047812Freddie Le..> | 2020-06-24 18:16 | 104K | |
![[IMG]](/icons/image2.gif) | 1593056106Abundant P..> | 2020-06-24 20:35 | 103K | |
![[IMG]](/icons/image2.gif) | 1593095646Asset 11LO..> | 2020-06-25 07:34 | 136K | |
![[IMG]](/icons/image2.gif) | 1593112697Liv%27s+Lo..> | 2020-06-25 12:18 | 18K | |
![[IMG]](/icons/image2.gif) | 1593137705IMG_8021 (..> | 2020-06-25 19:15 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1593142892logo.jpg | 2020-06-25 20:41 | 6.2K | |
![[IMG]](/icons/image2.gif) | 1593182909LFC LARGE ..> | 2020-06-26 07:48 | 56K | |
![[IMG]](/icons/image2.gif) | 1593227871logosuperw..> | 2020-06-26 20:17 | 74K | |
![[IMG]](/icons/image2.gif) | 1593451159lunainthep..> | 2020-06-29 10:19 | 97K | |
![[IMG]](/icons/image2.gif) | 1593467175PL Logo Sm..> | 2020-06-29 14:46 | 100K | |
![[IMG]](/icons/image2.gif) | 1593536782gray fgd.png | 2020-06-30 10:06 | 9.0K | |
![[IMG]](/icons/image2.gif) | 1593547073HDFC_Logo_..> | 2020-06-30 12:57 | 634K | |
![[IMG]](/icons/image2.gif) | 1593550603harvest mo..> | 2020-06-30 13:56 | 54K | |
![[IMG]](/icons/image2.gif) | 1593575704abi logo.jpeg | 2020-06-30 20:55 | 66K | |
![[IMG]](/icons/image2.gif) | 1593607406final log..> | 2020-07-01 05:43 | 272K | |
![[IMG]](/icons/image2.gif) | 1593654535finallogo.jpg | 2020-07-01 18:48 | 417K | |
![[IMG]](/icons/image2.gif) | 1594067837flower 1.PNG | 2020-07-06 13:37 | 9.7K | |
![[IMG]](/icons/image2.gif) | 1594137146earthcircl..> | 2020-07-07 08:52 | 20K | |
![[IMG]](/icons/image2.gif) | 1594144482JAB-Compan..> | 2020-07-07 10:54 | 278K | |
![[IMG]](/icons/image2.gif) | 1594145033logoFREV1_..> | 2020-07-07 11:03 | 279K | |
![[IMG]](/icons/image2.gif) | 1594145847CreamCity_..> | 2020-07-07 11:17 | 445K | |
![[IMG]](/icons/image2.gif) | 1594153875NLC_logo-b..> | 2020-07-07 13:31 | 49K | |
![[IMG]](/icons/image2.gif) | 1594253731Logo 1.jpg | 2020-07-08 17:15 | 890K | |
![[IMG]](/icons/image2.gif) | 1594266624Newest Log..> | 2020-07-08 20:50 | 45K | |
![[IMG]](/icons/image2.gif) | 1594331571SiroccoLog..> | 2020-07-09 14:52 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1594342383BrockettFa..> | 2020-07-09 17:53 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1594362095Elevate Ba..> | 2020-07-09 23:21 | 169K | |
![[IMG]](/icons/image2.gif) | 1594392613logo.jpeg | 2020-07-10 07:50 | 72K | |
![[IMG]](/icons/image2.gif) | 1594435616Lucky Suds..> | 2020-07-10 19:46 | 663K | |
![[IMG]](/icons/image2.gif) | 1594515772BCC5233A-A..> | 2020-07-11 18:02 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1594651646Pat_Molter..> | 2020-07-13 07:47 | 5.5K | |
![[IMG]](/icons/image2.gif) | 1594677606NatureKeep..> | 2020-07-13 15:00 | 29K | |
![[IMG]](/icons/image2.gif) | 1594779703logo witho..> | 2020-07-14 19:21 | 167K | |
![[IMG]](/icons/image2.gif) | 1594787072GoG Logo 0..> | 2020-07-14 21:24 | 19K | |
![[IMG]](/icons/image2.gif) | 1594821203TysonFarms..> | 2020-07-15 06:53 | 98K | |
![[IMG]](/icons/image2.gif) | 1594863934Family Pic..> | 2020-07-15 18:45 | 79K | |
![[IMG]](/icons/image2.gif) | 1594917758sakura lo ..> | 2020-07-16 09:42 | 189K | |
![[IMG]](/icons/image2.gif) | 1595043899Pollen & P..> | 2020-07-17 20:44 | 365K | |
![[IMG]](/icons/image2.gif) | 1595203568County Lin..> | 2020-07-19 17:06 | 426K | |
![[IMG]](/icons/image2.gif) | 1595216544Thrive mus..> | 2020-07-19 20:42 | 250K | |
![[IMG]](/icons/image2.gif) | 1595271705MF-Seasoni..> | 2020-07-20 12:01 | 18K | |
![[IMG]](/icons/image2.gif) | 1595288706Core&Rind_..> | 2020-07-20 16:45 | 86K | |
![[IMG]](/icons/image2.gif) | 1595349972ROOSTERS S..> | 2020-07-21 09:46 | 15K | |
![[IMG]](/icons/image2.gif) | 1595378293A0D994A2-6..> | 2020-07-21 17:38 | 187K | |
![[IMG]](/icons/image2.gif) | 1595383966LBC logo-2..> | 2020-07-21 19:12 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1595425082logo_white..> | 2020-07-22 06:38 | 322K | |
![[IMG]](/icons/image2.gif) | 1595446302Sign photo..> | 2020-07-22 12:31 | 67K | |
![[IMG]](/icons/image2.gif) | 1595504679Logo with ..> | 2020-07-23 04:44 | 15K | |
![[IMG]](/icons/image2.gif) | 1595517199CryBaby We..> | 2020-07-23 08:13 | 45K | |
![[IMG]](/icons/image2.gif) | 1595623070Product Im..> | 2020-07-24 13:37 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1595625472me and chl..> | 2020-07-24 14:17 | 8.5K | |
![[IMG]](/icons/image2.gif) | 1595634462image.JPG | 2020-07-24 16:47 | 74K | |
![[IMG]](/icons/image2.gif) | 1595884340CountyLine..> | 2020-07-27 14:12 | 220K | |
![[IMG]](/icons/image2.gif) | 1595892319Preview.png | 2020-07-27 16:25 | 424K | |
![[IMG]](/icons/image2.gif) | 1595897502_ESP_Logo-..> | 2020-07-27 17:51 | 18K | |
![[IMG]](/icons/image2.gif) | 1595904705JH-LS-FF-A..> | 2020-07-27 19:51 | 29K | |
![[IMG]](/icons/image2.gif) | 1595978003TN Artisan..> | 2020-07-28 16:13 | 882K | |
![[IMG]](/icons/image2.gif) | 1596017278logo_size.jpg | 2020-07-29 03:07 | 19K | |
![[IMG]](/icons/image2.gif) | 1596066243D4386A4C-A..> | 2020-07-29 16:44 | 501K | |
![[IMG]](/icons/image2.gif) | 1596077627Two_Men_An..> | 2020-07-29 19:53 | 44K | |
![[IMG]](/icons/image2.gif) | 1596083347Summer's F..> | 2020-07-29 21:29 | 37K | |
![[IMG]](/icons/image2.gif) | 1596119160Milkhaus a..> | 2020-07-30 07:26 | 711K | |
![[IMG]](/icons/image2.gif) | 1596128595SugarCreek..> | 2020-07-30 10:03 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1596140559THCfinal.png | 2020-07-30 13:22 | 729K | |
![[IMG]](/icons/image2.gif) | 1596141174CIB - Logo..> | 2020-07-30 13:32 | 214K | |
![[IMG]](/icons/image2.gif) | 1596213736Logo.jpg | 2020-07-31 09:42 | 16K | |
![[IMG]](/icons/image2.gif) | 1596241009Ralph.jpg | 2020-07-31 17:16 | 101K | |
![[IMG]](/icons/image2.gif) | 1596252360MIC new lo..> | 2020-07-31 20:26 | 191K | |
![[IMG]](/icons/image2.gif) | 1596384171IMG_202008..> | 2020-08-02 09:02 | 872K | |
![[IMG]](/icons/image2.gif) | 1596456538test3.png | 2020-08-03 05:08 | 77K | |
![[IMG]](/icons/image2.gif) | 1596464921A568E4B9-2..> | 2020-08-03 07:28 | 472K | |
![[IMG]](/icons/image2.gif) | 1596466871received_1..> | 2020-08-03 08:01 | 5.9K | |
![[IMG]](/icons/image2.gif) | 1596473656Logo_300_S..> | 2020-08-03 09:54 | 67K | |
![[IMG]](/icons/image2.gif) | 1596560031Pneuma Fro..> | 2020-08-04 09:53 | 369K | |
![[IMG]](/icons/image2.gif) | 1596570312Logo 1.jpg | 2020-08-04 12:45 | 97K | |
![[IMG]](/icons/image2.gif) | 1596590387emmpeccabl..> | 2020-08-04 18:19 | 706K | |
![[IMG]](/icons/image2.gif) | 1596597091logo2.jpg | 2020-08-04 20:11 | 14K | |
![[IMG]](/icons/image2.gif) | 1596604927thesheep2.png | 2020-08-04 22:22 | 244K | |
![[IMG]](/icons/image2.gif) | 1596669918IMG_3646.JPG | 2020-08-05 16:25 | 170K | |
![[IMG]](/icons/image2.gif) | 1596676692IMG-0337.JPG | 2020-08-05 18:18 | 281K | |
![[IMG]](/icons/image2.gif) | 1596715445logo_name.jpg | 2020-08-06 05:04 | 55K | |
![[IMG]](/icons/image2.gif) | 1596723492Logo - Hum..> | 2020-08-06 07:18 | 35K | |
![[IMG]](/icons/image2.gif) | 1596821547stellas_he..> | 2020-08-07 10:32 | 85K | |
![[IMG]](/icons/image2.gif) | 1596823052mini box c..> | 2020-08-07 10:57 | 613K | |
![[IMG]](/icons/image2.gif) | 1596939315FBWhite (2..> | 2020-08-08 19:15 | 39K | |
![[IMG]](/icons/image2.gif) | 1597008401TO1_3213_l..> | 2020-08-09 14:26 | 392K | |
![[IMG]](/icons/image2.gif) | 1597009445EA6B9DA5-8..> | 2020-08-09 14:44 | 110K | |
![[IMG]](/icons/image2.gif) | 1597025782IMG-6818.jpg | 2020-08-09 19:16 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1597028599VintageFLo..> | 2020-08-09 20:03 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1597036340Logo.png | 2020-08-09 22:12 | 62K | |
![[IMG]](/icons/image2.gif) | 1597066511oat1001_pk..> | 2020-08-10 06:35 | 6.8K | |
![[IMG]](/icons/image2.gif) | 1597074243Clearview ..> | 2020-08-10 08:44 | 50K | |
![[IMG]](/icons/image2.gif) | 1597074988IMG_8897.JPG | 2020-08-10 08:56 | 290K | |
![[IMG]](/icons/image2.gif) | 1597078479IMG_202008..> | 2020-08-10 09:54 | 233K | |
![[IMG]](/icons/image2.gif) | 1597084509CF Brand.jpg | 2020-08-10 11:35 | 117K | |
![[IMG]](/icons/image2.gif) | 1597116521A8D7B22A-B..> | 2020-08-10 20:28 | 581K | |
![[IMG]](/icons/image2.gif) | 1597147369garden-but..> | 2020-08-11 05:02 | 453K | |
![[IMG]](/icons/image2.gif) | 1597248230WeinzierlF..> | 2020-08-12 09:03 | 490K | |
![[IMG]](/icons/image2.gif) | 1597260531Mark Engel..> | 2020-08-12 12:28 | 98K | |
![[IMG]](/icons/image2.gif) | 1597263767Updated Lo..> | 2020-08-12 13:22 | 597K | |
![[IMG]](/icons/image2.gif) | 1597337513Misty Morn..> | 2020-08-13 09:51 | 166K | |
![[IMG]](/icons/image2.gif) | 1597340710IMG_3415.JPG | 2020-08-13 10:45 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1597349130Logo.jpg | 2020-08-13 13:05 | 118K | |
![[IMG]](/icons/image2.gif) | 1597355206OSA COFFEE..> | 2020-08-13 14:46 | 259K | |
![[IMG]](/icons/image2.gif) | 1597360173Driftless-..> | 2020-08-13 16:09 | 468K | |
![[IMG]](/icons/image2.gif) | 1597526214BFF_Logo.jpg | 2020-08-15 14:16 | 111K | |
![[IMG]](/icons/image2.gif) | 1597531018FB_IMG_159..> | 2020-08-15 15:36 | 26K | |
![[IMG]](/icons/image2.gif) | 1597534702LRF-LOGO-F..> | 2020-08-15 16:38 | 309K | |
![[IMG]](/icons/image2.gif) | 1597608967blc_full.png | 2020-08-16 13:16 | 84K | |
![[IMG]](/icons/image2.gif) | 1597684495DDLogo.png | 2020-08-17 10:14 | 585K | |
![[IMG]](/icons/image2.gif) | 1597688690Droscha Lo..> | 2020-08-17 11:24 | 432K | |
![[IMG]](/icons/image2.gif) | 1597704296SimpleTime..> | 2020-08-17 15:44 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1597772326honey comb..> | 2020-08-18 10:38 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1597774582WM upload ..> | 2020-08-18 11:16 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1597776931E2938790-5..> | 2020-08-18 11:55 | 331K | |
![[IMG]](/icons/image2.gif) | 1597781240JAR_LOGO_2..> | 2020-08-18 13:07 | 40K | |
![[IMG]](/icons/image2.gif) | 1597781834IMG-4581.JPG | 2020-08-18 13:17 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1597794373IMG_5790.jpg | 2020-08-18 16:46 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1597855781RootsDown_..> | 2020-08-19 09:49 | 344K | |
![[IMG]](/icons/image2.gif) | 1597860134Nine Spoon..> | 2020-08-19 11:02 | 494K | |
![[IMG]](/icons/image2.gif) | 1597875861BogartsFro..> | 2020-08-19 15:24 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1597881534BBBCo. Log..> | 2020-08-19 16:58 | 627K | |
![[IMG]](/icons/image2.gif) | 1597931563BEEE411C-8..> | 2020-08-20 06:52 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1597943243Hot Sauce ..> | 2020-08-20 10:07 | 71K | |
![[IMG]](/icons/image2.gif) | 1597965503CompanionL..> | 2020-08-20 16:18 | 9.5K | |
![[IMG]](/icons/image2.gif) | 1597975241LewistonFa..> | 2020-08-20 19:00 | 57K | |
![[IMG]](/icons/image2.gif) | 1598021477Bruno's Ma..> | 2020-08-21 07:51 | 29K | |
![[IMG]](/icons/image2.gif) | 1598022561OH-SO CHEE..> | 2020-08-21 08:09 | 12K | |
![[IMG]](/icons/image2.gif) | 1598027453IMG_202008..> | 2020-08-21 09:30 | 169K | |
![[IMG]](/icons/image2.gif) | 1598068213ZNBC Logo.PNG | 2020-08-21 20:50 | 170K | |
![[IMG]](/icons/image2.gif) | 1598102259Gumbo In S..> | 2020-08-22 06:17 | 296K | |
![[IMG]](/icons/image2.gif) | 1598132120Removal 20..> | 2020-08-22 14:35 | 336K | |
![[IMG]](/icons/image2.gif) | 1598136306AEC9969D-4..> | 2020-08-22 15:45 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1598164899golden egg..> | 2020-08-22 23:41 | 42K | |
![[IMG]](/icons/image2.gif) | 1598207028Sign with ..> | 2020-08-23 11:23 | 15K | |
![[IMG]](/icons/image2.gif) | 1598228574Viewpoint%..> | 2020-08-23 17:22 | 107K | |
![[IMG]](/icons/image2.gif) | 1598285917Bee's Knee..> | 2020-08-24 09:18 | 170K | |
![[IMG]](/icons/image2.gif) | 1598289217A29B567D-4..> | 2020-08-24 10:13 | 60K | |
![[IMG]](/icons/image2.gif) | 1598293320EH9A0080 c..> | 2020-08-24 11:22 | 215K | |
![[IMG]](/icons/image2.gif) | 1598296926DG_Roaster..> | 2020-08-24 12:22 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1598301796HTF pic.jpg | 2020-08-24 13:43 | 100K | |
![[IMG]](/icons/image2.gif) | 1598327460ColorLogo(..> | 2020-08-24 20:51 | 207K | |
![[IMG]](/icons/image2.gif) | 1598366609New Sugar ..> | 2020-08-25 07:43 | 38K | |
![[IMG]](/icons/image2.gif) | 1598379021Gosia_seco..> | 2020-08-25 11:10 | 851K | |
![[IMG]](/icons/image2.gif) | 1598379607icon.jpg | 2020-08-25 11:20 | 554K | |
![[IMG]](/icons/image2.gif) | 1598454280Screenshot..> | 2020-08-26 08:04 | 63K | |
![[IMG]](/icons/image2.gif) | 1598457561Kei2Health..> | 2020-08-26 08:59 | 20K | |
![[IMG]](/icons/image2.gif) | 1598486443CEBAEAA6-6..> | 2020-08-26 17:00 | 73K | |
![[IMG]](/icons/image2.gif) | 1598541745AC293A44-9..> | 2020-08-27 08:22 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1598549606Mark and K..> | 2020-08-27 10:33 | 226K | |
![[IMG]](/icons/image2.gif) | 1598618634LOGO_Alder..> | 2020-08-28 05:43 | 228K | |
![[IMG]](/icons/image2.gif) | 1598918101Real Fruit..> | 2020-08-31 16:55 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1598971097yogurt.png | 2020-09-01 07:38 | 224K | |
![[IMG]](/icons/image2.gif) | 1598977941Tbrooke-15..> | 2020-09-01 09:32 | 779K | |
![[IMG]](/icons/image2.gif) | 1599103265IMG-5979.JPG | 2020-09-03 03:21 | 520K | |
![[IMG]](/icons/image2.gif) | 1599163415New Logo P..> | 2020-09-03 20:03 | 85K | |
![[IMG]](/icons/image2.gif) | 1599189609logo1.jpg | 2020-09-04 03:20 | 259K | |
![[IMG]](/icons/image2.gif) | 1599257831Mighty Cri..> | 2020-09-04 22:17 | 306K | |
![[IMG]](/icons/image2.gif) | 1599265737light.on.d..> | 2020-09-05 00:28 | 34K | |
![[IMG]](/icons/image2.gif) | 1599328363Eckert's l..> | 2020-09-05 17:52 | 32K | |
![[IMG]](/icons/image2.gif) | 1599328375Eckert's l..> | 2020-09-05 17:52 | 32K | |
![[IMG]](/icons/image2.gif) | 1599349972NEW Map lo..> | 2020-09-05 23:52 | 261K | |
![[IMG]](/icons/image2.gif) | 1599398084Getting to..> | 2020-09-06 13:14 | 2.8K | |
![[IMG]](/icons/image2.gif) | 1599398313Sam and Al..> | 2020-09-06 13:18 | 125K | |
![[IMG]](/icons/image2.gif) | 1599398529Culinary h..> | 2020-09-06 13:22 | 114K | |
![[IMG]](/icons/image2.gif) | 1599413842preview.png | 2020-09-06 17:37 | 26K | |
![[IMG]](/icons/image2.gif) | 1599592181BENJAMIN B..> | 2020-09-08 19:09 | 904K | |
![[IMG]](/icons/image2.gif) | 1599610704logo_size.jpg | 2020-09-09 00:18 | 70K | |
![[IMG]](/icons/image2.gif) | 1599668424C85411AD-4..> | 2020-09-09 16:20 | 158K | |
![[IMG]](/icons/image2.gif) | 1599690194Logo with ..> | 2020-09-09 22:23 | 49K | |
![[IMG]](/icons/image2.gif) | 1599753908michaels l..> | 2020-09-10 16:05 | 169K | |
![[IMG]](/icons/image2.gif) | 1599761632preview.png | 2020-09-10 18:13 | 26K | |
![[IMG]](/icons/image2.gif) | 1599762347Vigeo_NOS_..> | 2020-09-10 18:25 | 2.4K | |
![[IMG]](/icons/image2.gif) | 1599843579Blank 630 ..> | 2020-09-11 16:59 | 52K | |
![[IMG]](/icons/image2.gif) | 1599937226Artboard 2..> | 2020-09-12 19:00 | 121K | |
![[IMG]](/icons/image2.gif) | 1599943873sM.png | 2020-09-12 20:51 | 207K | |
![[IMG]](/icons/image2.gif) | 1600006043Asset 11Wi..> | 2020-09-13 14:07 | 560K | |
![[IMG]](/icons/image2.gif) | 1600093584PPC Logo.jpg | 2020-09-14 14:26 | 54K | |
![[IMG]](/icons/image2.gif) | 1600117982New MultiL..> | 2020-09-14 21:13 | 83K | |
![[IMG]](/icons/image2.gif) | 1600129129Logo.jpg | 2020-09-15 00:18 | 78K | |
![[IMG]](/icons/image2.gif) | 1600318214Fotolia_33..> | 2020-09-17 04:50 | 24K | |
![[IMG]](/icons/image2.gif) | 1600318253logo.png | 2020-09-17 04:50 | 49K | |
![[IMG]](/icons/image2.gif) | 1600355881IMG_7680.jpg | 2020-09-17 15:18 | 489K | |
![[IMG]](/icons/image2.gif) | 1600361886HAlogo_185..> | 2020-09-17 16:58 | 156K | |
![[IMG]](/icons/image2.gif) | 1600399292Abi Jeremy..> | 2020-09-18 03:21 | 446K | |
![[IMG]](/icons/image2.gif) | 1600702432HealthJunk..> | 2020-09-21 15:33 | 630K | |
![[IMG]](/icons/image2.gif) | 1600703447logo.png | 2020-09-21 15:50 | 7.1K | |
![[IMG]](/icons/image2.gif) | 1600706115TCR_logo_j..> | 2020-09-21 16:35 | 16K | |
![[IMG]](/icons/image2.gif) | 1600718843castingwhi..> | 2020-09-21 20:07 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1600813317Resized_20..> | 2020-09-22 22:21 | 641K | |
![[IMG]](/icons/image2.gif) | 1600873121C9CF69B4-E..> | 2020-09-23 14:58 | 542K | |
![[IMG]](/icons/image2.gif) | 1600914406RussellRoa..> | 2020-09-24 02:26 | 61K | |
![[IMG]](/icons/image2.gif) | 1600955959eat to liv..> | 2020-09-24 13:59 | 44K | |
![[IMG]](/icons/image2.gif) | 1600963070DFCD1846-5..> | 2020-09-24 15:57 | 98K | |
![[IMG]](/icons/image2.gif) | 1600971700RollingSto..> | 2020-09-24 18:21 | 168K | |
![[IMG]](/icons/image2.gif) | 1600971907H2Produce...> | 2020-09-24 18:25 | 168K | |
![[IMG]](/icons/image2.gif) | 1600987482Black logo..> | 2020-09-24 22:44 | 83K | |
![[IMG]](/icons/image2.gif) | 1601259289CCC Logo.png | 2020-09-28 02:14 | 53K | |
![[IMG]](/icons/image2.gif) | 1601303821Screenshot..> | 2020-09-28 14:37 | 5.5K | |
![[IMG]](/icons/image2.gif) | 1601312200SRF-logo-o..> | 2020-09-28 16:56 | 6.5K | |
![[IMG]](/icons/image2.gif) | 1601319867B8C8DF76-7..> | 2020-09-28 19:04 | 195K | |
![[IMG]](/icons/image2.gif) | 1601321028Bee Great ..> | 2020-09-28 19:23 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1601321102hives.jpg | 2020-09-28 19:25 | 118K | |
![[IMG]](/icons/image2.gif) | 1601325531Spark Spic..> | 2020-09-28 20:38 | 90K | |
![[IMG]](/icons/image2.gif) | 1601415587rainbow Ba..> | 2020-09-29 21:39 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1601492340market wag..> | 2020-09-30 18:59 | 433K | |
![[IMG]](/icons/image2.gif) | 1601522996IMG_202009..> | 2020-10-01 03:29 | 201K | |
![[IMG]](/icons/image2.gif) | 1601581356El Toro lo..> | 2020-10-01 19:42 | 89K | |
![[IMG]](/icons/image2.gif) | 1601647139FB_IMG_159..> | 2020-10-02 13:58 | 67K | |
![[IMG]](/icons/image2.gif) | 1601669536EAE6D498-E..> | 2020-10-02 20:12 | 216K | |
![[IMG]](/icons/image2.gif) | 1601759479chocolate_..> | 2020-10-03 21:11 | 847K | |
![[IMG]](/icons/image2.gif) | 1601840383Brighton W..> | 2020-10-04 19:39 | 119K | |
![[IMG]](/icons/image2.gif) | 1601860513LCR LOGO f..> | 2020-10-05 01:15 | 319K | |
![[IMG]](/icons/image2.gif) | 1601900508LCR LOGO L..> | 2020-10-05 12:21 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1601911937Facebook P..> | 2020-10-05 15:32 | 52K | |
![[IMG]](/icons/image2.gif) | 1601922535Layla Hors..> | 2020-10-05 18:28 | 144K | |
![[IMG]](/icons/image2.gif) | 1601923963TM Busines..> | 2020-10-05 18:52 | 88K | |
![[IMG]](/icons/image2.gif) | 1601946385BroadcapFa..> | 2020-10-06 01:06 | 51K | |
![[IMG]](/icons/image2.gif) | 1601954463CC Logo wi..> | 2020-10-06 03:21 | 6.0K | |
![[IMG]](/icons/image2.gif) | 1601997254BBEF3756-0..> | 2020-10-06 15:14 | 149K | |
![[IMG]](/icons/image2.gif) | 1602010481RCA logo w..> | 2020-10-06 18:54 | 389K | |
![[IMG]](/icons/image2.gif) | 1602100293logo.png | 2020-10-07 19:51 | 10K | |
![[IMG]](/icons/image2.gif) | 1602116474pretty pig..> | 2020-10-08 00:21 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1602116537prettypig3..> | 2020-10-08 00:22 | 862K | |
![[IMG]](/icons/image2.gif) | 1602117083michaels l..> | 2020-10-08 00:31 | 169K | |
![[IMG]](/icons/image2.gif) | 1602117122michaels l..> | 2020-10-08 00:32 | 22K | |
![[IMG]](/icons/image2.gif) | 1602117253michaels l..> | 2020-10-08 00:34 | 169K | |
![[IMG]](/icons/image2.gif) | 1602122270lightning-..> | 2020-10-08 01:57 | 19K | |
![[IMG]](/icons/image2.gif) | 1602126256farm logo.png | 2020-10-08 03:04 | 68K | |
![[IMG]](/icons/image2.gif) | 1602168467BEUR5499.PNG | 2020-10-08 14:47 | 768K | |
![[IMG]](/icons/image2.gif) | 1602177392Potluck Pi..> | 2020-10-08 17:16 | 693K | |
![[IMG]](/icons/image2.gif) | 1602180531Logo.jpg | 2020-10-08 18:08 | 31K | |
![[IMG]](/icons/image2.gif) | 1602182109lc_logo.png | 2020-10-08 18:35 | 24K | |
![[IMG]](/icons/image2.gif) | 1602254926Shell Dust..> | 2020-10-09 14:48 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1602273571HCR_ColorL..> | 2020-10-09 19:59 | 73K | |
![[IMG]](/icons/image2.gif) | 1602407917BBC1451F-B..> | 2020-10-11 09:18 | 134K | |
![[IMG]](/icons/image2.gif) | 1602430398sugary veg..> | 2020-10-11 15:33 | 31K | |
![[IMG]](/icons/image2.gif) | 1602463042TBLogo2.jpg | 2020-10-12 00:37 | 64K | |
![[IMG]](/icons/image2.gif) | 1602463082PieceofPum..> | 2020-10-12 00:38 | 142K | |
![[IMG]](/icons/image2.gif) | 1602464090A9A72C28-C..> | 2020-10-12 00:54 | 117K | |
![[IMG]](/icons/image2.gif) | 1602464152A9A72C28-C..> | 2020-10-12 00:55 | 117K | |
![[IMG]](/icons/image2.gif) | 1602510172SouthStree..> | 2020-10-12 13:42 | 27K | |
![[IMG]](/icons/image2.gif) | 1602517172BF4068C3-5..> | 2020-10-12 15:39 | 871K | |
![[IMG]](/icons/image2.gif) | 1602517480AE09B2C7-8..> | 2020-10-12 15:44 | 202K | |
![[IMG]](/icons/image2.gif) | 1602518484profile ph..> | 2020-10-12 16:01 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1602530314kmh jars.jpg | 2020-10-12 19:18 | 68K | |
![[IMG]](/icons/image2.gif) | 1602601232download (..> | 2020-10-13 15:00 | 4.3K | |
![[IMG]](/icons/image2.gif) | 1602610151kettlecorn..> | 2020-10-13 17:29 | 230K | |
![[IMG]](/icons/image2.gif) | 1602630680BCC label ..> | 2020-10-13 23:11 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1602644026received_9..> | 2020-10-14 02:53 | 52K | |
![[IMG]](/icons/image2.gif) | 1602684402LovefoodLo..> | 2020-10-14 14:06 | 24K | |
![[IMG]](/icons/image2.gif) | 1602686610EBFDF787-2..> | 2020-10-14 14:43 | 148K | |
![[IMG]](/icons/image2.gif) | 1602690194B2D_Logo.png | 2020-10-14 15:43 | 278K | |
![[IMG]](/icons/image2.gif) | 1602690215B2D_Logo.png | 2020-10-14 15:43 | 278K | |
![[IMG]](/icons/image2.gif) | 1602690244lovefood_l..> | 2020-10-14 15:44 | 17K | |
![[IMG]](/icons/image2.gif) | 1602690313LovefoodLo..> | 2020-10-14 15:45 | 24K | |
![[IMG]](/icons/image2.gif) | 1602698700DuerksonTu..> | 2020-10-14 18:05 | 277K | |
![[IMG]](/icons/image2.gif) | 1602707293HQ Sign ar..> | 2020-10-14 20:28 | 503K | |
![[IMG]](/icons/image2.gif) | 1602711104profile.jpg | 2020-10-14 21:31 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1602773182Greener Si..> | 2020-10-15 14:46 | 203K | |
![[IMG]](/icons/image2.gif) | 1602773554emily mate..> | 2020-10-15 14:52 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1602785422LCR LOGO L..> | 2020-10-15 18:10 | 606K | |
![[IMG]](/icons/image2.gif) | 1602794262pic of me.jpg | 2020-10-15 20:37 | 283K | |
![[IMG]](/icons/image2.gif) | 1602861160tester.jpg | 2020-10-16 15:12 | 157K | |
![[IMG]](/icons/image2.gif) | 1603059311EA8A214A-D..> | 2020-10-18 22:15 | 195K | |
![[IMG]](/icons/image2.gif) | 1603125228logo2020a.JPG | 2020-10-19 16:33 | 67K | |
![[IMG]](/icons/image2.gif) | 1603128503FD51F526-1..> | 2020-10-19 17:28 | 68K | |
![[IMG]](/icons/image2.gif) | 1603137186beas baker..> | 2020-10-19 19:53 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1603137219beas baker..> | 2020-10-19 19:53 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1603138869SMF LOGO.jpg | 2020-10-19 20:21 | 92K | |
![[IMG]](/icons/image2.gif) | 1603159043Far Breton..> | 2020-10-20 01:57 | 740K | |
![[IMG]](/icons/image2.gif) | 1603215896Black on W..> | 2020-10-20 17:44 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1603219730OHPM Squar..> | 2020-10-20 18:48 | 342K | |
![[IMG]](/icons/image2.gif) | 1603239657TAF_Logo_G..> | 2020-10-21 00:20 | 85K | |
![[IMG]](/icons/image2.gif) | 1603298460Ideal-Food..> | 2020-10-21 16:41 | 15K | |
![[IMG]](/icons/image2.gif) | 1603299095received_3..> | 2020-10-21 16:51 | 44K | |
![[IMG]](/icons/image2.gif) | 1603313698Round Logo..> | 2020-10-21 20:54 | 5.5K | |
![[IMG]](/icons/image2.gif) | 1603395760downloadan..> | 2020-10-22 19:42 | 6.9K | |
![[IMG]](/icons/image2.gif) | 1603396481AppleTreeL..> | 2020-10-22 19:54 | 31K | |
![[IMG]](/icons/image2.gif) | 1603415213magna_logo..> | 2020-10-23 01:06 | 70K | |
![[IMG]](/icons/image2.gif) | 1603460199IMG_202010..> | 2020-10-23 13:36 | 87K | |
![[IMG]](/icons/image2.gif) | 1603479579Anna 2 MP.jpg | 2020-10-23 18:59 | 362K | |
![[IMG]](/icons/image2.gif) | 1603483423coffee log..> | 2020-10-23 20:03 | 72K | |
![[IMG]](/icons/image2.gif) | 1603492510Hey Honey ..> | 2020-10-23 22:35 | 794K | |
![[IMG]](/icons/image2.gif) | 1603544532Logo for s..> | 2020-10-24 13:02 | 15K | |
![[IMG]](/icons/image2.gif) | 1603720786AFF14BF8-3..> | 2020-10-26 13:59 | 86K | |
![[IMG]](/icons/image2.gif) | 1603729356D72E427C-5..> | 2020-10-26 16:22 | 915K | |
![[IMG]](/icons/image2.gif) | 1603746225b&Wlogo.jpg | 2020-10-26 21:03 | 38K | |
![[IMG]](/icons/image2.gif) | 1603797045Social Med..> | 2020-10-27 11:10 | 17K | |
![[IMG]](/icons/image2.gif) | 1603815681aunt bs.jpg | 2020-10-27 16:21 | 25K | |
![[IMG]](/icons/image2.gif) | 1603824938DMGRoundLo..> | 2020-10-27 18:55 | 43K | |
![[IMG]](/icons/image2.gif) | 1603829013six red ch..> | 2020-10-27 20:03 | 425K | |
![[IMG]](/icons/image2.gif) | 1603860286HP SIGN (L..> | 2020-10-28 04:44 | 296K | |
![[IMG]](/icons/image2.gif) | 1603896479IMG_3007.JPG | 2020-10-28 14:47 | 167K | |
![[IMG]](/icons/image2.gif) | 1603896546IMG_3007.JPG | 2020-10-28 14:49 | 167K | |
![[IMG]](/icons/image2.gif) | 1603896799IMG_3007.JPG | 2020-10-28 14:53 | 167K | |
![[IMG]](/icons/image2.gif) | 1603897295IMG_3007.JPG | 2020-10-28 15:01 | 167K | |
![[IMG]](/icons/image2.gif) | 1603900213Smokin Oak..> | 2020-10-28 15:50 | 303K | |
![[IMG]](/icons/image2.gif) | 1603906490EBFDF787-2..> | 2020-10-28 17:34 | 0 | |
![[IMG]](/icons/image2.gif) | 1603913161E3F3EE51-2..> | 2020-10-28 19:26 | 161K | |
![[IMG]](/icons/image2.gif) | 1603939245IMG_201912..> | 2020-10-29 02:40 | 70K | |
![[IMG]](/icons/image2.gif) | 1603995209Logo Pictu..> | 2020-10-29 18:13 | 5.0K | |
![[IMG]](/icons/image2.gif) | 1604001589LOGO_3.jpg | 2020-10-29 19:59 | 327K | |
![[IMG]](/icons/image2.gif) | 1604003993Mojo.jpg | 2020-10-29 20:39 | 162K | |
![[IMG]](/icons/image2.gif) | 1604004044LOGO.jpg | 2020-10-29 20:40 | 29K | |
![[IMG]](/icons/image2.gif) | 1604016719HeritageMe..> | 2020-10-30 00:11 | 49K | |
![[IMG]](/icons/image2.gif) | 1604065299A5tm.jpg | 2020-10-30 13:41 | 64K | |
![[IMG]](/icons/image2.gif) | 1604080928Wise Butte..> | 2020-10-30 18:02 | 665K | |
![[IMG]](/icons/image2.gif) | 1604091080UISC LOGO.jpg | 2020-10-30 20:51 | 193K | |
![[IMG]](/icons/image2.gif) | 1604100439nutcase-lo..> | 2020-10-30 23:27 | 29K | |
![[IMG]](/icons/image2.gif) | 1604155581BroadrunFa..> | 2020-10-31 14:46 | 70K | |
![[IMG]](/icons/image2.gif) | 1604157481Main Logo.jpg | 2020-10-31 15:18 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1604201283IMG_202010..> | 2020-11-01 03:28 | 54K | |
![[IMG]](/icons/image2.gif) | 1604201405small-logo..> | 2020-11-01 03:30 | 562K | |
![[IMG]](/icons/image2.gif) | 1604249400HB new log..> | 2020-11-01 16:50 | 26K | |
![[IMG]](/icons/image2.gif) | 1604261017black cake..> | 2020-11-01 20:03 | 109K | |
![[IMG]](/icons/image2.gif) | 1604266215LOGO.jpg | 2020-11-01 21:30 | 30K | |
![[IMG]](/icons/image2.gif) | 1604343864fourstarnl..> | 2020-11-02 19:04 | 90K | |
![[IMG]](/icons/image2.gif) | 1604346027CaS Taco S..> | 2020-11-02 19:40 | 666K | |
![[IMG]](/icons/image2.gif) | 1604349748yhcnew.jpg | 2020-11-02 20:42 | 148K | |
![[IMG]](/icons/image2.gif) | 1604351431yhcnew.jpg | 2020-11-02 21:10 | 148K | |
![[IMG]](/icons/image2.gif) | 1604357563william-ro..> | 2020-11-02 22:52 | 19K | |
![[IMG]](/icons/image2.gif) | 1604413711DA2F4664-8..> | 2020-11-03 14:28 | 35K | |
![[IMG]](/icons/image2.gif) | 1604423396IMG-202010..> | 2020-11-03 17:09 | 62K | |
![[IMG]](/icons/image2.gif) | 1604425357GoodDogFar..> | 2020-11-03 17:42 | 26K | |
![[IMG]](/icons/image2.gif) | 1604499118A3297870-2..> | 2020-11-04 14:11 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1604515089final-murt..> | 2020-11-04 18:38 | 162K | |
![[IMG]](/icons/image2.gif) | 1604520808generic st..> | 2020-11-04 20:13 | 57K | |
![[IMG]](/icons/image2.gif) | 1604598553FATTYCAKES..> | 2020-11-05 17:49 | 613K | |
![[IMG]](/icons/image2.gif) | 1604598571FATTYCAKES..> | 2020-11-05 17:49 | 613K | |
![[IMG]](/icons/image2.gif) | 1604667565SignPrint.jpg | 2020-11-06 12:59 | 286K | |
![[IMG]](/icons/image2.gif) | 1604691500Schoolhous..> | 2020-11-06 19:38 | 32K | |
![[IMG]](/icons/image2.gif) | 1604704370Eat Surrea..> | 2020-11-06 23:12 | 59K | |
![[IMG]](/icons/image2.gif) | 1604765258Lapaceks-l..> | 2020-11-07 16:07 | 137K | |
![[IMG]](/icons/image2.gif) | 1604863524DE3BEFC4-3..> | 2020-11-08 19:25 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1604935867Lindsay-Lo..> | 2020-11-09 15:31 | 550K | |
![[IMG]](/icons/image2.gif) | 1604939890hazenslogo..> | 2020-11-09 16:38 | 93K | |
![[IMG]](/icons/image2.gif) | 1604950577ROUND LOGO..> | 2020-11-09 19:36 | 613K | |
![[IMG]](/icons/image2.gif) | 1604954751Tracis log..> | 2020-11-09 20:45 | 394K | |
![[IMG]](/icons/image2.gif) | 1604971845logo.jpg | 2020-11-10 01:30 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1605013778FB_IMG_159..> | 2020-11-10 13:09 | 87K | |
![[IMG]](/icons/image2.gif) | 1605023800Logo Fille..> | 2020-11-10 15:56 | 205K | |
![[IMG]](/icons/image2.gif) | 1605043045lbflogo.png | 2020-11-10 21:17 | 69K | |
![[IMG]](/icons/image2.gif) | 1605046207FB_IMG_160..> | 2020-11-10 22:10 | 60K | |
![[IMG]](/icons/image2.gif) | 1605057262HappySprou..> | 2020-11-11 01:14 | 165K | |
![[IMG]](/icons/image2.gif) | 1605071826logo.png | 2020-11-11 05:17 | 195K | |
![[IMG]](/icons/image2.gif) | 1605113154Gertie's B..> | 2020-11-11 16:45 | 289K | |
![[IMG]](/icons/image2.gif) | 1605125638IMG_201905..> | 2020-11-11 20:13 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1605133751Trans logo..> | 2020-11-11 22:29 | 205K | |
![[IMG]](/icons/image2.gif) | 1605161913IMG_1843.jpg | 2020-11-12 06:18 | 19K | |
![[IMG]](/icons/image2.gif) | 1605191736logo.png | 2020-11-12 14:35 | 632K | |
![[IMG]](/icons/image2.gif) | 1605199569fb_main_e.jpg | 2020-11-12 16:46 | 159K | |
![[IMG]](/icons/image2.gif) | 1605202050Lunar Fox ..> | 2020-11-12 17:27 | 447K | |
![[IMG]](/icons/image2.gif) | 1605230846banner 3-1..> | 2020-11-13 01:27 | 51K | |
![[IMG]](/icons/image2.gif) | 1605237045E5D8F2C5-A..> | 2020-11-13 03:10 | 797K | |
![[IMG]](/icons/image2.gif) | 1605263200Great Morn..> | 2020-11-13 10:26 | 59K | |
![[IMG]](/icons/image2.gif) | 1605298961IMG_0302.JPG | 2020-11-13 20:22 | 94K | |
![[IMG]](/icons/image2.gif) | 1605313764BDAFFE2F-3..> | 2020-11-14 00:29 | 28K | |
![[IMG]](/icons/image2.gif) | 1605315192cattle_1.jpg | 2020-11-14 00:53 | 40K | |
![[IMG]](/icons/image2.gif) | 1605363551B93E9A8F-6..> | 2020-11-14 14:19 | 39K | |
![[IMG]](/icons/image2.gif) | 1605382952logo.jpg | 2020-11-14 19:42 | 37K | |
![[IMG]](/icons/image2.gif) | 1605495512PekaraLogo..> | 2020-11-16 02:58 | 96K | |
![[IMG]](/icons/image2.gif) | 1605506102phantom_sh..> | 2020-11-16 05:55 | 15K | |
![[IMG]](/icons/image2.gif) | 1605529838BF1012B5-5..> | 2020-11-16 12:30 | 209K | |
![[IMG]](/icons/image2.gif) | 1605549409Melanie's ..> | 2020-11-16 17:56 | 195K | |
![[IMG]](/icons/image2.gif) | 1605558454Biz Logo s..> | 2020-11-16 20:27 | 6.3K | |
![[IMG]](/icons/image2.gif) | 1605558491Biz Logo s..> | 2020-11-16 20:28 | 6.3K | |
![[IMG]](/icons/image2.gif) | 1605574023Kilgus_Mil..> | 2020-11-17 00:47 | 399K | |
![[IMG]](/icons/image2.gif) | 1605578343logo color..> | 2020-11-17 01:59 | 77K | |
![[IMG]](/icons/image2.gif) | 1605578367Logo Flowe..> | 2020-11-17 01:59 | 146K | |
![[IMG]](/icons/image2.gif) | 1605648815E6709C9A-2..> | 2020-11-17 21:33 | 98K | |
![[IMG]](/icons/image2.gif) | 1605655107SISTERS AM..> | 2020-11-17 23:18 | 86K | |
![[IMG]](/icons/image2.gif) | 1605656069SISTERS AM..> | 2020-11-17 23:34 | 86K | |
![[IMG]](/icons/image2.gif) | 1605718490JoDell.jpg | 2020-11-18 16:54 | 66K | |
![[IMG]](/icons/image2.gif) | 1605720550CHICKENS.jpg | 2020-11-18 17:29 | 422K | |
![[IMG]](/icons/image2.gif) | 1605720773CHICKENSII..> | 2020-11-18 17:32 | 293K | |
![[IMG]](/icons/image2.gif) | 1605727950Wendigo Te..> | 2020-11-18 19:32 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1605729934Sedara.PNG | 2020-11-18 20:05 | 104K | |
![[IMG]](/icons/image2.gif) | 1605729983Sedara.PNG | 2020-11-18 20:06 | 104K | |
![[IMG]](/icons/image2.gif) | 1605752562SIS_FINALA..> | 2020-11-19 02:22 | 268K | |
![[IMG]](/icons/image2.gif) | 1605789973Wells Farm..> | 2020-11-19 12:46 | 39K | |
![[IMG]](/icons/image2.gif) | 1605898257LittleFarm..> | 2020-11-20 18:50 | 643K | |
![[IMG]](/icons/image2.gif) | 1605901469COWSONHILL..> | 2020-11-20 19:44 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1606058303BA Logo Cr..> | 2020-11-22 15:18 | 18K | |
![[IMG]](/icons/image2.gif) | 1606142484viking lam..> | 2020-11-23 14:41 | 40K | |
![[IMG]](/icons/image2.gif) | 1606238241Screenshot..> | 2020-11-24 17:17 | 30K | |
![[IMG]](/icons/image2.gif) | 1606242165HLO Logo.jpg | 2020-11-24 18:22 | 124K | |
![[IMG]](/icons/image2.gif) | 1606243062Small Logo..> | 2020-11-24 18:37 | 161K | |
![[IMG]](/icons/image2.gif) | 1606256522D&CC.png | 2020-11-24 22:22 | 271K | |
![[IMG]](/icons/image2.gif) | 1606272726new logo j..> | 2020-11-25 02:52 | 54K | |
![[IMG]](/icons/image2.gif) | 1606409861Poke Guru ..> | 2020-11-26 16:57 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1606576976IMG_202011..> | 2020-11-28 15:22 | 86K | |
![[IMG]](/icons/image2.gif) | 1606583159PXL_202010..> | 2020-11-28 17:05 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1606605525Screen Sho..> | 2020-11-28 23:18 | 933K | |
![[IMG]](/icons/image2.gif) | 1606756725IMG_3013.jpg | 2020-11-30 17:18 | 188K | |
![[IMG]](/icons/image2.gif) | 1606757570ProfilePho..> | 2020-11-30 17:32 | 215K | |
![[IMG]](/icons/image2.gif) | 1606761939QktDC6d-_4..> | 2020-11-30 18:45 | 23K | |
![[IMG]](/icons/image2.gif) | 1606791615B6172A6B-0..> | 2020-12-01 03:00 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1606917219IMG_201909..> | 2020-12-02 13:53 | 269K | |
![[IMG]](/icons/image2.gif) | 1606927809ElainesLOG..> | 2020-12-02 16:50 | 684K | |
![[IMG]](/icons/image2.gif) | 1606939497youtubepic..> | 2020-12-02 20:04 | 294K | |
![[IMG]](/icons/image2.gif) | 1606944844frog-pond-..> | 2020-12-02 21:34 | 583K | |
![[IMG]](/icons/image2.gif) | 1606956975received_1..> | 2020-12-03 00:56 | 107K | |
![[IMG]](/icons/image2.gif) | 1606984492Photo Jul ..> | 2020-12-03 08:34 | 255K | |
![[IMG]](/icons/image2.gif) | 1607025166Screenshot..> | 2020-12-03 19:52 | 66K | |
![[IMG]](/icons/image2.gif) | 1607026131BROC PINK ..> | 2020-12-03 20:08 | 695K | |
![[IMG]](/icons/image2.gif) | 1607027715Screenshot..> | 2020-12-03 20:35 | 32K | |
![[IMG]](/icons/image2.gif) | 1607031194foxpathfar..> | 2020-12-03 21:33 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1607094270AAF4CB2B-4..> | 2020-12-04 15:04 | 767K | |
![[IMG]](/icons/image2.gif) | 1607135108Screenshot..> | 2020-12-05 02:25 | 253K | |
![[IMG]](/icons/image2.gif) | 1607141476bars.jpg | 2020-12-05 04:11 | 108K | |
![[IMG]](/icons/image2.gif) | 1607274654wordmark@2..> | 2020-12-06 17:10 | 8.7K | |
![[IMG]](/icons/image2.gif) | 1607276244Round-Va.png | 2020-12-06 17:37 | 5.4K | |
![[IMG]](/icons/image2.gif) | 1607276251Round-Va.png | 2020-12-06 17:37 | 5.4K | |
![[IMG]](/icons/image2.gif) | 1607295709DC-Fab5-Al..> | 2020-12-06 23:01 | 319K | |
![[IMG]](/icons/image2.gif) | 1607295737DC-Fab5-Al..> | 2020-12-06 23:02 | 319K | |
![[IMG]](/icons/image2.gif) | 1607306073JGSfaceboo..> | 2020-12-07 01:54 | 276K | |
![[IMG]](/icons/image2.gif) | 1607357065stock-phot..> | 2020-12-07 16:04 | 80K | |
![[IMG]](/icons/image2.gif) | 1607362796Picture1.png | 2020-12-07 17:39 | 34K | |
![[IMG]](/icons/image2.gif) | 1607362917BentleyFar..> | 2020-12-07 17:41 | 111K | |
![[IMG]](/icons/image2.gif) | 1607372091Bonnie Cal..> | 2020-12-07 20:14 | 116K | |
![[IMG]](/icons/image2.gif) | 1607387438logo.jpg | 2020-12-08 00:30 | 33K | |
![[IMG]](/icons/image2.gif) | 1607391220MSF Logo.png | 2020-12-08 01:33 | 38K | |
![[IMG]](/icons/image2.gif) | 1607397560Lappitup-9..> | 2020-12-08 03:19 | 497K | |
![[IMG]](/icons/image2.gif) | 1607397626full-logo-..> | 2020-12-08 03:20 | 142K | |
![[IMG]](/icons/image2.gif) | 1607451981Madame-Chu..> | 2020-12-08 18:26 | 33K | |
![[IMG]](/icons/image2.gif) | 1607473012JOJO.jpg | 2020-12-09 00:16 | 109K | |
![[IMG]](/icons/image2.gif) | 1607474673Capracadab..> | 2020-12-09 00:44 | 56K | |
![[IMG]](/icons/image2.gif) | 1607523063SmallLogo.jpg | 2020-12-09 14:11 | 25K | |
![[IMG]](/icons/image2.gif) | 1607528918Rail Line ..> | 2020-12-09 15:48 | 78K | |
![[IMG]](/icons/image2.gif) | 1607552343image4.jpeg | 2020-12-09 22:19 | 117K | |
![[IMG]](/icons/image2.gif) | 1607617070Rossi-Farm..> | 2020-12-10 16:17 | 282K | |
![[IMG]](/icons/image2.gif) | 1607619101CF_red_txt..> | 2020-12-10 16:51 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1607702376HQ alden-h..> | 2020-12-11 15:59 | 56K | |
![[IMG]](/icons/image2.gif) | 1607704557C8147219-C..> | 2020-12-11 16:35 | 58K | |
![[IMG]](/icons/image2.gif) | 1607726339DSC_4109.jpg | 2020-12-11 22:38 | 271K | |
![[IMG]](/icons/image2.gif) | 1607737835DSC_5371.jpg | 2020-12-12 01:50 | 931K | |
![[IMG]](/icons/image2.gif) | 1607811796Firecreek ..> | 2020-12-12 22:23 | 836K | |
![[IMG]](/icons/image2.gif) | 1607883930B56E644A-B..> | 2020-12-13 18:25 | 884K | |
![[IMG]](/icons/image2.gif) | 1607883942B56E644A-B..> | 2020-12-13 18:25 | 884K | |
![[IMG]](/icons/image2.gif) | 1607888303IMG_2584.JPG | 2020-12-13 19:38 | 156K | |
![[IMG]](/icons/image2.gif) | 1607898565Cheeses.jpg | 2020-12-13 22:29 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1607920507Screenshot..> | 2020-12-14 04:35 | 488K | |
![[IMG]](/icons/image2.gif) | 1607920734Screenshot..> | 2020-12-14 04:38 | 488K | |
![[IMG]](/icons/image2.gif) | 1607920879Screen Sho..> | 2020-12-14 04:41 | 30K | |
![[IMG]](/icons/image2.gif) | 1607949267Egg Pic 00..> | 2020-12-14 12:34 | 269K | |
![[IMG]](/icons/image2.gif) | 1607958393Kountry Fr..> | 2020-12-14 15:06 | 198K | |
![[IMG]](/icons/image2.gif) | 1607977089FB_IMG_160..> | 2020-12-14 20:18 | 24K | |
![[IMG]](/icons/image2.gif) | 1607986597serenity-h..> | 2020-12-14 22:56 | 17K | |
![[IMG]](/icons/image2.gif) | 1607994108image00000..> | 2020-12-15 01:01 | 453K | |
![[IMG]](/icons/image2.gif) | 1607996702avocado oi..> | 2020-12-15 01:45 | 161K | |
![[IMG]](/icons/image2.gif) | 1608039954Artesian_F..> | 2020-12-15 13:45 | 336K | |
![[IMG]](/icons/image2.gif) | 1608050017Facebook_I..> | 2020-12-15 16:33 | 422K | |
![[IMG]](/icons/image2.gif) | 1608056273logo rgb.png | 2020-12-15 18:17 | 14K | |
![[IMG]](/icons/image2.gif) | 1608062046Picture010..> | 2020-12-15 19:54 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1608127828A2A19869-8..> | 2020-12-16 14:10 | 143K | |
![[IMG]](/icons/image2.gif) | 1608134162Screenshot..> | 2020-12-16 15:56 | 22K | |
![[IMG]](/icons/image2.gif) | 1608134217Screenshot..> | 2020-12-16 15:56 | 25K | |
![[IMG]](/icons/image2.gif) | 1608134245Screenshot..> | 2020-12-16 15:57 | 30K | |
![[IMG]](/icons/image2.gif) | 1608134270Screenshot..> | 2020-12-16 15:57 | 29K | |
![[IMG]](/icons/image2.gif) | 1608154971clark fami..> | 2020-12-16 21:42 | 85K | |
![[IMG]](/icons/image2.gif) | 1608204424pasture ma..> | 2020-12-17 11:27 | 764K | |
![[IMG]](/icons/image2.gif) | 1608223083FlyingRhin..> | 2020-12-17 16:38 | 741K | |
![[IMG]](/icons/image2.gif) | 1608305255Hannah in ..> | 2020-12-18 15:27 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1608395684ShopSprFar..> | 2020-12-19 16:34 | 358K | |
![[IMG]](/icons/image2.gif) | 1608431086prg logo.jpg | 2020-12-20 02:24 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1608431173BROC PINK ..> | 2020-12-20 02:26 | 695K | |
![[IMG]](/icons/image2.gif) | 1608516231AB3244E3-0..> | 2020-12-21 02:03 | 593K | |
![[IMG]](/icons/image2.gif) | 1608516352FTB-Color ..> | 2020-12-21 02:05 | 124K | |
![[IMG]](/icons/image2.gif) | 1608516438photo sep ..> | 2020-12-21 02:07 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1608516480FTB-Color ..> | 2020-12-21 02:08 | 124K | |
![[IMG]](/icons/image2.gif) | 1608560151C0723271-3..> | 2020-12-21 14:15 | 41K | |
![[IMG]](/icons/image2.gif) | 1608569510Bedners-pr..> | 2020-12-21 16:51 | 767K | |
![[IMG]](/icons/image2.gif) | 1608576469cip logo.jpg | 2020-12-21 18:47 | 13K | |
![[IMG]](/icons/image2.gif) | 1608582718CIB - Logo..> | 2020-12-21 20:31 | 214K | |
![[IMG]](/icons/image2.gif) | 1608582730CIB - Logo..> | 2020-12-21 20:32 | 214K | |
![[IMG]](/icons/image2.gif) | 1608582833cip logo.jpg | 2020-12-21 20:33 | 13K | |
![[IMG]](/icons/image2.gif) | 1608582841cip logo.jpg | 2020-12-21 20:34 | 13K | |
![[IMG]](/icons/image2.gif) | 1608662523Logo squar..> | 2020-12-22 18:42 | 7.1K | |
![[IMG]](/icons/image2.gif) | 1608691361business c..> | 2020-12-23 02:42 | 561K | |
![[IMG]](/icons/image2.gif) | 1608691373Screen Sho..> | 2020-12-23 02:42 | 469K | |
![[IMG]](/icons/image2.gif) | 1608756834Meier-Bach..> | 2020-12-23 20:53 | 40K | |
![[IMG]](/icons/image2.gif) | 1608758204Basic Circ..> | 2020-12-23 21:16 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1609106824color_logo..> | 2020-12-27 22:07 | 433K | |
![[IMG]](/icons/image2.gif) | 1609127417Yummy-biz-..> | 2020-12-28 03:50 | 140K | |
![[IMG]](/icons/image2.gif) | 1609169090CAB670CC-B..> | 2020-12-28 15:24 | 98K | |
![[IMG]](/icons/image2.gif) | 1609175345Farm Logo-..> | 2020-12-28 17:09 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1609195858fullcolorl..> | 2020-12-28 22:50 | 60K | |
![[IMG]](/icons/image2.gif) | 1609209444produce ph..> | 2020-12-29 02:37 | 203K | |
![[IMG]](/icons/image2.gif) | 1609245350farm biz c..> | 2020-12-29 12:35 | 46K | |
![[IMG]](/icons/image2.gif) | 1609263107E833FD8B-F..> | 2020-12-29 17:31 | 322K | |
![[IMG]](/icons/image2.gif) | 1609269209Logo with ..> | 2020-12-29 19:13 | 234K | |
![[IMG]](/icons/image2.gif) | 1609609925Screen Sho..> | 2021-01-02 17:52 | 81K | |
![[IMG]](/icons/image2.gif) | 1609780806EBEC109A-9..> | 2021-01-04 17:20 | 22K | |
![[IMG]](/icons/image2.gif) | 1609781549OriginalLo..> | 2021-01-04 17:32 | 200K | |
![[IMG]](/icons/image2.gif) | 1609797104ConTodo-Lo..> | 2021-01-04 21:51 | 65K | |
![[IMG]](/icons/image2.gif) | 1609798927CB714040-8..> | 2021-01-04 22:22 | 29K | |
![[IMG]](/icons/image2.gif) | 1609798997CB714040-8..> | 2021-01-04 22:23 | 29K | |
![[IMG]](/icons/image2.gif) | 1609807782Misty Lane..> | 2021-01-05 00:49 | 13K | |
![[IMG]](/icons/image2.gif) | 1609810339HP logo.jpg | 2021-01-05 01:32 | 20K | |
![[IMG]](/icons/image2.gif) | 1609812194BA484547-E..> | 2021-01-05 02:03 | 606K | |
![[IMG]](/icons/image2.gif) | 1609812215Misty Lane..> | 2021-01-05 02:03 | 595K | |
![[IMG]](/icons/image2.gif) | 1609812271Logo.png | 2021-01-05 02:04 | 71K | |
![[IMG]](/icons/image2.gif) | 1609820874png (1).png | 2021-01-05 04:27 | 289K | |
![[IMG]](/icons/image2.gif) | 1609857400profile.jpg | 2021-01-05 14:36 | 148K | |
![[IMG]](/icons/image2.gif) | 1609859078ASC_LOGO_V..> | 2021-01-05 15:04 | 130K | |
![[IMG]](/icons/image2.gif) | 1609865202pizza.jpg | 2021-01-05 16:46 | 110K | |
![[IMG]](/icons/image2.gif) | 1609873990farm.jpg | 2021-01-05 19:13 | 503K | |
![[IMG]](/icons/image2.gif) | 1609874969logo1.jpg | 2021-01-05 19:29 | 60K | |
![[IMG]](/icons/image2.gif) | 1609951521IMG_8501.jpg | 2021-01-06 16:45 | 159K | |
![[IMG]](/icons/image2.gif) | 1609955250CrystalLak..> | 2021-01-06 17:47 | 377K | |
![[IMG]](/icons/image2.gif) | 1610028026tester.jpg | 2021-01-07 14:00 | 157K | |
![[IMG]](/icons/image2.gif) | 1610036464rs=w_600,h..> | 2021-01-07 16:21 | 25K | |
![[IMG]](/icons/image2.gif) | 1610037234bomb-card-..> | 2021-01-07 16:33 | 0 | |
![[IMG]](/icons/image2.gif) | 1610037254bomb-card-..> | 2021-01-07 16:34 | 110K | |
![[IMG]](/icons/image2.gif) | 1610049662Moyer-2630..> | 2021-01-07 20:01 | 788K | |
![[IMG]](/icons/image2.gif) | 1610052324company lo..> | 2021-01-07 20:45 | 910K | |
![[IMG]](/icons/image2.gif) | 1610115358IMG_202101..> | 2021-01-08 14:15 | 132K | |
![[IMG]](/icons/image2.gif) | 1610130051Lucky Prod..> | 2021-01-08 18:20 | 441K | |
![[IMG]](/icons/image2.gif) | 1610139048HATfresh-i..> | 2021-01-08 20:50 | 115K | |
![[IMG]](/icons/image2.gif) | 1610140468Sicilia Ba..> | 2021-01-08 21:14 | 7.3K | |
![[IMG]](/icons/image2.gif) | 1610211882Ella-Ollie..> | 2021-01-09 17:04 | 119K | |
![[IMG]](/icons/image2.gif) | 1610305741DE467496-F..> | 2021-01-10 19:09 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1610354304poster - C..> | 2021-01-11 08:38 | 141K | |
![[IMG]](/icons/image2.gif) | 1610373413WLF Logo B..> | 2021-01-11 13:56 | 136K | |
![[IMG]](/icons/image2.gif) | 1610374443WLF Logo W..> | 2021-01-11 14:14 | 144K | |
![[IMG]](/icons/image2.gif) | 1610383237Full Color..> | 2021-01-11 16:40 | 565K | |
![[IMG]](/icons/image2.gif) | 1610383618MLB_1744 (..> | 2021-01-11 16:46 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1610387409WMLogo (2)..> | 2021-01-11 17:50 | 126K | |
![[IMG]](/icons/image2.gif) | 1610400813Wildwood_B..> | 2021-01-11 21:33 | 165K | |
![[IMG]](/icons/image2.gif) | 1610408775veloutefre..> | 2021-01-11 23:46 | 284K | |
![[IMG]](/icons/image2.gif) | 1610415800bluePRFLog..> | 2021-01-12 01:43 | 23K | |
![[IMG]](/icons/image2.gif) | 1610417457IMG_202005..> | 2021-01-12 02:10 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1610457380LWP_9783.jpg | 2021-01-12 13:16 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1610479727The-Creame..> | 2021-01-12 19:28 | 113K | |
![[IMG]](/icons/image2.gif) | 1610548830DD879A7D-E..> | 2021-01-13 14:40 | 133K | |
![[IMG]](/icons/image2.gif) | 1610556051StoutsMark..> | 2021-01-13 16:40 | 88K | |
![[IMG]](/icons/image2.gif) | 1610557510E38FCBC0-1..> | 2021-01-13 17:05 | 77K | |
![[IMG]](/icons/image2.gif) | 1610557644BECAF299-6..> | 2021-01-13 17:07 | 77K | |
![[IMG]](/icons/image2.gif) | 1610582371thumbnail.jpg | 2021-01-13 23:59 | 110K | |
![[IMG]](/icons/image2.gif) | 1610594351Untitled d..> | 2021-01-14 03:19 | 897K | |
![[IMG]](/icons/image2.gif) | 1610644126Logo.jpg | 2021-01-14 17:08 | 38K | |
![[IMG]](/icons/image2.gif) | 1610657651lincolnlan..> | 2021-01-14 20:54 | 69K | |
![[IMG]](/icons/image2.gif) | 1610668150Shady Cree..> | 2021-01-14 23:49 | 70K | |
![[IMG]](/icons/image2.gif) | 1610672017LOGO PING.png | 2021-01-15 00:53 | 80K | |
![[IMG]](/icons/image2.gif) | 1610672541LOGO PING.png | 2021-01-15 01:02 | 73K | |
![[IMG]](/icons/image2.gif) | 1610681200IMG_3190.JPG | 2021-01-15 03:26 | 308K | |
![[IMG]](/icons/image2.gif) | 1610729500LogoSMALLC..> | 2021-01-15 16:51 | 44K | |
![[IMG]](/icons/image2.gif) | 1610730772image.png | 2021-01-15 17:12 | 205K | |
![[IMG]](/icons/image2.gif) | 1610732036best ever ..> | 2021-01-15 17:33 | 31K | |
![[IMG]](/icons/image2.gif) | 1610763774MudRun+B&W..> | 2021-01-16 02:22 | 183K | |
![[IMG]](/icons/image2.gif) | 1610797464Small-Acre..> | 2021-01-16 11:44 | 493K | |
![[IMG]](/icons/image2.gif) | 1610825490Eddie Mack..> | 2021-01-16 19:31 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1610899065Logo.jpg | 2021-01-17 15:57 | 709K | |
![[IMG]](/icons/image2.gif) | 1610900249FB_IMG_161..> | 2021-01-17 16:17 | 229K | |
![[IMG]](/icons/image2.gif) | 1610939628WGLogo1cro..> | 2021-01-18 03:13 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1610995452Agri-Culte..> | 2021-01-18 18:44 | 66K | |
![[IMG]](/icons/image2.gif) | 1610999900ABCo_LOGO_..> | 2021-01-18 19:58 | 8.0K | |
![[IMG]](/icons/image2.gif) | 1611004489pexels-pix..> | 2021-01-18 21:14 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1611004538ABCo_LOGO_..> | 2021-01-18 21:15 | 40K | |
![[IMG]](/icons/image2.gif) | 1611018982logo final..> | 2021-01-19 01:16 | 72K | |
![[IMG]](/icons/image2.gif) | 1611025732brand 2.jpg | 2021-01-19 03:08 | 9.6K | |
![[IMG]](/icons/image2.gif) | 1611086214IMG_3828.jpg | 2021-01-19 19:56 | 189K | |
![[IMG]](/icons/image2.gif) | 1611100770Screenshot..> | 2021-01-19 23:59 | 338K | |
![[IMG]](/icons/image2.gif) | 1611101146Screenshot..> | 2021-01-20 00:05 | 88K | |
![[IMG]](/icons/image2.gif) | 1611102398kc-logo-we..> | 2021-01-20 00:26 | 14K | |
![[IMG]](/icons/image2.gif) | 1611104377Logo Orang..> | 2021-01-20 00:59 | 447K | |
![[IMG]](/icons/image2.gif) | 1611114409Box Labels..> | 2021-01-20 03:46 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1611157170IMG_7520.JPG | 2021-01-20 15:39 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1611165001B7988AFF-5..> | 2021-01-20 17:50 | 36K | |
![[IMG]](/icons/image2.gif) | 1611166410SoChatti-W..> | 2021-01-20 18:13 | 45K | |
![[IMG]](/icons/image2.gif) | 1611166686Logo Marke..> | 2021-01-20 18:18 | 43K | |
![[IMG]](/icons/image2.gif) | 1611179455logo low r..> | 2021-01-20 21:50 | 11K | |
![[IMG]](/icons/image2.gif) | 1611200685JUST-ENOUG..> | 2021-01-21 03:44 | 149K | |
![[IMG]](/icons/image2.gif) | 1611231915LxQ0iW9QRn..> | 2021-01-21 12:25 | 0 | |
![[IMG]](/icons/image2.gif) | 1611232565LxQ0iW9QRn..> | 2021-01-21 12:36 | 206K | |
![[IMG]](/icons/image2.gif) | 1611243976IMG_202012..> | 2021-01-21 15:46 | 618K | |
![[IMG]](/icons/image2.gif) | 1611243992IMG_202012..> | 2021-01-21 15:46 | 618K | |
![[IMG]](/icons/image2.gif) | 1611246691DSC_7561 -..> | 2021-01-21 16:31 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1611249536Logo Final..> | 2021-01-21 17:18 | 97K | |
![[IMG]](/icons/image2.gif) | 1611250162goathillfa..> | 2021-01-21 17:29 | 59K | |
![[IMG]](/icons/image2.gif) | 1611250664IMG_7164.jpg | 2021-01-21 17:37 | 360K | |
![[IMG]](/icons/image2.gif) | 1611251984ChampionCh..> | 2021-01-21 17:59 | 901K | |
![[IMG]](/icons/image2.gif) | 1611252249roaster-06..> | 2021-01-21 18:04 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1611253384Bedners-ic..> | 2021-01-21 18:23 | 765K | |
![[IMG]](/icons/image2.gif) | 1611268670phillipsor..> | 2021-01-21 22:37 | 106K | |
![[IMG]](/icons/image2.gif) | 1611270746Itty Bitty..> | 2021-01-21 23:12 | 99K | |
![[IMG]](/icons/image2.gif) | 1611270922IMG_201909..> | 2021-01-21 23:15 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1611273978Birch Cree..> | 2021-01-22 00:06 | 237K | |
![[IMG]](/icons/image2.gif) | 1611276051GIG logo.png | 2021-01-22 00:40 | 60K | |
![[IMG]](/icons/image2.gif) | 1611282340MMS_logo-b..> | 2021-01-22 02:25 | 856K | |
![[IMG]](/icons/image2.gif) | 1611320549Uptown Caf..> | 2021-01-22 13:02 | 124K | |
![[IMG]](/icons/image2.gif) | 1611323461Square Log..> | 2021-01-22 13:51 | 186K | |
![[IMG]](/icons/image2.gif) | 1611338981PetesBigJe..> | 2021-01-22 18:09 | 26K | |
![[IMG]](/icons/image2.gif) | 1611338994PetesBigJe..> | 2021-01-22 18:09 | 26K | |
![[IMG]](/icons/image2.gif) | 1611341580Capture1.PNG | 2021-01-22 18:53 | 49K | |
![[IMG]](/icons/image2.gif) | 1611355323Centered S..> | 2021-01-22 22:42 | 361K | |
![[IMG]](/icons/image2.gif) | 1611430246TRANSPAREN..> | 2021-01-23 19:30 | 321K | |
![[IMG]](/icons/image2.gif) | 1611440564B2EE8587-F..> | 2021-01-23 22:22 | 32K | |
![[IMG]](/icons/image2.gif) | 1611444328ff black n..> | 2021-01-23 23:25 | 84K | |
![[IMG]](/icons/image2.gif) | 1611512408E376427D-8..> | 2021-01-24 18:20 | 229K | |
![[IMG]](/icons/image2.gif) | 1611512435E376427D-8..> | 2021-01-24 18:20 | 229K | |
![[IMG]](/icons/image2.gif) | 1611527856SUGARROOS ..> | 2021-01-24 22:37 | 487K | |
![[IMG]](/icons/image2.gif) | 1611529403F8C73DBC-8..> | 2021-01-24 23:03 | 32K | |
![[IMG]](/icons/image2.gif) | 1611584953Market Wag..> | 2021-01-25 14:29 | 148K | |
![[IMG]](/icons/image2.gif) | 1611586075bleufigori..> | 2021-01-25 14:47 | 42K | |
![[IMG]](/icons/image2.gif) | 1611586908W4_flat.png | 2021-01-25 15:01 | 170K | |
![[IMG]](/icons/image2.gif) | 1611591696Screen Sho..> | 2021-01-25 16:21 | 207K | |
![[IMG]](/icons/image2.gif) | 1611594673PBI_Clear.png | 2021-01-25 17:11 | 160K | |
![[IMG]](/icons/image2.gif) | 1611606906logo.jpg | 2021-01-25 20:35 | 121K | |
![[IMG]](/icons/image2.gif) | 1611608263color_logo..> | 2021-01-25 20:57 | 231K | |
![[IMG]](/icons/image2.gif) | 1611609320PnFLabelSt..> | 2021-01-25 21:15 | 211K | |
![[IMG]](/icons/image2.gif) | 1611616846ppcLogo_50..> | 2021-01-25 23:20 | 140K | |
![[IMG]](/icons/image2.gif) | 1611618139BluBirdAcr..> | 2021-01-25 23:42 | 347K | |
![[IMG]](/icons/image2.gif) | 1611619707BluBirdAcr..> | 2021-01-26 00:08 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1611619808BluBirdAcr..> | 2021-01-26 00:10 | 347K | |
![[IMG]](/icons/image2.gif) | 1611620008Untitled d..> | 2021-01-26 00:13 | 196K | |
![[IMG]](/icons/image2.gif) | 1611620130Untitled d..> | 2021-01-26 00:15 | 162K | |
![[IMG]](/icons/image2.gif) | 1611620210Untitled d..> | 2021-01-26 00:16 | 192K | |
![[IMG]](/icons/image2.gif) | 1611667035Rachelwith..> | 2021-01-26 13:17 | 225K | |
![[IMG]](/icons/image2.gif) | 1611667447LOST ASH P..> | 2021-01-26 13:24 | 213K | |
![[IMG]](/icons/image2.gif) | 1611667788acadiana l..> | 2021-01-26 13:29 | 75K | |
![[IMG]](/icons/image2.gif) | 1611675205Screen Sho..> | 2021-01-26 15:33 | 109K | |
![[IMG]](/icons/image2.gif) | 1611690063Untitled d..> | 2021-01-26 19:41 | 57K | |
![[IMG]](/icons/image2.gif) | 1611690716PAC Logo 1..> | 2021-01-26 19:51 | 627K | |
![[IMG]](/icons/image2.gif) | 1611694085PPF-Logo-C..> | 2021-01-26 20:48 | 638K | |
![[IMG]](/icons/image2.gif) | 1611698581Palmatier ..> | 2021-01-26 22:03 | 190K | |
![[IMG]](/icons/image2.gif) | 1611747348FamilyPic ..> | 2021-01-27 11:35 | 463K | |
![[IMG]](/icons/image2.gif) | 1611767682IMG_6560.jpg | 2021-01-27 17:14 | 251K | |
![[IMG]](/icons/image2.gif) | 1611767861E38F1B5F-0..> | 2021-01-27 17:17 | 25K | |
![[IMG]](/icons/image2.gif) | 1611767876E38F1B5F-0..> | 2021-01-27 17:17 | 25K | |
![[IMG]](/icons/image2.gif) | 1611778251bleufigori..> | 2021-01-27 20:10 | 42K | |
![[IMG]](/icons/image2.gif) | 1611780723bleufiglog..> | 2021-01-27 20:52 | 70K | |
![[IMG]](/icons/image2.gif) | 1611781121Ann&Allen...> | 2021-01-27 20:58 | 175K | |
![[IMG]](/icons/image2.gif) | 1611782762annallen b..> | 2021-01-27 21:26 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1611838817MakeDoLogo..> | 2021-01-28 13:00 | 337K | |
![[IMG]](/icons/image2.gif) | 1611843097PVP_Logo.jpg | 2021-01-28 14:11 | 75K | |
![[IMG]](/icons/image2.gif) | 1611845686DD Logo 10..> | 2021-01-28 14:54 | 89K | |
![[IMG]](/icons/image2.gif) | 1611845726logo png f..> | 2021-01-28 14:55 | 223K | |
![[IMG]](/icons/image2.gif) | 1611845738logo png f..> | 2021-01-28 14:55 | 223K | |
![[IMG]](/icons/image2.gif) | 1611864365LOGO.jpg | 2021-01-28 20:06 | 369K | |
![[IMG]](/icons/image2.gif) | 1611867971IMG_9191.jpg | 2021-01-28 21:06 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1611877781RB llc log..> | 2021-01-28 23:49 | 217K | |
![[IMG]](/icons/image2.gif) | 1611918478FB Profile..> | 2021-01-29 11:07 | 219K | |
![[IMG]](/icons/image2.gif) | 1611976587HH logo.jpg | 2021-01-30 03:16 | 26K | |
![[IMG]](/icons/image2.gif) | 1612030688Rivet Chem..> | 2021-01-30 18:18 | 534K | |
![[IMG]](/icons/image2.gif) | 1612036221Rivet Logo..> | 2021-01-30 19:50 | 23K | |
![[IMG]](/icons/image2.gif) | 1612110134Oldevirden..> | 2021-01-31 16:22 | 313K | |
![[IMG]](/icons/image2.gif) | 1612112571Small Logo..> | 2021-01-31 17:02 | 157K | |
![[IMG]](/icons/image2.gif) | 1612185412edit #2.jpg | 2021-02-01 13:16 | 123K | |
![[IMG]](/icons/image2.gif) | 1612185996edit #2.jpg | 2021-02-01 13:26 | 123K | |
![[IMG]](/icons/image2.gif) | 1612186202edit #3.jpg | 2021-02-01 13:30 | 338K | |
![[IMG]](/icons/image2.gif) | 1612186281edit #3.jpg | 2021-02-01 13:31 | 338K | |
![[IMG]](/icons/image2.gif) | 1612186456edit #4.jpg | 2021-02-01 13:34 | 323K | |
![[IMG]](/icons/image2.gif) | 1612186684B9AFD8C8-4..> | 2021-02-01 13:38 | 569K | |
![[IMG]](/icons/image2.gif) | 1612186770edit 8.jpg | 2021-02-01 13:39 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1612194816Rivet Logo..> | 2021-02-01 15:53 | 33K | |
![[IMG]](/icons/image2.gif) | 1612194877Rivet Logo..> | 2021-02-01 15:54 | 28K | |
![[IMG]](/icons/image2.gif) | 1612194951Rivet Logo..> | 2021-02-01 15:55 | 34K | |
![[IMG]](/icons/image2.gif) | 1612194995Rivet Logo..> | 2021-02-01 15:56 | 28K | |
![[IMG]](/icons/image2.gif) | 1612197102Shirini 20..> | 2021-02-01 16:31 | 200K | |
![[IMG]](/icons/image2.gif) | 1612197796FB0BA4C3-0..> | 2021-02-01 16:43 | 31K | |
![[IMG]](/icons/image2.gif) | 1612208286JustFarmin..> | 2021-02-01 19:38 | 40K | |
![[IMG]](/icons/image2.gif) | 1612212591instagram-..> | 2021-02-01 20:49 | 16K | |
![[IMG]](/icons/image2.gif) | 1612216286IMG_202010..> | 2021-02-01 21:51 | 34K | |
![[IMG]](/icons/image2.gif) | 1612224306Untitled d..> | 2021-02-02 00:05 | 38K | |
![[IMG]](/icons/image2.gif) | 1612241170aGYMANDJUI..> | 2021-02-02 04:46 | 165K | |
![[IMG]](/icons/image2.gif) | 1612279746Bales Farm..> | 2021-02-02 15:29 | 50K | |
![[IMG]](/icons/image2.gif) | 1612287807TCP grand ..> | 2021-02-02 17:43 | 173K | |
![[IMG]](/icons/image2.gif) | 1612298435Screen Sho..> | 2021-02-02 20:40 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1612298555Screen Sho..> | 2021-02-02 20:42 | 684K | |
![[IMG]](/icons/image2.gif) | 1612302683seed guy f..> | 2021-02-02 21:51 | 39K | |
![[IMG]](/icons/image2.gif) | 1612309784headshot-2..> | 2021-02-02 23:49 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1612315233June-Bug-L..> | 2021-02-03 01:20 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1612315300June-Bug-L..> | 2021-02-03 01:21 | 59K | |
![[IMG]](/icons/image2.gif) | 1612352595Growing Gr..> | 2021-02-03 11:43 | 30K | |
![[IMG]](/icons/image2.gif) | 1612368209Logo for M..> | 2021-02-03 16:03 | 99K | |
![[IMG]](/icons/image2.gif) | 1612372382full-logo-..> | 2021-02-03 17:13 | 326K | |
![[IMG]](/icons/image2.gif) | 1612377027shower bom..> | 2021-02-03 18:30 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1612378873cow13[686]..> | 2021-02-03 19:01 | 63K | |
![[IMG]](/icons/image2.gif) | 1612382774Zahncroft ..> | 2021-02-03 20:06 | 34K | |
![[IMG]](/icons/image2.gif) | 1612456997Resized.png | 2021-02-04 16:43 | 18K | |
![[IMG]](/icons/image2.gif) | 1612457033Mama Cs GF..> | 2021-02-04 16:43 | 726K | |
![[IMG]](/icons/image2.gif) | 1612458722Ani feedin..> | 2021-02-04 17:12 | 657K | |
![[IMG]](/icons/image2.gif) | 1612460254A4164E73-6..> | 2021-02-04 17:37 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1612460665backdrop.jpg | 2021-02-04 17:44 | 96K | |
![[IMG]](/icons/image2.gif) | 1612460766Tomatoes.jpg | 2021-02-04 17:46 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1612464766Sofia'sSel..> | 2021-02-04 18:52 | 285K | |
![[IMG]](/icons/image2.gif) | 1612466841logo.jpg | 2021-02-04 19:27 | 75K | |
![[IMG]](/icons/image2.gif) | 1612476130logo.jpg | 2021-02-04 22:02 | 34K | |
![[IMG]](/icons/image2.gif) | 1612476791TVF Logo O..> | 2021-02-04 22:13 | 35K | |
![[IMG]](/icons/image2.gif) | 1612537955logoWRH.png | 2021-02-05 15:12 | 264K | |
![[IMG]](/icons/image2.gif) | 1612537965logoWRH.png | 2021-02-05 15:12 | 264K | |
![[IMG]](/icons/image2.gif) | 1612538461WRH ™ Lo..> | 2021-02-05 15:21 | 143K | |
![[IMG]](/icons/image2.gif) | 1612538539WRH ™ Lo..> | 2021-02-05 15:22 | 96K | |
![[IMG]](/icons/image2.gif) | 1612540614SachaiLogo..> | 2021-02-05 15:56 | 98K | |
![[IMG]](/icons/image2.gif) | 1612545734LightfootF..> | 2021-02-05 17:22 | 26K | |
![[IMG]](/icons/image2.gif) | 1612552796Collage 20..> | 2021-02-05 19:19 | 157K | |
![[IMG]](/icons/image2.gif) | 1612552945Logo godad..> | 2021-02-05 19:22 | 33K | |
![[IMG]](/icons/image2.gif) | 1612562936ROOT 23 He..> | 2021-02-05 22:08 | 38K | |
![[IMG]](/icons/image2.gif) | 1612567841RISE091 3.jpg | 2021-02-05 23:30 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1612735016Asset 1.png | 2021-02-07 21:56 | 12K | |
![[IMG]](/icons/image2.gif) | 1612742719F23C0F61-7..> | 2021-02-08 00:05 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1612750375AATS New L..> | 2021-02-08 02:12 | 154K | |
![[IMG]](/icons/image2.gif) | 1612802195Linked Pho..> | 2021-02-08 16:36 | 932K | |
![[IMG]](/icons/image2.gif) | 1612802364Highland F..> | 2021-02-08 16:39 | 64K | |
![[IMG]](/icons/image2.gif) | 1612807548DS logo co..> | 2021-02-08 18:05 | 786K | |
![[IMG]](/icons/image2.gif) | 1612810161Profile Pi..> | 2021-02-08 18:49 | 29K | |
![[IMG]](/icons/image2.gif) | 1612823632logo_v3_he..> | 2021-02-08 22:33 | 16K | |
![[IMG]](/icons/image2.gif) | 1612831435#1 Felted ..> | 2021-02-09 00:43 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1612834393#1 Felted ..> | 2021-02-09 01:33 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1612834405#1 Felted ..> | 2021-02-09 01:33 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1612834463#1 Felted ..> | 2021-02-09 01:34 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1612834676Landscape ..> | 2021-02-09 01:37 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1612834779Landscape ..> | 2021-02-09 01:39 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1612841401g6755.png | 2021-02-09 03:30 | 24K | |
![[IMG]](/icons/image2.gif) | 1612876201received_7..> | 2021-02-09 13:10 | 938K | |
![[IMG]](/icons/image2.gif) | 1612881414OakLogo2-2..> | 2021-02-09 14:36 | 12K | |
![[IMG]](/icons/image2.gif) | 1612883737FB_IMG_159..> | 2021-02-09 15:15 | 88K | |
![[IMG]](/icons/image2.gif) | 1612886106Living--lo..> | 2021-02-09 15:55 | 262K | |
![[IMG]](/icons/image2.gif) | 1612886364Living-log..> | 2021-02-09 15:59 | 150K | |
![[IMG]](/icons/image2.gif) | 1612889472Landscape ..> | 2021-02-09 16:51 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1612890430Landscape ..> | 2021-02-09 17:07 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1612921268IMG_3203.jpg | 2021-02-10 01:41 | 730K | |
![[IMG]](/icons/image2.gif) | 1612935921ClevelandP..> | 2021-02-10 05:45 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1612978068Singular_l..> | 2021-02-10 17:27 | 30K | |
![[IMG]](/icons/image2.gif) | 1612980389GME Logo.png | 2021-02-10 18:06 | 64K | |
![[IMG]](/icons/image2.gif) | 1612993647logo.jpg | 2021-02-10 21:47 | 63K | |
![[IMG]](/icons/image2.gif) | 1612994794Beanpatch ..> | 2021-02-10 22:06 | 125K | |
![[IMG]](/icons/image2.gif) | 1613003970Chimi.jpg | 2021-02-11 00:39 | 91K | |
![[IMG]](/icons/image2.gif) | 1613004243Bandeira l..> | 2021-02-11 00:44 | 108K | |
![[IMG]](/icons/image2.gif) | 1613010476BDFB18BF-B..> | 2021-02-11 02:27 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1613042561Riverside ..> | 2021-02-11 11:22 | 28K | |
![[IMG]](/icons/image2.gif) | 1613058625square log..> | 2021-02-11 15:50 | 124K | |
![[IMG]](/icons/image2.gif) | 1613061127fullsizeou..> | 2021-02-11 16:32 | 23K | |
![[IMG]](/icons/image2.gif) | 1613062082BeFunky-ph..> | 2021-02-11 16:48 | 371K | |
![[IMG]](/icons/image2.gif) | 1613062683fullsizeou..> | 2021-02-11 16:58 | 52K | |
![[IMG]](/icons/image2.gif) | 1613063535PLF-2019-L..> | 2021-02-11 17:12 | 45K | |
![[IMG]](/icons/image2.gif) | 1613063584PLF-2019-L..> | 2021-02-11 17:13 | 659K | |
![[IMG]](/icons/image2.gif) | 1613071828IMG_0341.jpeg | 2021-02-11 19:30 | 176K | |
![[IMG]](/icons/image2.gif) | 1613073944Long Range..> | 2021-02-11 20:05 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1613076020lola bean ..> | 2021-02-11 20:40 | 62K | |
![[IMG]](/icons/image2.gif) | 1613076855magnoliafa..> | 2021-02-11 20:54 | 308K | |
![[IMG]](/icons/image2.gif) | 1613076898magnoliafa..> | 2021-02-11 20:54 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1613077684magnoliafa..> | 2021-02-11 21:08 | 964K | |
![[IMG]](/icons/image2.gif) | 1613084890IMG_0140-1..> | 2021-02-11 23:08 | 186K | |
![[IMG]](/icons/image2.gif) | 1613090975Piedmont B..> | 2021-02-12 00:49 | 52K | |
![[IMG]](/icons/image2.gif) | 1613147127market_wa.jpg | 2021-02-12 16:25 | 6.7K | |
![[IMG]](/icons/image2.gif) | 1613148151Sicilia Ba..> | 2021-02-12 16:42 | 7.3K | |
![[IMG]](/icons/image2.gif) | 1613152056fullsizeou..> | 2021-02-12 17:47 | 777K | |
![[IMG]](/icons/image2.gif) | 1613153430Logo - dow..> | 2021-02-12 18:10 | 64K | |
![[IMG]](/icons/image2.gif) | 1613154370Simplea La..> | 2021-02-12 18:26 | 70K | |
![[IMG]](/icons/image2.gif) | 1613155791Social Squ..> | 2021-02-12 18:49 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1613155968Copy of Em..> | 2021-02-12 18:52 | 101K | |
![[IMG]](/icons/image2.gif) | 1613221353logo-01-br..> | 2021-02-13 13:02 | 57K | |
![[IMG]](/icons/image2.gif) | 1613222221logo-words..> | 2021-02-13 13:17 | 45K | |
![[IMG]](/icons/image2.gif) | 1613235344image0(1)...> | 2021-02-13 16:55 | 45K | |
![[IMG]](/icons/image2.gif) | 1613255971LOGO.png | 2021-02-13 22:39 | 37K | |
![[IMG]](/icons/image2.gif) | 1613344012Market Wag..> | 2021-02-14 23:06 | 111K | |
![[IMG]](/icons/image2.gif) | 1613410520Logo.jpg | 2021-02-15 17:35 | 24K | |
![[IMG]](/icons/image2.gif) | 1613414505wee logo w..> | 2021-02-15 18:41 | 62K | |
![[IMG]](/icons/image2.gif) | 1613496333bluelogo3-..> | 2021-02-16 17:25 | 148K | |
![[IMG]](/icons/image2.gif) | 1613497234Todd & Tra..> | 2021-02-16 17:40 | 106K | |
![[IMG]](/icons/image2.gif) | 1613573756logo_trans..> | 2021-02-17 14:55 | 170K | |
![[IMG]](/icons/image2.gif) | 1613589087DEF Logo.png | 2021-02-17 19:11 | 40K | |
![[IMG]](/icons/image2.gif) | 1613601896Social Med..> | 2021-02-17 22:44 | 303K | |
![[IMG]](/icons/image2.gif) | 1613684400PTCC LOGO.jpg | 2021-02-18 21:40 | 93K | |
![[IMG]](/icons/image2.gif) | 1613684673PTCC LOGO.jpg | 2021-02-18 21:44 | 93K | |
![[IMG]](/icons/image2.gif) | 1613697208IMG_9844.JPG | 2021-02-19 01:13 | 477K | |
![[IMG]](/icons/image2.gif) | 1613697240fam.png | 2021-02-19 01:14 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1613697271IMG_9854.JPG | 2021-02-19 01:14 | 466K | |
![[IMG]](/icons/image2.gif) | 1613750379unnamed.png | 2021-02-19 15:59 | 20K | |
![[IMG]](/icons/image2.gif) | 1613750389unnamed.png | 2021-02-19 15:59 | 20K | |
![[IMG]](/icons/image2.gif) | 1613757680jeff&angie..> | 2021-02-19 18:01 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1613759211judes-logo..> | 2021-02-19 18:26 | 61K | |
![[IMG]](/icons/image2.gif) | 1613769959HH-Logo-Sq..> | 2021-02-19 21:25 | 209K | |
![[IMG]](/icons/image2.gif) | 1613827713IMG_202009..> | 2021-02-20 13:28 | 714K | |
![[IMG]](/icons/image2.gif) | 1613845405Antler.png | 2021-02-20 18:23 | 81K | |
![[IMG]](/icons/image2.gif) | 1613845454Antler.png | 2021-02-20 18:24 | 81K | |
![[IMG]](/icons/image2.gif) | 1613881829Logo.png | 2021-02-21 04:30 | 87K | |
![[IMG]](/icons/image2.gif) | 1613881845Logo.png | 2021-02-21 04:30 | 87K | |
![[IMG]](/icons/image2.gif) | 1613882142Logo for m..> | 2021-02-21 04:35 | 233K | |
![[IMG]](/icons/image2.gif) | 1613882150Logo for m..> | 2021-02-21 04:35 | 233K | |
![[IMG]](/icons/image2.gif) | 1613882742Logo for m..> | 2021-02-21 04:45 | 301K | |
![[IMG]](/icons/image2.gif) | 1613882871Logo for m..> | 2021-02-21 04:47 | 249K | |
![[IMG]](/icons/image2.gif) | 1613885440D0FCA47E-A..> | 2021-02-21 05:30 | 225K | |
![[IMG]](/icons/image2.gif) | 1613922271Logo.jpg | 2021-02-21 15:44 | 42K | |
![[IMG]](/icons/image2.gif) | 1613949581microgreen..> | 2021-02-21 23:19 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1613956466Helios Gra..> | 2021-02-22 01:14 | 12K | |
![[IMG]](/icons/image2.gif) | 1613962841minestream..> | 2021-02-22 03:00 | 166K | |
![[IMG]](/icons/image2.gif) | 1614003662lilyvalley..> | 2021-02-22 14:21 | 84K | |
![[IMG]](/icons/image2.gif) | 1614011803DeepEarth.png | 2021-02-22 16:36 | 68K | |
![[IMG]](/icons/image2.gif) | 1614011971DEF Logo C..> | 2021-02-22 16:39 | 157K | |
![[IMG]](/icons/image2.gif) | 1614013125DEF Logo C..> | 2021-02-22 16:58 | 137K | |
![[IMG]](/icons/image2.gif) | 1614013269DEF Logo C..> | 2021-02-22 17:01 | 106K | |
![[IMG]](/icons/image2.gif) | 1614013572DEF Logo C..> | 2021-02-22 17:06 | 105K | |
![[IMG]](/icons/image2.gif) | 1614014120DEF Logo C..> | 2021-02-22 17:15 | 300K | |
![[IMG]](/icons/image2.gif) | 1614014251DEF Logo C..> | 2021-02-22 17:17 | 157K | |
![[IMG]](/icons/image2.gif) | 1614029435result_160..> | 2021-02-22 21:30 | 459K | |
![[IMG]](/icons/image2.gif) | 1614040169BPC - LOGO..> | 2021-02-23 00:29 | 906K | |
![[IMG]](/icons/image2.gif) | 1614050651Lakeside W..> | 2021-02-23 03:24 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1614050857Lakeside W..> | 2021-02-23 03:27 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1614093573sister of ..> | 2021-02-23 15:19 | 446K | |
![[IMG]](/icons/image2.gif) | 1614102210ChickadeeS..> | 2021-02-23 17:43 | 48K | |
![[IMG]](/icons/image2.gif) | 1614103076unnamed.png | 2021-02-23 17:57 | 127K | |
![[IMG]](/icons/image2.gif) | 1614105075LOGO.jpg | 2021-02-23 18:31 | 7.8K | |
![[IMG]](/icons/image2.gif) | 1614105146LOGO.jpg | 2021-02-23 18:32 | 7.8K | |
![[IMG]](/icons/image2.gif) | 1614109782Spring Wat..> | 2021-02-23 19:49 | 10K | |
![[IMG]](/icons/image2.gif) | 1614113487Image_1.JPG | 2021-02-23 20:51 | 166K | |
![[IMG]](/icons/image2.gif) | 1614116290MTYV7162.JPG | 2021-02-23 21:38 | 27K | |
![[IMG]](/icons/image2.gif) | 1614117635bwgetmomuf..> | 2021-02-23 22:00 | 56K | |
![[IMG]](/icons/image2.gif) | 1614122882No circle2..> | 2021-02-23 23:28 | 51K | |
![[IMG]](/icons/image2.gif) | 1614127456Bristolwoo..> | 2021-02-24 00:44 | 605K | |
![[IMG]](/icons/image2.gif) | 1614127496Bristolwoo..> | 2021-02-24 00:44 | 598K | |
![[IMG]](/icons/image2.gif) | 1614127515Bristolwoo..> | 2021-02-24 00:45 | 598K | |
![[IMG]](/icons/image2.gif) | 1614137389Textured_L..> | 2021-02-24 03:29 | 548K | |
![[IMG]](/icons/image2.gif) | 1614180305Circle log..> | 2021-02-24 15:25 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1614183394pretzel pi..> | 2021-02-24 16:16 | 217K | |
![[IMG]](/icons/image2.gif) | 1614184054shadycreek..> | 2021-02-24 16:27 | 831K | |
![[IMG]](/icons/image2.gif) | 1614185099F6FD2EC0-6..> | 2021-02-24 16:44 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1614186183IMG_4609.jpeg | 2021-02-24 17:03 | 73K | |
![[IMG]](/icons/image2.gif) | 1614187514IMG_4614.jpeg | 2021-02-24 17:25 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1614192418CFBB6F1E-0..> | 2021-02-24 18:46 | 109K | |
![[IMG]](/icons/image2.gif) | 1614200431CHATEAU-LA..> | 2021-02-24 21:00 | 790K | |
![[IMG]](/icons/image2.gif) | 1614200770Logo Profi..> | 2021-02-24 21:06 | 56K | |
![[IMG]](/icons/image2.gif) | 1614200998Market-Log..> | 2021-02-24 21:09 | 2.7K | |
![[IMG]](/icons/image2.gif) | 1614201048Memoirs bu..> | 2021-02-24 21:10 | 393K | |
![[IMG]](/icons/image2.gif) | 1614201091Market-log..> | 2021-02-24 21:11 | 6.5K | |
![[IMG]](/icons/image2.gif) | 1614203052CHATEAULAG..> | 2021-02-24 21:44 | 65K | |
![[IMG]](/icons/image2.gif) | 1614203092CHATEAU-LA..> | 2021-02-24 21:44 | 790K | |
![[IMG]](/icons/image2.gif) | 1614209046HistoricPe..> | 2021-02-24 23:24 | 233K | |
![[IMG]](/icons/image2.gif) | 1614216902logo.jpg | 2021-02-25 01:35 | 772K | |
![[IMG]](/icons/image2.gif) | 1614254398farmerbruc..> | 2021-02-25 11:59 | 230K | |
![[IMG]](/icons/image2.gif) | 1614259718Spring Wat..> | 2021-02-25 13:28 | 10K | |
![[IMG]](/icons/image2.gif) | 1614260762PHblue.png | 2021-02-25 13:46 | 155K | |
![[IMG]](/icons/image2.gif) | 1614263873No circle.jpg | 2021-02-25 14:37 | 68K | |
![[IMG]](/icons/image2.gif) | 1614265440Gluten Fre..> | 2021-02-25 15:04 | 24K | |
![[IMG]](/icons/image2.gif) | 1614267591SouthwindS..> | 2021-02-25 15:39 | 57K | |
![[IMG]](/icons/image2.gif) | 1614268368pic1.jpg | 2021-02-25 15:52 | 386K | |
![[IMG]](/icons/image2.gif) | 1614274816Dark Logo ..> | 2021-02-25 17:40 | 178K | |
![[IMG]](/icons/image2.gif) | 1614276612Wall Stree..> | 2021-02-25 18:10 | 23K | |
![[IMG]](/icons/image2.gif) | 1614277379AdAstraMar..> | 2021-02-25 18:22 | 816K | |
![[IMG]](/icons/image2.gif) | 1614277698JCF_Tshirt..> | 2021-02-25 18:28 | 379K | |
![[IMG]](/icons/image2.gif) | 1614279417skyland.jpg | 2021-02-25 18:56 | 539K | |
![[IMG]](/icons/image2.gif) | 1614279426skyland.jpg | 2021-02-25 18:57 | 539K | |
![[IMG]](/icons/image2.gif) | 1614280860Wall-Stree..> | 2021-02-25 19:21 | 153K | |
![[IMG]](/icons/image2.gif) | 1614280869Wall-Stree..> | 2021-02-25 19:21 | 153K | |
![[IMG]](/icons/image2.gif) | 1614283998MIDWEST SP..> | 2021-02-25 20:13 | 32K | |
![[IMG]](/icons/image2.gif) | 1614305264Screen Sho..> | 2021-02-26 02:07 | 167K | |
![[IMG]](/icons/image2.gif) | 1614305336DeepEarth.png | 2021-02-26 02:08 | 68K | |
![[IMG]](/icons/image2.gif) | 1614305369DeepEarth.jpg | 2021-02-26 02:09 | 154K | |
![[IMG]](/icons/image2.gif) | 1614305391DeepEarth.png | 2021-02-26 02:09 | 68K | |
![[IMG]](/icons/image2.gif) | 1614305427DEF Logo C..> | 2021-02-26 02:10 | 157K | |
![[IMG]](/icons/image2.gif) | 1614305483Deep Earth..> | 2021-02-26 02:11 | 164K | |
![[IMG]](/icons/image2.gif) | 1614305524DEF Logo C..> | 2021-02-26 02:12 | 157K | |
![[IMG]](/icons/image2.gif) | 1614305713DEF Logo C..> | 2021-02-26 02:15 | 105K | |
![[IMG]](/icons/image2.gif) | 1614306000DEF Logo C..> | 2021-02-26 02:20 | 105K | |
![[IMG]](/icons/image2.gif) | 1614306025DEF Logo C..> | 2021-02-26 02:20 | 105K | |
![[IMG]](/icons/image2.gif) | 1614306050DEF Logo C..> | 2021-02-26 02:20 | 157K | |
![[IMG]](/icons/image2.gif) | 1614370375IMG_3166.jpg | 2021-02-26 20:12 | 621K | |
![[IMG]](/icons/image2.gif) | 1614373150HRC logo.jpeg | 2021-02-26 20:59 | 69K | |
![[IMG]](/icons/image2.gif) | 1614384756Logo 2020.png | 2021-02-27 00:12 | 106K | |
![[IMG]](/icons/image2.gif) | 1614388909Gracefully..> | 2021-02-27 01:21 | 40K | |
![[IMG]](/icons/image2.gif) | 1614390458Helios Log..> | 2021-02-27 01:47 | 138K | |
![[IMG]](/icons/image2.gif) | 1614396620LinkedIn C..> | 2021-02-27 03:30 | 87K | |
![[IMG]](/icons/image2.gif) | 1614443351Shady Cree..> | 2021-02-27 16:29 | 70K | |
![[IMG]](/icons/image2.gif) | 1614444250Coffee wit..> | 2021-02-27 16:44 | 496K | |
![[IMG]](/icons/image2.gif) | 1614444712Banner wit..> | 2021-02-27 16:51 | 64K | |
![[IMG]](/icons/image2.gif) | 1614444876Stoneridge..> | 2021-02-27 16:54 | 111K | |
![[IMG]](/icons/image2.gif) | 1614526698logo.jpg | 2021-02-28 15:38 | 34K | |
![[IMG]](/icons/image2.gif) | 1614603261NCC_400x.png | 2021-03-01 12:54 | 13K | |
![[IMG]](/icons/image2.gif) | 1614609525Pietrzyk P..> | 2021-03-01 14:38 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1614612363Spring Wat..> | 2021-03-01 15:26 | 22K | |
![[IMG]](/icons/image2.gif) | 1614616620Lucky Elix..> | 2021-03-01 16:37 | 59K | |
![[IMG]](/icons/image2.gif) | 1614618538LE Logo - ..> | 2021-03-01 17:08 | 67K | |
![[IMG]](/icons/image2.gif) | 1614618762LE Logo - ..> | 2021-03-01 17:12 | 93K | |
![[IMG]](/icons/image2.gif) | 1614618772LE Logo - ..> | 2021-03-01 17:12 | 93K | |
![[IMG]](/icons/image2.gif) | 1614621648so logo.jpg | 2021-03-01 18:00 | 227K | |
![[IMG]](/icons/image2.gif) | 1614636731facebook.jpg | 2021-03-01 22:12 | 175K | |
![[IMG]](/icons/image2.gif) | 1614664504GREEN-05.png | 2021-03-02 05:55 | 90K | |
![[IMG]](/icons/image2.gif) | 1614696365Bellisaris..> | 2021-03-02 14:46 | 22K | |
![[IMG]](/icons/image2.gif) | 1614698768Screen Sho..> | 2021-03-02 15:26 | 171K | |
![[IMG]](/icons/image2.gif) | 1614701274SLAP Farms..> | 2021-03-02 16:07 | 76K | |
![[IMG]](/icons/image2.gif) | 1614707764paradisesn..> | 2021-03-02 17:56 | 9.1K | |
![[IMG]](/icons/image2.gif) | 1614721956IMG_4764.jpg | 2021-03-02 21:52 | 493K | |
![[IMG]](/icons/image2.gif) | 1614734468Goldens No..> | 2021-03-03 01:21 | 195K | |
![[IMG]](/icons/image2.gif) | 1614738636'Nola FB C..> | 2021-03-03 02:30 | 199K | |
![[IMG]](/icons/image2.gif) | 1614785487New.T&M Lo..> | 2021-03-03 15:31 | 177K | |
![[IMG]](/icons/image2.gif) | 1614814022C90F5B8D-9..> | 2021-03-03 23:27 | 387K | |
![[IMG]](/icons/image2.gif) | 1614865826Logo.jpg | 2021-03-04 13:50 | 11K | |
![[IMG]](/icons/image2.gif) | 1614871255TeaWithTif..> | 2021-03-04 15:20 | 342K | |
![[IMG]](/icons/image2.gif) | 1614871272TeaWithTif..> | 2021-03-04 15:21 | 342K | |
![[IMG]](/icons/image2.gif) | 1614891389Teffola_Lo..> | 2021-03-04 20:56 | 48K | |
![[IMG]](/icons/image2.gif) | 1614891583MMD.png | 2021-03-04 20:59 | 52K | |
![[IMG]](/icons/image2.gif) | 1614963629IMG_7590.jpg | 2021-03-05 17:00 | 85K | |
![[IMG]](/icons/image2.gif) | 1615048883MHV Logo.png | 2021-03-06 16:41 | 8.0K | |
![[IMG]](/icons/image2.gif) | 1615048917MHV Logo.png | 2021-03-06 16:41 | 8.0K | |
![[IMG]](/icons/image2.gif) | 1615081141Screenshot..> | 2021-03-07 01:39 | 246K | |
![[IMG]](/icons/image2.gif) | 1615081207Screenshot..> | 2021-03-07 01:40 | 94K | |
![[IMG]](/icons/image2.gif) | 1615081220Screenshot..> | 2021-03-07 01:40 | 94K | |
![[IMG]](/icons/image2.gif) | 1615082997Wet_Knot_P..> | 2021-03-07 02:09 | 513K | |
![[IMG]](/icons/image2.gif) | 1615137136firefly ri..> | 2021-03-07 17:12 | 729K | |
![[IMG]](/icons/image2.gif) | 1615213852New small...> | 2021-03-08 14:30 | 8.2K | |
![[IMG]](/icons/image2.gif) | 1615214444New small...> | 2021-03-08 14:40 | 96K | |
![[IMG]](/icons/image2.gif) | 1615221412Mom and Da..> | 2021-03-08 16:36 | 181K | |
![[IMG]](/icons/image2.gif) | 1615226493Circle Log..> | 2021-03-08 18:01 | 181K | |
![[IMG]](/icons/image2.gif) | 1615226507Cows on gr..> | 2021-03-08 18:01 | 914K | |
![[IMG]](/icons/image2.gif) | 1615230212B&W.jpg | 2021-03-08 19:03 | 19K | |
![[IMG]](/icons/image2.gif) | 1615243820DSC_0038.jpg | 2021-03-08 22:50 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1615243983DSC_0001.jpg | 2021-03-08 22:53 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1615253094AFFEF24B-2..> | 2021-03-09 01:24 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1615257461JPEG Slaug..> | 2021-03-09 02:37 | 470K | |
![[IMG]](/icons/image2.gif) | 1615301770MCF Logo.jpg | 2021-03-09 14:56 | 19K | |
![[IMG]](/icons/image2.gif) | 1615302467IMG_202101..> | 2021-03-09 15:07 | 252K | |
![[IMG]](/icons/image2.gif) | 1615302605Farmstead ..> | 2021-03-09 15:10 | 71K | |
![[IMG]](/icons/image2.gif) | 1615307623farm logo ..> | 2021-03-09 16:33 | 152K | |
![[IMG]](/icons/image2.gif) | 1615311332Logo-Desig..> | 2021-03-09 17:35 | 29K | |
![[IMG]](/icons/image2.gif) | 1615316126Valor-Aqua..> | 2021-03-09 18:55 | 232K | |
![[IMG]](/icons/image2.gif) | 1615320945Logo.jpg | 2021-03-09 20:15 | 26K | |
![[IMG]](/icons/image2.gif) | 1615322190pinkmagnol..> | 2021-03-09 20:36 | 100K | |
![[IMG]](/icons/image2.gif) | 1615325472PPD logo.jpg | 2021-03-09 21:31 | 4.6K | |
![[IMG]](/icons/image2.gif) | 1615326561F91A25B2-B..> | 2021-03-09 21:49 | 91K | |
![[IMG]](/icons/image2.gif) | 1615394359Amy Head s..> | 2021-03-10 16:39 | 888K | |
![[IMG]](/icons/image2.gif) | 1615402235HV Logo-01..> | 2021-03-10 18:50 | 93K | |
![[IMG]](/icons/image2.gif) | 1615410267iVIVA fina..> | 2021-03-10 21:04 | 22K | |
![[IMG]](/icons/image2.gif) | 1615410405RenderedIm..> | 2021-03-10 21:06 | 768K | |
![[IMG]](/icons/image2.gif) | 1615413920Original o..> | 2021-03-10 22:05 | 811K | |
![[IMG]](/icons/image2.gif) | 1615424145Fifty-Four..> | 2021-03-11 00:55 | 44K | |
![[IMG]](/icons/image2.gif) | 1615487502CRO_logo.jpg | 2021-03-11 18:31 | 59K | |
![[IMG]](/icons/image2.gif) | 1615490290our logo ..> | 2021-03-11 19:18 | 161K | |
![[IMG]](/icons/image2.gif) | 1615504308New Logo.png | 2021-03-11 23:11 | 93K | |
![[IMG]](/icons/image2.gif) | 1615511758new logo w..> | 2021-03-12 01:15 | 75K | |
![[IMG]](/icons/image2.gif) | 1615570534received_2..> | 2021-03-12 17:35 | 47K | |
![[IMG]](/icons/image2.gif) | 1615570730received_2..> | 2021-03-12 17:38 | 47K | |
![[IMG]](/icons/image2.gif) | 1615573065ENCORE400.png | 2021-03-12 18:17 | 53K | |
![[IMG]](/icons/image2.gif) | 1615573616elijojo_lo..> | 2021-03-12 18:26 | 170K | |
![[IMG]](/icons/image2.gif) | 1615586236elijojo_lo..> | 2021-03-12 21:57 | 170K | |
![[IMG]](/icons/image2.gif) | 1615654888Screen Sho..> | 2021-03-13 17:01 | 137K | |
![[IMG]](/icons/image2.gif) | 1615655111Card_Sweet..> | 2021-03-13 17:05 | 136K | |
![[IMG]](/icons/image2.gif) | 1615685727preview (1..> | 2021-03-14 01:35 | 7.4K | |
![[IMG]](/icons/image2.gif) | 1615687661sincerely ..> | 2021-03-14 02:07 | 390K | |
![[IMG]](/icons/image2.gif) | 1615687664sincerely ..> | 2021-03-14 02:07 | 390K | |
![[IMG]](/icons/image2.gif) | 1615687852IMG_2871.jpg | 2021-03-14 02:10 | 73K | |
![[IMG]](/icons/image2.gif) | 1615688232Sincerly_S..> | 2021-03-14 02:17 | 16K | |
![[IMG]](/icons/image2.gif) | 1615736911FERMENTI A..> | 2021-03-14 15:48 | 382K | |
![[IMG]](/icons/image2.gif) | 1615744876Logo2.png | 2021-03-14 18:01 | 149K | |
![[IMG]](/icons/image2.gif) | 1615818784Foothills ..> | 2021-03-15 14:33 | 72K | |
![[IMG]](/icons/image2.gif) | 1615822289IMG_0244.JPG | 2021-03-15 15:31 | 917K | |
![[IMG]](/icons/image2.gif) | 1615829426HGH Logo F..> | 2021-03-15 17:30 | 180K | |
![[IMG]](/icons/image2.gif) | 1615830678HGH Logo F..> | 2021-03-15 17:51 | 180K | |
![[IMG]](/icons/image2.gif) | 1615839257BG Logo (..> | 2021-03-15 20:14 | 165K | |
![[IMG]](/icons/image2.gif) | 1615899724AD40711A-8..> | 2021-03-16 13:02 | 586K | |
![[IMG]](/icons/image2.gif) | 1615902778F48EA2C7-0..> | 2021-03-16 13:52 | 526K | |
![[IMG]](/icons/image2.gif) | 1615902829F48EA2C7-0..> | 2021-03-16 13:53 | 526K | |
![[IMG]](/icons/image2.gif) | 1615906440fbLogo.jpg | 2021-03-16 14:54 | 33K | |
![[IMG]](/icons/image2.gif) | 1615925962DBC71DF2-7..> | 2021-03-16 20:19 | 95K | |
![[IMG]](/icons/image2.gif) | 1615932805Logo_Final..> | 2021-03-16 22:13 | 77K | |
![[IMG]](/icons/image2.gif) | 1615932829Logo_Final..> | 2021-03-16 22:13 | 77K | |
![[IMG]](/icons/image2.gif) | 1615933237Logo_Final..> | 2021-03-16 22:20 | 53K | |
![[IMG]](/icons/image2.gif) | 1615933273Logo_Final..> | 2021-03-16 22:21 | 53K | |
![[IMG]](/icons/image2.gif) | 1615933318Screen Sho..> | 2021-03-16 22:21 | 760K | |
![[IMG]](/icons/image2.gif) | 1615933441Screen Sho..> | 2021-03-16 22:24 | 291K | |
![[IMG]](/icons/image2.gif) | 1615933454Screen Sho..> | 2021-03-16 22:24 | 291K | |
![[IMG]](/icons/image2.gif) | 1615938794Group-NEW.jpg | 2021-03-16 23:53 | 633K | |
![[IMG]](/icons/image2.gif) | 1615941735Sawyer Nat..> | 2021-03-17 00:42 | 23K | |
![[IMG]](/icons/image2.gif) | 1615944898LOGO - OR ..> | 2021-03-17 01:34 | 387K | |
![[IMG]](/icons/image2.gif) | 1615988801DSC_0081 (..> | 2021-03-17 13:46 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1616006134ATFlogo3C-..> | 2021-03-17 18:35 | 104K | |
![[IMG]](/icons/image2.gif) | 1616011629PPD logo.jpg | 2021-03-17 20:07 | 4.6K | |
![[IMG]](/icons/image2.gif) | 1616074761Largelogo.jpg | 2021-03-18 13:39 | 82K | |
![[IMG]](/icons/image2.gif) | 1616079489A2F89D71-3..> | 2021-03-18 14:58 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1616079986Final File..> | 2021-03-18 15:06 | 300K | |
![[IMG]](/icons/image2.gif) | 1616083493giddy Wiza..> | 2021-03-18 16:04 | 102K | |
![[IMG]](/icons/image2.gif) | 1616086094ph_border_..> | 2021-03-18 16:48 | 64K | |
![[IMG]](/icons/image2.gif) | 1616099394Island Nut..> | 2021-03-18 20:29 | 110K | |
![[IMG]](/icons/image2.gif) | 1616106474Beachery.jpg | 2021-03-18 22:27 | 587K | |
![[IMG]](/icons/image2.gif) | 1616108578B square.jpg | 2021-03-18 23:02 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1616120657barn.jpg | 2021-03-19 02:24 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1616167659Dorothy's ..> | 2021-03-19 15:27 | 18K | |
![[IMG]](/icons/image2.gif) | 1616293756ATFlogo3C-..> | 2021-03-21 02:29 | 28K | |
![[IMG]](/icons/image2.gif) | 1616337545FE56BE8D-A..> | 2021-03-21 14:39 | 259K | |
![[IMG]](/icons/image2.gif) | 1616337682DF6A590C-D..> | 2021-03-21 14:41 | 308K | |
![[IMG]](/icons/image2.gif) | 1616361215Meier-Bach..> | 2021-03-21 21:13 | 477K | |
![[IMG]](/icons/image2.gif) | 1616366067logo_circl..> | 2021-03-21 22:34 | 73K | |
![[IMG]](/icons/image2.gif) | 1616368112Logo_SlotO..> | 2021-03-21 23:08 | 804K | |
![[IMG]](/icons/image2.gif) | 1616428702ATFicon-20..> | 2021-03-22 15:58 | 3.1K | |
![[IMG]](/icons/image2.gif) | 1616428757ATFicon3C.png | 2021-03-22 15:59 | 6.7K | |
![[IMG]](/icons/image2.gif) | 1616454624fullsizeou..> | 2021-03-22 23:10 | 94K | |
![[IMG]](/icons/image2.gif) | 1616462233C07C7108-F..> | 2021-03-23 01:17 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1616465442cauldron4c..> | 2021-03-23 02:10 | 47K | |
![[IMG]](/icons/image2.gif) | 1616503345AC3CBD8B-5..> | 2021-03-23 12:42 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1616503436AC3CBD8B-5..> | 2021-03-23 12:43 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1616509031Yang_Yin_O..> | 2021-03-23 14:17 | 8.8K | |
![[IMG]](/icons/image2.gif) | 1616509086Yang_Yin_O..> | 2021-03-23 14:18 | 24K | |
![[IMG]](/icons/image2.gif) | 1616519997PizzaParm-..> | 2021-03-23 17:19 | 42K | |
![[IMG]](/icons/image2.gif) | 1616522508CC-web-log..> | 2021-03-23 18:01 | 32K | |
![[IMG]](/icons/image2.gif) | 1616522517bee kind.jpg | 2021-03-23 18:01 | 57K | |
![[IMG]](/icons/image2.gif) | 1616523876IMG_2803_2..> | 2021-03-23 18:24 | 309K | |
![[IMG]](/icons/image2.gif) | 1616523902FB_IMG_157..> | 2021-03-23 18:25 | 100K | |
![[IMG]](/icons/image2.gif) | 1616534562IMG_3275 c..> | 2021-03-23 21:22 | 134K | |
![[IMG]](/icons/image2.gif) | 1616550707Untitled d..> | 2021-03-24 01:51 | 219K | |
![[IMG]](/icons/image2.gif) | 1616587637IMG_202103..> | 2021-03-24 12:07 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1616593240DWC_Logo(2..> | 2021-03-24 13:40 | 224K | |
![[IMG]](/icons/image2.gif) | 1616593312DWC_Logo(2..> | 2021-03-24 13:41 | 224K | |
![[IMG]](/icons/image2.gif) | 1616606476BE768720-5..> | 2021-03-24 17:21 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1616606911Joe.jpg | 2021-03-24 17:28 | 25K | |
![[IMG]](/icons/image2.gif) | 1616609772PGF-Final-..> | 2021-03-24 18:16 | 40K | |
![[IMG]](/icons/image2.gif) | 1616611338IMG_7404_M..> | 2021-03-24 18:42 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1616636868Holiday ca..> | 2021-03-25 01:47 | 742K | |
![[IMG]](/icons/image2.gif) | 1616680194image.png | 2021-03-25 13:49 | 273K | |
![[IMG]](/icons/image2.gif) | 1616701871MMF2020-fa..> | 2021-03-25 19:51 | 560K | |
![[IMG]](/icons/image2.gif) | 1616704381Final RF L..> | 2021-03-25 20:33 | 87K | |
![[IMG]](/icons/image2.gif) | 1616718827Cultivate-..> | 2021-03-26 00:33 | 232K | |
![[IMG]](/icons/image2.gif) | 1616719208Cultivate-..> | 2021-03-26 00:40 | 232K | |
![[IMG]](/icons/image2.gif) | 1616778341Dirt Road ..> | 2021-03-26 17:05 | 793K | |
![[IMG]](/icons/image2.gif) | 1616781103mouzin-bro..> | 2021-03-26 17:51 | 7.5K | |
![[IMG]](/icons/image2.gif) | 1616784979MangoMan f..> | 2021-03-26 18:56 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1616787078Secondary ..> | 2021-03-26 19:31 | 43K | |
![[IMG]](/icons/image2.gif) | 1616787088Secondary ..> | 2021-03-26 19:31 | 43K | |
![[IMG]](/icons/image2.gif) | 1616854530CLGlogo.jpg | 2021-03-27 14:15 | 4.5K | |
![[IMG]](/icons/image2.gif) | 1616892726MYLK-AND-H..> | 2021-03-28 00:52 | 17K | |
![[IMG]](/icons/image2.gif) | 1616962237Robinson H..> | 2021-03-28 20:10 | 746K | |
![[IMG]](/icons/image2.gif) | 1617028124logo.png | 2021-03-29 14:28 | 14K | |
![[IMG]](/icons/image2.gif) | 1617064414NEW Nate's..> | 2021-03-30 00:33 | 65K | |
![[IMG]](/icons/image2.gif) | 1617067902PXL_202010..> | 2021-03-30 01:31 | 47K | |
![[IMG]](/icons/image2.gif) | 1617070115Cookies1Li..> | 2021-03-30 02:08 | 596K | |
![[IMG]](/icons/image2.gif) | 1617070313European C..> | 2021-03-30 02:11 | 239K | |
![[IMG]](/icons/image2.gif) | 1617110759Full Logo.png | 2021-03-30 13:25 | 27K | |
![[IMG]](/icons/image2.gif) | 1617112756Logo Full ..> | 2021-03-30 13:59 | 393K | |
![[IMG]](/icons/image2.gif) | 1617136532Viewpoint ..> | 2021-03-30 20:35 | 59K | |
![[IMG]](/icons/image2.gif) | 1617208416Nature's P..> | 2021-03-31 16:33 | 37K | |
![[IMG]](/icons/image2.gif) | 1617239319ATFiconSqu..> | 2021-04-01 01:08 | 3.7K | |
![[IMG]](/icons/image2.gif) | 1617239365ATFiconSqu..> | 2021-04-01 01:09 | 3.7K | |
![[IMG]](/icons/image2.gif) | 1617239445ATFiconSqu..> | 2021-04-01 01:10 | 3.7K | |
![[IMG]](/icons/image2.gif) | 1617239688ATFiconBW.jpg | 2021-04-01 01:14 | 35K | |
![[IMG]](/icons/image2.gif) | 1617239700ATFiconSqu..> | 2021-04-01 01:15 | 3.7K | |
![[IMG]](/icons/image2.gif) | 1617239724ATFiconSqu..> | 2021-04-01 01:15 | 3.7K | |
![[IMG]](/icons/image2.gif) | 1617282985WhelpdaleL..> | 2021-04-01 13:16 | 34K | |
![[IMG]](/icons/image2.gif) | 1617290489LogoSmallJ..> | 2021-04-01 15:21 | 40K | |
![[IMG]](/icons/image2.gif) | 1617302004new transp..> | 2021-04-01 18:33 | 82K | |
![[IMG]](/icons/image2.gif) | 1617306582_1050330.jpg | 2021-04-01 19:49 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1617306714FB_IMG_161..> | 2021-04-01 19:51 | 10K | |
![[IMG]](/icons/image2.gif) | 1617313674earlybirdf..> | 2021-04-01 21:47 | 421K | |
![[IMG]](/icons/image2.gif) | 1617320521IMG_202103..> | 2021-04-01 23:42 | 22K | |
![[IMG]](/icons/image2.gif) | 1617364003Picture1.png | 2021-04-02 11:46 | 73K | |
![[IMG]](/icons/image2.gif) | 1617364290Logo small..> | 2021-04-02 11:51 | 21K | |
![[IMG]](/icons/image2.gif) | 1617364420Logo in mi..> | 2021-04-02 11:53 | 14K | |
![[IMG]](/icons/image2.gif) | 1617630995SteuryFarm..> | 2021-04-05 13:56 | 50K | |
![[IMG]](/icons/image2.gif) | 1617650252D6668C18-D..> | 2021-04-05 19:17 | 282K | |
![[IMG]](/icons/image2.gif) | 1617652003Purple and..> | 2021-04-05 19:46 | 230K | |
![[IMG]](/icons/image2.gif) | 1617658824logo.jpg | 2021-04-05 21:40 | 293K | |
![[IMG]](/icons/image2.gif) | 1617673466Screenshot..> | 2021-04-06 01:44 | 155K | |
![[IMG]](/icons/image2.gif) | 1617726264all tins (..> | 2021-04-06 16:24 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1617729417logo final..> | 2021-04-06 17:16 | 63K | |
![[IMG]](/icons/image2.gif) | 1617750832shirt4-1.png | 2021-04-06 23:13 | 341K | |
![[IMG]](/icons/image2.gif) | 1617821186IMG_0697.jpg | 2021-04-07 18:46 | 461K | |
![[IMG]](/icons/image2.gif) | 1617876568Capture+_2..> | 2021-04-08 10:09 | 387K | |
![[IMG]](/icons/image2.gif) | 1617902015[Original ..> | 2021-04-08 17:13 | 84K | |
![[IMG]](/icons/image2.gif) | 1617903607bluewallfa..> | 2021-04-08 17:40 | 472K | |
![[IMG]](/icons/image2.gif) | 1617903788A466FB8B-F..> | 2021-04-08 17:43 | 181K | |
![[IMG]](/icons/image2.gif) | 1617904453A466FB8B-F..> | 2021-04-08 17:54 | 181K | |
![[IMG]](/icons/image2.gif) | 1617904485A466FB8B-F..> | 2021-04-08 17:54 | 181K | |
![[IMG]](/icons/image2.gif) | 1617906571graceinsta..> | 2021-04-08 18:29 | 102K | |
![[IMG]](/icons/image2.gif) | 1617914694RJB_Logo_f..> | 2021-04-08 20:44 | 189K | |
![[IMG]](/icons/image2.gif) | 1617935071irie cup w..> | 2021-04-09 02:24 | 41K | |
![[IMG]](/icons/image2.gif) | 1617972315Rock house..> | 2021-04-09 12:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | 1617980567logo (1).png | 2021-04-09 15:02 | 63K | |
![[IMG]](/icons/image2.gif) | 1618001874vanilla lo..> | 2021-04-09 20:57 | 72K | |
![[IMG]](/icons/image2.gif) | 1618009801IMG_202104..> | 2021-04-09 23:10 | 30K | |
![[IMG]](/icons/image2.gif) | 1618061437Logo.png | 2021-04-10 13:30 | 4.2K | |
![[IMG]](/icons/image2.gif) | 1618085280print 3-10..> | 2021-04-10 20:08 | 724K | |
![[IMG]](/icons/image2.gif) | 1618111130exotic emp..> | 2021-04-11 03:18 | 58K | |
![[IMG]](/icons/image2.gif) | 1618111228for web-00..> | 2021-04-11 03:20 | 954K | |
![[IMG]](/icons/image2.gif) | 1618111283Main Logo-..> | 2021-04-11 03:21 | 166K | |
![[IMG]](/icons/image2.gif) | 1618160579UVFinal.jpg | 2021-04-11 17:02 | 680K | |
![[IMG]](/icons/image2.gif) | 1618228646Breeden's-..> | 2021-04-12 11:57 | 331K | |
![[IMG]](/icons/image2.gif) | 1618238913color.png | 2021-04-12 14:48 | 20K | |
![[IMG]](/icons/image2.gif) | 1618238926color.png | 2021-04-12 14:48 | 20K | |
![[IMG]](/icons/image2.gif) | 1618250418Blue and B..> | 2021-04-12 18:00 | 73K | |
![[IMG]](/icons/image2.gif) | 1618258945Branch Log..> | 2021-04-12 20:22 | 527K | |
![[IMG]](/icons/image2.gif) | 1618285982profile.jpg | 2021-04-13 03:53 | 155K | |
![[IMG]](/icons/image2.gif) | 1618329313colorstick..> | 2021-04-13 15:55 | 603K | |
![[IMG]](/icons/image2.gif) | 1618329426renfarm bi..> | 2021-04-13 15:57 | 25K | |
![[IMG]](/icons/image2.gif) | 1618331897Mixed Berr..> | 2021-04-13 16:38 | 22K | |
![[IMG]](/icons/image2.gif) | 1618342844image (3).jpg | 2021-04-13 19:40 | 22K | |
![[IMG]](/icons/image2.gif) | 1618350966New label ..> | 2021-04-13 21:56 | 176K | |
![[IMG]](/icons/image2.gif) | 1618351040new logo b..> | 2021-04-13 21:57 | 176K | |
![[IMG]](/icons/image2.gif) | 1618407309Stand and ..> | 2021-04-14 13:35 | 70K | |
![[IMG]](/icons/image2.gif) | 1618409533C04254F5-1..> | 2021-04-14 14:12 | 159K | |
![[IMG]](/icons/image2.gif) | 1618422986mainstreet..> | 2021-04-14 17:56 | 82K | |
![[IMG]](/icons/image2.gif) | 1618425269Summer han..> | 2021-04-14 18:34 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1618427183Remedy_Log..> | 2021-04-14 19:06 | 28K | |
![[IMG]](/icons/image2.gif) | 1618437635Iron Root ..> | 2021-04-14 22:00 | 120K | |
![[IMG]](/icons/image2.gif) | 1618488295IMG_202104..> | 2021-04-15 12:04 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1618488347IMG_202104..> | 2021-04-15 12:05 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1618491586rhythm-2.jpg | 2021-04-15 12:59 | 86K | |
![[IMG]](/icons/image2.gif) | 1618491597rhythm-2.jpg | 2021-04-15 12:59 | 86K | |
![[IMG]](/icons/image2.gif) | 1618491713rhythm-2-n..> | 2021-04-15 13:01 | 72K | |
![[IMG]](/icons/image2.gif) | 1618491719rhythm-2-n..> | 2021-04-15 13:01 | 72K | |
![[IMG]](/icons/image2.gif) | 1618498233LOGO.png | 2021-04-15 14:50 | 112K | |
![[IMG]](/icons/image2.gif) | 1618500989Screenshot..> | 2021-04-15 15:36 | 130K | |
![[IMG]](/icons/image2.gif) | 1618502882OG Banner ..> | 2021-04-15 16:08 | 715K | |
![[IMG]](/icons/image2.gif) | 1618513711IMG_202104..> | 2021-04-15 19:08 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1618517617Nates Logo..> | 2021-04-15 20:13 | 212K | |
![[IMG]](/icons/image2.gif) | 1618521105Prana Heal..> | 2021-04-15 21:11 | 738K | |
![[IMG]](/icons/image2.gif) | 1618530288D&B Farm a..> | 2021-04-15 23:44 | 447K | |
![[IMG]](/icons/image2.gif) | 1618532268noshbutter..> | 2021-04-16 00:17 | 38K | |
![[IMG]](/icons/image2.gif) | 1618583122Black Dist..> | 2021-04-16 14:25 | 19K | |
![[IMG]](/icons/image2.gif) | 1618586303Healthy Ha..> | 2021-04-16 15:18 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1618666458A925CF47-B..> | 2021-04-17 13:34 | 227K | |
![[IMG]](/icons/image2.gif) | 1618693389Flavorful ..> | 2021-04-17 21:03 | 175K | |
![[IMG]](/icons/image2.gif) | 1618693447Flavorful ..> | 2021-04-17 21:04 | 175K | |
![[IMG]](/icons/image2.gif) | 1618693462Flavorful ..> | 2021-04-17 21:04 | 175K | |
![[IMG]](/icons/image2.gif) | 1618700488CHERRY FAR..> | 2021-04-17 23:01 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1618708069CD1CD17C-A..> | 2021-04-18 01:07 | 337K | |
![[IMG]](/icons/image2.gif) | 1618839691PURSpicesL..> | 2021-04-19 13:41 | 23K | |
![[IMG]](/icons/image2.gif) | 1618839771PUR Spices..> | 2021-04-19 13:42 | 614K | |
![[IMG]](/icons/image2.gif) | 1618845208PowerPeppe..> | 2021-04-19 15:13 | 91K | |
![[IMG]](/icons/image2.gif) | 1618850001FA5127CD-C..> | 2021-04-19 16:33 | 154K | |
![[IMG]](/icons/image2.gif) | 1618851131Midwest_Sp..> | 2021-04-19 16:52 | 351K | |
![[IMG]](/icons/image2.gif) | 1618854099PowerPeppe..> | 2021-04-19 17:41 | 137K | |
![[IMG]](/icons/image2.gif) | 1618862573Kozy Korne..> | 2021-04-19 20:02 | 463K | |
![[IMG]](/icons/image2.gif) | 1618881247E0F7F112-8..> | 2021-04-20 01:14 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1618928324logo-coffe..> | 2021-04-20 14:18 | 11K | |
![[IMG]](/icons/image2.gif) | 1618930919IMG_5920.JPG | 2021-04-20 15:01 | 33K | |
![[IMG]](/icons/image2.gif) | 1618936046Pic of ELW..> | 2021-04-20 16:27 | 342K | |
![[IMG]](/icons/image2.gif) | 1618943129beeimage.jpg | 2021-04-20 18:25 | 160K | |
![[IMG]](/icons/image2.gif) | 1618943212beeimage.jpg | 2021-04-20 18:26 | 160K | |
![[IMG]](/icons/image2.gif) | 1618943459best queen..> | 2021-04-20 18:30 | 599K | |
![[IMG]](/icons/image2.gif) | 1618943473best queen..> | 2021-04-20 18:31 | 599K | |
![[IMG]](/icons/image2.gif) | 1618944736finalc.png | 2021-04-20 18:52 | 87K | |
![[IMG]](/icons/image2.gif) | 1618944889finalc.png | 2021-04-20 18:54 | 87K | |
![[IMG]](/icons/image2.gif) | 1618962702Screenshot..> | 2021-04-20 23:51 | 299K | |
![[IMG]](/icons/image2.gif) | 1618962705Screenshot..> | 2021-04-20 23:51 | 299K | |
![[IMG]](/icons/image2.gif) | 1618967925B9A86180-B..> | 2021-04-21 01:18 | 562K | |
![[IMG]](/icons/image2.gif) | 1618980956Baked with..> | 2021-04-21 04:55 | 43K | |
![[IMG]](/icons/image2.gif) | 1618982289Baked with..> | 2021-04-21 05:18 | 43K | |
![[IMG]](/icons/image2.gif) | 1619013014LadyRens l..> | 2021-04-21 13:50 | 84K | |
![[IMG]](/icons/image2.gif) | 1619017304Point Blur..> | 2021-04-21 15:01 | 281K | |
![[IMG]](/icons/image2.gif) | 1619021653Creole Tom..> | 2021-04-21 16:14 | 105K | |
![[IMG]](/icons/image2.gif) | 1619025742Big O' Str..> | 2021-04-21 17:22 | 124K | |
![[IMG]](/icons/image2.gif) | 1619029275CC9ED549-1..> | 2021-04-21 18:21 | 51K | |
![[IMG]](/icons/image2.gif) | 1619030936My Homeste..> | 2021-04-21 18:48 | 465K | |
![[IMG]](/icons/image2.gif) | 1619031065DHF Logo P..> | 2021-04-21 18:51 | 951K | |
![[IMG]](/icons/image2.gif) | 1619059443mason c1 i..> | 2021-04-22 02:44 | 326K | |
![[IMG]](/icons/image2.gif) | 1619089532IMG_202104..> | 2021-04-22 11:05 | 383K | |
![[IMG]](/icons/image2.gif) | 1619089542IMG_202104..> | 2021-04-22 11:05 | 383K | |
![[IMG]](/icons/image2.gif) | 1619093259logo.jpeg | 2021-04-22 12:07 | 85K | |
![[IMG]](/icons/image2.gif) | 1619107249HelloPieLo..> | 2021-04-22 16:00 | 69K | |
![[IMG]](/icons/image2.gif) | 1619171079Dream Chas..> | 2021-04-23 09:44 | 691K | |
![[IMG]](/icons/image2.gif) | 1619186043Logo for s..> | 2021-04-23 13:54 | 7.0K | |
![[IMG]](/icons/image2.gif) | 1619188313Root 42 Ha..> | 2021-04-23 14:31 | 30K | |
![[IMG]](/icons/image2.gif) | 1619190688bbkc2.jpg | 2021-04-23 15:11 | 13K | |
![[IMG]](/icons/image2.gif) | 1619193128hatmakerho..> | 2021-04-23 15:52 | 256K | |
![[IMG]](/icons/image2.gif) | 1619194721Root 42 Ha..> | 2021-04-23 16:18 | 54K | |
![[IMG]](/icons/image2.gif) | 1619194915greenhouse..> | 2021-04-23 16:21 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1619220951garden.jpg | 2021-04-23 23:35 | 617K | |
![[IMG]](/icons/image2.gif) | 1619290986WFHS Logo ..> | 2021-04-24 19:03 | 102K | |
![[IMG]](/icons/image2.gif) | 1619291106WFHS Logo ..> | 2021-04-24 19:05 | 104K | |
![[IMG]](/icons/image2.gif) | 1619310537large_thum..> | 2021-04-25 00:28 | 13K | |
![[IMG]](/icons/image2.gif) | 1619375569FINAL-Evan..> | 2021-04-25 18:32 | 59K | |
![[IMG]](/icons/image2.gif) | 1619376440IMG_1020.jpg | 2021-04-25 18:47 | 229K | |
![[IMG]](/icons/image2.gif) | 1619380212FINAL-Evan..> | 2021-04-25 19:50 | 59K | |
![[IMG]](/icons/image2.gif) | 1619386532Sweet Magn..> | 2021-04-25 21:35 | 38K | |
![[IMG]](/icons/image2.gif) | 1619441628IMG_1020.jpg | 2021-04-26 12:53 | 229K | |
![[IMG]](/icons/image2.gif) | 1619446335MLM.Logo.S..> | 2021-04-26 14:12 | 23K | |
![[IMG]](/icons/image2.gif) | 1619457944Hengleson ..> | 2021-04-26 17:25 | 20K | |
![[IMG]](/icons/image2.gif) | 1619459423Parker Far..> | 2021-04-26 17:50 | 103K | |
![[IMG]](/icons/image2.gif) | 1619462030IMG_3344.jpg | 2021-04-26 18:33 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1619473177DPF-logo-2..> | 2021-04-26 21:39 | 16K | |
![[IMG]](/icons/image2.gif) | 1619475221IMG_family..> | 2021-04-26 22:13 | 112K | |
![[IMG]](/icons/image2.gif) | 1619482149Logo.jpg | 2021-04-27 00:09 | 170K | |
![[IMG]](/icons/image2.gif) | 1619482685Logo.png | 2021-04-27 00:18 | 186K | |
![[IMG]](/icons/image2.gif) | 1619482826Centered L..> | 2021-04-27 00:20 | 120K | |
![[IMG]](/icons/image2.gif) | 1619483956source fil..> | 2021-04-27 00:39 | 431K | |
![[IMG]](/icons/image2.gif) | 1619489263RRF - new.png | 2021-04-27 02:07 | 37K | |
![[IMG]](/icons/image2.gif) | 1619497671logo-set a..> | 2021-04-27 04:27 | 119K | |
![[IMG]](/icons/image2.gif) | 1619517630Braid.png | 2021-04-27 10:00 | 50K | |
![[IMG]](/icons/image2.gif) | 1619535728webbslogo.jpg | 2021-04-27 15:02 | 345K | |
![[IMG]](/icons/image2.gif) | 1619540325IMG_0156.jpeg | 2021-04-27 16:18 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1619561474New Logo.T..> | 2021-04-27 22:11 | 26K | |
![[IMG]](/icons/image2.gif) | 1619573689New Logo.T..> | 2021-04-28 01:34 | 26K | |
![[IMG]](/icons/image2.gif) | 1619575578SCM.PNG | 2021-04-28 02:06 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1619615703profile im..> | 2021-04-28 13:15 | 93K | |
![[IMG]](/icons/image2.gif) | 1619631725E0EC7879-5..> | 2021-04-28 17:42 | 202K | |
![[IMG]](/icons/image2.gif) | 1619660298RiverTrail..> | 2021-04-29 01:38 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1619701191RiverTrail..> | 2021-04-29 12:59 | 149K | |
![[IMG]](/icons/image2.gif) | 1619701350RiverTrail..> | 2021-04-29 13:02 | 167K | |
![[IMG]](/icons/image2.gif) | 1619701371RiverTrail..> | 2021-04-29 13:02 | 155K | |
![[IMG]](/icons/image2.gif) | 1619701398Logo.PNG | 2021-04-29 13:03 | 227K | |
![[IMG]](/icons/image2.gif) | 1619701455RiverTrail..> | 2021-04-29 13:04 | 159K | |
![[IMG]](/icons/image2.gif) | 1619701522RiverTrail..> | 2021-04-29 13:05 | 149K | |
![[IMG]](/icons/image2.gif) | 1619701553RiverTrail..> | 2021-04-29 13:05 | 464K | |
![[IMG]](/icons/image2.gif) | 1619701578RiverTrail..> | 2021-04-29 13:06 | 149K | |
![[IMG]](/icons/image2.gif) | 1619713003Screenshot..> | 2021-04-29 16:16 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1619713436garfield c..> | 2021-04-29 16:23 | 11K | |
![[IMG]](/icons/image2.gif) | 1619713762Screenshot..> | 2021-04-29 16:29 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1619714220green whit..> | 2021-04-29 16:37 | 71K | |
![[IMG]](/icons/image2.gif) | 1619714848Bree Hive ..> | 2021-04-29 16:47 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1619716491custom8732..> | 2021-04-29 17:14 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1619725831MuggerZ1.png | 2021-04-29 19:50 | 185K | |
![[IMG]](/icons/image2.gif) | 1619796945Poppets Co..> | 2021-04-30 15:35 | 414K | |
![[IMG]](/icons/image2.gif) | 1619807241logo.png | 2021-04-30 18:27 | 139K | |
![[IMG]](/icons/image2.gif) | 1619819205A260957E-5..> | 2021-04-30 21:46 | 45K | |
![[IMG]](/icons/image2.gif) | 1619911814Farm logo.jpg | 2021-05-01 23:30 | 125K | |
![[IMG]](/icons/image2.gif) | 1619966509facebook-p..> | 2021-05-02 14:41 | 18K | |
![[IMG]](/icons/image2.gif) | 1619966521facebook-p..> | 2021-05-02 14:42 | 18K | |
![[IMG]](/icons/image2.gif) | 1619973584PicsArt_04..> | 2021-05-02 16:39 | 253K | |
![[IMG]](/icons/image2.gif) | 1619987402Raes Eggs.jpg | 2021-05-02 20:30 | 44K | |
![[IMG]](/icons/image2.gif) | 1620050660Copy of Lo..> | 2021-05-03 14:04 | 79K | |
![[IMG]](/icons/image2.gif) | 1620052065IMG_7085.jpg | 2021-05-03 14:27 | 88K | |
![[IMG]](/icons/image2.gif) | 1620053207Rocky Rive..> | 2021-05-03 14:46 | 306K | |
![[IMG]](/icons/image2.gif) | 1620055397Growing fo..> | 2021-05-03 15:23 | 7.0K | |
![[IMG]](/icons/image2.gif) | 1620069952Mommoms-Ba..> | 2021-05-03 19:25 | 406K | |
![[IMG]](/icons/image2.gif) | 1620071397IMG_8412.jpg | 2021-05-03 19:49 | 653K | |
![[IMG]](/icons/image2.gif) | 1620082745Nutty B_s-..> | 2021-05-03 22:59 | 194K | |
![[IMG]](/icons/image2.gif) | 1620083675dunx-origi..> | 2021-05-03 23:14 | 287K | |
![[IMG]](/icons/image2.gif) | 1620085202IMG_1369 (..> | 2021-05-03 23:40 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1620085871Copy of Ev..> | 2021-05-03 23:51 | 31K | |
![[IMG]](/icons/image2.gif) | 1620095005GGB Logo.png | 2021-05-04 02:23 | 229K | |
![[IMG]](/icons/image2.gif) | 1620134627NK.png | 2021-05-04 13:23 | 30K | |
![[IMG]](/icons/image2.gif) | 1620135414RB-BikeWhe..> | 2021-05-04 13:36 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1620139284C453F486-B..> | 2021-05-04 14:41 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1620142428pinchspice..> | 2021-05-04 15:33 | 300K | |
![[IMG]](/icons/image2.gif) | 1620143400Chicken si..> | 2021-05-04 15:50 | 865K | |
![[IMG]](/icons/image2.gif) | 1620151363logo-400.png | 2021-05-04 18:02 | 25K | |
![[IMG]](/icons/image2.gif) | 1620154297ready-set-..> | 2021-05-04 18:51 | 20K | |
![[IMG]](/icons/image2.gif) | 1620160617F869D5FE-9..> | 2021-05-04 20:36 | 73K | |
![[IMG]](/icons/image2.gif) | 1620168823ba6d8f91-4..> | 2021-05-04 22:53 | 771K | |
![[IMG]](/icons/image2.gif) | 1620175204simply jil..> | 2021-05-05 00:40 | 65K | |
![[IMG]](/icons/image2.gif) | 1620221246Logo-01.png | 2021-05-05 13:27 | 71K | |
![[IMG]](/icons/image2.gif) | 1620236474logo_white..> | 2021-05-05 17:41 | 0 | |
![[IMG]](/icons/image2.gif) | 1620236523logo_white..> | 2021-05-05 17:42 | 353K | |
![[IMG]](/icons/image2.gif) | 1620236527logo_white..> | 2021-05-05 17:42 | 353K | |
![[IMG]](/icons/image2.gif) | 1620240456ccf logo n..> | 2021-05-05 18:47 | 56K | |
![[IMG]](/icons/image2.gif) | 1620242412CircleBRan..> | 2021-05-05 19:20 | 20K | |
![[IMG]](/icons/image2.gif) | 1620244337FMF LOGO.jpg | 2021-05-05 19:52 | 33K | |
![[IMG]](/icons/image2.gif) | 1620245421BL_Logo_tr..> | 2021-05-05 20:10 | 0 | |
![[IMG]](/icons/image2.gif) | 1620264450red.jpg | 2021-05-06 01:27 | 594K | |
![[IMG]](/icons/image2.gif) | 1620267209BrownLogo.png | 2021-05-06 02:13 | 358K | |
![[IMG]](/icons/image2.gif) | 1620314621i-nzCjs2t-..> | 2021-05-06 15:23 | 78K | |
![[IMG]](/icons/image2.gif) | 1620322256WF_Logo_F.jpg | 2021-05-06 17:30 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1620322266WF_Logo_F.jpg | 2021-05-06 17:31 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1620322438LogoTanOrg..> | 2021-05-06 17:33 | 115K | |
![[IMG]](/icons/image2.gif) | 1620322489WF_Logo_F.png | 2021-05-06 17:34 | 89K | |
![[IMG]](/icons/image2.gif) | 1620322509WF_Logo_F.png | 2021-05-06 17:35 | 89K | |
![[IMG]](/icons/image2.gif) | 1620322578Waseda Far..> | 2021-05-06 17:36 | 13K | |
![[IMG]](/icons/image2.gif) | 1620322619WasedaTan.jpg | 2021-05-06 17:36 | 252K | |
![[IMG]](/icons/image2.gif) | 1620322779WF_Logo_F.png | 2021-05-06 17:39 | 89K | |
![[IMG]](/icons/image2.gif) | 1620325564WF_Logo_F...> | 2021-05-06 18:26 | 444K | |
![[IMG]](/icons/image2.gif) | 1620348656IMG_0277.jpg | 2021-05-07 00:50 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1620349117indigo new..> | 2021-05-07 00:58 | 197K | |
![[IMG]](/icons/image2.gif) | 1620350363Jellybean ..> | 2021-05-07 01:19 | 62K | |
![[IMG]](/icons/image2.gif) | 1620404023KOD B&W Lo..> | 2021-05-07 16:13 | 326K | |
![[IMG]](/icons/image2.gif) | 1620418250Smaller lo..> | 2021-05-07 20:10 | 242K | |
![[IMG]](/icons/image2.gif) | 1620478366chicken.jpg | 2021-05-08 12:52 | 187K | |
![[IMG]](/icons/image2.gif) | 1620509040EandM (2).jpg | 2021-05-08 21:24 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1620512712THF_LOGO_L..> | 2021-05-08 22:25 | 243K | |
![[IMG]](/icons/image2.gif) | 1620513169THF_LOGO_L..> | 2021-05-08 22:32 | 243K | |
![[IMG]](/icons/image2.gif) | 1620654469HCLogo.png | 2021-05-10 13:47 | 60K | |
![[IMG]](/icons/image2.gif) | 1620655161WM Logo.jpg | 2021-05-10 13:59 | 37K | |
![[IMG]](/icons/image2.gif) | 1620655247WM Logo Fi..> | 2021-05-10 14:00 | 88K | |
![[IMG]](/icons/image2.gif) | 1620658591FB-Profile..> | 2021-05-10 14:56 | 121K | |
![[IMG]](/icons/image2.gif) | 1620670211dogwood2 (..> | 2021-05-10 18:10 | 509K | |
![[IMG]](/icons/image2.gif) | 1620682471IMG_202105..> | 2021-05-10 21:34 | 156K | |
![[IMG]](/icons/image2.gif) | 1620687562little gr.png | 2021-05-10 22:59 | 19K | |
![[IMG]](/icons/image2.gif) | 1620804749whimsicall..> | 2021-05-12 07:32 | 121K | |
![[IMG]](/icons/image2.gif) | 1620841104BarlowsFoo..> | 2021-05-12 17:38 | 26K | |
![[IMG]](/icons/image2.gif) | 1620848944Rowe Famil..> | 2021-05-12 19:49 | 71K | |
![[IMG]](/icons/image2.gif) | 1620854222received_8..> | 2021-05-12 21:17 | 407K | |
![[IMG]](/icons/image2.gif) | 1620860847SHFpicture..> | 2021-05-12 23:07 | 13K | |
![[IMG]](/icons/image2.gif) | 1620868244logo_1.jpg | 2021-05-13 01:10 | 802K | |
![[IMG]](/icons/image2.gif) | 1620930843IMG_2240.jpg | 2021-05-13 18:34 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1620933526color_logo..> | 2021-05-13 19:18 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1620935266GreenStree..> | 2021-05-13 19:47 | 233K | |
![[IMG]](/icons/image2.gif) | 1620999583HH Intro J..> | 2021-05-14 13:39 | 722K | |
![[IMG]](/icons/image2.gif) | 1621004721wildfern2(..> | 2021-05-14 15:05 | 40K | |
![[IMG]](/icons/image2.gif) | 1621007309IMG_0237 (..> | 2021-05-14 15:48 | 162K | |
![[IMG]](/icons/image2.gif) | 1621009366Front Porc..> | 2021-05-14 16:22 | 80K | |
![[IMG]](/icons/image2.gif) | 1621009374Front Porc..> | 2021-05-14 16:22 | 80K | |
![[IMG]](/icons/image2.gif) | 1621204512E2358B5C-7..> | 2021-05-16 22:35 | 114K | |
![[IMG]](/icons/image2.gif) | 1621209324PiedmontHo..> | 2021-05-16 23:55 | 40K | |
![[IMG]](/icons/image2.gif) | 1621265403Copy of Co..> | 2021-05-17 15:30 | 81K | |
![[IMG]](/icons/image2.gif) | 1621292386fb.jpg | 2021-05-17 22:59 | 417K | |
![[IMG]](/icons/image2.gif) | 1621338749creativecu..> | 2021-05-18 11:52 | 450K | |
![[IMG]](/icons/image2.gif) | 1621338773FB Maiin P..> | 2021-05-18 11:52 | 48K | |
![[IMG]](/icons/image2.gif) | 1621347896BPP PDF fo..> | 2021-05-18 14:24 | 118K | |
![[IMG]](/icons/image2.gif) | 1621348911blank Circ..> | 2021-05-18 14:41 | 66K | |
![[IMG]](/icons/image2.gif) | 1621356912wenderfarm..> | 2021-05-18 16:55 | 450K | |
![[IMG]](/icons/image2.gif) | 1621361215Profile.jpg | 2021-05-18 18:06 | 99K | |
![[IMG]](/icons/image2.gif) | 1621367306ECC Family..> | 2021-05-18 19:48 | 307K | |
![[IMG]](/icons/image2.gif) | 1621382863Baxter's B..> | 2021-05-19 00:07 | 21K | |
![[IMG]](/icons/image2.gif) | 1621431474Northwoods..> | 2021-05-19 13:37 | 134K | |
![[IMG]](/icons/image2.gif) | 1621433448StefsSweet..> | 2021-05-19 14:10 | 181K | |
![[IMG]](/icons/image2.gif) | 1621443263logo 2.25 ..> | 2021-05-19 16:54 | 382K | |
![[IMG]](/icons/image2.gif) | 1621451408LABEL.jpg | 2021-05-19 19:10 | 102K | |
![[IMG]](/icons/image2.gif) | 1621477572Green Bake..> | 2021-05-20 02:26 | 1.8K | |
![[IMG]](/icons/image2.gif) | 1621519759Schroll'sL..> | 2021-05-20 14:09 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1621525720GBMLogo150..> | 2021-05-20 15:48 | 4.7K | |
![[IMG]](/icons/image2.gif) | 1621529384HF-IconArt..> | 2021-05-20 16:49 | 477K | |
![[IMG]](/icons/image2.gif) | 1621529652HF-EmblemA..> | 2021-05-20 16:54 | 650K | |
![[IMG]](/icons/image2.gif) | 1621535426logo round..> | 2021-05-20 18:30 | 49K | |
![[IMG]](/icons/image2.gif) | 1621539274huhn farm ..> | 2021-05-20 19:34 | 201K | |
![[IMG]](/icons/image2.gif) | 1621549430WindcrestF..> | 2021-05-20 22:23 | 81K | |
![[IMG]](/icons/image2.gif) | 1621556865received_1..> | 2021-05-21 00:27 | 137K | |
![[IMG]](/icons/image2.gif) | 1621621724Glazed Ove..> | 2021-05-21 18:28 | 105K | |
![[IMG]](/icons/image2.gif) | 1621627709%22a pet l..> | 2021-05-21 20:08 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1621627735%22a pet l..> | 2021-05-21 20:08 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1621627932LADYSBANAN..> | 2021-05-21 20:12 | 550K | |
![[IMG]](/icons/image2.gif) | 1621636758C4 Family ..> | 2021-05-21 22:39 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1621643253oatmeal_ch..> | 2021-05-22 00:27 | 136K | |
![[IMG]](/icons/image2.gif) | 1621746942Asset 4.jpg | 2021-05-23 05:15 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1621814014EEBAABE0-2..> | 2021-05-23 23:53 | 158K | |
![[IMG]](/icons/image2.gif) | 1621873205download-2..> | 2021-05-24 16:20 | 5.2K | |
![[IMG]](/icons/image2.gif) | 1621873755RedBarnLog..> | 2021-05-24 16:29 | 41K | |
![[IMG]](/icons/image2.gif) | 1621874222Glenview L..> | 2021-05-24 16:37 | 260K | |
![[IMG]](/icons/image2.gif) | 1621876517Humming Hi..> | 2021-05-24 17:15 | 37K | |
![[IMG]](/icons/image2.gif) | 1621882331received_2..> | 2021-05-24 18:52 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1621883973CG - Prima..> | 2021-05-24 19:19 | 598K | |
![[IMG]](/icons/image2.gif) | 1621887444Logo_marke..> | 2021-05-24 20:17 | 267K | |
![[IMG]](/icons/image2.gif) | 1621889833SPD-Logo.jpg | 2021-05-24 20:57 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1621900484AFC8F99D-A..> | 2021-05-24 23:54 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1621944808RusticRoot..> | 2021-05-25 12:13 | 0 | |
![[IMG]](/icons/image2.gif) | 1621944838RusticRoot..> | 2021-05-25 12:13 | 86K | |
![[IMG]](/icons/image2.gif) | 1621947719Screen Sho..> | 2021-05-25 13:01 | 98K | |
![[IMG]](/icons/image2.gif) | 1621959991logo squar..> | 2021-05-25 16:26 | 174K | |
![[IMG]](/icons/image2.gif) | 1621967693Official M..> | 2021-05-25 18:34 | 7.8K | |
![[IMG]](/icons/image2.gif) | 1621972128kent-pilch..> | 2021-05-25 19:48 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1621972232mike-tinni..> | 2021-05-25 19:50 | 818K | |
![[IMG]](/icons/image2.gif) | 1621976293IMG_202007..> | 2021-05-25 20:58 | 66K | |
![[IMG]](/icons/image2.gif) | 1621983725KC Logo Bl..> | 2021-05-25 23:02 | 54K | |
![[IMG]](/icons/image2.gif) | 1621990266IMG-4337.jpg | 2021-05-26 00:51 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1621990984Bully Bite..> | 2021-05-26 01:03 | 963K | |
![[IMG]](/icons/image2.gif) | 1621991269IMG-4344.jpg | 2021-05-26 01:07 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1621991794fourth qua..> | 2021-05-26 01:16 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1622003723mudprofile..> | 2021-05-26 04:35 | 470K | |
![[IMG]](/icons/image2.gif) | 1622039300Wolcott Fo..> | 2021-05-26 14:28 | 51K | |
![[IMG]](/icons/image2.gif) | 1622039966IMG_202105..> | 2021-05-26 14:39 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1622058473business_c..> | 2021-05-26 19:47 | 55K | |
![[IMG]](/icons/image2.gif) | 1622126934Screen Sho..> | 2021-05-27 14:48 | 548K | |
![[IMG]](/icons/image2.gif) | 1622129207FT logo bl..> | 2021-05-27 15:26 | 21K | |
![[IMG]](/icons/image2.gif) | 1622130090A461E7DA-2..> | 2021-05-27 15:41 | 155K | |
![[IMG]](/icons/image2.gif) | 1622131198Harvest-Mo..> | 2021-05-27 15:59 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1622133213DINO'S COO..> | 2021-05-27 16:33 | 81K | |
![[IMG]](/icons/image2.gif) | 1622133574MUSIC CITY..> | 2021-05-27 16:39 | 248K | |
![[IMG]](/icons/image2.gif) | 1622133902Republic f..> | 2021-05-27 16:45 | 36K | |
![[IMG]](/icons/image2.gif) | 1622207237IMG-9276.jpg | 2021-05-28 13:07 | 23K | |
![[IMG]](/icons/image2.gif) | 1622213389RabbitCres..> | 2021-05-28 14:49 | 71K | |
![[IMG]](/icons/image2.gif) | 1622241875FB_IMG_162..> | 2021-05-28 22:44 | 27K | |
![[IMG]](/icons/image2.gif) | 1622258715business c..> | 2021-05-29 03:25 | 16K | |
![[IMG]](/icons/image2.gif) | 1622362278Skulkcraft..> | 2021-05-30 08:11 | 496K | |
![[IMG]](/icons/image2.gif) | 1622381090thumbprint..> | 2021-05-30 13:24 | 17K | |
![[IMG]](/icons/image2.gif) | 1622470494Dayspring+..> | 2021-05-31 14:14 | 177K | |
![[IMG]](/icons/image2.gif) | 1622489007devidea220..> | 2021-05-31 19:23 | 68K | |
![[IMG]](/icons/image2.gif) | 1622493183Sharon's p..> | 2021-05-31 20:33 | 5.2K | |
![[IMG]](/icons/image2.gif) | 1622564124J and L FM..> | 2021-06-01 16:15 | 107K | |
![[IMG]](/icons/image2.gif) | 1622567078granola ja..> | 2021-06-01 17:04 | 30K | |
![[IMG]](/icons/image2.gif) | 1622567674granola ja..> | 2021-06-01 17:14 | 30K | |
![[IMG]](/icons/image2.gif) | 1622570956J and L FM..> | 2021-06-01 18:09 | 44K | |
![[IMG]](/icons/image2.gif) | 1622639910Smiley Gre..> | 2021-06-02 13:18 | 29K | |
![[IMG]](/icons/image2.gif) | 1622644525Picture2.png | 2021-06-02 14:35 | 42K | |
![[IMG]](/icons/image2.gif) | 1622648581Logo-final..> | 2021-06-02 15:43 | 27K | |
![[IMG]](/icons/image2.gif) | 1622661173mayamadelo..> | 2021-06-02 19:12 | 439K | |
![[IMG]](/icons/image2.gif) | 1622662191Picture4.png | 2021-06-02 19:29 | 57K | |
![[IMG]](/icons/image2.gif) | 1622663683Picture4.png | 2021-06-02 19:54 | 57K | |
![[IMG]](/icons/image2.gif) | 1622665245wrapme-log..> | 2021-06-02 20:20 | 145K | |
![[IMG]](/icons/image2.gif) | 1622665845Picture5.png | 2021-06-02 20:30 | 53K | |
![[IMG]](/icons/image2.gif) | 1622668416IMG_8995.jpg | 2021-06-02 21:13 | 112K | |
![[IMG]](/icons/image2.gif) | 1622691771D243BA23-F..> | 2021-06-03 03:42 | 27K | |
![[IMG]](/icons/image2.gif) | 1622734552Ingredient..> | 2021-06-03 15:35 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1622735965Zolaterra_..> | 2021-06-03 15:59 | 45K | |
![[IMG]](/icons/image2.gif) | 1622749700Real Food ..> | 2021-06-03 19:48 | 96K | |
![[IMG]](/icons/image2.gif) | 1622749896Real Food ..> | 2021-06-03 19:51 | 96K | |
![[IMG]](/icons/image2.gif) | 1622767024justwordss..> | 2021-06-04 00:37 | 287K | |
![[IMG]](/icons/image2.gif) | 1622767456banner fac..> | 2021-06-04 00:44 | 728K | |
![[IMG]](/icons/image2.gif) | 1622808867Realistic-..> | 2021-06-04 12:14 | 70K | |
![[IMG]](/icons/image2.gif) | 1622814173TLBKLOGO1.jpg | 2021-06-04 13:42 | 163K | |
![[IMG]](/icons/image2.gif) | 1622826969IMG_202106..> | 2021-06-04 17:16 | 876K | |
![[IMG]](/icons/image2.gif) | 1622840154Untitled d..> | 2021-06-04 20:55 | 95K | |
![[IMG]](/icons/image2.gif) | 1622840952bens logo ..> | 2021-06-04 21:09 | 428K | |
![[IMG]](/icons/image2.gif) | 1622841344yutzy past..> | 2021-06-04 21:15 | 68K | |
![[IMG]](/icons/image2.gif) | 1622848704MimiJos_Co..> | 2021-06-04 23:18 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1622859405West Michi..> | 2021-06-05 02:16 | 240K | |
![[IMG]](/icons/image2.gif) | 1622937564ADECF553-8..> | 2021-06-05 23:59 | 352K | |
![[IMG]](/icons/image2.gif) | 1622943260Emmet and ..> | 2021-06-06 01:34 | 59K | |
![[IMG]](/icons/image2.gif) | 1622980391Logo--04-T..> | 2021-06-06 11:53 | 320K | |
![[IMG]](/icons/image2.gif) | 1622980446Logo-No-Bo..> | 2021-06-06 11:54 | 70K | |
![[IMG]](/icons/image2.gif) | 1622980493Logo-Board..> | 2021-06-06 11:54 | 96K | |
![[IMG]](/icons/image2.gif) | 1622991538ChequyGrid..> | 2021-06-06 14:58 | 49K | |
![[IMG]](/icons/image2.gif) | 1623074657black cow ..> | 2021-06-07 14:04 | 96K | |
![[IMG]](/icons/image2.gif) | 1623074749black cows..> | 2021-06-07 14:05 | 91K | |
![[IMG]](/icons/image2.gif) | 1623074831Emmet and ..> | 2021-06-07 14:07 | 59K | |
![[IMG]](/icons/image2.gif) | 1623080760Sally's Tr..> | 2021-06-07 15:46 | 144K | |
![[IMG]](/icons/image2.gif) | 1623087328Farm Lands..> | 2021-06-07 17:35 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1623092462B14F7CB0-4..> | 2021-06-07 19:01 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1623095963Original.1..> | 2021-06-07 19:59 | 351K | |
![[IMG]](/icons/image2.gif) | 1623110145D70B3802-2..> | 2021-06-07 23:55 | 139K | |
![[IMG]](/icons/image2.gif) | 1623113809BB_Logo.png | 2021-06-08 00:56 | 77K | |
![[IMG]](/icons/image2.gif) | 1623160833BigFork_Wo..> | 2021-06-08 14:00 | 164K | |
![[IMG]](/icons/image2.gif) | 1623160907bigforklog..> | 2021-06-08 14:01 | 168K | |
![[IMG]](/icons/image2.gif) | 1623162490F06947C2-5..> | 2021-06-08 14:28 | 166K | |
![[IMG]](/icons/image2.gif) | 1623165666Noble Gnom..> | 2021-06-08 15:21 | 92K | |
![[IMG]](/icons/image2.gif) | 1623167881Carissa an..> | 2021-06-08 15:58 | 204K | |
![[IMG]](/icons/image2.gif) | 1623168193New Font L..> | 2021-06-08 16:03 | 403K | |
![[IMG]](/icons/image2.gif) | 1623169519New Font L..> | 2021-06-08 16:25 | 403K | |
![[IMG]](/icons/image2.gif) | 1623169554New Font L..> | 2021-06-08 16:25 | 403K | |
![[IMG]](/icons/image2.gif) | 1623171271BAA998C3-6..> | 2021-06-08 16:54 | 55K | |
![[IMG]](/icons/image2.gif) | 1623173391singingbre..> | 2021-06-08 17:29 | 303K | |
![[IMG]](/icons/image2.gif) | 1623184622SMALL JPEG..> | 2021-06-08 20:37 | 211K | |
![[IMG]](/icons/image2.gif) | 1623189855Screenshot..> | 2021-06-08 22:04 | 408K | |
![[IMG]](/icons/image2.gif) | 1623206133Woodland m..> | 2021-06-09 02:35 | 580K | |
![[IMG]](/icons/image2.gif) | 1623238530MG Logo.jpg | 2021-06-09 11:35 | 43K | |
![[IMG]](/icons/image2.gif) | 1623244537FruitHillF..> | 2021-06-09 13:15 | 490K | |
![[IMG]](/icons/image2.gif) | 1623258928Snapchat-6..> | 2021-06-09 17:15 | 100K | |
![[IMG]](/icons/image2.gif) | 1623262913Script-S-L..> | 2021-06-09 18:21 | 46K | |
![[IMG]](/icons/image2.gif) | 1623272487burp_logoA..> | 2021-06-09 21:01 | 80K | |
![[IMG]](/icons/image2.gif) | 1623276729YFMT label..> | 2021-06-09 22:12 | 56K | |
![[IMG]](/icons/image2.gif) | 1623284310Preseved D..> | 2021-06-10 00:18 | 60K | |
![[IMG]](/icons/image2.gif) | 1623291847Nap n Hill..> | 2021-06-10 02:24 | 34K | |
![[IMG]](/icons/image2.gif) | 1623295003SmallLogo.png | 2021-06-10 03:16 | 27K | |
![[IMG]](/icons/image2.gif) | 1623303427BlackBerry..> | 2021-06-10 05:37 | 89K | |
![[IMG]](/icons/image2.gif) | 1623330525logo final..> | 2021-06-10 13:08 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1623360321updated lo..> | 2021-06-10 21:25 | 46K | |
![[IMG]](/icons/image2.gif) | 1623369036Logo (stic..> | 2021-06-10 23:50 | 340K | |
![[IMG]](/icons/image2.gif) | 1623370610Ellijay Lo..> | 2021-06-11 00:16 | 163K | |
![[IMG]](/icons/image2.gif) | 1623414494DailyBread..> | 2021-06-11 12:28 | 23K | |
![[IMG]](/icons/image2.gif) | 1623421915Whitagram-..> | 2021-06-11 14:31 | 85K | |
![[IMG]](/icons/image2.gif) | 1623445040IMG-1779co..> | 2021-06-11 20:57 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1623446523Harmony Ac..> | 2021-06-11 21:22 | 83K | |
![[IMG]](/icons/image2.gif) | 1623449149Snip202104..> | 2021-06-11 22:05 | 270K | |
![[IMG]](/icons/image2.gif) | 1623451148Harmony Ac..> | 2021-06-11 22:39 | 193K | |
![[IMG]](/icons/image2.gif) | 1623451184Harmony Ac..> | 2021-06-11 22:39 | 784K | |
![[IMG]](/icons/image2.gif) | 1623461757All.jpg | 2021-06-12 01:35 | 142K | |
![[IMG]](/icons/image2.gif) | 1623473752PXL_202106..> | 2021-06-12 04:55 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1623597018Coni_logo(..> | 2021-06-13 15:10 | 13K | |
![[IMG]](/icons/image2.gif) | 1623597128Toad Haven..> | 2021-06-13 15:12 | 721K | |
![[IMG]](/icons/image2.gif) | 1623619014HEF-HHH-Lo..> | 2021-06-13 21:16 | 211K | |
![[IMG]](/icons/image2.gif) | 1623628194Blackberry..> | 2021-06-13 23:49 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1623686232No Backgro..> | 2021-06-14 15:57 | 57K | |
![[IMG]](/icons/image2.gif) | 1623686322No Backgro..> | 2021-06-14 15:58 | 57K | |
![[IMG]](/icons/image2.gif) | 1623690695Copy of PB..> | 2021-06-14 17:11 | 12K | |
![[IMG]](/icons/image2.gif) | 1623695519Troll Brid..> | 2021-06-14 18:31 | 825K | |
![[IMG]](/icons/image2.gif) | 1623699373Screenshot..> | 2021-06-14 19:36 | 83K | |
![[IMG]](/icons/image2.gif) | 1623767736favicon.png | 2021-06-15 14:35 | 22K | |
![[IMG]](/icons/image2.gif) | 1623774405us.jpg | 2021-06-15 16:26 | 60K | |
![[IMG]](/icons/image2.gif) | 1623781057logo1.jpg | 2021-06-15 18:17 | 171K | |
![[IMG]](/icons/image2.gif) | 1623784774oatn_produ..> | 2021-06-15 19:19 | 159K | |
![[IMG]](/icons/image2.gif) | 1623883784D4F66C5C-2..> | 2021-06-16 22:49 | 204K | |
![[IMG]](/icons/image2.gif) | 1623932684Screenshot..> | 2021-06-17 12:24 | 145K | |
![[IMG]](/icons/image2.gif) | 1623933811_storage_e..> | 2021-06-17 12:43 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1623944183LOGO.png | 2021-06-17 15:36 | 22K | |
![[IMG]](/icons/image2.gif) | 1623947111Kolache.jpg | 2021-06-17 16:25 | 109K | |
![[IMG]](/icons/image2.gif) | 1623962874COUNTRY-LO..> | 2021-06-17 20:47 | 307K | |
![[IMG]](/icons/image2.gif) | 1623963832ACF logo.jpg | 2021-06-17 21:03 | 111K | |
![[IMG]](/icons/image2.gif) | 1624028426SBBBQLogo.png | 2021-06-18 15:00 | 13K | |
![[IMG]](/icons/image2.gif) | 1624028473SBBBQLogo.png | 2021-06-18 15:01 | 13K | |
![[IMG]](/icons/image2.gif) | 1624030714PicsArt_06..> | 2021-06-18 15:38 | 431K | |
![[IMG]](/icons/image2.gif) | 1624068487IMG_8588.JPG | 2021-06-19 02:08 | 192K | |
![[IMG]](/icons/image2.gif) | 1624131855Convenient..> | 2021-06-19 19:44 | 37K | |
![[IMG]](/icons/image2.gif) | 1624135424TheBlended..> | 2021-06-19 20:43 | 16K | |
![[IMG]](/icons/image2.gif) | 1624215910tcff4.jpg | 2021-06-20 19:05 | 134K | |
![[IMG]](/icons/image2.gif) | 1624232826logo soap ..> | 2021-06-20 23:47 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1624283347Untitled d..> | 2021-06-21 13:49 | 146K | |
![[IMG]](/icons/image2.gif) | 1624292219D4E93924-3..> | 2021-06-21 16:16 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1624294306IMG_E5874.JPG | 2021-06-21 16:51 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1624294706logo.png | 2021-06-21 16:58 | 37K | |
![[IMG]](/icons/image2.gif) | 1624295856A386C94F-A..> | 2021-06-21 17:17 | 213K | |
![[IMG]](/icons/image2.gif) | 1624299046Frequently..> | 2021-06-21 18:10 | 72K | |
![[IMG]](/icons/image2.gif) | 1624299457RedBarnLog..> | 2021-06-21 18:17 | 17K | |
![[IMG]](/icons/image2.gif) | 1624301980Redbudsuds..> | 2021-06-21 18:59 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1624314692logo.png | 2021-06-21 22:31 | 551K | |
![[IMG]](/icons/image2.gif) | 1624322826CambridgeM..> | 2021-06-22 00:47 | 151K | |
![[IMG]](/icons/image2.gif) | 1624377647MEF03-01_c..> | 2021-06-22 16:00 | 668K | |
![[IMG]](/icons/image2.gif) | 1624391839primarylog..> | 2021-06-22 19:57 | 59K | |
![[IMG]](/icons/image2.gif) | 1624392208PrimaryLog..> | 2021-06-22 20:03 | 592K | |
![[IMG]](/icons/image2.gif) | 1624396201IMG_202103..> | 2021-06-22 21:10 | 664K | |
![[IMG]](/icons/image2.gif) | 1624398789SimplyGree..> | 2021-06-22 21:53 | 107K | |
![[IMG]](/icons/image2.gif) | 1624451103AFrndBrdLa..> | 2021-06-23 12:25 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1624464825FEHLogoPla..> | 2021-06-23 16:13 | 14K | |
![[IMG]](/icons/image2.gif) | 1624464868NewLogo-No..> | 2021-06-23 16:14 | 375K | |
![[IMG]](/icons/image2.gif) | 1624467604BBB logo.jpg | 2021-06-23 17:00 | 204K | |
![[IMG]](/icons/image2.gif) | 1624499450IMG_9952.jpg | 2021-06-24 01:50 | 87K | |
![[IMG]](/icons/image2.gif) | 1624545245IMG_0214.JPG | 2021-06-24 14:34 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1624560418sdtf logo.png | 2021-06-24 18:46 | 71K | |
![[IMG]](/icons/image2.gif) | 1624566465IMG_0885.JPG | 2021-06-24 20:27 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1624567892Whitelogo.jpg | 2021-06-24 20:51 | 69K | |
![[IMG]](/icons/image2.gif) | 1624592917LOGO red b..> | 2021-06-25 03:48 | 612K | |
![[IMG]](/icons/image2.gif) | 1624637983white_logo..> | 2021-06-25 16:19 | 245K | |
![[IMG]](/icons/image2.gif) | 1624638287IMG_2715MW..> | 2021-06-25 16:24 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1624640535pollinator..> | 2021-06-25 17:02 | 256K | |
![[IMG]](/icons/image2.gif) | 1624641344fbavatar_1..> | 2021-06-25 17:15 | 326K | |
![[IMG]](/icons/image2.gif) | 1624643041FB_IMG_162..> | 2021-06-25 17:44 | 130K | |
![[IMG]](/icons/image2.gif) | 1624643047FCE9854C-7..> | 2021-06-25 17:44 | 302K | |
![[IMG]](/icons/image2.gif) | 1624647332Brown'sFar..> | 2021-06-25 18:55 | 344K | |
![[IMG]](/icons/image2.gif) | 1624653973Picture1.png | 2021-06-25 20:46 | 40K | |
![[IMG]](/icons/image2.gif) | 1624655607Marks-Rese..> | 2021-06-25 21:13 | 60K | |
![[IMG]](/icons/image2.gif) | 1624761377Banner_(1)..> | 2021-06-27 02:36 | 26K | |
![[IMG]](/icons/image2.gif) | 1624826939IMG_1986.JPG | 2021-06-27 20:48 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1624828822Pierogi-Jo..> | 2021-06-27 21:20 | 94K | |
![[IMG]](/icons/image2.gif) | 1624841878Howerdon m..> | 2021-06-28 00:57 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1624891899logo.png | 2021-06-28 14:51 | 42K | |
![[IMG]](/icons/image2.gif) | 1624899345lisa fb pi..> | 2021-06-28 16:55 | 927K | |
![[IMG]](/icons/image2.gif) | 1624901536logo_size.jpg | 2021-06-28 17:32 | 17K | |
![[IMG]](/icons/image2.gif) | 1624916577Steph-logo..> | 2021-06-28 21:42 | 23K | |
![[IMG]](/icons/image2.gif) | 1624924569ADash .png | 2021-06-28 23:56 | 105K | |
![[IMG]](/icons/image2.gif) | 1624988494mapmap.jpg | 2021-06-29 17:41 | 136K | |
![[IMG]](/icons/image2.gif) | 1624990276Boikeys-lo..> | 2021-06-29 18:11 | 461K | |
![[IMG]](/icons/image2.gif) | 1624992252logo.jpg | 2021-06-29 18:44 | 74K | |
![[IMG]](/icons/image2.gif) | 1625001023Epoche Int..> | 2021-06-29 21:10 | 27K | |
![[IMG]](/icons/image2.gif) | 1625004095Mile creek..> | 2021-06-29 22:01 | 158K | |
![[IMG]](/icons/image2.gif) | 1625019859Screenshot..> | 2021-06-30 02:24 | 407K | |
![[IMG]](/icons/image2.gif) | 1625056095Black Hawk..> | 2021-06-30 12:28 | 587K | |
![[IMG]](/icons/image2.gif) | 1625058268Logo.png | 2021-06-30 13:04 | 23K | |
![[IMG]](/icons/image2.gif) | 1625069265HHMilk LOG..> | 2021-06-30 16:07 | 242K | |
![[IMG]](/icons/image2.gif) | 1625069360IMG_2545.jpeg | 2021-06-30 16:09 | 15K | |
![[IMG]](/icons/image2.gif) | 1625072291LOGO.jpg | 2021-06-30 16:58 | 316K | |
![[IMG]](/icons/image2.gif) | 1625080930small.png | 2021-06-30 19:22 | 7.6K | |
![[IMG]](/icons/image2.gif) | 1625083227Evermore F..> | 2021-06-30 20:00 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1625093253IMG_202011..> | 2021-06-30 22:47 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1625093335IMG_202011..> | 2021-06-30 22:48 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1625152384DE609485-F..> | 2021-07-01 15:13 | 303K | |
![[IMG]](/icons/image2.gif) | 1625163728Decorated ..> | 2021-07-01 18:22 | 781K | |
![[IMG]](/icons/image2.gif) | 1625169931Kristin's ..> | 2021-07-01 20:05 | 53K | |
![[IMG]](/icons/image2.gif) | 1625192454mktwagonlg..> | 2021-07-02 02:20 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1625193047OPF Facebo..> | 2021-07-02 02:30 | 9.7K | |
![[IMG]](/icons/image2.gif) | 1625223843farm3.jpg | 2021-07-02 11:04 | 176K | |
![[IMG]](/icons/image2.gif) | 1625224273DHFF Logo ..> | 2021-07-02 11:11 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1625232890Way Har Fa..> | 2021-07-02 13:34 | 612K | |
![[IMG]](/icons/image2.gif) | 1625246198updated Pi..> | 2021-07-02 17:16 | 140K | |
![[IMG]](/icons/image2.gif) | 1625246256pinkmagnol..> | 2021-07-02 17:17 | 100K | |
![[IMG]](/icons/image2.gif) | 1625246398updated Pi..> | 2021-07-02 17:19 | 122K | |
![[IMG]](/icons/image2.gif) | 1625258428trialfbpho..> | 2021-07-02 20:40 | 39K | |
![[IMG]](/icons/image2.gif) | 1625259828Hive18x18.png | 2021-07-02 21:03 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1625262956trialfbpho..> | 2021-07-02 21:55 | 39K | |
![[IMG]](/icons/image2.gif) | 1625324334FACEBOOK C..> | 2021-07-03 14:58 | 93K | |
![[IMG]](/icons/image2.gif) | 1625324357bATTER'N B..> | 2021-07-03 14:59 | 79K | |
![[IMG]](/icons/image2.gif) | 1625326485GeorgiaMic..> | 2021-07-03 15:34 | 0 | |
![[IMG]](/icons/image2.gif) | 1625333950one hubcap..> | 2021-07-03 17:39 | 60K | |
![[IMG]](/icons/image2.gif) | 1625333959one hubcap..> | 2021-07-03 17:39 | 60K | |
![[IMG]](/icons/image2.gif) | 1625489939PickleCree..> | 2021-07-05 12:58 | 315K | |
![[IMG]](/icons/image2.gif) | 1625503131IMG_0709.JPG | 2021-07-05 16:38 | 72K | |
![[IMG]](/icons/image2.gif) | 1625512613C81D0A91-0..> | 2021-07-05 19:16 | 772K | |
![[IMG]](/icons/image2.gif) | 1625531781weird meat..> | 2021-07-06 00:36 | 66K | |
![[IMG]](/icons/image2.gif) | 1625579053Peaches.jpg | 2021-07-06 13:44 | 6.3K | |
![[IMG]](/icons/image2.gif) | 1625584467Katie's Fa..> | 2021-07-06 15:14 | 88K | |
![[IMG]](/icons/image2.gif) | 1625584520Katie's Fa..> | 2021-07-06 15:15 | 88K | |
![[IMG]](/icons/image2.gif) | 1625599664fullsizeou..> | 2021-07-06 19:27 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1625601572Creekside-..> | 2021-07-06 19:59 | 62K | |
![[IMG]](/icons/image2.gif) | 1625620958OCF sign.jpg | 2021-07-07 01:22 | 50K | |
![[IMG]](/icons/image2.gif) | 1625624508The Mixing..> | 2021-07-07 02:21 | 25K | |
![[IMG]](/icons/image2.gif) | 1625666276Logo TCO.jpg | 2021-07-07 13:57 | 31K | |
![[IMG]](/icons/image2.gif) | 1625673549Handdrawn ..> | 2021-07-07 15:59 | 39K | |
![[IMG]](/icons/image2.gif) | 1625687995The Mixing..> | 2021-07-07 19:59 | 38K | |
![[IMG]](/icons/image2.gif) | 1625688909Pride Road..> | 2021-07-07 20:15 | 86K | |
![[IMG]](/icons/image2.gif) | 1625690756logo 2.jpg | 2021-07-07 20:45 | 926K | |
![[IMG]](/icons/image2.gif) | 1625691696Golden Tas..> | 2021-07-07 21:01 | 80K | |
![[IMG]](/icons/image2.gif) | 1625697920GeorgiaMic..> | 2021-07-07 22:45 | 236K | |
![[IMG]](/icons/image2.gif) | 1625755372IMG_202106..> | 2021-07-08 14:42 | 184K | |
![[IMG]](/icons/image2.gif) | 1625757771Mondo Genu..> | 2021-07-08 15:22 | 505K | |
![[IMG]](/icons/image2.gif) | 1625759033IMG_5407.JPG | 2021-07-08 15:43 | 173K | |
![[IMG]](/icons/image2.gif) | 1625767226IMG_E3711[..> | 2021-07-08 18:00 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1625915105logo.jpg | 2021-07-10 11:05 | 6.2K | |
![[IMG]](/icons/image2.gif) | 1625944142medium.png | 2021-07-10 19:09 | 41K | |
![[IMG]](/icons/image2.gif) | 1625960333IMG_3911.PNG | 2021-07-10 23:38 | 193K | |
![[IMG]](/icons/image2.gif) | 1626041172IMG_jbddis..> | 2021-07-11 22:06 | 184K | |
![[IMG]](/icons/image2.gif) | 1626118617Amish Bugg..> | 2021-07-12 19:36 | 28K | |
![[IMG]](/icons/image2.gif) | 1626121401MySauce-Sa..> | 2021-07-12 20:23 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1626124653CloverHill..> | 2021-07-12 21:17 | 34K | |
![[IMG]](/icons/image2.gif) | 1626130848yellow_hen..> | 2021-07-12 23:00 | 541K | |
![[IMG]](/icons/image2.gif) | 1626131234csa veggie..> | 2021-07-12 23:07 | 108K | |
![[IMG]](/icons/image2.gif) | 1626188378Me.PNG | 2021-07-13 14:59 | 81K | |
![[IMG]](/icons/image2.gif) | 1626188486Screenshot..> | 2021-07-13 15:01 | 299K | |
![[IMG]](/icons/image2.gif) | 1626190695plank.jpg | 2021-07-13 15:38 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1626193725panache-lo..> | 2021-07-13 16:28 | 18K | |
![[IMG]](/icons/image2.gif) | 1626195384panache-lo..> | 2021-07-13 16:56 | 18K | |
![[IMG]](/icons/image2.gif) | 1626197047Truck Rear..> | 2021-07-13 17:24 | 201K | |
![[IMG]](/icons/image2.gif) | 1626197057Truck Rear..> | 2021-07-13 17:24 | 201K | |
![[IMG]](/icons/image2.gif) | 1626199973LumaceTrin..> | 2021-07-13 18:12 | 315K | |
![[IMG]](/icons/image2.gif) | 1626203433IMG_202008..> | 2021-07-13 19:10 | 201K | |
![[IMG]](/icons/image2.gif) | 1626218632Logo stamp..> | 2021-07-13 23:23 | 42K | |
![[IMG]](/icons/image2.gif) | 1626227731Logo 2 Off..> | 2021-07-14 01:55 | 16K | |
![[IMG]](/icons/image2.gif) | 1626231201Logo 1.5.png | 2021-07-14 02:53 | 749K | |
![[IMG]](/icons/image2.gif) | 1626263514CF logo.jpg | 2021-07-14 11:51 | 124K | |
![[IMG]](/icons/image2.gif) | 1626267847DOGGIE DEL..> | 2021-07-14 13:04 | 961K | |
![[IMG]](/icons/image2.gif) | 1626273075BB Patch A..> | 2021-07-14 14:31 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1626289861Garfield o..> | 2021-07-14 19:11 | 816K | |
![[IMG]](/icons/image2.gif) | 1626298597oh_grate_l..> | 2021-07-14 21:36 | 24K | |
![[IMG]](/icons/image2.gif) | 1626301293EB9B3DE9-9..> | 2021-07-14 22:21 | 54K | |
![[IMG]](/icons/image2.gif) | 1626319560Logo Oval ..> | 2021-07-15 03:26 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1626320996WILD SPIRI..> | 2021-07-15 03:49 | 57K | |
![[IMG]](/icons/image2.gif) | 1626325171IMG_4175 (..> | 2021-07-15 04:59 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1626325293IMG_4175 (..> | 2021-07-15 05:01 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1626350985E49D44F2-8..> | 2021-07-15 12:09 | 141K | |
![[IMG]](/icons/image2.gif) | 1626365554photo for ..> | 2021-07-15 16:12 | 60K | |
![[IMG]](/icons/image2.gif) | 1626373078Earths_Del..> | 2021-07-15 18:17 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1626375637Vicki and ..> | 2021-07-15 19:00 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1626382859BerryGoods..> | 2021-07-15 21:00 | 201K | |
![[IMG]](/icons/image2.gif) | 1626389686horizontal..> | 2021-07-15 22:54 | 660K | |
![[IMG]](/icons/image2.gif) | 1626394643BC5C6FE7-5..> | 2021-07-16 00:17 | 518K | |
![[IMG]](/icons/image2.gif) | 1626419264C0920647-0..> | 2021-07-16 07:07 | 53K | |
![[IMG]](/icons/image2.gif) | 1626439608Coleman Cr..> | 2021-07-16 12:46 | 30K | |
![[IMG]](/icons/image2.gif) | 1626443606hbhf sizes..> | 2021-07-16 13:53 | 81K | |
![[IMG]](/icons/image2.gif) | 1626465537BD Logo De..> | 2021-07-16 19:58 | 538K | |
![[IMG]](/icons/image2.gif) | 1626473186FC4515B3-A..> | 2021-07-16 22:06 | 46K | |
![[IMG]](/icons/image2.gif) | 1626486156MMM Logo.png | 2021-07-17 01:42 | 19K | |
![[IMG]](/icons/image2.gif) | 1626555051Portrait.jpg | 2021-07-17 20:50 | 63K | |
![[IMG]](/icons/image2.gif) | 1626657472b.t._leigh..> | 2021-07-19 01:17 | 780K | |
![[IMG]](/icons/image2.gif) | 1626658577faithfulfo..> | 2021-07-19 01:36 | 46K | |
![[IMG]](/icons/image2.gif) | 1626701594Midwest Sp..> | 2021-07-19 13:33 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1626704895face1.jpg | 2021-07-19 14:28 | 447K | |
![[IMG]](/icons/image2.gif) | 1626710943Untitled d..> | 2021-07-19 16:09 | 232K | |
![[IMG]](/icons/image2.gif) | 1626713098logo16.png | 2021-07-19 16:44 | 110K | |
![[IMG]](/icons/image2.gif) | 1626715336- Facebook..> | 2021-07-19 17:22 | 529K | |
![[IMG]](/icons/image2.gif) | 1626717229B21AED38-7..> | 2021-07-19 17:53 | 380K | |
![[IMG]](/icons/image2.gif) | 1626720989Dogpatch_L..> | 2021-07-19 18:56 | 160K | |
![[IMG]](/icons/image2.gif) | 1626721420LOGO.jpg | 2021-07-19 19:03 | 23K | |
![[IMG]](/icons/image2.gif) | 1626722440Screenshot..> | 2021-07-19 19:20 | 151K | |
![[IMG]](/icons/image2.gif) | 1626722574Screenshot..> | 2021-07-19 19:22 | 151K | |
![[IMG]](/icons/image2.gif) | 1626722876B4175EF5-E..> | 2021-07-19 19:27 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1626728760Hemp Promo..> | 2021-07-19 21:06 | 307K | |
![[IMG]](/icons/image2.gif) | 1626737936IMG_3623.JPG | 2021-07-19 23:38 | 234K | |
![[IMG]](/icons/image2.gif) | 1626742280Lettuce Sa..> | 2021-07-20 00:51 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1626790157DA149803-A..> | 2021-07-20 14:09 | 431K | |
![[IMG]](/icons/image2.gif) | 1626795848pizza2_pin..> | 2021-07-20 15:44 | 61K | |
![[IMG]](/icons/image2.gif) | 1626796359mcallensch..> | 2021-07-20 15:52 | 466K | |
![[IMG]](/icons/image2.gif) | 1626803654website-lo..> | 2021-07-20 17:54 | 5.0K | |
![[IMG]](/icons/image2.gif) | 1626808713Square.png | 2021-07-20 19:18 | 458K | |
![[IMG]](/icons/image2.gif) | 1626809759image.jpeg | 2021-07-20 19:35 | 106K | |
![[IMG]](/icons/image2.gif) | 1626815245Kelly Prof..> | 2021-07-20 21:07 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1626825216D8E46200-D..> | 2021-07-20 23:53 | 921K | |
![[IMG]](/icons/image2.gif) | 1626825292DDB8C3D6-4..> | 2021-07-20 23:54 | 681K | |
![[IMG]](/icons/image2.gif) | 1626832919Screenshot..> | 2021-07-21 02:01 | 33K | |
![[IMG]](/icons/image2.gif) | 1626837406IMG_1170.jpeg | 2021-07-21 03:16 | 65K | |
![[IMG]](/icons/image2.gif) | 1626876208cara-beth-..> | 2021-07-21 14:03 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1626881074Jeff Zimme..> | 2021-07-21 15:24 | 261K | |
![[IMG]](/icons/image2.gif) | 1626883502FB_IMG_157..> | 2021-07-21 16:05 | 99K | |
![[IMG]](/icons/image2.gif) | 1626906934Logo.Small..> | 2021-07-21 22:35 | 8.0K | |
![[IMG]](/icons/image2.gif) | 1626915153Purus Allu..> | 2021-07-22 00:52 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1626946238FullColor_..> | 2021-07-22 09:30 | 87K | |
![[IMG]](/icons/image2.gif) | 1626969073Tasty Good..> | 2021-07-22 15:51 | 450K | |
![[IMG]](/icons/image2.gif) | 1626980871THClogodar..> | 2021-07-22 19:07 | 530K | |
![[IMG]](/icons/image2.gif) | 1626987044HQM_Logo-0..> | 2021-07-22 20:50 | 72K | |
![[IMG]](/icons/image2.gif) | 1626990562IMG_7725 -..> | 2021-07-22 21:49 | 345K | |
![[IMG]](/icons/image2.gif) | 1627000448HQM_Logo_M..> | 2021-07-23 00:34 | 68K | |
![[IMG]](/icons/image2.gif) | 1627000461HQM_Logo_M..> | 2021-07-23 00:34 | 68K | |
![[IMG]](/icons/image2.gif) | 1627008847IMG_8127.jpg | 2021-07-23 02:54 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1627024531Logo2.png | 2021-07-23 07:15 | 117K | |
![[IMG]](/icons/image2.gif) | 1627046234profile pi..> | 2021-07-23 13:17 | 138K | |
![[IMG]](/icons/image2.gif) | 1627064980BudandCoLo..> | 2021-07-23 18:29 | 98K | |
![[IMG]](/icons/image2.gif) | 1627075515Profile pi..> | 2021-07-23 21:25 | 213K | |
![[IMG]](/icons/image2.gif) | 1627159452Coleslaw--..> | 2021-07-24 20:44 | 495K | |
![[IMG]](/icons/image2.gif) | 1627159576Coleslaw--..> | 2021-07-24 20:46 | 495K | |
![[IMG]](/icons/image2.gif) | 1627182696BLACKBERRY..> | 2021-07-25 03:11 | 638K | |
![[IMG]](/icons/image2.gif) | 1627182792Fotolia_10..> | 2021-07-25 03:13 | 137K | |
![[IMG]](/icons/image2.gif) | 1627242550Instagram ..> | 2021-07-25 19:49 | 16K | |
![[IMG]](/icons/image2.gif) | 1627247770chicken.jpg | 2021-07-25 21:16 | 45K | |
![[IMG]](/icons/image2.gif) | 1627265089Southern-S..> | 2021-07-26 02:04 | 21K | |
![[IMG]](/icons/image2.gif) | 1627265126Southern-S..> | 2021-07-26 02:05 | 710K | |
![[IMG]](/icons/image2.gif) | 1627323009Linkedin C..> | 2021-07-26 18:10 | 56K | |
![[IMG]](/icons/image2.gif) | 1627323053Facebook P..> | 2021-07-26 18:10 | 131K | |
![[IMG]](/icons/image2.gif) | 1627348802Barn Logo ..> | 2021-07-27 01:20 | 5.2K | |
![[IMG]](/icons/image2.gif) | 1627348831Barn Logo ..> | 2021-07-27 01:20 | 50K | |
![[IMG]](/icons/image2.gif) | 1627348846Dreamy 280..> | 2021-07-27 01:20 | 387K | |
![[IMG]](/icons/image2.gif) | 1627348872Dreamy 280..> | 2021-07-27 01:21 | 96K | |
![[IMG]](/icons/image2.gif) | 1627348894Oval logo.JPG | 2021-07-27 01:21 | 60K | |
![[IMG]](/icons/image2.gif) | 1627348924Dreamy 280..> | 2021-07-27 01:22 | 387K | |
![[IMG]](/icons/image2.gif) | 1627348946Dreamy 280..> | 2021-07-27 01:22 | 86K | |
![[IMG]](/icons/image2.gif) | 1627348960Dreamy 280..> | 2021-07-27 01:22 | 590K | |
![[IMG]](/icons/image2.gif) | 1627348976Dreamy 280..> | 2021-07-27 01:22 | 387K | |
![[IMG]](/icons/image2.gif) | 1627353980Dreamy 280..> | 2021-07-27 02:46 | 590K | |
![[IMG]](/icons/image2.gif) | 1627354008Dreamy 280..> | 2021-07-27 02:46 | 387K | |
![[IMG]](/icons/image2.gif) | 1627354025Barn Logo ..> | 2021-07-27 02:47 | 69K | |
![[IMG]](/icons/image2.gif) | 1627354070Dreamy 280..> | 2021-07-27 02:47 | 387K | |
![[IMG]](/icons/image2.gif) | 1627355542LR Black J..> | 2021-07-27 03:12 | 366K | |
![[IMG]](/icons/image2.gif) | 1627401961VandV_Main..> | 2021-07-27 16:06 | 148K | |
![[IMG]](/icons/image2.gif) | 1627428331kitchen gi..> | 2021-07-27 23:25 | 228K | |
![[IMG]](/icons/image2.gif) | 1627440563Baker and ..> | 2021-07-28 02:49 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1627474680D44B2E0D-9..> | 2021-07-28 12:18 | 337K | |
![[IMG]](/icons/image2.gif) | 1627521586newlogo.png | 2021-07-29 01:19 | 0 | |
![[IMG]](/icons/image2.gif) | 1627523835newlogo.png | 2021-07-29 01:57 | 0 | |
![[IMG]](/icons/image2.gif) | 1627565792Zen Again_..> | 2021-07-29 13:36 | 247K | |
![[IMG]](/icons/image2.gif) | 1627565861Zen Again_..> | 2021-07-29 13:37 | 250K | |
![[IMG]](/icons/image2.gif) | 1627565894Zen Again_..> | 2021-07-29 13:38 | 225K | |
![[IMG]](/icons/image2.gif) | 1627591908RMFLogo.jpg | 2021-07-29 20:51 | 41K | |
![[IMG]](/icons/image2.gif) | 1627596605HQM_Logo_M..> | 2021-07-29 22:10 | 810K | |
![[IMG]](/icons/image2.gif) | 1627598819TS LOGO.png | 2021-07-29 22:46 | 165K | |
![[IMG]](/icons/image2.gif) | 1627660022Tranquilit..> | 2021-07-30 15:47 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1627670312LilaLueSwe..> | 2021-07-30 18:38 | 306K | |
![[IMG]](/icons/image2.gif) | 1627693939Caracal He..> | 2021-07-31 01:12 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1627762693Riverbend ..> | 2021-07-31 20:18 | 343K | |
![[IMG]](/icons/image2.gif) | 1627842011profile.jpg | 2021-08-01 18:20 | 795K | |
![[IMG]](/icons/image2.gif) | 1627847835TS LOGO.png | 2021-08-01 19:57 | 165K | |
![[IMG]](/icons/image2.gif) | 1627848168TS LOGO.JPG | 2021-08-01 20:02 | 53K | |
![[IMG]](/icons/image2.gif) | 1627911550frosted cr..> | 2021-08-02 13:39 | 155K | |
![[IMG]](/icons/image2.gif) | 1627912326E9E33FC4-6..> | 2021-08-02 13:52 | 582K | |
![[IMG]](/icons/image2.gif) | 1627919524C3_png_.png | 2021-08-02 15:52 | 18K | |
![[IMG]](/icons/image2.gif) | 1627924594Caracal He..> | 2021-08-02 17:16 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1627925156FB_IMG_162..> | 2021-08-02 17:25 | 154K | |
![[IMG]](/icons/image2.gif) | 1627927205farm.png | 2021-08-02 18:00 | 247K | |
![[IMG]](/icons/image2.gif) | 1627932991Primary Lo..> | 2021-08-02 19:36 | 18K | |
![[IMG]](/icons/image2.gif) | 1627934316received_1..> | 2021-08-02 19:58 | 137K | |
![[IMG]](/icons/image2.gif) | 1627934348MEME 3 Sto..> | 2021-08-02 19:59 | 101K | |
![[IMG]](/icons/image2.gif) | 1627934531MEME 3 Sto..> | 2021-08-02 20:02 | 108K | |
![[IMG]](/icons/image2.gif) | 1627940790LOGO-05.png | 2021-08-02 21:46 | 138K | |
![[IMG]](/icons/image2.gif) | 1627940869LOGO-05.png | 2021-08-02 21:47 | 138K | |
![[IMG]](/icons/image2.gif) | 1627946614IMG_6497.jpg | 2021-08-02 23:23 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1627950858OGGlogo.JPG | 2021-08-03 00:34 | 434K | |
![[IMG]](/icons/image2.gif) | 1627953006IMG_162795..> | 2021-08-03 01:10 | 370K | |
![[IMG]](/icons/image2.gif) | 1627995917Eden Farms..> | 2021-08-03 13:05 | 22K | |
![[IMG]](/icons/image2.gif) | 1627996514ECF82B1D-4..> | 2021-08-03 13:15 | 222K | |
![[IMG]](/icons/image2.gif) | 1628003600Shafer Fam..> | 2021-08-03 15:13 | 5.8K | |
![[IMG]](/icons/image2.gif) | 1628003619Shafer Fam..> | 2021-08-03 15:13 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1628005840NH logo 5.jpg | 2021-08-03 15:50 | 12K | |
![[IMG]](/icons/image2.gif) | 1628008883Cinsoy ss ..> | 2021-08-03 16:41 | 270K | |
![[IMG]](/icons/image2.gif) | 1628013493Brazilian ..> | 2021-08-03 17:58 | 216K | |
![[IMG]](/icons/image2.gif) | 1628013805CommonGrou..> | 2021-08-03 18:03 | 173K | |
![[IMG]](/icons/image2.gif) | 1628013839CommonGrou..> | 2021-08-03 18:03 | 173K | |
![[IMG]](/icons/image2.gif) | 1628019325DSC00204.jpg | 2021-08-03 19:35 | 270K | |
![[IMG]](/icons/image2.gif) | 1628020149tempImageT..> | 2021-08-03 19:49 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1628030280homeplace ..> | 2021-08-03 22:38 | 45K | |
![[IMG]](/icons/image2.gif) | 1628037691IMG_3292.jpg | 2021-08-04 00:41 | 192K | |
![[IMG]](/icons/image2.gif) | 1628038206Josh and W..> | 2021-08-04 00:50 | 555K | |
![[IMG]](/icons/image2.gif) | 1628042988Logo.jpg | 2021-08-04 02:09 | 607K | |
![[IMG]](/icons/image2.gif) | 1628053222LilaLue Sw..> | 2021-08-04 05:00 | 316K | |
![[IMG]](/icons/image2.gif) | 1628053926LilaLue Sw..> | 2021-08-04 05:12 | 305K | |
![[IMG]](/icons/image2.gif) | 1628093257Lukes vegg..> | 2021-08-04 16:07 | 259K | |
![[IMG]](/icons/image2.gif) | 1628101565FINAL_Tvit..> | 2021-08-04 18:26 | 80K | |
![[IMG]](/icons/image2.gif) | 1628104902Hollowbroo..> | 2021-08-04 19:21 | 49K | |
![[IMG]](/icons/image2.gif) | 1628105520received_2..> | 2021-08-04 19:32 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1628116557LOGO.jpg | 2021-08-04 22:35 | 139K | |
![[IMG]](/icons/image2.gif) | 1628119090logo(bigge..> | 2021-08-04 23:18 | 682K | |
![[IMG]](/icons/image2.gif) | 1628119657D2Meats-Fi..> | 2021-08-04 23:27 | 364K | |
![[IMG]](/icons/image2.gif) | 1628174796IMG_0688 (..> | 2021-08-05 14:46 | 78K | |
![[IMG]](/icons/image2.gif) | 1628178153ProfilePic..> | 2021-08-05 15:42 | 64K | |
![[IMG]](/icons/image2.gif) | 1628179536Soap -1.png | 2021-08-05 16:05 | 460K | |
![[IMG]](/icons/image2.gif) | 1628185263il_340x270..> | 2021-08-05 17:41 | 33K | |
![[IMG]](/icons/image2.gif) | 1628186110IMG_1366.JPG | 2021-08-05 17:55 | 89K | |
![[IMG]](/icons/image2.gif) | 1628194269LOGO-05.png | 2021-08-05 20:11 | 141K | |
![[IMG]](/icons/image2.gif) | 1628195935Ooyoo logo..> | 2021-08-05 20:38 | 95K | |
![[IMG]](/icons/image2.gif) | 1628208607Favicon-10..> | 2021-08-06 00:10 | 104K | |
![[IMG]](/icons/image2.gif) | 1628214690The Sourdo..> | 2021-08-06 01:51 | 99K | |
![[IMG]](/icons/image2.gif) | 1628214764The Sourdo..> | 2021-08-06 01:52 | 99K | |
![[IMG]](/icons/image2.gif) | 1628304159Tucker&Co...> | 2021-08-07 02:42 | 121K | |
![[IMG]](/icons/image2.gif) | 1628362886rs=h_1000,..> | 2021-08-07 19:01 | 41K | |
![[IMG]](/icons/image2.gif) | 1628391774FD965213-A..> | 2021-08-08 03:02 | 125K | |
![[IMG]](/icons/image2.gif) | 1628438789Oatballs c..> | 2021-08-08 16:06 | 22K | |
![[IMG]](/icons/image2.gif) | 1628441765Iron Will.JPG | 2021-08-08 16:56 | 778K | |
![[IMG]](/icons/image2.gif) | 1628449610NANAS SWE..> | 2021-08-08 19:06 | 33K | |
![[IMG]](/icons/image2.gif) | 1628458144facebookpr..> | 2021-08-08 21:29 | 34K | |
![[IMG]](/icons/image2.gif) | 1628458158facebookpr..> | 2021-08-08 21:29 | 34K | |
![[IMG]](/icons/image2.gif) | 1628468688image.png | 2021-08-09 00:24 | 35K | |
![[IMG]](/icons/image2.gif) | 1628468791Logo_Color..> | 2021-08-09 00:26 | 8.4K | |
![[IMG]](/icons/image2.gif) | 1628468904JuiceJarLo..> | 2021-08-09 00:28 | 72K | |
![[IMG]](/icons/image2.gif) | 1628468956Logo_Color..> | 2021-08-09 00:29 | 29K | |
![[IMG]](/icons/image2.gif) | 1628477073D55F333C-8..> | 2021-08-09 02:44 | 901K | |
![[IMG]](/icons/image2.gif) | 1628487111IMG_202007..> | 2021-08-09 05:31 | 97K | |
![[IMG]](/icons/image2.gif) | 1628531583IMG_0537 (..> | 2021-08-09 17:53 | 145K | |
![[IMG]](/icons/image2.gif) | 1628532428SADES ACRE..> | 2021-08-09 18:07 | 335K | |
![[IMG]](/icons/image2.gif) | 1628547294iphone 452..> | 2021-08-09 22:14 | 518K | |
![[IMG]](/icons/image2.gif) | 1628552795Red Ridge ..> | 2021-08-09 23:46 | 360K | |
![[IMG]](/icons/image2.gif) | 1628561628sandill_ac..> | 2021-08-10 02:13 | 282K | |
![[IMG]](/icons/image2.gif) | 1628563120Capture.PNG | 2021-08-10 02:38 | 10K | |
![[IMG]](/icons/image2.gif) | 1628583244IMG_162858..> | 2021-08-10 08:14 | 330K | |
![[IMG]](/icons/image2.gif) | 1628584776IMG_162858..> | 2021-08-10 08:39 | 312K | |
![[IMG]](/icons/image2.gif) | 1628599566logo.png | 2021-08-10 12:46 | 32K | |
![[IMG]](/icons/image2.gif) | 1628607964Luminary C..> | 2021-08-10 15:06 | 164K | |
![[IMG]](/icons/image2.gif) | 1628609870Black Shee..> | 2021-08-10 15:37 | 53K | |
![[IMG]](/icons/image2.gif) | 1628615077ujYd2fVn_4..> | 2021-08-10 17:04 | 13K | |
![[IMG]](/icons/image2.gif) | 1628637683Peanuckle ..> | 2021-08-10 23:21 | 532K | |
![[IMG]](/icons/image2.gif) | 1628652555AE3DD5B2-B..> | 2021-08-11 03:29 | 778K | |
![[IMG]](/icons/image2.gif) | 1628691330JR-circle-..> | 2021-08-11 14:15 | 27K | |
![[IMG]](/icons/image2.gif) | 1628698543Color_Full..> | 2021-08-11 16:15 | 915K | |
![[IMG]](/icons/image2.gif) | 1628699115FRONT OF H..> | 2021-08-11 16:25 | 217K | |
![[IMG]](/icons/image2.gif) | 1628704805A659DCAE-A..> | 2021-08-11 18:00 | 17K | |
![[IMG]](/icons/image2.gif) | 1628704891C1B9F867-5..> | 2021-08-11 18:01 | 419K | |
![[IMG]](/icons/image2.gif) | 1628705941Salad Mix ..> | 2021-08-11 18:19 | 14K | |
![[IMG]](/icons/image2.gif) | 1628713699LoCaf Coff..> | 2021-08-11 20:28 | 79K | |
![[IMG]](/icons/image2.gif) | 1628725926Maple Grov..> | 2021-08-11 23:52 | 236K | |
![[IMG]](/icons/image2.gif) | 1628771280farm logo.jpg | 2021-08-12 12:28 | 417K | |
![[IMG]](/icons/image2.gif) | 1628791225Dawn.jpg | 2021-08-12 18:00 | 43K | |
![[IMG]](/icons/image2.gif) | 1628793460good logo.jpg | 2021-08-12 18:37 | 235K | |
![[IMG]](/icons/image2.gif) | 1628793534Arps_FullC..> | 2021-08-12 18:38 | 148K | |
![[IMG]](/icons/image2.gif) | 1628793576Arps_FullC..> | 2021-08-12 18:39 | 376K | |
![[IMG]](/icons/image2.gif) | 1628793600Arps_FullC..> | 2021-08-12 18:40 | 359K | |
![[IMG]](/icons/image2.gif) | 1628793634logo crop.png | 2021-08-12 18:40 | 648K | |
![[IMG]](/icons/image2.gif) | 1628799949SmartSelec..> | 2021-08-12 20:25 | 191K | |
![[IMG]](/icons/image2.gif) | 1628808104C2C95B04-B..> | 2021-08-12 22:41 | 658K | |
![[IMG]](/icons/image2.gif) | 1628814548sugarwood-..> | 2021-08-13 00:29 | 107K | |
![[IMG]](/icons/image2.gif) | 1628855664logo-distr..> | 2021-08-13 11:54 | 505K | |
![[IMG]](/icons/image2.gif) | 1628881457SMC_NewLog..> | 2021-08-13 19:04 | 25K | |
![[IMG]](/icons/image2.gif) | 1628885254KP Gail ne..> | 2021-08-13 20:07 | 698K | |
![[IMG]](/icons/image2.gif) | 1628910648Églantine..> | 2021-08-14 03:10 | 292K | |
![[IMG]](/icons/image2.gif) | 1628964305B471F830-5..> | 2021-08-14 18:05 | 95K | |
![[IMG]](/icons/image2.gif) | 1628982461Untitled-5..> | 2021-08-14 23:07 | 90K | |
![[IMG]](/icons/image2.gif) | 1628990451logo for i..> | 2021-08-15 01:20 | 615K | |
![[IMG]](/icons/image2.gif) | 1629050580Farms by A..> | 2021-08-15 18:03 | 799K | |
![[IMG]](/icons/image2.gif) | 1629122500SassyCow_s..> | 2021-08-16 14:01 | 99K | |
![[IMG]](/icons/image2.gif) | 1629137073MCF Logo 1..> | 2021-08-16 18:04 | 289K | |
![[IMG]](/icons/image2.gif) | 1629138202image003.jpg | 2021-08-16 18:23 | 40K | |
![[IMG]](/icons/image2.gif) | 1629141457Self Portr..> | 2021-08-16 19:17 | 157K | |
![[IMG]](/icons/image2.gif) | 1629141547Gold Medus..> | 2021-08-16 19:19 | 799K | |
![[IMG]](/icons/image2.gif) | 1629141774market wag..> | 2021-08-16 19:22 | 636K | |
![[IMG]](/icons/image2.gif) | 1629141900market wag..> | 2021-08-16 19:25 | 927K | |
![[IMG]](/icons/image2.gif) | 1629142041Fat-Caps-l..> | 2021-08-16 19:27 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1629144623IMG_3999.jpg | 2021-08-16 20:10 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1629152312isla_280x2..> | 2021-08-16 22:18 | 13K | |
![[IMG]](/icons/image2.gif) | 1629164560Resized_20..> | 2021-08-17 01:42 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1629171826IMG_1371.jpg | 2021-08-17 03:43 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1629198629Business C..> | 2021-08-17 11:10 | 57K | |
![[IMG]](/icons/image2.gif) | 1629209401LOGO.png | 2021-08-17 14:10 | 238K | |
![[IMG]](/icons/image2.gif) | 1629210696SMC_NewLog..> | 2021-08-17 14:31 | 25K | |
![[IMG]](/icons/image2.gif) | 1629210762SMC Logo 2..> | 2021-08-17 14:32 | 134K | |
![[IMG]](/icons/image2.gif) | 1629214348logo.JPG | 2021-08-17 15:32 | 108K | |
![[IMG]](/icons/image2.gif) | 1629214380logo.JPG | 2021-08-17 15:33 | 108K | |
![[IMG]](/icons/image2.gif) | 1629216400fur_pawz_l..> | 2021-08-17 16:06 | 216K | |
![[IMG]](/icons/image2.gif) | 1629234833HCC-Logo-F..> | 2021-08-17 21:13 | 61K | |
![[IMG]](/icons/image2.gif) | 1629236007Palisades ..> | 2021-08-17 21:33 | 222K | |
![[IMG]](/icons/image2.gif) | 1629296925HCM FoodWa..> | 2021-08-18 14:28 | 409K | |
![[IMG]](/icons/image2.gif) | 1629301406RCF_Logo_C..> | 2021-08-18 15:43 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1629303346WFP_FullLo..> | 2021-08-18 16:15 | 55K | |
![[IMG]](/icons/image2.gif) | 1629306524shooting.s..> | 2021-08-18 17:08 | 332K | |
![[IMG]](/icons/image2.gif) | 1629310719Preservati..> | 2021-08-18 18:18 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1629311648TF Logo JP..> | 2021-08-18 18:34 | 17K | |
![[IMG]](/icons/image2.gif) | 1629312003D30A993C-9..> | 2021-08-18 18:40 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1629317067barnsilohi..> | 2021-08-18 20:04 | 40K | |
![[IMG]](/icons/image2.gif) | 1629321088METAMORA-L..> | 2021-08-18 21:11 | 899K | |
![[IMG]](/icons/image2.gif) | 1629321169METAMORA-L..> | 2021-08-18 21:12 | 82K | |
![[IMG]](/icons/image2.gif) | 1629321199METAMORA-L..> | 2021-08-18 21:13 | 420K | |
![[IMG]](/icons/image2.gif) | 1629327101Lonesome D..> | 2021-08-18 22:51 | 404K | |
![[IMG]](/icons/image2.gif) | 1629333053Lirio-Red-..> | 2021-08-19 00:30 | 59K | |
![[IMG]](/icons/image2.gif) | 1629378275F8BE6562-4..> | 2021-08-19 13:04 | 55K | |
![[IMG]](/icons/image2.gif) | 1629397035group pic.jpg | 2021-08-19 18:17 | 87K | |
![[IMG]](/icons/image2.gif) | 1629401108bwglogo.jpeg | 2021-08-19 19:25 | 22K | |
![[IMG]](/icons/image2.gif) | 1629403140Business C..> | 2021-08-19 19:59 | 622K | |
![[IMG]](/icons/image2.gif) | 1629406067Field_To_F..> | 2021-08-19 20:47 | 33K | |
![[IMG]](/icons/image2.gif) | 1629472446LOF_Logo-2..> | 2021-08-20 15:14 | 695K | |
![[IMG]](/icons/image2.gif) | 1629474942hens.jpg | 2021-08-20 15:55 | 81K | |
![[IMG]](/icons/image2.gif) | 1629492530Facebook_T..> | 2021-08-20 20:48 | 52K | |
![[IMG]](/icons/image2.gif) | 1629512485Lorien gre..> | 2021-08-21 02:21 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1629648219unnamed.png | 2021-08-22 16:03 | 62K | |
![[IMG]](/icons/image2.gif) | 1629648469received_1..> | 2021-08-22 16:07 | 137K | |
![[IMG]](/icons/image2.gif) | 1629654888logo.jpg | 2021-08-22 17:54 | 9.0K | |
![[IMG]](/icons/image2.gif) | 1629661958afternoon-..> | 2021-08-22 19:52 | 27K | |
![[IMG]](/icons/image2.gif) | 1629680699Bluegrass ..> | 2021-08-23 01:04 | 62K | |
![[IMG]](/icons/image2.gif) | 1629737933Untitled d..> | 2021-08-23 16:58 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1629744082PeacefulHe..> | 2021-08-23 18:41 | 110K | |
![[IMG]](/icons/image2.gif) | 1629745940The Lawson..> | 2021-08-23 19:12 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1629749494Primary_Lo..> | 2021-08-23 20:11 | 290K | |
![[IMG]](/icons/image2.gif) | 1629756409CMClogo1.jpg | 2021-08-23 22:06 | 71K | |
![[IMG]](/icons/image2.gif) | 1629770398A7DAB834-9..> | 2021-08-24 01:59 | 84K | |
![[IMG]](/icons/image2.gif) | 1629776344master log..> | 2021-08-24 03:39 | 90K | |
![[IMG]](/icons/image2.gif) | 1629776364br logo ne..> | 2021-08-24 03:39 | 74K | |
![[IMG]](/icons/image2.gif) | 1629811659Savoure Ki..> | 2021-08-24 13:27 | 27K | |
![[IMG]](/icons/image2.gif) | 1629819534received_5..> | 2021-08-24 15:38 | 44K | |
![[IMG]](/icons/image2.gif) | 1629823642heartIA_lo..> | 2021-08-24 16:47 | 753K | |
![[IMG]](/icons/image2.gif) | 1629827015FW2.jpg.png | 2021-08-24 17:43 | 233K | |
![[IMG]](/icons/image2.gif) | 1629830846IMG_201812..> | 2021-08-24 18:47 | 389K | |
![[IMG]](/icons/image2.gif) | 1629835283farmstead_..> | 2021-08-24 20:01 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1629836919WEB LOGO 5..> | 2021-08-24 20:28 | 25K | |
![[IMG]](/icons/image2.gif) | 1629850061helga 3.jpg | 2021-08-25 00:07 | 229K | |
![[IMG]](/icons/image2.gif) | 1629856540wholee-gra..> | 2021-08-25 01:55 | 61K | |
![[IMG]](/icons/image2.gif) | 1629896020yokley 4 m..> | 2021-08-25 12:53 | 689K | |
![[IMG]](/icons/image2.gif) | 1629898836CassavaBre..> | 2021-08-25 13:40 | 19K | |
![[IMG]](/icons/image2.gif) | 1629931287RC logo wi..> | 2021-08-25 22:41 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1629931641logo.png | 2021-08-25 22:47 | 482K | |
![[IMG]](/icons/image2.gif) | 1629943174Alessandro..> | 2021-08-26 01:59 | 189K | |
![[IMG]](/icons/image2.gif) | 1629992566Cannizzaro..> | 2021-08-26 15:42 | 35K | |
![[IMG]](/icons/image2.gif) | 1630011687d0d3df0fb9..> | 2021-08-26 21:01 | 23K | |
![[IMG]](/icons/image2.gif) | 1630014963B60E89CD-0..> | 2021-08-26 21:56 | 52K | |
![[IMG]](/icons/image2.gif) | 1630078618MAF Logo 1..> | 2021-08-27 15:36 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1630080566KNB Logo_F..> | 2021-08-27 16:09 | 545K | |
![[IMG]](/icons/image2.gif) | 1630082530Loaf-Bar-F..> | 2021-08-27 16:42 | 163K | |
![[IMG]](/icons/image2.gif) | 1630082597Loaf-Bar-S..> | 2021-08-27 16:43 | 102K | |
![[IMG]](/icons/image2.gif) | 1630084511MYSTERYBLE..> | 2021-08-27 17:15 | 67K | |
![[IMG]](/icons/image2.gif) | 1630094658IMG_202104..> | 2021-08-27 20:04 | 25K | |
![[IMG]](/icons/image2.gif) | 1630094784Screenshot..> | 2021-08-27 20:06 | 733K | |
![[IMG]](/icons/image2.gif) | 1630098932IMG_-2b5br..> | 2021-08-27 21:15 | 248K | |
![[IMG]](/icons/image2.gif) | 1630106427IMG_8532.jpeg | 2021-08-27 23:20 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1630149448Label-01.jpg | 2021-08-28 11:17 | 122K | |
![[IMG]](/icons/image2.gif) | 1630168041DBF291C4-8..> | 2021-08-28 16:27 | 138K | |
![[IMG]](/icons/image2.gif) | 1630178227FAF_White_..> | 2021-08-28 19:17 | 349K | |
![[IMG]](/icons/image2.gif) | 1630183018Screen Sho..> | 2021-08-28 20:36 | 258K | |
![[IMG]](/icons/image2.gif) | 1630191546Deliciousl..> | 2021-08-28 22:59 | 647K | |
![[IMG]](/icons/image2.gif) | 1630254542background..> | 2021-08-29 16:29 | 102K | |
![[IMG]](/icons/image2.gif) | 1630346552IMG_6778.jpg | 2021-08-30 18:02 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1630361849ChapelFord..> | 2021-08-30 22:17 | 762K | |
![[IMG]](/icons/image2.gif) | 1630408815common_roo..> | 2021-08-31 11:20 | 465K | |
![[IMG]](/icons/image2.gif) | 1630410691cookiewith..> | 2021-08-31 11:51 | 156K | |
![[IMG]](/icons/image2.gif) | 1630425940greeting c..> | 2021-08-31 16:05 | 440K | |
![[IMG]](/icons/image2.gif) | 1630427816image00000..> | 2021-08-31 16:36 | 137K | |
![[IMG]](/icons/image2.gif) | 1630462113Logo-04 ma..> | 2021-09-01 02:08 | 70K | |
![[IMG]](/icons/image2.gif) | 1630502205kallan far..> | 2021-09-01 13:16 | 174K | |
![[IMG]](/icons/image2.gif) | 1630502262kallan far..> | 2021-09-01 13:17 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1630502370kallan far..> | 2021-09-01 13:19 | 218K | |
![[IMG]](/icons/image2.gif) | 1630503242logo.jpg | 2021-09-01 13:34 | 60K | |
![[IMG]](/icons/image2.gif) | 1630503269logo2.jpg | 2021-09-01 13:34 | 60K | |
![[IMG]](/icons/image2.gif) | 1630503526mama c log..> | 2021-09-01 13:38 | 2.7K | |
![[IMG]](/icons/image2.gif) | 1630508247Screenshot..> | 2021-09-01 14:57 | 247K | |
![[IMG]](/icons/image2.gif) | 1630516371Dudash Log..> | 2021-09-01 17:12 | 30K | |
![[IMG]](/icons/image2.gif) | 1630541899web-small-..> | 2021-09-02 00:18 | 204K | |
![[IMG]](/icons/image2.gif) | 1630592744advertise ..> | 2021-09-02 14:25 | 108K | |
![[IMG]](/icons/image2.gif) | 1630612428Logo (3).png | 2021-09-02 19:53 | 19K | |
![[IMG]](/icons/image2.gif) | 1630617730Kendra Log..> | 2021-09-02 21:22 | 463K | |
![[IMG]](/icons/image2.gif) | 1630619430Slide1.jpg | 2021-09-02 21:50 | 45K | |
![[IMG]](/icons/image2.gif) | 1630623305FabelFarms..> | 2021-09-02 22:55 | 494K | |
![[IMG]](/icons/image2.gif) | 1630676251Elegent-Lo..> | 2021-09-03 13:37 | 82K | |
![[IMG]](/icons/image2.gif) | 1630692171MOONLIGHT ..> | 2021-09-03 18:02 | 669K | |
![[IMG]](/icons/image2.gif) | 1630692772MOONLIGHT ..> | 2021-09-03 18:12 | 204K | |
![[IMG]](/icons/image2.gif) | 1630718114SB Logo la..> | 2021-09-04 01:15 | 205K | |
![[IMG]](/icons/image2.gif) | 1630720527sb Logo sq..> | 2021-09-04 01:55 | 207K | |
![[IMG]](/icons/image2.gif) | 1630737520cropped-ba..> | 2021-09-04 06:38 | 46K | |
![[IMG]](/icons/image2.gif) | 1630769176IMG_2021-2..> | 2021-09-04 15:26 | 347K | |
![[IMG]](/icons/image2.gif) | 1630813381Pejrina Lo..> | 2021-09-05 03:43 | 48K | |
![[IMG]](/icons/image2.gif) | 1630875152Better Ber..> | 2021-09-05 20:52 | 8.4K | |
![[IMG]](/icons/image2.gif) | 1630940969IMG_5817 2..> | 2021-09-06 15:09 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1630985560farm mediu..> | 2021-09-07 03:32 | 210K | |
![[IMG]](/icons/image2.gif) | 1631016916Farm heade..> | 2021-09-07 12:15 | 97K | |
![[IMG]](/icons/image2.gif) | 1631027505logo.jpg | 2021-09-07 15:11 | 79K | |
![[IMG]](/icons/image2.gif) | 1631031144AAAB2D93-4..> | 2021-09-07 16:12 | 30K | |
![[IMG]](/icons/image2.gif) | 1631034022C72E4B70-E..> | 2021-09-07 17:00 | 747K | |
![[IMG]](/icons/image2.gif) | 1631035930Stadium Sa..> | 2021-09-07 17:32 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1631040435InShot_202..> | 2021-09-07 18:47 | 575K | |
![[IMG]](/icons/image2.gif) | 1631041422The Blue S..> | 2021-09-07 19:03 | 0 | |
![[IMG]](/icons/image2.gif) | 1631044693Well Groom..> | 2021-09-07 19:58 | 190K | |
![[IMG]](/icons/image2.gif) | 1631048036DOUBLEDUTC..> | 2021-09-07 20:53 | 561K | |
![[IMG]](/icons/image2.gif) | 1631060040IMG_202007..> | 2021-09-08 00:14 | 711K | |
![[IMG]](/icons/image2.gif) | 1631108683FB_IMG_163..> | 2021-09-08 13:44 | 56K | |
![[IMG]](/icons/image2.gif) | 1631117327The Cake C..> | 2021-09-08 16:08 | 513K | |
![[IMG]](/icons/image2.gif) | 1631124420CityScapeW..> | 2021-09-08 18:07 | 306K | |
![[IMG]](/icons/image2.gif) | 1631124662CityScapeW..> | 2021-09-08 18:11 | 306K | |
![[IMG]](/icons/image2.gif) | 1631126555Screen Sho..> | 2021-09-08 18:42 | 277K | |
![[IMG]](/icons/image2.gif) | 1631127911logo pic.jpg | 2021-09-08 19:05 | 36K | |
![[IMG]](/icons/image2.gif) | 1631133674Hazelhaven..> | 2021-09-08 20:41 | 39K | |
![[IMG]](/icons/image2.gif) | 1631137263banner.png | 2021-09-08 21:41 | 88K | |
![[IMG]](/icons/image2.gif) | 1631141422Cabin-1.jpg | 2021-09-08 22:50 | 934K | |
![[IMG]](/icons/image2.gif) | 1631142646Copy of Kn..> | 2021-09-08 23:10 | 34K | |
![[IMG]](/icons/image2.gif) | 1631143411Cabin-1.jpg | 2021-09-08 23:23 | 934K | |
![[IMG]](/icons/image2.gif) | 1631150685Pink on wh..> | 2021-09-09 01:24 | 1.9K | |
![[IMG]](/icons/image2.gif) | 1631150734Pink on wh..> | 2021-09-09 01:25 | 541K | |
![[IMG]](/icons/image2.gif) | 1631193132RF100-Orga..> | 2021-09-09 13:12 | 9.0K | |
![[IMG]](/icons/image2.gif) | 1631208023BPF-fish l..> | 2021-09-09 17:20 | 203K | |
![[IMG]](/icons/image2.gif) | 1631221587logo-web.jpg | 2021-09-09 21:06 | 8.5K | |
![[IMG]](/icons/image2.gif) | 1631221744Together.jpg | 2021-09-09 21:09 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1631221751Together.jpg | 2021-09-09 21:09 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1631239563Tomasic's ..> | 2021-09-10 02:06 | 402K | |
![[IMG]](/icons/image2.gif) | 1631246463image0.jpeg | 2021-09-10 04:01 | 118K | |
![[IMG]](/icons/image2.gif) | 1631276051Fat man ki..> | 2021-09-10 12:14 | 478K | |
![[IMG]](/icons/image2.gif) | 1631287474IMG_1047.jpeg | 2021-09-10 15:24 | 132K | |
![[IMG]](/icons/image2.gif) | 1631292577the_nut_ho..> | 2021-09-10 16:49 | 61K | |
![[IMG]](/icons/image2.gif) | 1631314921Knife, Her..> | 2021-09-10 23:02 | 429K | |
![[IMG]](/icons/image2.gif) | 1631334761radish-ram..> | 2021-09-11 04:32 | 117K | |
![[IMG]](/icons/image2.gif) | 1631449393FFTrishasE..> | 2021-09-12 12:23 | 9.8K | |
![[IMG]](/icons/image2.gif) | 1631481865Prana Heal..> | 2021-09-12 21:24 | 323K | |
![[IMG]](/icons/image2.gif) | 1631550397mok1.png | 2021-09-13 16:26 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1631551825Logo small..> | 2021-09-13 16:50 | 57K | |
![[IMG]](/icons/image2.gif) | 1631553918Square Ico..> | 2021-09-13 17:25 | 316K | |
![[IMG]](/icons/image2.gif) | 1631557023KinneyMini..> | 2021-09-13 18:17 | 77K | |
![[IMG]](/icons/image2.gif) | 1631557604MW RSZ.png | 2021-09-13 18:26 | 236K | |
![[IMG]](/icons/image2.gif) | 1631557972Foxhound-B..> | 2021-09-13 18:32 | 833K | |
![[IMG]](/icons/image2.gif) | 1631562416Alson Farm..> | 2021-09-13 19:46 | 16K | |
![[IMG]](/icons/image2.gif) | 1631575584logo.jpg | 2021-09-13 23:26 | 42K | |
![[IMG]](/icons/image2.gif) | 1631578180The Pie La..> | 2021-09-14 00:09 | 855K | |
![[IMG]](/icons/image2.gif) | 1631578193The Pie La..> | 2021-09-14 00:09 | 855K | |
![[IMG]](/icons/image2.gif) | 1631582218Logo brown..> | 2021-09-14 01:16 | 42K | |
![[IMG]](/icons/image2.gif) | 1631634326RaccoonFor..> | 2021-09-14 15:45 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1631646311green-stem..> | 2021-09-14 19:05 | 64K | |
![[IMG]](/icons/image2.gif) | 1631657095ECFE05AC-3..> | 2021-09-14 22:04 | 144K | |
![[IMG]](/icons/image2.gif) | 1631661369NCA_NewLog..> | 2021-09-14 23:16 | 89K | |
![[IMG]](/icons/image2.gif) | 1631669845me.jpg | 2021-09-15 01:37 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1631745260BCF759CE-A..> | 2021-09-15 22:34 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1631762100Clean_Gene..> | 2021-09-16 03:15 | 34K | |
![[IMG]](/icons/image2.gif) | 1631794920GreenTable..> | 2021-09-16 12:22 | 172K | |
![[IMG]](/icons/image2.gif) | 1631799510Salad_Fork..> | 2021-09-16 13:38 | 25K | |
![[IMG]](/icons/image2.gif) | 1631804536logo small..> | 2021-09-16 15:02 | 7.7K | |
![[IMG]](/icons/image2.gif) | 1631819886Oval Chees..> | 2021-09-16 19:18 | 158K | |
![[IMG]](/icons/image2.gif) | 1631823843ARK_logo-b..> | 2021-09-16 20:24 | 311K | |
![[IMG]](/icons/image2.gif) | 1631845480Middlefork..> | 2021-09-17 02:24 | 469K | |
![[IMG]](/icons/image2.gif) | 1631845513Middlefork..> | 2021-09-17 02:25 | 469K | |
![[IMG]](/icons/image2.gif) | 1631894068GMF Logo.jpg | 2021-09-17 15:54 | 53K | |
![[IMG]](/icons/image2.gif) | 1631909793LogoTaglin..> | 2021-09-17 20:16 | 444K | |
![[IMG]](/icons/image2.gif) | 1631909815LogoTaglin..> | 2021-09-17 20:16 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1631914093B5AEED67-7..> | 2021-09-17 21:28 | 52K | |
![[IMG]](/icons/image2.gif) | 1631965757The Busy F..> | 2021-09-18 11:49 | 45K | |
![[IMG]](/icons/image2.gif) | 1631977084Rottenbill..> | 2021-09-18 14:58 | 395K | |
![[IMG]](/icons/image2.gif) | 1631979674round logo..> | 2021-09-18 15:41 | 168K | |
![[IMG]](/icons/image2.gif) | 1632071433SSB & WHC ..> | 2021-09-19 17:10 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1632078786_Logo (1).png | 2021-09-19 19:13 | 77K | |
![[IMG]](/icons/image2.gif) | 1632152270Stony Cree..> | 2021-09-20 15:37 | 52K | |
![[IMG]](/icons/image2.gif) | 1632156160logo_trans..> | 2021-09-20 16:42 | 35K | |
![[IMG]](/icons/image2.gif) | 1632160404d0d3ab4b95..> | 2021-09-20 17:53 | 14K | |
![[IMG]](/icons/image2.gif) | 1632168062The Comfor..> | 2021-09-20 20:01 | 970K | |
![[IMG]](/icons/image2.gif) | 1632168206The Comfor..> | 2021-09-20 20:03 | 970K | |
![[IMG]](/icons/image2.gif) | 1632185461RiverWatch..> | 2021-09-21 00:51 | 23K | |
![[IMG]](/icons/image2.gif) | 1632208792logo - Cop..> | 2021-09-21 07:19 | 57K | |
![[IMG]](/icons/image2.gif) | 1632208799logo - Cop..> | 2021-09-21 07:19 | 57K | |
![[IMG]](/icons/image2.gif) | 1632232110BBH_Logo_Y..> | 2021-09-21 13:48 | 691K | |
![[IMG]](/icons/image2.gif) | 1632244852Love, Oliv..> | 2021-09-21 17:20 | 54K | |
![[IMG]](/icons/image2.gif) | 1632246758BELLHOLLOW..> | 2021-09-21 17:52 | 76K | |
![[IMG]](/icons/image2.gif) | 1632255050FB_IMG_163..> | 2021-09-21 20:10 | 90K | |
![[IMG]](/icons/image2.gif) | 1632257711Winterfell..> | 2021-09-21 20:55 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1632260232us1.jpg | 2021-09-21 21:37 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1632260240us1.jpg | 2021-09-21 21:37 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1632260282us1.jpg | 2021-09-21 21:38 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1632268598Warm_Heart..> | 2021-09-21 23:56 | 30K | |
![[IMG]](/icons/image2.gif) | 1632327873logo JPEG ..> | 2021-09-22 16:24 | 941K | |
![[IMG]](/icons/image2.gif) | 1632349483CE6ECA65-0..> | 2021-09-22 22:24 | 178K | |
![[IMG]](/icons/image2.gif) | 1632358018Screenshot..> | 2021-09-23 00:46 | 258K | |
![[IMG]](/icons/image2.gif) | 1632402646Untitled.png | 2021-09-23 13:10 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1632402709Untitled.png | 2021-09-23 13:11 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1632407925NOKIDHUNGR..> | 2021-09-23 14:38 | 66K | |
![[IMG]](/icons/image2.gif) | 1632411874rs=w_1440,..> | 2021-09-23 15:44 | 9.7K | |
![[IMG]](/icons/image2.gif) | 1632415583promo2 (3)..> | 2021-09-23 16:46 | 67K | |
![[IMG]](/icons/image2.gif) | 1632489398DTC LOGO M..> | 2021-09-24 13:16 | 17K | |
![[IMG]](/icons/image2.gif) | 1632490544E8C18F37-2..> | 2021-09-24 13:35 | 353K | |
![[IMG]](/icons/image2.gif) | 1632491075SFF_Social..> | 2021-09-24 13:44 | 72K | |
![[IMG]](/icons/image2.gif) | 1632505586Logo_black..> | 2021-09-24 17:46 | 21K | |
![[IMG]](/icons/image2.gif) | 1632507701IMG_2764.JPG | 2021-09-24 18:21 | 103K | |
![[IMG]](/icons/image2.gif) | 1632529618IMG_0307-2..> | 2021-09-25 00:26 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1632533494F29BD248-3..> | 2021-09-25 01:31 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1632588822image.jpg | 2021-09-25 16:53 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1632624702Witsend Fa..> | 2021-09-26 02:51 | 32K | |
![[IMG]](/icons/image2.gif) | 1632758073disklogo.png | 2021-09-27 15:54 | 300K | |
![[IMG]](/icons/image2.gif) | 1632765672RSkombucha..> | 2021-09-27 18:01 | 128K | |
![[IMG]](/icons/image2.gif) | 1632768928Boozer_Log..> | 2021-09-27 18:55 | 141K | |
![[IMG]](/icons/image2.gif) | 1632769092Logo for w..> | 2021-09-27 18:58 | 837K | |
![[IMG]](/icons/image2.gif) | 1632769176Logo for w..> | 2021-09-27 18:59 | 837K | |
![[IMG]](/icons/image2.gif) | 1632770684Borth Beac..> | 2021-09-27 19:24 | 220K | |
![[IMG]](/icons/image2.gif) | 1632770770Borth Beac..> | 2021-09-27 19:26 | 220K | |
![[IMG]](/icons/image2.gif) | 1632774518logo witho..> | 2021-09-27 20:28 | 486K | |
![[IMG]](/icons/image2.gif) | 1632774569new logo ..> | 2021-09-27 20:29 | 28K | |
![[IMG]](/icons/image2.gif) | 1632778668FB_IMG_163..> | 2021-09-27 21:37 | 63K | |
![[IMG]](/icons/image2.gif) | 1632794484pastalogo.jpg | 2021-09-28 02:01 | 31K | |
![[IMG]](/icons/image2.gif) | 1632832697Insta Prof..> | 2021-09-28 12:38 | 31K | |
![[IMG]](/icons/image2.gif) | 1632835200LOGO YEAH ..> | 2021-09-28 13:20 | 138K | |
![[IMG]](/icons/image2.gif) | 1632846083Mattie Lou..> | 2021-09-28 16:21 | 106K | |
![[IMG]](/icons/image2.gif) | 1632852428truck logo..> | 2021-09-28 18:07 | 141K | |
![[IMG]](/icons/image2.gif) | 1632856131FoF-Logo_O..> | 2021-09-28 19:08 | 247K | |
![[IMG]](/icons/image2.gif) | 1632857622Oksana Log..> | 2021-09-28 19:33 | 496K | |
![[IMG]](/icons/image2.gif) | 1632872019Best Logo ..> | 2021-09-28 23:33 | 632K | |
![[IMG]](/icons/image2.gif) | 1632873415logo.png | 2021-09-28 23:56 | 64K | |
![[IMG]](/icons/image2.gif) | 1632930553Text & Lea..> | 2021-09-29 15:49 | 349K | |
![[IMG]](/icons/image2.gif) | 1632930691FB Leaf lo..> | 2021-09-29 15:51 | 135K | |
![[IMG]](/icons/image2.gif) | 1632936813essentials..> | 2021-09-29 17:33 | 144K | |
![[IMG]](/icons/image2.gif) | 1633035222Logo.jpg | 2021-09-30 20:53 | 52K | |
![[IMG]](/icons/image2.gif) | 1633043382received_1..> | 2021-09-30 23:09 | 179K | |
![[IMG]](/icons/image2.gif) | 1633043675FB_IMG_163..> | 2021-09-30 23:14 | 26K | |
![[IMG]](/icons/image2.gif) | 1633054631FB_IMG_157..> | 2021-10-01 02:17 | 24K | |
![[IMG]](/icons/image2.gif) | 1633093101FFF_Warren..> | 2021-10-01 12:58 | 211K | |
![[IMG]](/icons/image2.gif) | 1633109406BBKK.Table..> | 2021-10-01 17:30 | 843K | |
![[IMG]](/icons/image2.gif) | 1633110589Small Soli..> | 2021-10-01 17:49 | 12K | |
![[IMG]](/icons/image2.gif) | 1633110895Effenheim ..> | 2021-10-01 17:54 | 36K | |
![[IMG]](/icons/image2.gif) | 1633110901Bourbon Ba..> | 2021-10-01 17:55 | 349K | |
![[IMG]](/icons/image2.gif) | 1633120731TheBlockLo..> | 2021-10-01 20:38 | 76K | |
![[IMG]](/icons/image2.gif) | 1633124414block phon..> | 2021-10-01 21:40 | 123K | |
![[IMG]](/icons/image2.gif) | 1633147526Yoli_Icon_..> | 2021-10-02 04:05 | 64K | |
![[IMG]](/icons/image2.gif) | 1633160492srdfghjkl.jpg | 2021-10-02 07:41 | 249K | |
![[IMG]](/icons/image2.gif) | 1633202775logo2.jpg | 2021-10-02 19:26 | 507K | |
![[IMG]](/icons/image2.gif) | 1633233523unnamed (2..> | 2021-10-03 03:58 | 19K | |
![[IMG]](/icons/image2.gif) | 1633277888Market Wag..> | 2021-10-03 16:18 | 64K | |
![[IMG]](/icons/image2.gif) | 1633285239logo (1).png | 2021-10-03 18:20 | 109K | |
![[IMG]](/icons/image2.gif) | 1633328563Clover Val..> | 2021-10-04 06:22 | 289K | |
![[IMG]](/icons/image2.gif) | 1633381371AMA ORIGIN..> | 2021-10-04 21:02 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1633383407Chesapeake..> | 2021-10-04 21:36 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1633383438Chesapeake..> | 2021-10-04 21:37 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1633387275B5824525-0..> | 2021-10-04 22:41 | 909K | |
![[IMG]](/icons/image2.gif) | 1633401123IMG_1604.jpeg | 2021-10-05 02:32 | 540K | |
![[IMG]](/icons/image2.gif) | 1633445700Sunflower ..> | 2021-10-05 14:55 | 207K | |
![[IMG]](/icons/image2.gif) | 1633446608Mitten.png | 2021-10-05 15:10 | 38K | |
![[IMG]](/icons/image2.gif) | 1633454129The Block ..> | 2021-10-05 17:15 | 907K | |
![[IMG]](/icons/image2.gif) | 1633462049HHH-Logo_C..> | 2021-10-05 19:27 | 204K | |
![[IMG]](/icons/image2.gif) | 1633484675IMG_4739.jpg | 2021-10-06 01:44 | 631K | |
![[IMG]](/icons/image2.gif) | 1633531692PRINT-0652..> | 2021-10-06 14:48 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1633531807PRINT-0660..> | 2021-10-06 14:50 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1633531837Web-06600.jpg | 2021-10-06 14:50 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1633541562Logo Black..> | 2021-10-06 17:32 | 154K | |
![[IMG]](/icons/image2.gif) | 1633541599Logo Black..> | 2021-10-06 17:33 | 181K | |
![[IMG]](/icons/image2.gif) | 1633544273Family Pic..> | 2021-10-06 18:17 | 353K | |
![[IMG]](/icons/image2.gif) | 1633544410Family Pic..> | 2021-10-06 18:20 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1633546169Chesapeake..> | 2021-10-06 18:49 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1633551998Polish_202..> | 2021-10-06 20:26 | 61K | |
![[IMG]](/icons/image2.gif) | 1633565129HHH-Logo_C..> | 2021-10-07 00:05 | 139K | |
![[IMG]](/icons/image2.gif) | 1633565760Untitled d..> | 2021-10-07 00:16 | 84K | |
![[IMG]](/icons/image2.gif) | 1633600718king cake ..> | 2021-10-07 09:58 | 86K | |
![[IMG]](/icons/image2.gif) | 1633618717wheat.jpg | 2021-10-07 14:58 | 110K | |
![[IMG]](/icons/image2.gif) | 1633619246TTG-circle..> | 2021-10-07 15:07 | 12K | |
![[IMG]](/icons/image2.gif) | 1633623095TTGLogo-We..> | 2021-10-07 16:11 | 609K | |
![[IMG]](/icons/image2.gif) | 1633623099DRF25thLog..> | 2021-10-07 16:11 | 25K | |
![[IMG]](/icons/image2.gif) | 1633624574em.jpg | 2021-10-07 16:36 | 7.6K | |
![[IMG]](/icons/image2.gif) | 1633631109AMA ORIGIN..> | 2021-10-07 18:25 | 673K | |
![[IMG]](/icons/image2.gif) | 1633636232logo_2021.png | 2021-10-07 19:50 | 8.2K | |
![[IMG]](/icons/image2.gif) | 1633636961Metro Micr..> | 2021-10-07 20:02 | 37K | |
![[IMG]](/icons/image2.gif) | 1633637469canstockph..> | 2021-10-07 20:11 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1633657428HC Logo.png | 2021-10-08 01:43 | 82K | |
![[IMG]](/icons/image2.gif) | 1633698932GVF Full L..> | 2021-10-08 13:15 | 43K | |
![[IMG]](/icons/image2.gif) | 1633709546FD Machine..> | 2021-10-08 16:12 | 14K | |
![[IMG]](/icons/image2.gif) | 1633916357tallpinesf..> | 2021-10-11 01:39 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1633954385Cannon Val..> | 2021-10-11 12:13 | 604K | |
![[IMG]](/icons/image2.gif) | 1633972770FB_IMG_161..> | 2021-10-11 17:19 | 18K | |
![[IMG]](/icons/image2.gif) | 1633985403FB_IMG_163..> | 2021-10-11 20:50 | 121K | |
![[IMG]](/icons/image2.gif) | 1633996060LOGO WE LO..> | 2021-10-11 23:47 | 194K | |
![[IMG]](/icons/image2.gif) | 1634001390PP logo (e..> | 2021-10-12 01:16 | 643K | |
![[IMG]](/icons/image2.gif) | 1634009108A50F589E-3..> | 2021-10-12 03:25 | 94K | |
![[IMG]](/icons/image2.gif) | 1634046814High Prime..> | 2021-10-12 13:53 | 65K | |
![[IMG]](/icons/image2.gif) | 1634068993CRYSTAL-BA..> | 2021-10-12 20:03 | 63K | |
![[IMG]](/icons/image2.gif) | 1634085251market set..> | 2021-10-13 00:34 | 819K | |
![[IMG]](/icons/image2.gif) | 1634089019newlogo.png | 2021-10-13 01:36 | 86K | |
![[IMG]](/icons/image2.gif) | 1634120388Platinum F..> | 2021-10-13 10:19 | 25K | |
![[IMG]](/icons/image2.gif) | 1634136820Meat_Craft..> | 2021-10-13 14:53 | 62K | |
![[IMG]](/icons/image2.gif) | 1634137940Bee happy.jpg | 2021-10-13 15:12 | 62K | |
![[IMG]](/icons/image2.gif) | 1634148642logo_size_..> | 2021-10-13 18:10 | 11K | |
![[IMG]](/icons/image2.gif) | 1634150392Becky the ..> | 2021-10-13 18:39 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1634154710IMG_5983.jpg | 2021-10-13 19:51 | 591K | |
![[IMG]](/icons/image2.gif) | 1634156687SalsaGreg.jpg | 2021-10-13 20:24 | 25K | |
![[IMG]](/icons/image2.gif) | 1634156702SalsaGreg.jpg | 2021-10-13 20:25 | 25K | |
![[IMG]](/icons/image2.gif) | 1634166628Bauman-Aut..> | 2021-10-13 23:10 | 67K | |
![[IMG]](/icons/image2.gif) | 1634172079Noted-Prof..> | 2021-10-14 00:41 | 79K | |
![[IMG]](/icons/image2.gif) | 1634176191Label logo..> | 2021-10-14 01:49 | 156K | |
![[IMG]](/icons/image2.gif) | 1634224064LOGO-COCOR..> | 2021-10-14 15:07 | 402K | |
![[IMG]](/icons/image2.gif) | 1634232471Drawn Logo..> | 2021-10-14 17:27 | 461K | |
![[IMG]](/icons/image2.gif) | 1634234434thumbnail_..> | 2021-10-14 18:00 | 39K | |
![[IMG]](/icons/image2.gif) | 1634238913IMG_4375-1..> | 2021-10-14 19:15 | 105K | |
![[IMG]](/icons/image2.gif) | 1634256652logo111.jpg | 2021-10-15 00:10 | 146K | |
![[IMG]](/icons/image2.gif) | 1634259257LLMC[1218]..> | 2021-10-15 00:54 | 85K | |
![[IMG]](/icons/image2.gif) | 1634265896T&D.png | 2021-10-15 02:44 | 16K | |
![[IMG]](/icons/image2.gif) | 1634297920RP SocMed ..> | 2021-10-15 11:38 | 55K | |
![[IMG]](/icons/image2.gif) | 1634312680NightOwlLo..> | 2021-10-15 15:44 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1634317594IMG_202012..> | 2021-10-15 17:06 | 395K | |
![[IMG]](/icons/image2.gif) | 1634318736Logo3.png | 2021-10-15 17:25 | 382K | |
![[IMG]](/icons/image2.gif) | 1634322399Copy of Mo..> | 2021-10-15 18:26 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1634335513Untitled d..> | 2021-10-15 22:05 | 199K | |
![[IMG]](/icons/image2.gif) | 1634337956Greenhouse..> | 2021-10-15 22:45 | 415K | |
![[IMG]](/icons/image2.gif) | 1634344815OCONEE-VAL..> | 2021-10-16 00:40 | 198K | |
![[IMG]](/icons/image2.gif) | 1634358664QueenCityT..> | 2021-10-16 04:31 | 527K | |
![[IMG]](/icons/image2.gif) | 1634483481Untitled d..> | 2021-10-17 15:11 | 66K | |
![[IMG]](/icons/image2.gif) | 1634588189B&B_EmbC_P..> | 2021-10-18 20:16 | 585K | |
![[IMG]](/icons/image2.gif) | 1634595496IMG_E5874.JPG | 2021-10-18 22:18 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1634640007FB logo MS..> | 2021-10-19 10:40 | 218K | |
![[IMG]](/icons/image2.gif) | 1634661805Working Co..> | 2021-10-19 16:43 | 501K | |
![[IMG]](/icons/image2.gif) | 1634674552Leo's Eggs..> | 2021-10-19 20:15 | 109K | |
![[IMG]](/icons/image2.gif) | 1634676718IMG_0679 4..> | 2021-10-19 20:51 | 145K | |
![[IMG]](/icons/image2.gif) | 1634678741E869C8B6-E..> | 2021-10-19 21:25 | 423K | |
![[IMG]](/icons/image2.gif) | 1634678775FD5D5294-0..> | 2021-10-19 21:26 | 26K | |
![[IMG]](/icons/image2.gif) | 1634683019E1F3E2C8-1..> | 2021-10-19 22:36 | 37K | |
![[IMG]](/icons/image2.gif) | 1634738229jchick.jpg | 2021-10-20 13:57 | 138K | |
![[IMG]](/icons/image2.gif) | 1634744074BE5423E6-1..> | 2021-10-20 15:34 | 853K | |
![[IMG]](/icons/image2.gif) | 1634750333Screenshot..> | 2021-10-20 17:18 | 61K | |
![[IMG]](/icons/image2.gif) | 1634759550logo.png | 2021-10-20 19:52 | 38K | |
![[IMG]](/icons/image2.gif) | 1634776923logo.jpg | 2021-10-21 00:42 | 157K | |
![[IMG]](/icons/image2.gif) | 1634816264ZingariMan..> | 2021-10-21 11:37 | 6.6K | |
![[IMG]](/icons/image2.gif) | 1634845461laurasnest..> | 2021-10-21 19:44 | 807K | |
![[IMG]](/icons/image2.gif) | 1634874722Aks homema..> | 2021-10-22 03:52 | 628K | |
![[IMG]](/icons/image2.gif) | 1634875055Aks homema..> | 2021-10-22 03:57 | 628K | |
![[IMG]](/icons/image2.gif) | 1634918045peonies.png | 2021-10-22 15:54 | 110K | |
![[IMG]](/icons/image2.gif) | 1634918074circle-cro..> | 2021-10-22 15:54 | 149K | |
![[IMG]](/icons/image2.gif) | 1634918083circle-cro..> | 2021-10-22 15:54 | 149K | |
![[IMG]](/icons/image2.gif) | 1634923619Ryans.Orig..> | 2021-10-22 17:26 | 311K | |
![[IMG]](/icons/image2.gif) | 1634934190Me.jpg | 2021-10-22 20:23 | 285K | |
![[IMG]](/icons/image2.gif) | 1634934201ADD76FDE-B..> | 2021-10-22 20:23 | 305K | |
![[IMG]](/icons/image2.gif) | 1635045130F448EA75-F..> | 2021-10-24 03:12 | 55K | |
![[IMG]](/icons/image2.gif) | 1635162788logo_size.jpg | 2021-10-25 11:53 | 16K | |
![[IMG]](/icons/image2.gif) | 1635195162texture ho..> | 2021-10-25 20:52 | 85K | |
![[IMG]](/icons/image2.gif) | 1635195844HM_farm_Sy..> | 2021-10-25 21:04 | 35K | |
![[IMG]](/icons/image2.gif) | 1635197411MarketWago..> | 2021-10-25 21:30 | 160K | |
![[IMG]](/icons/image2.gif) | 1635206169F46262DA-A..> | 2021-10-25 23:56 | 198K | |
![[IMG]](/icons/image2.gif) | 1635214270ES Meats w..> | 2021-10-26 02:11 | 7.0K | |
![[IMG]](/icons/image2.gif) | 1635264336path883-2-..> | 2021-10-26 16:05 | 73K | |
![[IMG]](/icons/image2.gif) | 1635267881Etsy Item ..> | 2021-10-26 17:04 | 195K | |
![[IMG]](/icons/image2.gif) | 1635274394picture.jp..> | 2021-10-26 18:53 | 105K | |
![[IMG]](/icons/image2.gif) | 1635288778ZFPP Logo.png | 2021-10-26 22:52 | 80K | |
![[IMG]](/icons/image2.gif) | 1635297286wsl-DF-whi..> | 2021-10-27 01:14 | 148K | |
![[IMG]](/icons/image2.gif) | 1635297362DF Notific..> | 2021-10-27 01:16 | 74K | |
![[IMG]](/icons/image2.gif) | 1635304604IMG_2413.jpg | 2021-10-27 03:16 | 130K | |
![[IMG]](/icons/image2.gif) | 1635305660images.jpe..> | 2021-10-27 03:34 | 8.4K | |
![[IMG]](/icons/image2.gif) | 1635305669images.jpe..> | 2021-10-27 03:34 | 8.4K | |
![[IMG]](/icons/image2.gif) | 1635354368MONCstuff_..> | 2021-10-27 17:06 | 18K | |
![[IMG]](/icons/image2.gif) | 1635354771CowsGrazin..> | 2021-10-27 17:12 | 27K | |
![[IMG]](/icons/image2.gif) | 1635359353C4868EEF-F..> | 2021-10-27 18:29 | 204K | |
![[IMG]](/icons/image2.gif) | 1635372097Atlanta Da..> | 2021-10-27 22:01 | 181K | |
![[IMG]](/icons/image2.gif) | 1635373756circle tnk..> | 2021-10-27 22:29 | 138K | |
![[IMG]](/icons/image2.gif) | 1635375058Small-Muer..> | 2021-10-27 22:50 | 237K | |
![[IMG]](/icons/image2.gif) | 1635435205TheFarm178..> | 2021-10-28 15:33 | 58K | |
![[IMG]](/icons/image2.gif) | 1635458731Southern S..> | 2021-10-28 22:05 | 20K | |
![[IMG]](/icons/image2.gif) | 1635505266image0.jpeg | 2021-10-29 11:01 | 87K | |
![[IMG]](/icons/image2.gif) | 1635509789logo final..> | 2021-10-29 12:16 | 237K | |
![[IMG]](/icons/image2.gif) | 1635520976Heartwood_..> | 2021-10-29 15:22 | 290K | |
![[IMG]](/icons/image2.gif) | 1635603053Aimes Gour..> | 2021-10-30 14:10 | 183K | |
![[IMG]](/icons/image2.gif) | 1635627084A2E95941-7..> | 2021-10-30 20:51 | 157K | |
![[IMG]](/icons/image2.gif) | 1635636116GDM_llc-RW..> | 2021-10-30 23:21 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1635772123ManeMush2_..> | 2021-11-01 13:08 | 171K | |
![[IMG]](/icons/image2.gif) | 1635796844Cute sunsh..> | 2021-11-01 20:00 | 628K | |
![[IMG]](/icons/image2.gif) | 1635798647Logo Baker..> | 2021-11-01 20:30 | 246K | |
![[IMG]](/icons/image2.gif) | 1635809477logo.jpg | 2021-11-01 23:31 | 697K | |
![[IMG]](/icons/image2.gif) | 1635814194soap_logo_..> | 2021-11-02 00:49 | 77K | |
![[IMG]](/icons/image2.gif) | 1635814515soap_logo_..> | 2021-11-02 00:55 | 77K | |
![[IMG]](/icons/image2.gif) | 1635819743Messages I..> | 2021-11-02 02:22 | 110K | |
![[IMG]](/icons/image2.gif) | 1635885995AMF_Logo.jpg | 2021-11-02 20:46 | 475K | |
![[IMG]](/icons/image2.gif) | 1635887828Indianapol..> | 2021-11-02 21:17 | 30K | |
![[IMG]](/icons/image2.gif) | 1635887839German Cho..> | 2021-11-02 21:17 | 873K | |
![[IMG]](/icons/image2.gif) | 1635903480IMG_202006..> | 2021-11-03 01:38 | 48K | |
![[IMG]](/icons/image2.gif) | 1635961684GFY Logo w..> | 2021-11-03 17:48 | 48K | |
![[IMG]](/icons/image2.gif) | 1635990070CRAVE_logo..> | 2021-11-04 01:41 | 799K | |
![[IMG]](/icons/image2.gif) | 1635990363CRAVE_logo..> | 2021-11-04 01:46 | 799K | |
![[IMG]](/icons/image2.gif) | 1635990405Crave-Chri..> | 2021-11-04 01:46 | 14K | |
![[IMG]](/icons/image2.gif) | 1635990414Crave-Chri..> | 2021-11-04 01:46 | 14K | |
![[IMG]](/icons/image2.gif) | 1635990418Crave-Chri..> | 2021-11-04 01:46 | 14K | |
![[IMG]](/icons/image2.gif) | 1635990474Crave Chri..> | 2021-11-04 01:47 | 42K | |
![[IMG]](/icons/image2.gif) | 1635990480Crave Chri..> | 2021-11-04 01:48 | 42K | |
![[IMG]](/icons/image2.gif) | 1636034473mountslogo..> | 2021-11-04 14:01 | 390K | |
![[IMG]](/icons/image2.gif) | 1636034593mountslogo..> | 2021-11-04 14:03 | 342K | |
![[IMG]](/icons/image2.gif) | 1636040542ML Name on..> | 2021-11-04 15:42 | 108K | |
![[IMG]](/icons/image2.gif) | 1636049543Zero Zero ..> | 2021-11-04 18:12 | 87K | |
![[IMG]](/icons/image2.gif) | 1636049545Zero Zero ..> | 2021-11-04 18:12 | 87K | |
![[IMG]](/icons/image2.gif) | 1636065663Cafe Press..> | 2021-11-04 22:41 | 269K | |
![[IMG]](/icons/image2.gif) | 1636129390hill n dal..> | 2021-11-05 16:23 | 191K | |
![[IMG]](/icons/image2.gif) | 1636129795logo.jpg | 2021-11-05 16:29 | 102K | |
![[IMG]](/icons/image2.gif) | 1636131517final logo..> | 2021-11-05 16:58 | 803K | |
![[IMG]](/icons/image2.gif) | 1636138578IMG_202008..> | 2021-11-05 18:56 | 41K | |
![[IMG]](/icons/image2.gif) | 1636151768Screenshot..> | 2021-11-05 22:36 | 916K | |
![[IMG]](/icons/image2.gif) | 1636151893Screenshot..> | 2021-11-05 22:38 | 167K | |
![[IMG]](/icons/image2.gif) | 1636379416IMG_6184.JPG | 2021-11-08 13:50 | 79K | |
![[IMG]](/icons/image2.gif) | 1636397604Clear_back..> | 2021-11-08 18:53 | 33K | |
![[IMG]](/icons/image2.gif) | 1636407386logo.png | 2021-11-08 21:36 | 39K | |
![[IMG]](/icons/image2.gif) | 1636407970B0981CD3-4..> | 2021-11-08 21:46 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1636484215profile.jpeg | 2021-11-09 18:56 | 437K | |
![[IMG]](/icons/image2.gif) | 1636488502Screenshot..> | 2021-11-09 20:08 | 220K | |
![[IMG]](/icons/image2.gif) | 1636497705LOGO FINAL..> | 2021-11-09 22:41 | 49K | |
![[IMG]](/icons/image2.gif) | 1636509618BlueRooste..> | 2021-11-10 02:00 | 185K | |
![[IMG]](/icons/image2.gif) | 1636509647BlueRooste..> | 2021-11-10 02:00 | 185K | |
![[IMG]](/icons/image2.gif) | 1636513607BlueRooste..> | 2021-11-10 03:06 | 185K | |
![[IMG]](/icons/image2.gif) | 1636513726BlueRooste..> | 2021-11-10 03:08 | 363K | |
![[IMG]](/icons/image2.gif) | 1636513758BlueRooste..> | 2021-11-10 03:09 | 185K | |
![[IMG]](/icons/image2.gif) | 1636543825nici & tbo..> | 2021-11-10 11:30 | 166K | |
![[IMG]](/icons/image2.gif) | 1636567059Icon & Nam..> | 2021-11-10 17:57 | 255K | |
![[IMG]](/icons/image2.gif) | 1636571969FF5DB2DA-6..> | 2021-11-10 19:19 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1636585905Model Cake..> | 2021-11-10 23:11 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1636645926Screen Sho..> | 2021-11-11 15:52 | 86K | |
![[IMG]](/icons/image2.gif) | 1636653097crop185265..> | 2021-11-11 17:51 | 361K | |
![[IMG]](/icons/image2.gif) | 1636663632D0018335-0..> | 2021-11-11 20:47 | 528K | |
![[IMG]](/icons/image2.gif) | 1636718782C9814CCE-1..> | 2021-11-12 12:06 | 754K | |
![[IMG]](/icons/image2.gif) | 1636718799C9814CCE-1..> | 2021-11-12 12:06 | 754K | |
![[IMG]](/icons/image2.gif) | 1636728623Logo Verti..> | 2021-11-12 14:50 | 383K | |
![[IMG]](/icons/image2.gif) | 1636737716withblackB..> | 2021-11-12 17:21 | 500K | |
![[IMG]](/icons/image2.gif) | 1636757135Central Il..> | 2021-11-12 22:45 | 651K | |
![[IMG]](/icons/image2.gif) | 1636776997Athena Col..> | 2021-11-13 04:16 | 75K | |
![[IMG]](/icons/image2.gif) | 1636777020Athena Col..> | 2021-11-13 04:17 | 590K | |
![[IMG]](/icons/image2.gif) | 1636926494IMG_5323.jpg | 2021-11-14 21:48 | 660K | |
![[IMG]](/icons/image2.gif) | 1636929973IMG_3817.jpg | 2021-11-14 22:46 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1636938303DBites ico..> | 2021-11-15 01:05 | 182K | |
![[IMG]](/icons/image2.gif) | 1636941961Luminary C..> | 2021-11-15 02:06 | 862K | |
![[IMG]](/icons/image2.gif) | 1637013714TSP_Pink_P..> | 2021-11-15 22:01 | 37K | |
![[IMG]](/icons/image2.gif) | 1637028315Gallon Jug..> | 2021-11-16 02:05 | 66K | |
![[IMG]](/icons/image2.gif) | 1637029071IMG_5499:P..> | 2021-11-16 02:17 | 40K | |
![[IMG]](/icons/image2.gif) | 1637030923internatio..> | 2021-11-16 02:48 | 0 | |
![[IMG]](/icons/image2.gif) | 1637066802MarketWago..> | 2021-11-16 12:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | 1637084002OHIO RED B..> | 2021-11-16 17:33 | 748K | |
![[IMG]](/icons/image2.gif) | 1637154675butterfly_..> | 2021-11-17 13:11 | 215K | |
![[IMG]](/icons/image2.gif) | 1637163753egg pictur..> | 2021-11-17 15:42 | 131K | |
![[IMG]](/icons/image2.gif) | 1637174192wheat.jpg | 2021-11-17 18:36 | 440K | |
![[IMG]](/icons/image2.gif) | 1637193853IMG_201807..> | 2021-11-18 00:04 | 108K | |
![[IMG]](/icons/image2.gif) | 1637251259East View ..> | 2021-11-18 16:00 | 274K | |
![[IMG]](/icons/image2.gif) | 1637270960barn & Hou..> | 2021-11-18 21:29 | 74K | |
![[IMG]](/icons/image2.gif) | 1637595352frontcropp..> | 2021-11-22 15:35 | 400K | |
![[IMG]](/icons/image2.gif) | 1637597395logo.JPG | 2021-11-22 16:09 | 15K | |
![[IMG]](/icons/image2.gif) | 1637597458logo (2).JPG | 2021-11-22 16:10 | 28K | |
![[IMG]](/icons/image2.gif) | 1637618415FB_IMG_163..> | 2021-11-22 22:00 | 76K | |
![[IMG]](/icons/image2.gif) | 1637618433FB_IMG_163..> | 2021-11-22 22:00 | 76K | |
![[IMG]](/icons/image2.gif) | 1637695079goat and m..> | 2021-11-23 19:17 | 72K | |
![[IMG]](/icons/image2.gif) | 1637717800DSC_1009-m..> | 2021-11-24 01:36 | 907K | |
![[IMG]](/icons/image2.gif) | 1637948862Gretta Mar..> | 2021-11-26 17:47 | 46K | |
![[IMG]](/icons/image2.gif) | 1638195934logo.png | 2021-11-29 14:25 | 18K | |
![[IMG]](/icons/image2.gif) | 1638202974RoamingBis..> | 2021-11-29 16:22 | 189K | |
![[IMG]](/icons/image2.gif) | 1638203060sausage ba..> | 2021-11-29 16:24 | 130K | |
![[IMG]](/icons/image2.gif) | 1638214241auspicious..> | 2021-11-29 19:30 | 166K | |
![[IMG]](/icons/image2.gif) | 1638218507hemp line ..> | 2021-11-29 20:41 | 675K | |
![[IMG]](/icons/image2.gif) | 1638226442image001 (..> | 2021-11-29 22:54 | 61K | |
![[IMG]](/icons/image2.gif) | 1638235436Screenshot..> | 2021-11-30 01:23 | 319K | |
![[IMG]](/icons/image2.gif) | 1638292642cove creek..> | 2021-11-30 17:17 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1638293634advertisin..> | 2021-11-30 17:33 | 97K | |
![[IMG]](/icons/image2.gif) | 1638293991A4FB26F7-5..> | 2021-11-30 17:39 | 152K | |
![[IMG]](/icons/image2.gif) | 1638294936Main Logo.jpg | 2021-11-30 17:55 | 66K | |
![[IMG]](/icons/image2.gif) | 1638327678happy camp..> | 2021-12-01 03:01 | 57K | |
![[IMG]](/icons/image2.gif) | 1638377259Hawk Farms..> | 2021-12-01 16:47 | 76K | |
![[IMG]](/icons/image2.gif) | 1638377900gnomecoupl..> | 2021-12-01 16:58 | 150K | |
![[IMG]](/icons/image2.gif) | 1638378347seal1.jpg | 2021-12-01 17:05 | 15K | |
![[IMG]](/icons/image2.gif) | 1638381883logo.png | 2021-12-01 18:04 | 23K | |
![[IMG]](/icons/image2.gif) | 1638387141MW_LOGO_CM..> | 2021-12-01 19:32 | 73K | |
![[IMG]](/icons/image2.gif) | 1638398685Robinson H..> | 2021-12-01 22:44 | 658K | |
![[IMG]](/icons/image2.gif) | 1638459466FranklinsC..> | 2021-12-02 15:37 | 110K | |
![[IMG]](/icons/image2.gif) | 1638475896Little Eur..> | 2021-12-02 20:11 | 50K | |
![[IMG]](/icons/image2.gif) | 1638478245bee yard 1..> | 2021-12-02 20:50 | 40K | |
![[IMG]](/icons/image2.gif) | 1638542750CSLogo-Cul..> | 2021-12-03 14:45 | 309K | |
![[IMG]](/icons/image2.gif) | 1638667562hrf_logo_3..> | 2021-12-05 01:26 | 444K | |
![[IMG]](/icons/image2.gif) | 1638720958Logo_Katie..> | 2021-12-05 16:15 | 705K | |
![[IMG]](/icons/image2.gif) | 1638727258Linwood Lo..> | 2021-12-05 18:00 | 128K | |
![[IMG]](/icons/image2.gif) | 1638740493Internet_2..> | 2021-12-05 21:41 | 15K | |
![[IMG]](/icons/image2.gif) | 1638817841Better Kom..> | 2021-12-06 19:10 | 19K | |
![[IMG]](/icons/image2.gif) | 1638828216IMG_E2668...> | 2021-12-06 22:03 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1638838970Big Guy BB..> | 2021-12-07 01:02 | 109K | |
![[IMG]](/icons/image2.gif) | 1638848151bw.PNG | 2021-12-07 03:35 | 49K | |
![[IMG]](/icons/image2.gif) | 1638900053DDC6670D-9..> | 2021-12-07 18:00 | 49K | |
![[IMG]](/icons/image2.gif) | 1638900525Logo.png | 2021-12-07 18:08 | 32K | |
![[IMG]](/icons/image2.gif) | 1638911601Crochet Cu..> | 2021-12-07 21:13 | 64K | |
![[IMG]](/icons/image2.gif) | 1638913134E76B85F5-F..> | 2021-12-07 21:38 | 188K | |
![[IMG]](/icons/image2.gif) | 1638962569AmberKeirn..> | 2021-12-08 11:22 | 138K | |
![[IMG]](/icons/image2.gif) | 1638963537AmberKeirn..> | 2021-12-08 11:38 | 138K | |
![[IMG]](/icons/image2.gif) | 1638973175FF5ADC46-1..> | 2021-12-08 14:19 | 188K | |
![[IMG]](/icons/image2.gif) | 1639013782leviathan ..> | 2021-12-09 01:36 | 964K | |
![[IMG]](/icons/image2.gif) | 1639154845FTLOD_Prim..> | 2021-12-10 16:47 | 59K | |
![[IMG]](/icons/image2.gif) | 1639168759Business C..> | 2021-12-10 20:39 | 16K | |
![[IMG]](/icons/image2.gif) | 1639186337isbl_1680x..> | 2021-12-11 01:32 | 165K | |
![[IMG]](/icons/image2.gif) | 1639186457yankee.jpg | 2021-12-11 01:34 | 45K | |
![[IMG]](/icons/image2.gif) | 1639249857D7E75E19-5..> | 2021-12-11 19:10 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1639361048galaxy log..> | 2021-12-13 02:04 | 99K | |
![[IMG]](/icons/image2.gif) | 1639538820IMG_4036.jpg | 2021-12-15 03:27 | 559K | |
![[IMG]](/icons/image2.gif) | 1639538867IMG_2944.jpg | 2021-12-15 03:27 | 878K | |
![[IMG]](/icons/image2.gif) | 1639583972ALO CIRCLE..> | 2021-12-15 15:59 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1639600059C43F421C-C..> | 2021-12-15 20:27 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1639600108C43F421C-C..> | 2021-12-15 20:28 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1639610420JPEG LOGO.jpg | 2021-12-15 23:20 | 51K | |
![[IMG]](/icons/image2.gif) | 1639610457ALO CIRCLE..> | 2021-12-15 23:20 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1639671628marketwago..> | 2021-12-16 16:20 | 305K | |
![[IMG]](/icons/image2.gif) | 1639679243Market-wag..> | 2021-12-16 18:27 | 15K | |
![[IMG]](/icons/image2.gif) | 1639718535food.jpg | 2021-12-17 05:22 | 5.9K | |
![[IMG]](/icons/image2.gif) | 1639751948test1.png | 2021-12-17 14:39 | 12K | |
![[IMG]](/icons/image2.gif) | 1639875903IMG_0748.jpg | 2021-12-19 01:05 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1639962670familypic...> | 2021-12-20 01:11 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1640010609FB_IMG_164..> | 2021-12-20 14:30 | 616K | |
![[IMG]](/icons/image2.gif) | 1640105859CBDM Logo.png | 2021-12-21 16:57 | 548K | |
![[IMG]](/icons/image2.gif) | 1640231006Joe and Sa..> | 2021-12-23 03:43 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1640271880Resized_20..> | 2021-12-23 15:04 | 4.5M | |
![[IMG]](/icons/image2.gif) | 1640470702boarding p..> | 2021-12-25 22:18 | 87K | |
![[IMG]](/icons/image2.gif) | 1640555324Screen Sho..> | 2021-12-26 21:48 | 158K | |
![[IMG]](/icons/image2.gif) | 1640629061Heart 2 He..> | 2021-12-27 18:17 | 55K | |
![[IMG]](/icons/image2.gif) | 1640707658nanigirl.jpeg | 2021-12-28 16:07 | 818K | |
![[IMG]](/icons/image2.gif) | 1640709830LBN - Tran..> | 2021-12-28 16:43 | 81K | |
![[IMG]](/icons/image2.gif) | 1640728571New Evolut..> | 2021-12-28 21:56 | 101K | |
![[IMG]](/icons/image2.gif) | 1640728621New Evolut..> | 2021-12-28 21:57 | 131K | |
![[IMG]](/icons/image2.gif) | 1640798201Evergrass ..> | 2021-12-29 17:16 | 179K | |
![[IMG]](/icons/image2.gif) | 1640804249Milesround..> | 2021-12-29 18:57 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1640820180imagejpeg_..> | 2021-12-29 23:23 | 968K | |
![[IMG]](/icons/image2.gif) | 1640820232imagejpeg_..> | 2021-12-29 23:23 | 968K | |
![[IMG]](/icons/image2.gif) | 1640840916Screenshot..> | 2021-12-30 05:08 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1640866105logo.jpg | 2021-12-30 12:08 | 202K | |
![[IMG]](/icons/image2.gif) | 1640871407Picture1.png | 2021-12-30 13:36 | 17K | |
![[IMG]](/icons/image2.gif) | 1640887486IG_Penelop..> | 2021-12-30 18:04 | 39K | |
![[IMG]](/icons/image2.gif) | 1640888486SiliskiSoa..> | 2021-12-30 18:21 | 25K | |
![[IMG]](/icons/image2.gif) | 1640910145default_us..> | 2021-12-31 00:22 | 14K | |
![[IMG]](/icons/image2.gif) | 1640987888CREES BEES..> | 2021-12-31 21:58 | 292K | |
![[IMG]](/icons/image2.gif) | 1641147066homestead ..> | 2022-01-02 18:11 | 422K | |
![[IMG]](/icons/image2.gif) | 1641227501IMG_202111..> | 2022-01-03 16:31 | 5.1M | |
![[IMG]](/icons/image2.gif) | 1641235438Triple R P..> | 2022-01-03 18:43 | 666K | |
![[IMG]](/icons/image2.gif) | 1641258588SGF_Logo.jpg | 2022-01-04 01:09 | 95K | |
![[IMG]](/icons/image2.gif) | 1641396774KrysiasKit..> | 2022-01-05 15:32 | 193K | |
![[IMG]](/icons/image2.gif) | 1641405012NJB_Artwor..> | 2022-01-05 17:50 | 578K | |
![[IMG]](/icons/image2.gif) | 1641412422logo.jpg | 2022-01-05 19:53 | 296K | |
![[IMG]](/icons/image2.gif) | 1641419090Logo.png | 2022-01-05 21:44 | 86K | |
![[IMG]](/icons/image2.gif) | 1641479665MX6 Logo.jpg | 2022-01-06 14:34 | 593K | |
![[IMG]](/icons/image2.gif) | 1641500956labellogo.jpg | 2022-01-06 20:29 | 99K | |
![[IMG]](/icons/image2.gif) | 1641577991WIN_202009..> | 2022-01-07 17:53 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1641583725cedar-vall..> | 2022-01-07 19:28 | 66K | |
![[IMG]](/icons/image2.gif) | 1641585609Satsuma-Ma..> | 2022-01-07 20:00 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1641655919Screenshot..> | 2022-01-08 15:31 | 530K | |
![[IMG]](/icons/image2.gif) | 1641688074Copy of La..> | 2022-01-09 00:27 | 364K | |
![[IMG]](/icons/image2.gif) | 1641765718Black Cap ..> | 2022-01-09 22:01 | 523K | |
![[IMG]](/icons/image2.gif) | 1641834771E3837FC8-A..> | 2022-01-10 17:12 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1641844107IMG_1546.jpg | 2022-01-10 19:48 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1641849345Goodbye202..> | 2022-01-10 21:15 | 820K | |
![[IMG]](/icons/image2.gif) | 1641852161boso logo.png | 2022-01-10 22:02 | 82K | |
![[IMG]](/icons/image2.gif) | 1641925414BHF _all T..> | 2022-01-11 18:23 | 102K | |
![[IMG]](/icons/image2.gif) | 1641939649DE639E84-5..> | 2022-01-11 22:20 | 58K | |
![[IMG]](/icons/image2.gif) | 1641941686PP-round l..> | 2022-01-11 22:54 | 504K | |
![[IMG]](/icons/image2.gif) | 1641995276Meier Meat..> | 2022-01-12 13:47 | 337K | |
![[IMG]](/icons/image2.gif) | 1642015338brad, moll..> | 2022-01-12 19:22 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1642015377miss molly..> | 2022-01-12 19:22 | 2.1M | |
![[IMG]](/icons/image2.gif) | 1642015673justthelog..> | 2022-01-12 19:27 | 93K | |
![[IMG]](/icons/image2.gif) | 1642091627WWH Dairy ..> | 2022-01-13 16:33 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1642098941Generation..> | 2022-01-13 18:35 | 3.3M | |
![[IMG]](/icons/image2.gif) | 1642205755fACEBOOK L..> | 2022-01-15 00:15 | 16K | |
![[IMG]](/icons/image2.gif) | 1642218133Baby Cake.jpg | 2022-01-15 03:42 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1642222724CF8515A4-6..> | 2022-01-15 04:58 | 2.3M | |
![[IMG]](/icons/image2.gif) | 1642284699IMG_2219.JPG | 2022-01-15 22:11 | 2.1M | |
![[IMG]](/icons/image2.gif) | 1642294842Tickety_Bo..> | 2022-01-16 01:00 | 328K | |
![[IMG]](/icons/image2.gif) | 1642372039HLYY2427.JPG | 2022-01-16 22:27 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1642446878hex-logo-p..> | 2022-01-17 19:14 | 385K | |
![[IMG]](/icons/image2.gif) | 1642448105sailor mer..> | 2022-01-17 19:35 | 3.7M | |
![[IMG]](/icons/image2.gif) | 1642520824IMG_4550.JPG | 2022-01-18 15:47 | 519K | |
![[IMG]](/icons/image2.gif) | 1642523973producerIm..> | 2022-01-18 16:39 | 779K | |
![[IMG]](/icons/image2.gif) | 1642532446Stacked.jpg | 2022-01-18 19:00 | 330K | |
![[IMG]](/icons/image2.gif) | 1642539571knifeandfo..> | 2022-01-18 20:59 | 458K | |
![[IMG]](/icons/image2.gif) | 1642539575knifeandfo..> | 2022-01-18 20:59 | 458K | |
![[IMG]](/icons/image2.gif) | 1642621051images.jpeg | 2022-01-19 19:37 | 35K | |
![[IMG]](/icons/image2.gif) | 1642646527LOGO_trans..> | 2022-01-20 02:42 | 413K | |
![[IMG]](/icons/image2.gif) | 1642682576Healthy-Na..> | 2022-01-20 12:42 | 287K | |
![[IMG]](/icons/image2.gif) | 1642704764test1.png | 2022-01-20 18:52 | 6.8K | |
![[IMG]](/icons/image2.gif) | 1642707571MadRadishF..> | 2022-01-20 19:39 | 673K | |
![[IMG]](/icons/image2.gif) | 1642708278MadRadishF..> | 2022-01-20 19:51 | 673K | |
![[IMG]](/icons/image2.gif) | 1642718101Cap stitch..> | 2022-01-20 22:35 | 5.5M | |
![[IMG]](/icons/image2.gif) | 1642863195hayride.jpg | 2022-01-22 14:53 | 578K | |
![[IMG]](/icons/image2.gif) | 1642884765Farmer Bro..> | 2022-01-22 20:52 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1642970582Caribbean ..> | 2022-01-23 20:43 | 163K | |
![[IMG]](/icons/image2.gif) | 1642989905DEC31124-B..> | 2022-01-24 02:05 | 282K | |
![[IMG]](/icons/image2.gif) | 1643003723Screenshot..> | 2022-01-24 05:55 | 912K | |
![[IMG]](/icons/image2.gif) | 1643032712circle log..> | 2022-01-24 13:58 | 317K | |
![[IMG]](/icons/image2.gif) | 1643037147FCBsocial-..> | 2022-01-24 15:12 | 534K | |
![[IMG]](/icons/image2.gif) | 1643054514DD6B38DE-E..> | 2022-01-24 20:01 | 160K | |
![[IMG]](/icons/image2.gif) | 1643134846Blue BG.png | 2022-01-25 18:20 | 89K | |
![[IMG]](/icons/image2.gif) | 1643155814Seven-Fork..> | 2022-01-26 00:10 | 346K | |
![[IMG]](/icons/image2.gif) | 1643163244FB LOGO.png | 2022-01-26 02:14 | 3.7K | |
![[IMG]](/icons/image2.gif) | 1643208290unnamed.jpg | 2022-01-26 14:44 | 51K | |
![[IMG]](/icons/image2.gif) | 1643212877logoreimag..> | 2022-01-26 16:01 | 105K | |
![[IMG]](/icons/image2.gif) | 1643220209I love my ..> | 2022-01-26 18:03 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1643222973good golly..> | 2022-01-26 18:49 | 59K | |
![[IMG]](/icons/image2.gif) | 1643224565CFF_MW_Log..> | 2022-01-26 19:16 | 346K | |
![[IMG]](/icons/image2.gif) | 1643224580CFF_MW_Log..> | 2022-01-26 19:16 | 346K | |
![[IMG]](/icons/image2.gif) | 1643229060staffordan..> | 2022-01-26 20:31 | 192K | |
![[IMG]](/icons/image2.gif) | 1643235203CopyrightL..> | 2022-01-26 22:13 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1643239730BF0B859F-4..> | 2022-01-26 23:28 | 3.1M | |
![[IMG]](/icons/image2.gif) | 1643246996f-01.png | 2022-01-27 01:29 | 235K | |
![[IMG]](/icons/image2.gif) | 1643248224FiberKids ..> | 2022-01-27 01:50 | 100K | |
![[IMG]](/icons/image2.gif) | 1643252831FiberKids ..> | 2022-01-27 03:07 | 160K | |
![[IMG]](/icons/image2.gif) | 1643268273[Original ..> | 2022-01-27 07:24 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1643296270IMG_1215.JPG | 2022-01-27 15:11 | 2.1M | |
![[IMG]](/icons/image2.gif) | 1643309783IMG_0016.JPG | 2022-01-27 18:56 | 2.6M | |
![[IMG]](/icons/image2.gif) | 1643310256logo.jpg | 2022-01-27 19:04 | 227K | |
![[IMG]](/icons/image2.gif) | 1643312202M.jpeg | 2022-01-27 19:36 | 142K | |
![[IMG]](/icons/image2.gif) | 1643334326Faithful f..> | 2022-01-28 01:45 | 180K | |
![[IMG]](/icons/image2.gif) | 1643334736E001DF9B-A..> | 2022-01-28 01:52 | 2.3M | |
![[IMG]](/icons/image2.gif) | 1643339475received_5..> | 2022-01-28 03:11 | 379K | |
![[IMG]](/icons/image2.gif) | 1643382144THE CAPITA..> | 2022-01-28 15:02 | 176K | |
![[IMG]](/icons/image2.gif) | 1643387565SGN_01_28_..> | 2022-01-28 16:32 | 136K | |
![[IMG]](/icons/image2.gif) | 1643392769Speakeasy ..> | 2022-01-28 17:59 | 155K | |
![[IMG]](/icons/image2.gif) | 1643393776catnip2.jpg | 2022-01-28 18:16 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1643393898catnip2.jpg | 2022-01-28 18:18 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1643399956FAIRE_LOGO..> | 2022-01-28 19:59 | 64K | |
![[IMG]](/icons/image2.gif) | 1643481893image.png | 2022-01-29 18:44 | 456K | |
![[IMG]](/icons/image2.gif) | 1643482760mama suz.jpg | 2022-01-29 18:59 | 578K | |
![[IMG]](/icons/image2.gif) | 1643502405cows.jpg | 2022-01-30 00:26 | 3.1M | |
![[IMG]](/icons/image2.gif) | 1643553524LOGOPNG.png | 2022-01-30 14:38 | 35K | |
![[IMG]](/icons/image2.gif) | 1643553784logo.png | 2022-01-30 14:43 | 7.8K | |
![[IMG]](/icons/image2.gif) | 1643557728KIMG0039.JPG | 2022-01-30 15:48 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1643658410Salman Goa..> | 2022-01-31 19:46 | 48K | |
![[IMG]](/icons/image2.gif) | 1643676881BFF thumbn..> | 2022-02-01 00:54 | 16K | |
![[IMG]](/icons/image2.gif) | 1643687533AAF64C6E-1..> | 2022-02-01 03:52 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1643722248IMG_9615.JPG | 2022-02-01 13:30 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1643752978contact ca..> | 2022-02-01 22:02 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1643753012image001.jpg | 2022-02-01 22:03 | 6.0K | |
![[IMG]](/icons/image2.gif) | 1643770757ACD-Logo_W..> | 2022-02-02 02:59 | 96K | |
![[IMG]](/icons/image2.gif) | 1643817956Vintage ba..> | 2022-02-02 16:05 | 751K | |
![[IMG]](/icons/image2.gif) | 1643819829YumYum_Log..> | 2022-02-02 16:37 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1643820839FF Logo.jpg | 2022-02-02 16:53 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1643822142CW Creamer..> | 2022-02-02 17:15 | 46K | |
![[IMG]](/icons/image2.gif) | 1643841479logo 1.jpg | 2022-02-02 22:37 | 270K | |
![[IMG]](/icons/image2.gif) | 1643841642logo2.jpg | 2022-02-02 22:40 | 156K | |
![[IMG]](/icons/image2.gif) | 1643847985Scruffy Li..> | 2022-02-03 00:26 | 617K | |
![[IMG]](/icons/image2.gif) | 1643848998HI Res for..> | 2022-02-03 00:43 | 130K | |
![[IMG]](/icons/image2.gif) | 1643922371IMG_6612 (..> | 2022-02-03 21:06 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1643923524perfectbit..> | 2022-02-03 21:25 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1643925247Benefits.jpg | 2022-02-03 21:54 | 407K | |
![[IMG]](/icons/image2.gif) | 1643925626Dlishus Or..> | 2022-02-03 22:00 | 389K | |
![[IMG]](/icons/image2.gif) | 1643991008JohnandGin..> | 2022-02-04 16:10 | 951K | |
![[IMG]](/icons/image2.gif) | 1643999516full color..> | 2022-02-04 18:31 | 927K | |
![[IMG]](/icons/image2.gif) | 1644009668Applewood ..> | 2022-02-04 21:21 | 515K | |
![[IMG]](/icons/image2.gif) | 1644168397PorkNPlant..> | 2022-02-06 17:26 | 3.7M | |
![[IMG]](/icons/image2.gif) | 1644221392HR-Logo-1-..> | 2022-02-07 08:09 | 331K | |
![[IMG]](/icons/image2.gif) | 1644247261Refugefarm..> | 2022-02-07 15:21 | 195K | |
![[IMG]](/icons/image2.gif) | 1644247271Refugefarm..> | 2022-02-07 15:21 | 195K | |
![[IMG]](/icons/image2.gif) | 1644252378F571D168-F..> | 2022-02-07 16:46 | 256K | |
![[IMG]](/icons/image2.gif) | 1644266871Logo-File.jpg | 2022-02-07 20:47 | 281K | |
![[IMG]](/icons/image2.gif) | 1644269630Hydn Chees..> | 2022-02-07 21:33 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1644275308TSF_Logo.jpg | 2022-02-07 23:08 | 248K | |
![[IMG]](/icons/image2.gif) | 1644285469IMG_202201..> | 2022-02-08 01:57 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1644286764Fine Flour..> | 2022-02-08 02:19 | 99K | |
![[IMG]](/icons/image2.gif) | 1644351554alaska 256..> | 2022-02-08 20:19 | 3.1M | |
![[IMG]](/icons/image2.gif) | 1644434862Farm.png | 2022-02-09 19:27 | 57K | |
![[IMG]](/icons/image2.gif) | 1644435776logo78.png | 2022-02-09 19:42 | 816K | |
![[IMG]](/icons/image2.gif) | 1644440743FB_IMG_164..> | 2022-02-09 21:05 | 357K | |
![[IMG]](/icons/image2.gif) | 1644441387received_3..> | 2022-02-09 21:16 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1644441576Test JPEG ..> | 2022-02-09 21:19 | 619K | |
![[IMG]](/icons/image2.gif) | 1644442086product pi..> | 2022-02-09 21:28 | 235K | |
![[IMG]](/icons/image2.gif) | 1644442844Adjuvia Lo..> | 2022-02-09 21:40 | 91K | |
![[IMG]](/icons/image2.gif) | 1644449898Nanoserene..> | 2022-02-09 23:38 | 77K | |
![[IMG]](/icons/image2.gif) | 1644500952Ragin Reap..> | 2022-02-10 13:49 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1644501000Groovy Gar..> | 2022-02-10 13:50 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1644502924Brenneman ..> | 2022-02-10 14:22 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1644505954VcF-0nqk_4..> | 2022-02-10 15:12 | 210K | |
![[IMG]](/icons/image2.gif) | 1644506652LITT_Logo_..> | 2022-02-10 15:24 | 9.3K | |
![[IMG]](/icons/image2.gif) | 1644520662image0.jpeg | 2022-02-10 19:17 | 510K | |
![[IMG]](/icons/image2.gif) | 1644521422logocroppe..> | 2022-02-10 19:30 | 54K | |
![[IMG]](/icons/image2.gif) | 1644522605back road ..> | 2022-02-10 19:50 | 324K | |
![[IMG]](/icons/image2.gif) | 1644590748FB_IMG_164..> | 2022-02-11 14:45 | 347K | |
![[IMG]](/icons/image2.gif) | 1644599038Miller Far..> | 2022-02-11 17:03 | 180K | |
![[IMG]](/icons/image2.gif) | 1644599125Miller Far..> | 2022-02-11 17:05 | 180K | |
![[IMG]](/icons/image2.gif) | 1644621096C1B54872-4..> | 2022-02-11 23:11 | 280K | |
![[IMG]](/icons/image2.gif) | 1644686046B48431A3-2..> | 2022-02-12 17:14 | 198K | |
![[IMG]](/icons/image2.gif) | 1644759868eggs2.jpg | 2022-02-13 13:44 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1644814785Logo La bu..> | 2022-02-14 04:59 | 687K | |
![[IMG]](/icons/image2.gif) | 1644864949Strawberry..> | 2022-02-14 18:55 | 520K | |
![[IMG]](/icons/image2.gif) | 1644866654CDC453F6-7..> | 2022-02-14 19:24 | 225K | |
![[IMG]](/icons/image2.gif) | 1644869699karenmarke..> | 2022-02-14 20:14 | 456K | |
![[IMG]](/icons/image2.gif) | 1644872749our logo ..> | 2022-02-14 21:05 | 198K | |
![[IMG]](/icons/image2.gif) | 1644893978IMG_1855.jpeg | 2022-02-15 02:59 | 2.8M | |
![[IMG]](/icons/image2.gif) | 1644921348our logo ..> | 2022-02-15 10:35 | 198K | |
![[IMG]](/icons/image2.gif) | 1644944623creative c..> | 2022-02-15 17:03 | 41K | |
![[IMG]](/icons/image2.gif) | 1644945360Primary VF..> | 2022-02-15 17:16 | 53K | |
![[IMG]](/icons/image2.gif) | 1644945579Primary VF..> | 2022-02-15 17:19 | 72K | |
![[IMG]](/icons/image2.gif) | 1644946361Sticker 3.jpg | 2022-02-15 17:32 | 667K | |
![[IMG]](/icons/image2.gif) | 1644950983IMG_7968.jpg | 2022-02-15 18:49 | 4.3M | |
![[IMG]](/icons/image2.gif) | 1644955135our logo ..> | 2022-02-15 19:58 | 198K | |
![[IMG]](/icons/image2.gif) | 1644960217C9C143BD-E..> | 2022-02-15 21:23 | 91K | |
![[IMG]](/icons/image2.gif) | 1644961042logo frame..> | 2022-02-15 21:37 | 320K | |
![[IMG]](/icons/image2.gif) | 1644968298Grilliant ..> | 2022-02-15 23:38 | 272K | |
![[IMG]](/icons/image2.gif) | 1645016352JLK PINTO.jpg | 2022-02-16 12:59 | 98K | |
![[IMG]](/icons/image2.gif) | 1645110683bauman-orc..> | 2022-02-17 15:11 | 75K | |
![[IMG]](/icons/image2.gif) | 1645119866Flavor360-..> | 2022-02-17 17:44 | 52K | |
![[IMG]](/icons/image2.gif) | 1645127038Smokehouse..> | 2022-02-17 19:43 | 238K | |
![[IMG]](/icons/image2.gif) | 1645128237LOGO.png | 2022-02-17 20:03 | 235K | |
![[IMG]](/icons/image2.gif) | 1645129027Fig, Honey..> | 2022-02-17 20:17 | 527K | |
![[IMG]](/icons/image2.gif) | 1645138820IMG_1193.JPG | 2022-02-17 23:00 | 107K | |
![[IMG]](/icons/image2.gif) | 1645139663Logo.jpg | 2022-02-17 23:14 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1645190298Logo.PNG | 2022-02-18 13:18 | 64K | |
![[IMG]](/icons/image2.gif) | 1645200259farm.jpg | 2022-02-18 16:04 | 2.1M | |
![[IMG]](/icons/image2.gif) | 1645208008phf chicke..> | 2022-02-18 18:13 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1645213678TLC's Farm..> | 2022-02-18 19:47 | 71K | |
![[IMG]](/icons/image2.gif) | 1645231011IMG_4562 -..> | 2022-02-19 00:36 | 266K | |
![[IMG]](/icons/image2.gif) | 1645232964Screenshot..> | 2022-02-19 01:09 | 346K | |
![[IMG]](/icons/image2.gif) | 1645233154Screenshot..> | 2022-02-19 01:12 | 346K | |
![[IMG]](/icons/image2.gif) | 1645290983Screenshot..> | 2022-02-19 17:16 | 361K | |
![[IMG]](/icons/image2.gif) | 1645310223Retail Bag..> | 2022-02-19 22:37 | 30K | |
![[IMG]](/icons/image2.gif) | 1645312528CCR_Images..> | 2022-02-19 23:15 | 38K | |
![[IMG]](/icons/image2.gif) | 1645387794Screen Sho..> | 2022-02-20 20:09 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1645471051Screenshot..> | 2022-02-21 19:17 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1645481023SweetField..> | 2022-02-21 22:03 | 259K | |
![[IMG]](/icons/image2.gif) | 1645546316Mission Hi..> | 2022-02-22 16:11 | 87K | |
![[IMG]](/icons/image2.gif) | 1645550569Sun Woman ..> | 2022-02-22 17:22 | 26K | |
![[IMG]](/icons/image2.gif) | 1645554374Logo Flowe..> | 2022-02-22 18:26 | 10K | |
![[IMG]](/icons/image2.gif) | 1645590225Schoenberg..> | 2022-02-23 04:23 | 321K | |
![[IMG]](/icons/image2.gif) | 1645620188Smitherman..> | 2022-02-23 12:43 | 164K | |
![[IMG]](/icons/image2.gif) | 1645648735Sharecuter..> | 2022-02-23 20:38 | 109K | |
![[IMG]](/icons/image2.gif) | 1645653113A3AF35BF-C..> | 2022-02-23 21:51 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1645653832D8979171-6..> | 2022-02-23 22:03 | 310K | |
![[IMG]](/icons/image2.gif) | 1645718122[FINAL] Di..> | 2022-02-24 15:55 | 240K | |
![[IMG]](/icons/image2.gif) | 1645803261HBG Color ..> | 2022-02-25 15:34 | 288K | |
![[IMG]](/icons/image2.gif) | 1645807609Red Head S..> | 2022-02-25 16:46 | 42K | |
![[IMG]](/icons/image2.gif) | 1645810269Geraldine ..> | 2022-02-25 17:31 | 860K | |
![[IMG]](/icons/image2.gif) | 1645812867B1D91A25-4..> | 2022-02-25 18:14 | 581K | |
![[IMG]](/icons/image2.gif) | 1645834019Profile (1..> | 2022-02-26 00:06 | 369K | |
![[IMG]](/icons/image2.gif) | 1645834114Field_to_F..> | 2022-02-26 00:08 | 134K | |
![[IMG]](/icons/image2.gif) | 1645834181Field_to_F..> | 2022-02-26 00:09 | 130K | |
![[IMG]](/icons/image2.gif) | 1645834249F2F_Logo_5..> | 2022-02-26 00:10 | 220K | |
![[IMG]](/icons/image2.gif) | 1645834622F2F_Logo_5..> | 2022-02-26 00:17 | 69K | |
![[IMG]](/icons/image2.gif) | 1645904032F63533CC-3..> | 2022-02-26 19:33 | 821K | |
![[IMG]](/icons/image2.gif) | 1645904218A0155050-2..> | 2022-02-26 19:36 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1645925890frey famil..> | 2022-02-27 01:38 | 3.1M | |
![[IMG]](/icons/image2.gif) | 1645998933bluegold r..> | 2022-02-27 21:55 | 130K | |
![[IMG]](/icons/image2.gif) | 1646008221Instagram ..> | 2022-02-28 00:30 | 266K | |
![[IMG]](/icons/image2.gif) | 1646017823Logo.png | 2022-02-28 03:10 | 133K | |
![[IMG]](/icons/image2.gif) | 1646017853Logo.png | 2022-02-28 03:10 | 133K | |
![[IMG]](/icons/image2.gif) | 1646063231Essencha L..> | 2022-02-28 15:47 | 19K | |
![[IMG]](/icons/image2.gif) | 1646063607Essencha v..> | 2022-02-28 15:53 | 105K | |
![[IMG]](/icons/image2.gif) | 1646067161Square Log..> | 2022-02-28 16:52 | 24K | |
![[IMG]](/icons/image2.gif) | 1646086851Transparen..> | 2022-02-28 22:20 | 48K | |
![[IMG]](/icons/image2.gif) | 1646150832Screenshot..> | 2022-03-01 16:07 | 156K | |
![[IMG]](/icons/image2.gif) | 1646166108Logo words..> | 2022-03-01 20:21 | 92K | |
![[IMG]](/icons/image2.gif) | 1646184101Storm Acre..> | 2022-03-02 01:21 | 66K | |
![[IMG]](/icons/image2.gif) | 1646252715Ma Annes F..> | 2022-03-02 20:25 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1646271524New Limitl..> | 2022-03-03 01:38 | 8.1K | |
![[IMG]](/icons/image2.gif) | 1646271900IMG_0739 (..> | 2022-03-03 01:45 | 116K | |
![[IMG]](/icons/image2.gif) | 1646341770Stone.jpg | 2022-03-03 21:09 | 856K | |
![[IMG]](/icons/image2.gif) | 1646407165Screen-Sho..> | 2022-03-04 15:19 | 232K | |
![[IMG]](/icons/image2.gif) | 1646426907luckys sau..> | 2022-03-04 20:48 | 77K | |
![[IMG]](/icons/image2.gif) | 1646450165Sugar Knea..> | 2022-03-05 03:16 | 384K | |
![[IMG]](/icons/image2.gif) | 1646452790#sco logo.jpg | 2022-03-05 03:59 | 87K | |
![[IMG]](/icons/image2.gif) | 1646493323Utopia Far..> | 2022-03-05 15:15 | 29K | |
![[IMG]](/icons/image2.gif) | 1646629452Cravebadge..> | 2022-03-07 05:04 | 170K | |
![[IMG]](/icons/image2.gif) | 1646662444C04962DB-B..> | 2022-03-07 14:14 | 2.6M | |
![[IMG]](/icons/image2.gif) | 1646751756BC63B1CE-5..> | 2022-03-08 15:02 | 528K | |
![[IMG]](/icons/image2.gif) | 1646762865EnE invoic..> | 2022-03-08 18:07 | 293K | |
![[IMG]](/icons/image2.gif) | 1646766715Savors Log..> | 2022-03-08 19:11 | 626K | |
![[IMG]](/icons/image2.gif) | 1646835300UHF_logo.jpg | 2022-03-09 14:15 | 43K | |
![[IMG]](/icons/image2.gif) | 1646842593Daily Cult..> | 2022-03-09 16:16 | 169K | |
![[IMG]](/icons/image2.gif) | 1646844139White tea ..> | 2022-03-09 16:42 | 2.3M | |
![[IMG]](/icons/image2.gif) | 1646845503IMG_0767.jpg | 2022-03-09 17:05 | 559K | |
![[IMG]](/icons/image2.gif) | 1646853660jalapeno a..> | 2022-03-09 19:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1646856686C9B65FE5-7..> | 2022-03-09 20:11 | 3.6M | |
![[IMG]](/icons/image2.gif) | 1646857705#sco logo.jpg | 2022-03-09 20:28 | 87K | |
![[IMG]](/icons/image2.gif) | 1646860825CCPC Photo..> | 2022-03-09 21:20 | 2.1M | |
![[IMG]](/icons/image2.gif) | 1646873256Screen Sho..> | 2022-03-10 00:47 | 115K | |
![[IMG]](/icons/image2.gif) | 1646876977red barn .jpg | 2022-03-10 01:49 | 155K | |
![[IMG]](/icons/image2.gif) | 1646883125IMG_0739 (..> | 2022-03-10 03:32 | 116K | |
![[IMG]](/icons/image2.gif) | 1646936733B2CD2CF6-8..> | 2022-03-10 18:25 | 327K | |
![[IMG]](/icons/image2.gif) | 1646957497A68B854C-B..> | 2022-03-11 00:11 | 510K | |
![[IMG]](/icons/image2.gif) | 1647018634VBSC Logo ..> | 2022-03-11 17:10 | 82K | |
![[IMG]](/icons/image2.gif) | 1647054081clear pic ..> | 2022-03-12 03:01 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1647096390fattyhead-..> | 2022-03-12 14:46 | 93K | |
![[IMG]](/icons/image2.gif) | 1647104529New Limitl..> | 2022-03-12 17:02 | 8.1K | |
![[IMG]](/icons/image2.gif) | 1647121785blight-log..> | 2022-03-12 21:49 | 235K | |
![[IMG]](/icons/image2.gif) | 1647180820knox micro..> | 2022-03-13 14:13 | 288K | |
![[IMG]](/icons/image2.gif) | 1647266016Family Pic..> | 2022-03-14 13:53 | 3.5M | |
![[IMG]](/icons/image2.gif) | 1647268383basil bund..> | 2022-03-14 14:33 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1647270465BCC56739-4..> | 2022-03-14 15:07 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1647277160logo.png | 2022-03-14 16:59 | 27K | |
![[IMG]](/icons/image2.gif) | 1647277779KFH+Logo+w..> | 2022-03-14 17:09 | 77K | |
![[IMG]](/icons/image2.gif) | 1647277806KFH+Logo+w..> | 2022-03-14 17:10 | 77K | |
![[IMG]](/icons/image2.gif) | 1647278286KFH+Logo+w..> | 2022-03-14 17:18 | 77K | |
![[IMG]](/icons/image2.gif) | 1647278337logo.png | 2022-03-14 17:18 | 27K | |
![[IMG]](/icons/image2.gif) | 1647278560logo stroh..> | 2022-03-14 17:22 | 24K | |
![[IMG]](/icons/image2.gif) | 1647284492Free Leafy..> | 2022-03-14 19:01 | 722K | |
![[IMG]](/icons/image2.gif) | 1647284623Kentucky F..> | 2022-03-14 19:03 | 769K | |
![[IMG]](/icons/image2.gif) | 1647297093Farming_En..> | 2022-03-14 22:31 | 594K | |
![[IMG]](/icons/image2.gif) | 1647303815CVBB Logo.png | 2022-03-15 00:23 | 455K | |
![[IMG]](/icons/image2.gif) | 1647356720Luci's Pet..> | 2022-03-15 15:05 | 608K | |
![[IMG]](/icons/image2.gif) | 1647365740GrandpaSpe..> | 2022-03-15 17:35 | 889K | |
![[IMG]](/icons/image2.gif) | 1647377452IMG_5232 2..> | 2022-03-15 20:50 | 682K | |
![[IMG]](/icons/image2.gif) | 1647378514Untitled (..> | 2022-03-15 21:08 | 157K | |
![[IMG]](/icons/image2.gif) | 1647383636MSL_HeroLo..> | 2022-03-15 22:33 | 702K | |
![[IMG]](/icons/image2.gif) | 1647400578FinalChoco..> | 2022-03-16 03:16 | 419K | |
![[IMG]](/icons/image2.gif) | 1647440760logo_dark ..> | 2022-03-16 14:26 | 27K | |
![[IMG]](/icons/image2.gif) | 1647457822JimmyMitch..> | 2022-03-16 19:10 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1647479066Facebook P..> | 2022-03-17 01:04 | 451K | |
![[IMG]](/icons/image2.gif) | 1647487888logo2.jpg | 2022-03-17 03:31 | 105K | |
![[IMG]](/icons/image2.gif) | 1647527753Georgia Bi..> | 2022-03-17 14:35 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1647534530Company lo..> | 2022-03-17 16:28 | 41K | |
![[IMG]](/icons/image2.gif) | 1647717110Egg Logo3.jpg | 2022-03-19 19:11 | 389K | |
![[IMG]](/icons/image2.gif) | 1647893496fullsizeou..> | 2022-03-21 20:11 | 184K | |
![[IMG]](/icons/image2.gif) | 1647910810Logo.jpg | 2022-03-22 01:00 | 820K | |
![[IMG]](/icons/image2.gif) | 1647952081BE14CC0F-F..> | 2022-03-22 12:28 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1647981624directmoos..> | 2022-03-22 20:40 | 123K | |
![[IMG]](/icons/image2.gif) | 1647984551Copy of sk..> | 2022-03-22 21:29 | 218K | |
![[IMG]](/icons/image2.gif) | 1648000815logo-dark-..> | 2022-03-23 02:00 | 37K | |
![[IMG]](/icons/image2.gif) | 1648000910Square-Log..> | 2022-03-23 02:01 | 32K | |
![[IMG]](/icons/image2.gif) | 1648058357AC7BCE49-6..> | 2022-03-23 17:59 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1648076406Untitled d..> | 2022-03-23 23:00 | 18K | |
![[IMG]](/icons/image2.gif) | 1648076412Untitled d..> | 2022-03-23 23:00 | 18K | |
![[IMG]](/icons/image2.gif) | 1648076515Untitled d..> | 2022-03-23 23:01 | 31K | |
![[IMG]](/icons/image2.gif) | 1648076531Untitled d..> | 2022-03-23 23:02 | 31K | |
![[IMG]](/icons/image2.gif) | 1648085918terra-nova..> | 2022-03-24 01:38 | 86K | |
![[IMG]](/icons/image2.gif) | 1648091656CDA92D63-4..> | 2022-03-24 03:14 | 139K | |
![[IMG]](/icons/image2.gif) | 1648091676CDA92D63-4..> | 2022-03-24 03:14 | 139K | |
![[IMG]](/icons/image2.gif) | 1648137035Turkey.png | 2022-03-24 15:50 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1648138882Bee-Wild-L..> | 2022-03-24 16:21 | 16K | |
![[IMG]](/icons/image2.gif) | 1648143041Cafe Logo ..> | 2022-03-24 17:30 | 479K | |
![[IMG]](/icons/image2.gif) | 1648144762HC Logo RG..> | 2022-03-24 17:59 | 545K | |
![[IMG]](/icons/image2.gif) | 1648152307FBProfile.png | 2022-03-24 20:05 | 100K | |
![[IMG]](/icons/image2.gif) | 1648154956Screenshot..> | 2022-03-24 20:49 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1648158399PUPLogo.jpg | 2022-03-24 21:46 | 31K | |
![[IMG]](/icons/image2.gif) | 1648228548BNS+LOGO+T..> | 2022-03-25 17:15 | 168K | |
![[IMG]](/icons/image2.gif) | 1648228630milk river..> | 2022-03-25 17:17 | 758K | |
![[IMG]](/icons/image2.gif) | 1648253198DMD Family..> | 2022-03-26 00:06 | 149K | |
![[IMG]](/icons/image2.gif) | 1648311945AA9B7693-E..> | 2022-03-26 16:25 | 403K | |
![[IMG]](/icons/image2.gif) | 1648417031Brothers_B..> | 2022-03-27 21:37 | 166K | |
![[IMG]](/icons/image2.gif) | 1648487917DB70B1FF-C..> | 2022-03-28 17:18 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1648499269Screenshot..> | 2022-03-28 20:27 | 273K | |
![[IMG]](/icons/image2.gif) | 1648500193[Original ..> | 2022-03-28 20:43 | 122K | |
![[IMG]](/icons/image2.gif) | 1648500400[Original ..> | 2022-03-28 20:46 | 119K | |
![[IMG]](/icons/image2.gif) | 1648515828Green Past..> | 2022-03-29 01:03 | 229K | |
![[IMG]](/icons/image2.gif) | 1648568792MB-Logo-Bl..> | 2022-03-29 15:46 | 12K | |
![[IMG]](/icons/image2.gif) | 1648579873marketwago..> | 2022-03-29 18:51 | 612K | |
![[IMG]](/icons/image2.gif) | 1648588795YankeeandB..> | 2022-03-29 21:19 | 21K | |
![[IMG]](/icons/image2.gif) | 1648600446aunt nazzi..> | 2022-03-30 00:34 | 4.0M | |
![[IMG]](/icons/image2.gif) | 1648661227Appalachia..> | 2022-03-30 17:27 | 5.8K | |
![[IMG]](/icons/image2.gif) | 1648661474MAHS Open ..> | 2022-03-30 17:31 | 223K | |
![[IMG]](/icons/image2.gif) | 1648744330Spicekick-..> | 2022-03-31 16:32 | 16K | |
![[IMG]](/icons/image2.gif) | 1648753138logo.jpg | 2022-03-31 18:58 | 213K | |
![[IMG]](/icons/image2.gif) | 1648756200logojpeg.jpg | 2022-03-31 19:50 | 135K | |
![[IMG]](/icons/image2.gif) | 1648768847Logo.jpg | 2022-03-31 23:20 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1648813547Logo - Upd..> | 2022-04-01 11:45 | 124K | |
![[IMG]](/icons/image2.gif) | 1648846994Growee-Log..> | 2022-04-01 21:03 | 116K | |
![[IMG]](/icons/image2.gif) | 1648865768Screenshot..> | 2022-04-02 02:16 | 402K | |
![[IMG]](/icons/image2.gif) | 1648911087barrel log..> | 2022-04-02 14:51 | 162K | |
![[IMG]](/icons/image2.gif) | 1648938551IMG_0713.PNG | 2022-04-02 22:29 | 154K | |
![[IMG]](/icons/image2.gif) | 1648938621pound cake..> | 2022-04-02 22:30 | 81K | |
![[IMG]](/icons/image2.gif) | 1648938760sweet but ..> | 2022-04-02 22:32 | 577K | |
![[IMG]](/icons/image2.gif) | 1649031800Clay Quarr..> | 2022-04-04 00:23 | 4.2M | |
![[IMG]](/icons/image2.gif) | 1649085602logo3.jpg | 2022-04-04 15:20 | 240K | |
![[IMG]](/icons/image2.gif) | 1649094430Snapchat-1..> | 2022-04-04 17:47 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1649101828LogoBlack.png | 2022-04-04 19:50 | 13K | |
![[IMG]](/icons/image2.gif) | 1649107790Dean 2017.png | 2022-04-04 21:29 | 104K | |
![[IMG]](/icons/image2.gif) | 1649127669E828A73A-2..> | 2022-04-05 03:01 | 2.3M | |
![[IMG]](/icons/image2.gif) | 1649176155Nectar Spr..> | 2022-04-05 16:29 | 514K | |
![[IMG]](/icons/image2.gif) | 1649177326IMG_0702.JPG | 2022-04-05 16:48 | 2.3M | |
![[IMG]](/icons/image2.gif) | 1649177905Nectar Spr..> | 2022-04-05 16:58 | 514K | |
![[IMG]](/icons/image2.gif) | 1649183747HBlogo.jpg | 2022-04-05 18:35 | 71K | |
![[IMG]](/icons/image2.gif) | 1649196478OneNation_..> | 2022-04-05 22:07 | 717K | |
![[IMG]](/icons/image2.gif) | 1649250980FASTA LOGO..> | 2022-04-06 13:16 | 97K | |
![[IMG]](/icons/image2.gif) | 1649256758jars-B.jpg | 2022-04-06 14:52 | 772K | |
![[IMG]](/icons/image2.gif) | 1649343354logo-5 -1.jpg | 2022-04-07 14:55 | 144K | |
![[IMG]](/icons/image2.gif) | 1649378389round labe..> | 2022-04-08 00:39 | 73K | |
![[IMG]](/icons/image2.gif) | 1649462690FEVERS9 (1..> | 2022-04-09 00:04 | 284K | |
![[IMG]](/icons/image2.gif) | 1649466725thumbnail_..> | 2022-04-09 01:12 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1649508376C52B5267-A..> | 2022-04-09 12:46 | 360K | |
![[IMG]](/icons/image2.gif) | 1649531628IMG_1696.jpg | 2022-04-09 19:13 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1649631467D3E84943-9..> | 2022-04-10 22:57 | 436K | |
![[IMG]](/icons/image2.gif) | 1649686533Logo Kocre..> | 2022-04-11 14:15 | 68K | |
![[IMG]](/icons/image2.gif) | 1649687905Logo 3.jpeg | 2022-04-11 14:38 | 64K | |
![[IMG]](/icons/image2.gif) | 1649702940LOGO_Wild ..> | 2022-04-11 18:49 | 20K | |
![[IMG]](/icons/image2.gif) | 1649706540VEHCS_Prim..> | 2022-04-11 19:49 | 156K | |
![[IMG]](/icons/image2.gif) | 1649710333IMG_7597.PNG | 2022-04-11 20:52 | 68K | |
![[IMG]](/icons/image2.gif) | 1649710394IMG-1940.jpg | 2022-04-11 20:53 | 2.1M | |
![[IMG]](/icons/image2.gif) | 1649710477IMG_0196.PNG | 2022-04-11 20:54 | 785K | |
![[IMG]](/icons/image2.gif) | 1649717774Pressed sa..> | 2022-04-11 22:56 | 586K | |
![[IMG]](/icons/image2.gif) | 1649717868Pressed sa..> | 2022-04-11 22:57 | 575K | |
![[IMG]](/icons/image2.gif) | 1649718045Pressed sa..> | 2022-04-11 23:00 | 621K | |
![[IMG]](/icons/image2.gif) | 1649720978F04569DE-B..> | 2022-04-11 23:49 | 4.6M | |
![[IMG]](/icons/image2.gif) | 1649720988F04569DE-B..> | 2022-04-11 23:49 | 4.6M | |
![[IMG]](/icons/image2.gif) | 1649769810label.jpg | 2022-04-12 13:23 | 691K | |
![[IMG]](/icons/image2.gif) | 1649785285Watch Us F..> | 2022-04-12 17:41 | 161K | |
![[IMG]](/icons/image2.gif) | 1649788053ED9C03AC-F..> | 2022-04-12 18:27 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1649805453logo_size_..> | 2022-04-12 23:17 | 82K | |
![[IMG]](/icons/image2.gif) | 1649813833white_logo..> | 2022-04-13 01:37 | 173K | |
![[IMG]](/icons/image2.gif) | 1649815559white_logo..> | 2022-04-13 02:05 | 132K | |
![[IMG]](/icons/image2.gif) | 1649862546Square log..> | 2022-04-13 15:09 | 443K | |
![[IMG]](/icons/image2.gif) | 1649865072Rich Farms..> | 2022-04-13 15:51 | 98K | |
![[IMG]](/icons/image2.gif) | 1649968808BB_V2_Logo..> | 2022-04-14 20:40 | 299K | |
![[IMG]](/icons/image2.gif) | 1649974465feather + ..> | 2022-04-14 22:14 | 151K | |
![[IMG]](/icons/image2.gif) | 1649974516feather + ..> | 2022-04-14 22:15 | 130K | |
![[IMG]](/icons/image2.gif) | 1649974523feather + ..> | 2022-04-14 22:15 | 130K | |
![[IMG]](/icons/image2.gif) | 1650144921BANNER DES..> | 2022-04-16 21:35 | 2.7M | |
![[IMG]](/icons/image2.gif) | 1650145927logo.png | 2022-04-16 21:52 | 780K | |
![[IMG]](/icons/image2.gif) | 1650145964CW logo.png | 2022-04-16 21:52 | 745K | |
![[IMG]](/icons/image2.gif) | 1650300990MPF.PNG | 2022-04-18 16:56 | 420K | |
![[IMG]](/icons/image2.gif) | 1650307997FFE75FFF-8..> | 2022-04-18 18:53 | 797K | |
![[IMG]](/icons/image2.gif) | 1650318750Kombuchade..> | 2022-04-18 21:52 | 240K | |
![[IMG]](/icons/image2.gif) | 1650319049Kombuchade..> | 2022-04-18 21:57 | 240K | |
![[IMG]](/icons/image2.gif) | 1650404357Fat_Lake_P..> | 2022-04-19 21:39 | 57K | |
![[IMG]](/icons/image2.gif) | 1650406209Fat_Lake_P..> | 2022-04-19 22:10 | 58K | |
![[IMG]](/icons/image2.gif) | 1650459749newlogo.jpg | 2022-04-20 13:02 | 799K | |
![[IMG]](/icons/image2.gif) | 1650460426newlogo.jpg | 2022-04-20 13:13 | 799K | |
![[IMG]](/icons/image2.gif) | 1650460628logo.png | 2022-04-20 13:17 | 780K | |
![[IMG]](/icons/image2.gif) | 1650460729CW logo pn..> | 2022-04-20 13:18 | 775K | |
![[IMG]](/icons/image2.gif) | 1650473262small logo..> | 2022-04-20 16:47 | 24K | |
![[IMG]](/icons/image2.gif) | 1650475970Norte Cafe..> | 2022-04-20 17:32 | 49K | |
![[IMG]](/icons/image2.gif) | 1650480123apple-icon..> | 2022-04-20 18:42 | 25K | |
![[IMG]](/icons/image2.gif) | 1650497841Screenshot..> | 2022-04-20 23:37 | 666K | |
![[IMG]](/icons/image2.gif) | 1650508024IMG_2366.jpg | 2022-04-21 02:27 | 4.6M | |
![[IMG]](/icons/image2.gif) | 1650508046IMG_2513.jpg | 2022-04-21 02:27 | 2.9M | |
![[IMG]](/icons/image2.gif) | 1650559174Nutcase Ve..> | 2022-04-21 16:39 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1650571843Cedar Ridg..> | 2022-04-21 20:10 | 42K | |
![[IMG]](/icons/image2.gif) | 1650571857Cedar Ridg..> | 2022-04-21 20:10 | 42K | |
![[IMG]](/icons/image2.gif) | 1650589272Picsart_22..> | 2022-04-22 01:01 | 688K | |
![[IMG]](/icons/image2.gif) | 1650635357IMG_0126 (..> | 2022-04-22 13:49 | 2.4M | |
![[IMG]](/icons/image2.gif) | 1650839655profile pi..> | 2022-04-24 22:34 | 81K | |
![[IMG]](/icons/image2.gif) | 1650842395profile pi..> | 2022-04-24 23:19 | 81K | |
![[IMG]](/icons/image2.gif) | 1650890564Logo.PNG | 2022-04-25 12:42 | 576K | |
![[IMG]](/icons/image2.gif) | 1650906144Snowville_..> | 2022-04-25 17:02 | 392K | |
![[IMG]](/icons/image2.gif) | 1650941290IMG_202201..> | 2022-04-26 02:48 | 2.6M | |
![[IMG]](/icons/image2.gif) | 1650982620IMG_0007.JPG | 2022-04-26 14:17 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1650984304IMG_0007.JPG | 2022-04-26 14:45 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1650984396Logo-12-(w..> | 2022-04-26 14:46 | 521K | |
![[IMG]](/icons/image2.gif) | 1650986625Screenshot..> | 2022-04-26 15:23 | 129K | |
![[IMG]](/icons/image2.gif) | 1650987090IMG_0007.JPG | 2022-04-26 15:31 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1650987656Wild Roots..> | 2022-04-26 15:40 | 520K | |
![[IMG]](/icons/image2.gif) | 1650987729The real W..> | 2022-04-26 15:42 | 510K | |
![[IMG]](/icons/image2.gif) | 1650987828Wild Roots..> | 2022-04-26 15:43 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1650988257Market Wag..> | 2022-04-26 15:50 | 438K | |
![[IMG]](/icons/image2.gif) | 1650988461Market Wag..> | 2022-04-26 15:54 | 468K | |
![[IMG]](/icons/image2.gif) | 1650988644market wag..> | 2022-04-26 15:57 | 368K | |
![[IMG]](/icons/image2.gif) | 1650988837market wag..> | 2022-04-26 16:00 | 368K | |
![[IMG]](/icons/image2.gif) | 1650988984market wag..> | 2022-04-26 16:03 | 421K | |
![[IMG]](/icons/image2.gif) | 1650989090Slide1.jpg | 2022-04-26 16:04 | 464K | |
![[IMG]](/icons/image2.gif) | 1650989305market wag..> | 2022-04-26 16:08 | 464K | |
![[IMG]](/icons/image2.gif) | 1651002065Bella's Mi..> | 2022-04-26 19:41 | 104K | |
![[IMG]](/icons/image2.gif) | 1651023892DF.png | 2022-04-27 01:44 | 292K | |
![[IMG]](/icons/image2.gif) | 1651082791farmer's m..> | 2022-04-27 18:06 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1651190071image1.jpeg | 2022-04-28 23:54 | 314K | |
![[IMG]](/icons/image2.gif) | 1651266871logo_black..> | 2022-04-29 21:14 | 71K | |
![[IMG]](/icons/image2.gif) | 1651281382Ranger Far..> | 2022-04-30 01:16 | 56K | |
![[IMG]](/icons/image2.gif) | 1651432449Denney Far..> | 2022-05-01 19:14 | 576K | |
![[IMG]](/icons/image2.gif) | 1651498648LOGO (1).png | 2022-05-02 13:37 | 321K | |
![[IMG]](/icons/image2.gif) | 1651502926cowpasture..> | 2022-05-02 14:48 | 113K | |
![[IMG]](/icons/image2.gif) | 1651504031cowpasture..> | 2022-05-02 15:07 | 113K | |
![[IMG]](/icons/image2.gif) | 1651512209lg logo sq..> | 2022-05-02 17:23 | 239K | |
![[IMG]](/icons/image2.gif) | 1651527417GiftBoxLog..> | 2022-05-02 21:36 | 42K | |
![[IMG]](/icons/image2.gif) | 1651584895TottaSausa..> | 2022-05-03 13:34 | 3.0M | |
![[IMG]](/icons/image2.gif) | 1651611360Brown Dog ..> | 2022-05-03 20:56 | 337K | |
![[IMG]](/icons/image2.gif) | 1651623434tempImageF..> | 2022-05-04 00:17 | 2.1M | |
![[IMG]](/icons/image2.gif) | 1651671743ProfileIm.jpg | 2022-05-04 13:42 | 290K | |
![[IMG]](/icons/image2.gif) | 1651687533DIP'T high..> | 2022-05-04 18:05 | 87K | |
![[IMG]](/icons/image2.gif) | 1651701338Simple and..> | 2022-05-04 21:55 | 43K | |
![[IMG]](/icons/image2.gif) | 1651767384IMG_0378.jpeg | 2022-05-05 16:16 | 4.6M | |
![[IMG]](/icons/image2.gif) | 1651774126F077943D-D..> | 2022-05-05 18:08 | 719K | |
![[IMG]](/icons/image2.gif) | 1651793651Eze Farms ..> | 2022-05-05 23:34 | 89K | |
![[IMG]](/icons/image2.gif) | 1651844116C07EB6FA-6..> | 2022-05-06 13:35 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1651844240DF608836-9..> | 2022-05-06 13:37 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1651851370B9102C27-0..> | 2022-05-06 15:36 | 2.3M | |
![[IMG]](/icons/image2.gif) | 1651876396Screenshot..> | 2022-05-06 22:33 | 142K | |
![[IMG]](/icons/image2.gif) | 1652021136RabbitCres..> | 2022-05-08 14:45 | 191K | |
![[IMG]](/icons/image2.gif) | 1652021147RabbitCres..> | 2022-05-08 14:45 | 191K | |
![[IMG]](/icons/image2.gif) | 1652021196Screen Sho..> | 2022-05-08 14:46 | 304K | |
![[IMG]](/icons/image2.gif) | 1652021207Screen Sho..> | 2022-05-08 14:46 | 304K | |
![[IMG]](/icons/image2.gif) | 1652021258Screen Sho..> | 2022-05-08 14:47 | 297K | |
![[IMG]](/icons/image2.gif) | 1652021269Screen Sho..> | 2022-05-08 14:47 | 297K | |
![[IMG]](/icons/image2.gif) | 1652114939Fyler Farm..> | 2022-05-09 16:48 | 123K | |
![[IMG]](/icons/image2.gif) | 1652124397CEB410C0-1..> | 2022-05-09 19:26 | 314K | |
![[IMG]](/icons/image2.gif) | 1652198670EF0DC243-9..> | 2022-05-10 16:04 | 474K | |
![[IMG]](/icons/image2.gif) | 1652276824IMG_7721.JPG | 2022-05-11 13:47 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1652306060Sunset Acr..> | 2022-05-11 21:54 | 216K | |
![[IMG]](/icons/image2.gif) | 1652306120Sunset Acr..> | 2022-05-11 21:55 | 423K | |
![[IMG]](/icons/image2.gif) | 1652306131Sunset Acr..> | 2022-05-11 21:55 | 423K | |
![[IMG]](/icons/image2.gif) | 1652365881Big Sky Fa..> | 2022-05-12 14:31 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1652368424IMG_202106..> | 2022-05-12 15:13 | 2.5M | |
![[IMG]](/icons/image2.gif) | 1652378929transparen..> | 2022-05-12 18:08 | 91K | |
![[IMG]](/icons/image2.gif) | 1652400321Logo.jpg | 2022-05-13 00:05 | 2.1M | |
![[IMG]](/icons/image2.gif) | 1652459041Profile-pi..> | 2022-05-13 16:24 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1652474963E7C6F813-E..> | 2022-05-13 20:49 | 431K | |
![[IMG]](/icons/image2.gif) | 1652497180logo.jpg | 2022-05-14 02:59 | 87K | |
![[IMG]](/icons/image2.gif) | 1652630556SFParent L..> | 2022-05-15 16:02 | 461K | |
![[IMG]](/icons/image2.gif) | 1652630567SFParent L..> | 2022-05-15 16:02 | 461K | |
![[IMG]](/icons/image2.gif) | 1652745949SMALLER GE..> | 2022-05-17 00:05 | 18K | |
![[IMG]](/icons/image2.gif) | 1652752997George Far..> | 2022-05-17 02:03 | 94K | |
![[IMG]](/icons/image2.gif) | 1652791312AB85F490-7..> | 2022-05-17 12:41 | 136K | |
![[IMG]](/icons/image2.gif) | 1652825105C38D2A7B-5..> | 2022-05-17 22:05 | 923K | |
![[IMG]](/icons/image2.gif) | 1653084532IMG_0450[1..> | 2022-05-20 22:08 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1653154545REF .jpeg | 2022-05-21 17:35 | 103K | |
![[IMG]](/icons/image2.gif) | 1653167305Viva-La-Ju..> | 2022-05-21 21:08 | 64K | |
![[IMG]](/icons/image2.gif) | 1653192492B45C390D-4..> | 2022-05-22 04:08 | 3.9M | |
![[IMG]](/icons/image2.gif) | 1653225007Original.png | 2022-05-22 13:10 | 67K | |
![[IMG]](/icons/image2.gif) | 1653342409project_20..> | 2022-05-23 21:46 | 243K | |
![[IMG]](/icons/image2.gif) | 1653346095logo_circl..> | 2022-05-23 22:48 | 210K | |
![[IMG]](/icons/image2.gif) | 1653351235logo-origi..> | 2022-05-24 00:13 | 151K | |
![[IMG]](/icons/image2.gif) | 1653351250logo_trans..> | 2022-05-24 00:14 | 55K | |
![[IMG]](/icons/image2.gif) | 1653351350logo-origi..> | 2022-05-24 00:15 | 151K | |
![[IMG]](/icons/image2.gif) | 1653406227logo_white..> | 2022-05-24 15:30 | 338K | |
![[IMG]](/icons/image2.gif) | 1653407666IMG_202203..> | 2022-05-24 15:54 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1653410334LoganFamil..> | 2022-05-24 16:38 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1653442007FB_IMG_165..> | 2022-05-25 01:26 | 80K | |
![[IMG]](/icons/image2.gif) | 1653445631FB_IMG_165..> | 2022-05-25 02:27 | 80K | |
![[IMG]](/icons/image2.gif) | 1653529385AFD9773D-9..> | 2022-05-26 01:43 | 900K | |
![[IMG]](/icons/image2.gif) | 1653665994StoneArchF..> | 2022-05-27 15:39 | 41K | |
![[IMG]](/icons/image2.gif) | 1653684307PKCO_Medal..> | 2022-05-27 20:45 | 13K | |
![[IMG]](/icons/image2.gif) | 1653686238Photo for ..> | 2022-05-27 21:17 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1653836978IMG_202205..> | 2022-05-29 15:09 | 508K | |
![[IMG]](/icons/image2.gif) | 1653851351A&S MW Log..> | 2022-05-29 19:09 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1653926417MR Charcut..> | 2022-05-30 16:00 | 431K | |
![[IMG]](/icons/image2.gif) | 1653934664Photo Dec ..> | 2022-05-30 18:17 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1653941035IMG_9856 (..> | 2022-05-30 20:03 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1653941406IMG_9888 (..> | 2022-05-30 20:10 | 205K | |
![[IMG]](/icons/image2.gif) | 1653960345Free Reign..> | 2022-05-31 01:25 | 8.2K | |
![[IMG]](/icons/image2.gif) | 1653962526TastyPicke..> | 2022-05-31 02:02 | 89K | |
![[IMG]](/icons/image2.gif) | 1654011251TLB_circle..> | 2022-05-31 15:34 | 532K | |
![[IMG]](/icons/image2.gif) | 1654099787D8C - Logo..> | 2022-06-01 16:09 | 35K | |
![[IMG]](/icons/image2.gif) | 1654111461IMG_9732.jpg | 2022-06-01 19:24 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1654114505GodinyaLog..> | 2022-06-01 20:15 | 313K | |
![[IMG]](/icons/image2.gif) | 1654132332pleasant f..> | 2022-06-02 01:12 | 26K | |
![[IMG]](/icons/image2.gif) | 1654133364Sales-Spec..> | 2022-06-02 01:29 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1654133503F7B2895F-6..> | 2022-06-02 01:31 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1654181801GEORGIA BI..> | 2022-06-02 14:56 | 72K | |
![[IMG]](/icons/image2.gif) | 1654198819IMG_0279.PNG | 2022-06-02 19:40 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1654206357Simply Sag..> | 2022-06-02 21:45 | 135K | |
![[IMG]](/icons/image2.gif) | 1654215868logo.2.21.jpg | 2022-06-03 00:24 | 748K | |
![[IMG]](/icons/image2.gif) | 1654291232image0002.jpg | 2022-06-03 21:20 | 145K | |
![[IMG]](/icons/image2.gif) | 1654348065label logo..> | 2022-06-04 13:07 | 18K | |
![[IMG]](/icons/image2.gif) | 1654360425Happy Loca..> | 2022-06-04 16:33 | 507K | |
![[IMG]](/icons/image2.gif) | 1654387384sheep.png | 2022-06-05 00:03 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1654394393Logo final..> | 2022-06-05 01:59 | 386K | |
![[IMG]](/icons/image2.gif) | 1654455964Twitter_Ba..> | 2022-06-05 19:06 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1654543723Full-color..> | 2022-06-06 19:28 | 164K | |
![[IMG]](/icons/image2.gif) | 1654570080Screen Sho..> | 2022-06-07 02:48 | 23K | |
![[IMG]](/icons/image2.gif) | 1654572795founder.jpg | 2022-06-07 03:33 | 267K | |
![[IMG]](/icons/image2.gif) | 1654603091Logo as GI..> | 2022-06-07 11:58 | 72K | |
![[IMG]](/icons/image2.gif) | 1654648999Logo 3.jpg | 2022-06-08 00:43 | 169K | |
![[IMG]](/icons/image2.gif) | 1654649030Logo 3.jpg | 2022-06-08 00:43 | 169K | |
![[IMG]](/icons/image2.gif) | 1654692641TCBC_Logo_..> | 2022-06-08 12:50 | 188K | |
![[IMG]](/icons/image2.gif) | 1654712298eZy Waterm..> | 2022-06-08 18:18 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1654728408E186B7C1-3..> | 2022-06-08 22:46 | 593K | |
![[IMG]](/icons/image2.gif) | 1654732055WOPWE Bann..> | 2022-06-08 23:47 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1654732091WOPWE Bann..> | 2022-06-08 23:48 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1654783529KC Logo.jpg | 2022-06-09 14:05 | 150K | |
![[IMG]](/icons/image2.gif) | 1654823814Ithica Bee..> | 2022-06-10 01:16 | 85K | |
![[IMG]](/icons/image2.gif) | 1654863102SGGC Logo.png | 2022-06-10 12:11 | 235K | |
![[IMG]](/icons/image2.gif) | 1654952241tgsp.jpg | 2022-06-11 12:57 | 143K | |
![[IMG]](/icons/image2.gif) | 1655042163Outskirts-..> | 2022-06-12 13:56 | 92K | |
![[IMG]](/icons/image2.gif) | 1655057814A408B8B1-6..> | 2022-06-12 18:16 | 164K | |
![[IMG]](/icons/image2.gif) | 1655131840Baldwin Br..> | 2022-06-13 14:50 | 657K | |
![[IMG]](/icons/image2.gif) | 1655137918destihl.jpg | 2022-06-13 16:31 | 956K | |
![[IMG]](/icons/image2.gif) | 1655140512Rolling Hi..> | 2022-06-13 17:15 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1655146199IMG_4902 (..> | 2022-06-13 18:49 | 678K | |
![[IMG]](/icons/image2.gif) | 1655230083Cute Kyla ..> | 2022-06-14 18:08 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1655231307B2D0A4B6-F..> | 2022-06-14 18:28 | 506K | |
![[IMG]](/icons/image2.gif) | 1655234032CoveyChase..> | 2022-06-14 19:13 | 809K | |
![[IMG]](/icons/image2.gif) | 1655239160Screenshot..> | 2022-06-14 20:39 | 25K | |
![[IMG]](/icons/image2.gif) | 1655244468BBV-LogoTa..> | 2022-06-14 22:07 | 16K | |
![[IMG]](/icons/image2.gif) | 1655244930BBV-social..> | 2022-06-14 22:15 | 219K | |
![[IMG]](/icons/image2.gif) | 1655331385AF4719DC-1..> | 2022-06-15 22:16 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1655341271IMG_0481.PNG | 2022-06-16 01:01 | 148K | |
![[IMG]](/icons/image2.gif) | 1655428000elderberry..> | 2022-06-17 01:06 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1655481415BBCO_Tervi..> | 2022-06-17 15:56 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1655488897butters st..> | 2022-06-17 18:01 | 293K | |
![[IMG]](/icons/image2.gif) | 1655488925butters ba..> | 2022-06-17 18:02 | 356K | |
![[IMG]](/icons/image2.gif) | 1655489057butters st..> | 2022-06-17 18:04 | 293K | |
![[IMG]](/icons/image2.gif) | 1655576863Sunshine (..> | 2022-06-18 18:27 | 91K | |
![[IMG]](/icons/image2.gif) | 1655577611Sunshine (..> | 2022-06-18 18:40 | 73K | |
![[IMG]](/icons/image2.gif) | 1655577661Sunshine (..> | 2022-06-18 18:41 | 86K | |
![[IMG]](/icons/image2.gif) | 1655600987Cover Phot..> | 2022-06-19 01:09 | 220K | |
![[IMG]](/icons/image2.gif) | 1655659073IMG_202206..> | 2022-06-19 17:17 | 4.8M | |
![[IMG]](/icons/image2.gif) | 1655664777Screenshot..> | 2022-06-19 18:52 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1655665967Screenshot..> | 2022-06-19 19:12 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1655666250Screenshot..> | 2022-06-19 19:17 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1655666552Screenshot..> | 2022-06-19 19:22 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1655666771Screenshot..> | 2022-06-19 19:26 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1655666829Screenshot..> | 2022-06-19 19:27 | 661K | |
![[IMG]](/icons/image2.gif) | 1655666885Screenshot..> | 2022-06-19 19:28 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1655732006DicedAndEa..> | 2022-06-20 13:33 | 57K | |
![[IMG]](/icons/image2.gif) | 1655746042Soul Food ..> | 2022-06-20 17:27 | 237K | |
![[IMG]](/icons/image2.gif) | 1655746360FB_IMG_165..> | 2022-06-20 17:32 | 604K | |
![[IMG]](/icons/image2.gif) | 1655778317image0.png | 2022-06-21 02:25 | 185K | |
![[IMG]](/icons/image2.gif) | 1655824195Untitled d..> | 2022-06-21 15:09 | 68K | |
![[IMG]](/icons/image2.gif) | 1655829317Screenshot..> | 2022-06-21 16:35 | 65K | |
![[IMG]](/icons/image2.gif) | 1655858290J&J Family..> | 2022-06-22 00:38 | 614K | |
![[IMG]](/icons/image2.gif) | 1655867587Screenshot..> | 2022-06-22 03:13 | 961K | |
![[IMG]](/icons/image2.gif) | 1655867624Capture.PNG | 2022-06-22 03:13 | 69K | |
![[IMG]](/icons/image2.gif) | 1655899310Phoenix Ne..> | 2022-06-22 12:01 | 165K | |
![[IMG]](/icons/image2.gif) | 1655904710H&H Cattle..> | 2022-06-22 13:31 | 11K | |
![[IMG]](/icons/image2.gif) | 1655919439BB4E03E6-2..> | 2022-06-22 17:37 | 510K | |
![[IMG]](/icons/image2.gif) | 1656004540FA283ED8-3..> | 2022-06-23 17:15 | 2.5M | |
![[IMG]](/icons/image2.gif) | 1656006042FTTI Brand..> | 2022-06-23 17:40 | 150K | |
![[IMG]](/icons/image2.gif) | 1656013528FB_IMG_165..> | 2022-06-23 19:45 | 115K | |
![[IMG]](/icons/image2.gif) | 1656014331IMG_0489(1..> | 2022-06-23 19:58 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1656099839Pinterest ..> | 2022-06-24 19:43 | 13K | |
![[IMG]](/icons/image2.gif) | 1656258702FB_IMG_165..> | 2022-06-26 15:51 | 722K | |
![[IMG]](/icons/image2.gif) | 1656357059VF_Logo_bl..> | 2022-06-27 19:10 | 210K | |
![[IMG]](/icons/image2.gif) | 1656384848caf970_75b..> | 2022-06-28 02:54 | 189K | |
![[IMG]](/icons/image2.gif) | 1656384983caf970_75b..> | 2022-06-28 02:56 | 115K | |
![[IMG]](/icons/image2.gif) | 1656434550FC045452-5..> | 2022-06-28 16:42 | 100K | |
![[IMG]](/icons/image2.gif) | 1656514644Me with so..> | 2022-06-29 14:57 | 285K | |
![[IMG]](/icons/image2.gif) | 1656524270Logo_3-17-..> | 2022-06-29 17:37 | 434K | |
![[IMG]](/icons/image2.gif) | 1656538962image.jpg | 2022-06-29 21:42 | 533K | |
![[IMG]](/icons/image2.gif) | 1656603488profile pi..> | 2022-06-30 15:38 | 907K | |
![[IMG]](/icons/image2.gif) | 1656605550Sift Baker..> | 2022-06-30 16:12 | 39K | |
![[IMG]](/icons/image2.gif) | 1656725454Screen Sho..> | 2022-07-02 01:30 | 691K | |
![[IMG]](/icons/image2.gif) | 1656787133Two Onion ..> | 2022-07-02 18:38 | 615K | |
![[IMG]](/icons/image2.gif) | 1656799496IMG_6661.JPG | 2022-07-02 22:04 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1656876914Facebook P..> | 2022-07-03 19:35 | 57K | |
![[IMG]](/icons/image2.gif) | 1656876941Facebook P..> | 2022-07-03 19:35 | 57K | |
![[IMG]](/icons/image2.gif) | 1656893096FB_IMG_165..> | 2022-07-04 00:04 | 308K | |
![[IMG]](/icons/image2.gif) | 1656932991Artboard 2..> | 2022-07-04 11:09 | 17K | |
![[IMG]](/icons/image2.gif) | 1656947707Screen Sho..> | 2022-07-04 15:15 | 104K | |
![[IMG]](/icons/image2.gif) | 1656975938priest fam..> | 2022-07-04 23:05 | 575K | |
![[IMG]](/icons/image2.gif) | 1657113941IMG_202206..> | 2022-07-06 13:25 | 2.5M | |
![[IMG]](/icons/image2.gif) | 1657144246farmers.jpg | 2022-07-06 21:50 | 145K | |
![[IMG]](/icons/image2.gif) | 1657161904NewEvoluti..> | 2022-07-07 02:45 | 34K | |
![[IMG]](/icons/image2.gif) | 1657231612macon baco..> | 2022-07-07 22:06 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1657310312logo_size.jpg | 2022-07-08 19:58 | 129K | |
![[IMG]](/icons/image2.gif) | 1657410712iced water..> | 2022-07-09 23:51 | 376K | |
![[IMG]](/icons/image2.gif) | 1657564862WGLogo1_wh..> | 2022-07-11 18:41 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1657604208C0969F59-C..> | 2022-07-12 05:36 | 567K | |
![[IMG]](/icons/image2.gif) | 1657654463wbcircles0..> | 2022-07-12 19:34 | 380K | |
![[IMG]](/icons/image2.gif) | 1657655269WB logo wi..> | 2022-07-12 19:47 | 399K | |
![[IMG]](/icons/image2.gif) | 1657721000Cahaba Urb..> | 2022-07-13 14:03 | 869K | |
![[IMG]](/icons/image2.gif) | 1657734643IMG_0876.jpg | 2022-07-13 17:50 | 2.5M | |
![[IMG]](/icons/image2.gif) | 1657804122Simply Sou..> | 2022-07-14 13:08 | 41K | |
![[IMG]](/icons/image2.gif) | 1657809490BA466D0D-D..> | 2022-07-14 14:38 | 664K | |
![[IMG]](/icons/image2.gif) | 1657817639EB8F17D1-3..> | 2022-07-14 16:53 | 676K | |
![[IMG]](/icons/image2.gif) | 1657821634Logo 2.jpg | 2022-07-14 18:00 | 360K | |
![[IMG]](/icons/image2.gif) | 1657832970Company Lo..> | 2022-07-14 21:09 | 451K | |
![[IMG]](/icons/image2.gif) | 1657834232Company Lo..> | 2022-07-14 21:30 | 405K | |
![[IMG]](/icons/image2.gif) | 1657849214Red Barn F..> | 2022-07-15 01:40 | 413K | |
![[IMG]](/icons/image2.gif) | 1657903518IMG_2942.JPG | 2022-07-15 16:45 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1657905468OCHOSALSA.png | 2022-07-15 17:17 | 259K | |
![[IMG]](/icons/image2.gif) | 1658158933AC7581B3-0..> | 2022-07-18 15:42 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1658161857Circle log..> | 2022-07-18 16:30 | 100K | |
![[IMG]](/icons/image2.gif) | 1658161911Circle log..> | 2022-07-18 16:31 | 100K | |
![[IMG]](/icons/image2.gif) | 1658163663Logo.jpg | 2022-07-18 17:01 | 396K | |
![[IMG]](/icons/image2.gif) | 1658166012Logo.jpg | 2022-07-18 17:40 | 412K | |
![[IMG]](/icons/image2.gif) | 1658166543Sourdoug C..> | 2022-07-18 17:49 | 172K | |
![[IMG]](/icons/image2.gif) | 1658166557Sourdoug C..> | 2022-07-18 17:49 | 172K | |
![[IMG]](/icons/image2.gif) | 1658201080UncleAls_P..> | 2022-07-19 03:24 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1658202888shuttersto..> | 2022-07-19 03:54 | 3.1M | |
![[IMG]](/icons/image2.gif) | 1658259129My project..> | 2022-07-19 19:32 | 101K | |
![[IMG]](/icons/image2.gif) | 1658268017Small logo..> | 2022-07-19 22:00 | 3.3M | |
![[IMG]](/icons/image2.gif) | 1658348943FinalLogo.png | 2022-07-20 20:29 | 355K | |
![[IMG]](/icons/image2.gif) | 1658363048RiverWatch..> | 2022-07-21 00:24 | 28K | |
![[IMG]](/icons/image2.gif) | 1658519130IMG_2368.jpg | 2022-07-22 19:45 | 365K | |
![[IMG]](/icons/image2.gif) | 1658683826Black logo..> | 2022-07-24 17:30 | 81K | |
![[IMG]](/icons/image2.gif) | 1658705458Aleuro_BLK..> | 2022-07-24 23:30 | 128K | |
![[IMG]](/icons/image2.gif) | 1658763517IMG_4396.jpg | 2022-07-25 15:38 | 2.8M | |
![[IMG]](/icons/image2.gif) | 1658766147PIP_no ill..> | 2022-07-25 16:22 | 119K | |
![[IMG]](/icons/image2.gif) | 1658777013IMG_7868.jpg | 2022-07-25 19:23 | 121K | |
![[IMG]](/icons/image2.gif) | 1658785216tempImage1..> | 2022-07-25 21:40 | 685K | |
![[IMG]](/icons/image2.gif) | 1658793543Mitchell's..> | 2022-07-25 23:59 | 121K | |
![[IMG]](/icons/image2.gif) | 1658794100Mitchell's..> | 2022-07-26 00:08 | 549K | |
![[IMG]](/icons/image2.gif) | 1658797201logo_etsy.png | 2022-07-26 01:00 | 152K | |
![[IMG]](/icons/image2.gif) | 1658865930Tastefully..> | 2022-07-26 20:05 | 320K | |
![[IMG]](/icons/image2.gif) | 1658868577Hipp Harve..> | 2022-07-26 20:49 | 42K | |
![[IMG]](/icons/image2.gif) | 1658868598Hipp Harve..> | 2022-07-26 20:49 | 132K | |
![[IMG]](/icons/image2.gif) | 1658868618IMG_3505.JPG | 2022-07-26 20:50 | 216K | |
![[IMG]](/icons/image2.gif) | 1658934814Market Wag..> | 2022-07-27 15:13 | 174K | |
![[IMG]](/icons/image2.gif) | 1658937764FB_IMG_160..> | 2022-07-27 16:02 | 472K | |
![[IMG]](/icons/image2.gif) | 1658944088edit 1.jpeg | 2022-07-27 17:48 | 3.2M | |
![[IMG]](/icons/image2.gif) | 1658947877Raising Ro..> | 2022-07-27 18:51 | 96K | |
![[IMG]](/icons/image2.gif) | 1658952366edit 1.jpeg | 2022-07-27 20:06 | 3.2M | |
![[IMG]](/icons/image2.gif) | 1658954900Large Labe..> | 2022-07-27 20:48 | 55K | |
![[IMG]](/icons/image2.gif) | 1659028051summer2.jpg | 2022-07-28 17:07 | 694K | |
![[IMG]](/icons/image2.gif) | 1659028107summer1.jpg | 2022-07-28 17:08 | 592K | |
![[IMG]](/icons/image2.gif) | 1659028184IMG_1448.jpg | 2022-07-28 17:09 | 2.3M | |
![[IMG]](/icons/image2.gif) | 1659028478summer1.jpg | 2022-07-28 17:14 | 592K | |
![[IMG]](/icons/image2.gif) | 1659031876MMS Logo.png | 2022-07-28 18:11 | 252K | |
![[IMG]](/icons/image2.gif) | 1659037640Voils-Fami..> | 2022-07-28 19:47 | 99K | |
![[IMG]](/icons/image2.gif) | 1659223632Sour and S..> | 2022-07-30 23:27 | 41K | |
![[IMG]](/icons/image2.gif) | 1659231947aval-png-f..> | 2022-07-31 01:45 | 102K | |
![[IMG]](/icons/image2.gif) | 1659232015aval-png-f..> | 2022-07-31 01:46 | 102K | |
![[IMG]](/icons/image2.gif) | 1659232090Avalanche ..> | 2022-07-31 01:48 | 319K | |
![[IMG]](/icons/image2.gif) | 1659232115aval-png-f..> | 2022-07-31 01:48 | 102K | |
![[IMG]](/icons/image2.gif) | 1659356234Rooted LOG..> | 2022-08-01 12:17 | 190K | |
![[IMG]](/icons/image2.gif) | 1659445998Logo Soul ..> | 2022-08-02 13:13 | 246K | |
![[IMG]](/icons/image2.gif) | 1659455933TWF - logo..> | 2022-08-02 15:58 | 57K | |
![[IMG]](/icons/image2.gif) | 1659460348images.jpe..> | 2022-08-02 17:12 | 86K | |
![[IMG]](/icons/image2.gif) | 1659461844ZOK LOGO F..> | 2022-08-02 17:37 | 419K | |
![[IMG]](/icons/image2.gif) | 1659486847Heart Shap..> | 2022-08-03 00:34 | 240K | |
![[IMG]](/icons/image2.gif) | 1659541287BEANS B&W.jpg | 2022-08-03 15:41 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1659557427unnamed.png | 2022-08-03 20:10 | 25K | |
![[IMG]](/icons/image2.gif) | 1659557516IMG_202203..> | 2022-08-03 20:11 | 777K | |
![[IMG]](/icons/image2.gif) | 1659587192received_6..> | 2022-08-04 04:26 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1659646187IMG_202201..> | 2022-08-04 20:49 | 167K | |
![[IMG]](/icons/image2.gif) | 1659648903Moss Lane ..> | 2022-08-04 21:35 | 828K | |
![[IMG]](/icons/image2.gif) | 1659666584Winning_LO..> | 2022-08-05 02:29 | 80K | |
![[IMG]](/icons/image2.gif) | 1659707645LOGO.png | 2022-08-05 13:54 | 324K | |
![[IMG]](/icons/image2.gif) | 1659725835Mythos Log..> | 2022-08-05 18:57 | 151K | |
![[IMG]](/icons/image2.gif) | 1659728640Screenshot..> | 2022-08-05 19:44 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1659731704ECAEEB81-7..> | 2022-08-05 20:35 | 4.4M | |
![[IMG]](/icons/image2.gif) | 1659735740penn st gr..> | 2022-08-05 21:42 | 33K | |
![[IMG]](/icons/image2.gif) | 1659903642MemoryPens..> | 2022-08-07 20:20 | 320K | |
![[IMG]](/icons/image2.gif) | 1659971833Trio of Gr..> | 2022-08-08 15:17 | 3.3M | |
![[IMG]](/icons/image2.gif) | 1659976187Logo.jpg | 2022-08-08 16:29 | 160K | |
![[IMG]](/icons/image2.gif) | 1659976909Honk alone..> | 2022-08-08 16:41 | 289K | |
![[IMG]](/icons/image2.gif) | 1659981013pahls farm..> | 2022-08-08 17:50 | 410K | |
![[IMG]](/icons/image2.gif) | 1659983629Cheeky_Mai..> | 2022-08-08 18:33 | 548K | |
![[IMG]](/icons/image2.gif) | 1660004553D212D3CA-A..> | 2022-08-09 00:22 | 3.7M | |
![[IMG]](/icons/image2.gif) | 1660007293hilaryande..> | 2022-08-09 01:08 | 882K | |
![[IMG]](/icons/image2.gif) | 1660007308hilaryande..> | 2022-08-09 01:08 | 882K | |
![[IMG]](/icons/image2.gif) | 1660018783final logo..> | 2022-08-09 04:19 | 62K | |
![[IMG]](/icons/image2.gif) | 1660058315msc-transp..> | 2022-08-09 15:18 | 62K | |
![[IMG]](/icons/image2.gif) | 1660060872medium.png | 2022-08-09 16:01 | 57K | |
![[IMG]](/icons/image2.gif) | 1660073257IMG_3073.jpg | 2022-08-09 19:27 | 889K | |
![[IMG]](/icons/image2.gif) | 1660154892corn image..> | 2022-08-10 18:08 | 3.9M | |
![[IMG]](/icons/image2.gif) | 1660168194Banner.png | 2022-08-10 21:49 | 256K | |
![[IMG]](/icons/image2.gif) | 1660168248Pepper Sti..> | 2022-08-10 21:50 | 872K | |
![[IMG]](/icons/image2.gif) | 1660181065logo.png | 2022-08-11 01:24 | 98K | |
![[IMG]](/icons/image2.gif) | 1660233165RDT - Main..> | 2022-08-11 15:52 | 295K | |
![[IMG]](/icons/image2.gif) | 1660248316Farm On Lo..> | 2022-08-11 20:05 | 30K | |
![[IMG]](/icons/image2.gif) | 1660272179Donnie pro..> | 2022-08-12 02:42 | 364K | |
![[IMG]](/icons/image2.gif) | 1660272221Smooth Acr..> | 2022-08-12 02:43 | 49K | |
![[IMG]](/icons/image2.gif) | 1660319881IMG_0195.JPG | 2022-08-12 15:58 | 2.3M | |
![[IMG]](/icons/image2.gif) | 1660407657B&W-HLC-Lo..> | 2022-08-13 16:20 | 35K | |
![[IMG]](/icons/image2.gif) | 1660472732Indigo Lak..> | 2022-08-14 10:25 | 431K | |
![[IMG]](/icons/image2.gif) | 1660472825Flame Icon..> | 2022-08-14 10:27 | 126K | |
![[IMG]](/icons/image2.gif) | 1660506707Three Bear..> | 2022-08-14 19:51 | 360K | |
![[IMG]](/icons/image2.gif) | 1660517126Untitled_A..> | 2022-08-14 22:45 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1660538883the-juice-..> | 2022-08-15 04:48 | 87K | |
![[IMG]](/icons/image2.gif) | 1660586900image.jpg | 2022-08-15 18:08 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1660606267Original o..> | 2022-08-15 23:31 | 171K | |
![[IMG]](/icons/image2.gif) | 1660664507Goats and ..> | 2022-08-16 15:41 | 416K | |
![[IMG]](/icons/image2.gif) | 1660671943baker jpeg..> | 2022-08-16 17:45 | 702K | |
![[IMG]](/icons/image2.gif) | 1660683566logo Dante..> | 2022-08-16 20:59 | 129K | |
![[IMG]](/icons/image2.gif) | 1660750426designcrow..> | 2022-08-17 15:33 | 14K | |
![[IMG]](/icons/image2.gif) | 1660753615melted.png | 2022-08-17 16:26 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1660753623melted.png | 2022-08-17 16:27 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1660756782Body+Brain..> | 2022-08-17 17:19 | 178K | |
![[IMG]](/icons/image2.gif) | 1660771707cover phot..> | 2022-08-17 21:28 | 651K | |
![[IMG]](/icons/image2.gif) | 1660788217Shuttersto..> | 2022-08-18 02:03 | 251K | |
![[IMG]](/icons/image2.gif) | 1660828356Logo-Trans..> | 2022-08-18 13:12 | 373K | |
![[IMG]](/icons/image2.gif) | 1660836180Iguess.png | 2022-08-18 15:23 | 218K | |
![[IMG]](/icons/image2.gif) | 1660838149THE LOGO.png | 2022-08-18 15:55 | 39K | |
![[IMG]](/icons/image2.gif) | 1660848867TomatoBlis..> | 2022-08-18 18:54 | 16K | |
![[IMG]](/icons/image2.gif) | 1660948534Untitled d..> | 2022-08-19 22:35 | 179K | |
![[IMG]](/icons/image2.gif) | 1661010424seasonal.jpg | 2022-08-20 15:47 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1661192593Evermore 2..> | 2022-08-22 18:23 | 263K | |
![[IMG]](/icons/image2.gif) | 1661209342Open Kats_..> | 2022-08-22 23:02 | 393K | |
![[IMG]](/icons/image2.gif) | 1661284342Evermore B..> | 2022-08-23 19:52 | 405K | |
![[IMG]](/icons/image2.gif) | 1661362902Tomato Bli..> | 2022-08-24 17:41 | 161K | |
![[IMG]](/icons/image2.gif) | 1661454628JW_Terra_N..> | 2022-08-25 19:10 | 253K | |
![[IMG]](/icons/image2.gif) | 1661527728B8782C77-3..> | 2022-08-26 15:28 | 2.1M | |
![[IMG]](/icons/image2.gif) | 1661545319MUD Logo.png | 2022-08-26 20:21 | 215K | |
![[IMG]](/icons/image2.gif) | 1661694530Untitled d..> | 2022-08-28 13:48 | 136K | |
![[IMG]](/icons/image2.gif) | 1661706544Me& Beeps.jpg | 2022-08-28 17:09 | 723K | |
![[IMG]](/icons/image2.gif) | 1661712779Chews Logo..> | 2022-08-28 18:52 | 308K | |
![[IMG]](/icons/image2.gif) | 1661782074oh myceliu..> | 2022-08-29 14:07 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1661782453CMiller-fa..> | 2022-08-29 14:14 | 3.1M | |
![[IMG]](/icons/image2.gif) | 1661789513FB cover n..> | 2022-08-29 16:11 | 246K | |
![[IMG]](/icons/image2.gif) | 1661802658Profile Pi..> | 2022-08-29 19:50 | 185K | |
![[IMG]](/icons/image2.gif) | 1661868748mini VCG l..> | 2022-08-30 14:12 | 51K | |
![[IMG]](/icons/image2.gif) | 1661881543Copy of co..> | 2022-08-30 17:45 | 121K | |
![[IMG]](/icons/image2.gif) | 1661902056CF6D6E2F-3..> | 2022-08-30 23:27 | 548K | |
![[IMG]](/icons/image2.gif) | 1661904802new logo20..> | 2022-08-31 00:13 | 66K | |
![[IMG]](/icons/image2.gif) | 1661969273IMG_202205..> | 2022-08-31 18:07 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1662028500PPF_Logo.png | 2022-09-01 10:35 | 939K | |
![[IMG]](/icons/image2.gif) | 1662042125Polarr_Pho..> | 2022-09-01 14:22 | 149K | |
![[IMG]](/icons/image2.gif) | 1662049578Market Whe..> | 2022-09-01 16:26 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1662062812Euphoria B..> | 2022-09-01 20:06 | 66K | |
![[IMG]](/icons/image2.gif) | 1662134159Classic Pe..> | 2022-09-02 15:55 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1662151688C6831ABC-7..> | 2022-09-02 20:48 | 927K | |
![[IMG]](/icons/image2.gif) | 1662158178Mikes Hot ..> | 2022-09-02 22:36 | 908K | |
![[IMG]](/icons/image2.gif) | 1662251989Relish Eat..> | 2022-09-04 00:39 | 212K | |
![[IMG]](/icons/image2.gif) | 1662309293etsy logo...> | 2022-09-04 16:34 | 29K | |
![[IMG]](/icons/image2.gif) | 1662408478daisyfish ..> | 2022-09-05 20:07 | 823K | |
![[IMG]](/icons/image2.gif) | 1662469631kom.jpg | 2022-09-06 13:07 | 125K | |
![[IMG]](/icons/image2.gif) | 1662483107logo-png.png | 2022-09-06 16:51 | 205K | |
![[IMG]](/icons/image2.gif) | 1662487886Final Logo..> | 2022-09-06 18:11 | 411K | |
![[IMG]](/icons/image2.gif) | 1662491866B52B52B7-7..> | 2022-09-06 19:17 | 184K | |
![[IMG]](/icons/image2.gif) | 1662499312D5471B37-3..> | 2022-09-06 21:21 | 542K | |
![[IMG]](/icons/image2.gif) | 1662505921PS-yogurt-..> | 2022-09-06 23:12 | 694K | |
![[IMG]](/icons/image2.gif) | 1662524831Slaughter ..> | 2022-09-07 04:27 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1662553625Crossroads..> | 2022-09-07 12:27 | 462K | |
![[IMG]](/icons/image2.gif) | 1662567265orange_log..> | 2022-09-07 16:14 | 302K | |
![[IMG]](/icons/image2.gif) | 1662568143sorceFresh..> | 2022-09-07 16:29 | 153K | |
![[IMG]](/icons/image2.gif) | 1662570928SSLogo.jpg | 2022-09-07 17:15 | 50K | |
![[IMG]](/icons/image2.gif) | 1662592952Cleveland ..> | 2022-09-07 23:22 | 165K | |
![[IMG]](/icons/image2.gif) | 1662650979A8A3FCFE-4..> | 2022-09-08 15:29 | 2.4M | |
![[IMG]](/icons/image2.gif) | 1662665106pumpkin-bo..> | 2022-09-08 19:25 | 130K | |
![[IMG]](/icons/image2.gif) | 1662679783Logo copy.jpg | 2022-09-08 23:29 | 430K | |
![[IMG]](/icons/image2.gif) | 1662689115Logo copy.jpg | 2022-09-09 02:05 | 430K | |
![[IMG]](/icons/image2.gif) | 1662725752Mushroom l..> | 2022-09-09 12:15 | 736K | |
![[IMG]](/icons/image2.gif) | 1662726376Nine Spoon..> | 2022-09-09 12:26 | 199K | |
![[IMG]](/icons/image2.gif) | 1662728405sm-profile..> | 2022-09-09 13:00 | 55K | |
![[IMG]](/icons/image2.gif) | 1662732388unnamed gf..> | 2022-09-09 14:06 | 2.4M | |
![[IMG]](/icons/image2.gif) | 1662992271Resized_20..> | 2022-09-12 14:17 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1662992599FB_IMG_166..> | 2022-09-12 14:23 | 333K | |
![[IMG]](/icons/image2.gif) | 1663008768Laukaitis_..> | 2022-09-12 18:52 | 3.4M | |
![[IMG]](/icons/image2.gif) | 1663020697White back..> | 2022-09-12 22:11 | 87K | |
![[IMG]](/icons/image2.gif) | 1663036535Sproutly L..> | 2022-09-13 02:35 | 149K | |
![[IMG]](/icons/image2.gif) | 1663062640Maven's So..> | 2022-09-13 09:50 | 26K | |
![[IMG]](/icons/image2.gif) | 1663084416timbar log..> | 2022-09-13 15:53 | 49K | |
![[IMG]](/icons/image2.gif) | 1663099085Logo.jpg | 2022-09-13 19:58 | 175K | |
![[IMG]](/icons/image2.gif) | 1663114458defining m..> | 2022-09-14 00:14 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1663127779Logo on S&..> | 2022-09-14 03:56 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1663173109IMG_202104..> | 2022-09-14 16:31 | 839K | |
![[IMG]](/icons/image2.gif) | 1663183200Littlefoot..> | 2022-09-14 19:20 | 440K | |
![[IMG]](/icons/image2.gif) | 1663233517IMG_202209..> | 2022-09-15 09:18 | 65K | |
![[IMG]](/icons/image2.gif) | 1663254574bluemindco..> | 2022-09-15 15:09 | 160K | |
![[IMG]](/icons/image2.gif) | 1663254882logo_local..> | 2022-09-15 15:14 | 13K | |
![[IMG]](/icons/image2.gif) | 1663262879logo with ..> | 2022-09-15 17:27 | 128K | |
![[IMG]](/icons/image2.gif) | 1663263441Screenshot..> | 2022-09-15 17:37 | 523K | |
![[IMG]](/icons/image2.gif) | 1663285546Helm final..> | 2022-09-15 23:45 | 186K | |
![[IMG]](/icons/image2.gif) | 1663341856clear bckg..> | 2022-09-16 15:24 | 67K | |
![[IMG]](/icons/image2.gif) | 1663414885PuttPantry..> | 2022-09-17 11:41 | 243K | |
![[IMG]](/icons/image2.gif) | 1663599545DFNUE9308.JPG | 2022-09-19 14:59 | 371K | |
![[IMG]](/icons/image2.gif) | 1663612008Screen Sho..> | 2022-09-19 18:26 | 128K | |
![[IMG]](/icons/image2.gif) | 1663613262IMG_3676.JPG | 2022-09-19 18:47 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1663615111hilaryande..> | 2022-09-19 19:18 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1663632268EDDY_Logo.png | 2022-09-20 00:04 | 8.8K | |
![[IMG]](/icons/image2.gif) | 1663632552EDDY_Logo.jpg | 2022-09-20 00:09 | 48K | |
![[IMG]](/icons/image2.gif) | 1663632579EDDY_Logo.jpg | 2022-09-20 00:09 | 48K | |
![[IMG]](/icons/image2.gif) | 1663633077eddy_logo.jpg | 2022-09-20 00:17 | 53K | |
![[IMG]](/icons/image2.gif) | 1663633081eddy_logo.jpg | 2022-09-20 00:18 | 53K | |
![[IMG]](/icons/image2.gif) | 1663633249eddy_logo2..> | 2022-09-20 00:20 | 13K | |
![[IMG]](/icons/image2.gif) | 1663633250eddy_logo2..> | 2022-09-20 00:20 | 13K | |
![[IMG]](/icons/image2.gif) | 1663633402eddy_logo3..> | 2022-09-20 00:23 | 14K | |
![[IMG]](/icons/image2.gif) | 1663633423eddy_logo2..> | 2022-09-20 00:23 | 13K | |
![[IMG]](/icons/image2.gif) | 1663637567Bake it yo..> | 2022-09-20 01:32 | 150K | |
![[IMG]](/icons/image2.gif) | 1663638786Copy of Ke..> | 2022-09-20 01:53 | 2.5M | |
![[IMG]](/icons/image2.gif) | 1663639656Kettle Cre..> | 2022-09-20 02:07 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1663685772foster_log..> | 2022-09-20 14:56 | 200K | |
![[IMG]](/icons/image2.gif) | 1663686377LOGO.JPEG | 2022-09-20 15:06 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1663687775whyms prof..> | 2022-09-20 15:29 | 684K | |
![[IMG]](/icons/image2.gif) | 1663713566Sum Love s..> | 2022-09-20 22:39 | 280K | |
![[IMG]](/icons/image2.gif) | 1663721668SBR.jpg | 2022-09-21 00:54 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1663722039Color logo..> | 2022-09-21 01:00 | 106K | |
![[IMG]](/icons/image2.gif) | 1663722223Social_Pro..> | 2022-09-21 01:03 | 184K | |
![[IMG]](/icons/image2.gif) | 1663735083Scott Hill..> | 2022-09-21 04:38 | 225K | |
![[IMG]](/icons/image2.gif) | 1663735290Scott Hill..> | 2022-09-21 04:41 | 339K | |
![[IMG]](/icons/image2.gif) | 1663891787hammerie f..> | 2022-09-23 00:09 | 798K | |
![[IMG]](/icons/image2.gif) | 1663975881F938E56D-3..> | 2022-09-23 23:31 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1663987911DMD Family..> | 2022-09-24 02:51 | 181K | |
![[IMG]](/icons/image2.gif) | 1664120771logo - red..> | 2022-09-25 15:46 | 9.5K | |
![[IMG]](/icons/image2.gif) | 1664138324Logo.jpg | 2022-09-25 20:38 | 86K | |
![[IMG]](/icons/image2.gif) | 1664197261*Orangey Y..> | 2022-09-26 13:01 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1664205710CG+Greens+..> | 2022-09-26 15:21 | 175K | |
![[IMG]](/icons/image2.gif) | 1664220959Screenshot..> | 2022-09-26 19:35 | 618K | |
![[IMG]](/icons/image2.gif) | 1664221035Screenshot..> | 2022-09-26 19:37 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1664281339A6B6B228-7..> | 2022-09-27 12:22 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1664281640Hungry Seo..> | 2022-09-27 12:27 | 881K | |
![[IMG]](/icons/image2.gif) | 1664304145logo.jpg | 2022-09-27 18:42 | 289K | |
![[IMG]](/icons/image2.gif) | 1664304203logo.jpg | 2022-09-27 18:43 | 289K | |
![[IMG]](/icons/image2.gif) | 1664386569YHCcircle-..> | 2022-09-28 17:36 | 58K | |
![[IMG]](/icons/image2.gif) | 1664462225house-g0d2..> | 2022-09-29 14:37 | 4.4M | |
![[IMG]](/icons/image2.gif) | 1664469995IMG_202208..> | 2022-09-29 16:46 | 468K | |
![[IMG]](/icons/image2.gif) | 1664472444BonW.png | 2022-09-29 17:27 | 14K | |
![[IMG]](/icons/image2.gif) | 1664568303Mud Lake F..> | 2022-09-30 20:05 | 14K | |
![[IMG]](/icons/image2.gif) | 1664573941Logo Blue ..> | 2022-09-30 21:39 | 46K | |
![[IMG]](/icons/image2.gif) | 1664635122FB_IMG_166..> | 2022-10-01 14:38 | 383K | |
![[IMG]](/icons/image2.gif) | 1664845837PhotoRoom-..> | 2022-10-04 01:10 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1664891771marvelouss..> | 2022-10-04 13:56 | 807K | |
![[IMG]](/icons/image2.gif) | 1664970738logo_white..> | 2022-10-05 11:52 | 276K | |
![[IMG]](/icons/image2.gif) | 1664988649image1.jpeg | 2022-10-05 16:50 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1665065691BandL.png | 2022-10-06 14:14 | 58K | |
![[IMG]](/icons/image2.gif) | 1665065754BandL.png | 2022-10-06 14:15 | 58K | |
![[IMG]](/icons/image2.gif) | 1665065767BandL.jpg | 2022-10-06 14:16 | 17K | |
![[IMG]](/icons/image2.gif) | 1665073661Twilight.jpg | 2022-10-06 16:27 | 71K | |
![[IMG]](/icons/image2.gif) | 1665076049BandL.jpg | 2022-10-06 17:07 | 17K | |
![[IMG]](/icons/image2.gif) | 1665079329CMlogo.png | 2022-10-06 18:02 | 80K | |
![[IMG]](/icons/image2.gif) | 1665080361circle_typ..> | 2022-10-06 18:19 | 120K | |
![[IMG]](/icons/image2.gif) | 1665083981CMmagnetBG..> | 2022-10-06 19:19 | 162K | |
![[IMG]](/icons/image2.gif) | 1665084531WBF_Logo.png | 2022-10-06 19:28 | 56K | |
![[IMG]](/icons/image2.gif) | 1665103711jpgfirstgl..> | 2022-10-07 00:48 | 336K | |
![[IMG]](/icons/image2.gif) | 1665175565Hazel logo..> | 2022-10-07 20:46 | 33K | |
![[IMG]](/icons/image2.gif) | 1665177755IMG_1067.JPG | 2022-10-07 21:22 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1665322624RHF Logo.jpg | 2022-10-09 13:37 | 447K | |
![[IMG]](/icons/image2.gif) | 1665340873OriginalBl..> | 2022-10-09 18:41 | 167K | |
![[IMG]](/icons/image2.gif) | 1665365121PXL_202209..> | 2022-10-10 01:25 | 2.1M | |
![[IMG]](/icons/image2.gif) | 1665493351F&S_second..> | 2022-10-11 13:02 | 195K | |
![[IMG]](/icons/image2.gif) | 1665505197AH Farms S..> | 2022-10-11 16:19 | 156K | |
![[IMG]](/icons/image2.gif) | 1665505217crop proce..> | 2022-10-11 16:20 | 190K | |
![[IMG]](/icons/image2.gif) | 1665505493AH Farms S..> | 2022-10-11 16:24 | 196K | |
![[IMG]](/icons/image2.gif) | 1665506536F-WhoomusF..> | 2022-10-11 16:42 | 248K | |
![[IMG]](/icons/image2.gif) | 1665620887WhiteBoule..> | 2022-10-13 00:28 | 911K | |
![[IMG]](/icons/image2.gif) | 1665623311Amber Pard..> | 2022-10-13 01:08 | 9.8K | |
![[IMG]](/icons/image2.gif) | 1665664586google.jpg | 2022-10-13 12:36 | 23K | |
![[IMG]](/icons/image2.gif) | 1665676782pouch pies..> | 2022-10-13 15:59 | 42K | |
![[IMG]](/icons/image2.gif) | 1665679434Original o..> | 2022-10-13 16:43 | 267K | |
![[IMG]](/icons/image2.gif) | 1665679673Instagram ..> | 2022-10-13 16:47 | 171K | |
![[IMG]](/icons/image2.gif) | 1665705117IMG_202207..> | 2022-10-13 23:51 | 416K | |
![[IMG]](/icons/image2.gif) | 1665756572confetti m..> | 2022-10-14 14:09 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1665848643IMG_5071.jpg | 2022-10-15 15:44 | 309K | |
![[IMG]](/icons/image2.gif) | 1665868864Dons logo ..> | 2022-10-15 21:21 | 72K | |
![[IMG]](/icons/image2.gif) | 1665871194D2ECA022-0..> | 2022-10-15 21:59 | 74K | |
![[IMG]](/icons/image2.gif) | 1665871203D2ECA022-0..> | 2022-10-15 22:00 | 74K | |
![[IMG]](/icons/image2.gif) | 1665930862Logo_Squar..> | 2022-10-16 14:34 | 234K | |
![[IMG]](/icons/image2.gif) | 1665943911.25mp logo..> | 2022-10-16 18:11 | 228K | |
![[IMG]](/icons/image2.gif) | 1665943920.25mp logo..> | 2022-10-16 18:12 | 228K | |
![[IMG]](/icons/image2.gif) | 1665944019BannerFB.jpg | 2022-10-16 18:13 | 295K | |
![[IMG]](/icons/image2.gif) | 1665944025BannerFB.jpg | 2022-10-16 18:13 | 295K | |
![[IMG]](/icons/image2.gif) | 1666001845CF132BB1-A..> | 2022-10-17 10:17 | 482K | |
![[IMG]](/icons/image2.gif) | 1666042209BJ_02349.jpg | 2022-10-17 21:30 | 3.3M | |
![[IMG]](/icons/image2.gif) | 1666102605newlogo.jpg | 2022-10-18 14:16 | 277K | |
![[IMG]](/icons/image2.gif) | 1666104535pbtc-color..> | 2022-10-18 14:48 | 57K | |
![[IMG]](/icons/image2.gif) | 1666114427IMG_6459.jpg | 2022-10-18 17:33 | 826K | |
![[IMG]](/icons/image2.gif) | 1666201448Jackson-Cl..> | 2022-10-19 17:44 | 191K | |
![[IMG]](/icons/image2.gif) | 1666207894raj-garden..> | 2022-10-19 19:31 | 18K | |
![[IMG]](/icons/image2.gif) | 1666207961raj-garden..> | 2022-10-19 19:32 | 18K | |
![[IMG]](/icons/image2.gif) | 1666227753Whitney wo..> | 2022-10-20 01:02 | 515K | |
![[IMG]](/icons/image2.gif) | 1666268098FDCD41AE-0..> | 2022-10-20 12:14 | 260K | |
![[IMG]](/icons/image2.gif) | 1666280425tshirt mer..> | 2022-10-20 15:40 | 188K | |
![[IMG]](/icons/image2.gif) | 1666323094IMG-2485.PNG | 2022-10-21 03:31 | 46K | |
![[IMG]](/icons/image2.gif) | 1666544311Screenshot..> | 2022-10-23 16:58 | 688K | |
![[IMG]](/icons/image2.gif) | 1666620536Screen Sho..> | 2022-10-24 14:08 | 3.0M | |
![[IMG]](/icons/image2.gif) | 1666620673veggies lo..> | 2022-10-24 14:11 | 164K | |
![[IMG]](/icons/image2.gif) | 1666624027unnamed (1..> | 2022-10-24 15:07 | 946K | |
![[IMG]](/icons/image2.gif) | 1666638503Untitled d..> | 2022-10-24 19:08 | 7.7K | |
![[IMG]](/icons/image2.gif) | 1666703756IMG_202105..> | 2022-10-25 13:15 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1666704870Frauleinwu..> | 2022-10-25 13:34 | 83K | |
![[IMG]](/icons/image2.gif) | 1666738606IMG_E3672.JPG | 2022-10-25 22:56 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1666739263Soul-Patch..> | 2022-10-25 23:07 | 358K | |
![[IMG]](/icons/image2.gif) | 1666791139Screenshot..> | 2022-10-26 13:32 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1666798071CassavaBre..> | 2022-10-26 15:27 | 164K | |
![[IMG]](/icons/image2.gif) | 1666808793PPFLogoSqu..> | 2022-10-26 18:26 | 369K | |
![[IMG]](/icons/image2.gif) | 1666811087Logo Full.png | 2022-10-26 19:04 | 107K | |
![[IMG]](/icons/image2.gif) | 1666879152C_MM_Logo_..> | 2022-10-27 13:59 | 86K | |
![[IMG]](/icons/image2.gif) | 1666889337instagraml..> | 2022-10-27 16:48 | 858K | |
![[IMG]](/icons/image2.gif) | 1666889397Untitled d..> | 2022-10-27 16:49 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1666901780IMG_0902.jpeg | 2022-10-27 20:16 | 2.9M | |
![[IMG]](/icons/image2.gif) | 1666989140IMG_202207..> | 2022-10-28 20:32 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1667008934CCB15366-4..> | 2022-10-29 02:02 | 149K | |
![[IMG]](/icons/image2.gif) | 1667066929sugarknead..> | 2022-10-29 18:08 | 82K | |
![[IMG]](/icons/image2.gif) | 1667076361Screenshot..> | 2022-10-29 20:46 | 452K | |
![[IMG]](/icons/image2.gif) | 1667076378Screenshot..> | 2022-10-29 20:46 | 452K | |
![[IMG]](/icons/image2.gif) | 1667100610The Big R.png | 2022-10-30 03:30 | 17K | |
![[IMG]](/icons/image2.gif) | 1667224783IMG_0072.jpg | 2022-10-31 13:59 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1667236699Logo_No Ba..> | 2022-10-31 17:18 | 2.4M | |
![[IMG]](/icons/image2.gif) | 1667245548Chesapeake..> | 2022-10-31 19:45 | 25K | |
![[IMG]](/icons/image2.gif) | 1667272180KLees Logo..> | 2022-11-01 03:09 | 307K | |
![[IMG]](/icons/image2.gif) | 1667307042bakery-too..> | 2022-11-01 12:50 | 128K | |
![[IMG]](/icons/image2.gif) | 1667396733IMG_2237.JPG | 2022-11-02 13:45 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1667415260ncaNewLogo..> | 2022-11-02 18:54 | 46K | |
![[IMG]](/icons/image2.gif) | 1667494587The M9 Log..> | 2022-11-03 16:56 | 228K | |
![[IMG]](/icons/image2.gif) | 1667581350Untitled-2..> | 2022-11-04 17:02 | 158K | |
![[IMG]](/icons/image2.gif) | 1667605961SmartSelec..> | 2022-11-04 23:52 | 484K | |
![[IMG]](/icons/image2.gif) | 1667615460LBS BizCar..> | 2022-11-05 02:31 | 142K | |
![[IMG]](/icons/image2.gif) | 1667660339River City..> | 2022-11-05 14:58 | 324K | |
![[IMG]](/icons/image2.gif) | 1667664546F825F633-6..> | 2022-11-05 16:09 | 133K | |
![[IMG]](/icons/image2.gif) | 1667673713Oatballs L..> | 2022-11-05 18:41 | 10K | |
![[IMG]](/icons/image2.gif) | 1667680349Oatballs L..> | 2022-11-05 20:32 | 59K | |
![[IMG]](/icons/image2.gif) | 1667692207layers.jpg | 2022-11-05 23:50 | 3.5M | |
![[IMG]](/icons/image2.gif) | 1667846863mw_general..> | 2022-11-07 18:47 | 235K | |
![[IMG]](/icons/image2.gif) | 1667847596Heartland.png | 2022-11-07 18:59 | 44K | |
![[IMG]](/icons/image2.gif) | 1667852075Joyce_Farm..> | 2022-11-07 20:14 | 56K | |
![[IMG]](/icons/image2.gif) | 1667918379Screenshot..> | 2022-11-08 14:39 | 860K | |
![[IMG]](/icons/image2.gif) | 1667918648Screenshot..> | 2022-11-08 14:44 | 842K | |
![[IMG]](/icons/image2.gif) | 1667925765pinetoptre..> | 2022-11-08 16:42 | 25K | |
![[IMG]](/icons/image2.gif) | 1667933453potluck fi..> | 2022-11-08 18:50 | 156K | |
![[IMG]](/icons/image2.gif) | 1667943404IMG_202210..> | 2022-11-08 21:36 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1667943569IMG_202210..> | 2022-11-08 21:39 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1667952908Habeeba's ..> | 2022-11-09 00:15 | 64K | |
![[IMG]](/icons/image2.gif) | 1668096613Pink Door ..> | 2022-11-10 16:10 | 774K | |
![[IMG]](/icons/image2.gif) | 1668109235Screenshot..> | 2022-11-10 19:40 | 131K | |
![[IMG]](/icons/image2.gif) | 1668120284e7GyoJfOTz..> | 2022-11-10 22:44 | 289K | |
![[IMG]](/icons/image2.gif) | 1668129477Copy of Ma..> | 2022-11-11 01:17 | 168K | |
![[IMG]](/icons/image2.gif) | 1668173553Hi Brau Hi..> | 2022-11-11 13:32 | 168K | |
![[IMG]](/icons/image2.gif) | 1668173886Hi Brau Hi..> | 2022-11-11 13:38 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1668185081Lucy's.webp | 2022-11-11 16:44 | 153K | |
![[IMG]](/icons/image2.gif) | 1668192682logowkyp.png | 2022-11-11 18:51 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1668212663aunt nazzi..> | 2022-11-12 00:24 | 250K | |
![[IMG]](/icons/image2.gif) | 1668287932FWH&WM Log..> | 2022-11-12 21:18 | 98K | |
![[IMG]](/icons/image2.gif) | 1668295399Luna Bakin..> | 2022-11-12 23:23 | 79K | |
![[IMG]](/icons/image2.gif) | 1668305528Logo.png | 2022-11-13 02:12 | 99K | |
![[IMG]](/icons/image2.gif) | 1668453644Mom Bell's..> | 2022-11-14 19:20 | 3.7M | |
![[IMG]](/icons/image2.gif) | 1668488290Original .png | 2022-11-15 04:58 | 123K | |
![[IMG]](/icons/image2.gif) | 1668621015Logo Circl..> | 2022-11-16 17:50 | 391K | |
![[IMG]](/icons/image2.gif) | 1668621099logo.png | 2022-11-16 17:51 | 72K | |
![[IMG]](/icons/image2.gif) | 1668700992white logo..> | 2022-11-17 16:03 | 46K | |
![[IMG]](/icons/image2.gif) | 1668701284Creator Fa..> | 2022-11-17 16:08 | 17K | |
![[IMG]](/icons/image2.gif) | 1668701824Creator Fa..> | 2022-11-17 16:17 | 23K | |
![[IMG]](/icons/image2.gif) | 1668701959Creator Fa..> | 2022-11-17 16:19 | 23K | |
![[ ]](/icons/layout.gif) | 1668706177proof.pdf | 2022-11-17 17:29 | 2.4M | |
![[IMG]](/icons/image2.gif) | 1668713022logobasta.jpg | 2022-11-17 19:23 | 230K | |
![[IMG]](/icons/image2.gif) | 1669151677lakewatche..> | 2022-11-22 21:14 | 28K | |
![[IMG]](/icons/image2.gif) | 1669151764lakewatche..> | 2022-11-22 21:16 | 28K | |
![[IMG]](/icons/image2.gif) | 1669254574FinalBestL..> | 2022-11-24 01:49 | 406K | |
![[IMG]](/icons/image2.gif) | 1669331618Original o..> | 2022-11-24 23:13 | 491K | |
![[IMG]](/icons/image2.gif) | 1669331639Original.png | 2022-11-24 23:13 | 187K | |
![[IMG]](/icons/image2.gif) | 1669331660Original.png | 2022-11-24 23:14 | 187K | |
![[IMG]](/icons/image2.gif) | 1669479176Orchard Ro..> | 2022-11-26 16:12 | 370K | |
![[IMG]](/icons/image2.gif) | 1669559404E19F7074-3..> | 2022-11-27 14:30 | 335K | |
![[IMG]](/icons/image2.gif) | 1669579820F6A37736-E..> | 2022-11-27 20:10 | 117K | |
![[IMG]](/icons/image2.gif) | 1669596938logo.jpg | 2022-11-28 00:55 | 863K | |
![[IMG]](/icons/image2.gif) | 1669597017logo.jpg | 2022-11-28 00:56 | 863K | |
![[IMG]](/icons/image2.gif) | 1669606255Melted (1)..> | 2022-11-28 03:30 | 232K | |
![[IMG]](/icons/image2.gif) | 1669606270Melted (1)..> | 2022-11-28 03:31 | 232K | |
![[IMG]](/icons/image2.gif) | 1669606291Melted (1)..> | 2022-11-28 03:31 | 232K | |
![[IMG]](/icons/image2.gif) | 1669730995FB_IMG_163..> | 2022-11-29 14:09 | 235K | |
![[IMG]](/icons/image2.gif) | 1669733711HHM.png | 2022-11-29 14:55 | 196K | |
![[IMG]](/icons/image2.gif) | 1669734038meats_roun..> | 2022-11-29 15:00 | 80K | |
![[IMG]](/icons/image2.gif) | 1669738193guacspecwh..> | 2022-11-29 16:09 | 32K | |
![[IMG]](/icons/image2.gif) | 1669740626Sturdy Ste..> | 2022-11-29 16:50 | 138K | |
![[IMG]](/icons/image2.gif) | 1669742185Umlands-cu..> | 2022-11-29 17:16 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1669751228IMG_4877.jpg | 2022-11-29 19:47 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1669783332Smokin But..> | 2022-11-30 04:42 | 420K | |
![[IMG]](/icons/image2.gif) | 1669783663image0 (5)..> | 2022-11-30 04:47 | 283K | |
![[IMG]](/icons/image2.gif) | 1669818398nom.png | 2022-11-30 14:26 | 468K | |
![[IMG]](/icons/image2.gif) | 1669819908Pinky's Mi..> | 2022-11-30 14:51 | 520K | |
![[IMG]](/icons/image2.gif) | 1669833519GG.jpg | 2022-11-30 18:38 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1669845513rooster_re..> | 2022-11-30 21:58 | 957K | |
![[IMG]](/icons/image2.gif) | 1669900318Sweettz Ta..> | 2022-12-01 13:11 | 195K | |
![[IMG]](/icons/image2.gif) | 1669915849Finalized ..> | 2022-12-01 17:30 | 91K | |
![[IMG]](/icons/image2.gif) | 1669926228download (..> | 2022-12-01 20:23 | 289K | |
![[IMG]](/icons/image2.gif) | 1669942407Freight Fa..> | 2022-12-02 00:53 | 810K | |
![[IMG]](/icons/image2.gif) | 1669978472VerLinaLog..> | 2022-12-02 10:54 | 18K | |
![[IMG]](/icons/image2.gif) | 1669989595McClure Li..> | 2022-12-02 13:59 | 41K | |
![[IMG]](/icons/image2.gif) | 1669998017Dovenbarge..> | 2022-12-02 16:20 | 633K | |
![[IMG]](/icons/image2.gif) | 1670004149StickyEds_..> | 2022-12-02 18:02 | 193K | |
![[IMG]](/icons/image2.gif) | 1670026956Full Logo ..> | 2022-12-03 00:22 | 386K | |
![[IMG]](/icons/image2.gif) | 1670099683Logo.jpg | 2022-12-03 20:34 | 585K | |
![[IMG]](/icons/image2.gif) | 1670165762Penelope's..> | 2022-12-04 14:56 | 57K | |
![[IMG]](/icons/image2.gif) | 1670269132AFD5C1AB-2..> | 2022-12-05 19:38 | 445K | |
![[IMG]](/icons/image2.gif) | 1670279737Final logo..> | 2022-12-05 22:35 | 487K | |
![[IMG]](/icons/image2.gif) | 1670463223Samosa Log..> | 2022-12-08 01:33 | 67K | |
![[IMG]](/icons/image2.gif) | 1670514779Square jpe..> | 2022-12-08 15:52 | 124K | |
![[IMG]](/icons/image2.gif) | 1670516578Roka Logo ..> | 2022-12-08 16:22 | 166K | |
![[IMG]](/icons/image2.gif) | 1670589778DEK best v..> | 2022-12-09 12:42 | 78K | |
![[IMG]](/icons/image2.gif) | 1670601068ZazuMushro..> | 2022-12-09 15:51 | 89K | |
![[IMG]](/icons/image2.gif) | 1670696796Duroc Red ..> | 2022-12-10 18:26 | 412K | |
![[IMG]](/icons/image2.gif) | 1670811437Adleiade's..> | 2022-12-12 02:17 | 435K | |
![[IMG]](/icons/image2.gif) | 1670842857Verlina-We..> | 2022-12-12 11:00 | 21K | |
![[IMG]](/icons/image2.gif) | 1670844789FB572E67-4..> | 2022-12-12 11:33 | 372K | |
![[IMG]](/icons/image2.gif) | 1670845676Adleiade's..> | 2022-12-12 11:47 | 571K | |
![[IMG]](/icons/image2.gif) | 1670846098Adleiade's..> | 2022-12-12 11:54 | 571K | |
![[IMG]](/icons/image2.gif) | 1670896448Adleiade's..> | 2022-12-13 01:54 | 270K | |
![[IMG]](/icons/image2.gif) | 1670956997ABBD9BDF-A..> | 2022-12-13 18:43 | 303K | |
![[IMG]](/icons/image2.gif) | 1670960429BROKENTOWN..> | 2022-12-13 19:40 | 73K | |
![[IMG]](/icons/image2.gif) | 1670961462Cute sunsh..> | 2022-12-13 19:57 | 344K | |
![[IMG]](/icons/image2.gif) | 1670964202TGM LLC.png | 2022-12-13 20:43 | 599K | |
![[IMG]](/icons/image2.gif) | 1670989421logo with ..> | 2022-12-14 03:43 | 560K | |
![[IMG]](/icons/image2.gif) | 1670989437logo with ..> | 2022-12-14 03:43 | 560K | |
![[IMG]](/icons/image2.gif) | 1671029827Screenshot..> | 2022-12-14 14:57 | 454K | |
![[IMG]](/icons/image2.gif) | 1671029939Screenshot..> | 2022-12-14 14:58 | 454K | |
![[IMG]](/icons/image2.gif) | 1671030249Screenshot..> | 2022-12-14 15:04 | 354K | |
![[IMG]](/icons/image2.gif) | 1671031158Screenshot..> | 2022-12-14 15:19 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1671032449Black Logo..> | 2022-12-14 15:40 | 41K | |
![[IMG]](/icons/image2.gif) | 1671036057thumbnail_..> | 2022-12-14 16:40 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1671037797Image (15)..> | 2022-12-14 17:09 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1671054483WOEFoodsLo..> | 2022-12-14 21:48 | 98K | |
![[IMG]](/icons/image2.gif) | 1671056531empanadas ..> | 2022-12-14 22:22 | 249K | |
![[IMG]](/icons/image2.gif) | 1671068091haffs_hots..> | 2022-12-15 01:34 | 310K | |
![[IMG]](/icons/image2.gif) | 1671068198haffs_hots..> | 2022-12-15 01:36 | 278K | |
![[IMG]](/icons/image2.gif) | 1671085627logo2.jpg | 2022-12-15 06:27 | 168K | |
![[IMG]](/icons/image2.gif) | 1671115211Capture.PNG | 2022-12-15 14:40 | 154K | |
![[IMG]](/icons/image2.gif) | 1671119884logoImage...> | 2022-12-15 15:58 | 142K | |
![[IMG]](/icons/image2.gif) | 1671142938logo-white..> | 2022-12-15 22:22 | 504K | |
![[IMG]](/icons/image2.gif) | 1671148284IMG_202210..> | 2022-12-15 23:51 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1671148286IMG_202210..> | 2022-12-15 23:51 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1671150286FRY FARM-l..> | 2022-12-16 00:24 | 166K | |
![[IMG]](/icons/image2.gif) | 1671150639IMG_202211..> | 2022-12-16 00:30 | 3.5M | |
![[IMG]](/icons/image2.gif) | 1671230417design-9c7..> | 2022-12-16 22:40 | 245K | |
![[IMG]](/icons/image2.gif) | 1671230432Untitled (..> | 2022-12-16 22:40 | 5.6K | |
![[IMG]](/icons/image2.gif) | 1671230445Untitled (..> | 2022-12-16 22:40 | 5.6K | |
![[IMG]](/icons/image2.gif) | 1671230467Untitled d..> | 2022-12-16 22:41 | 79K | |
![[IMG]](/icons/image2.gif) | 1671334037logo5.jpg | 2022-12-18 03:27 | 129K | |
![[IMG]](/icons/image2.gif) | 1671468167ChocoDashL..> | 2022-12-19 16:42 | 170K | |
![[IMG]](/icons/image2.gif) | 1671553061Daisyfish ..> | 2022-12-20 16:17 | 103K | |
![[IMG]](/icons/image2.gif) | 1671553184Daisyfish ..> | 2022-12-20 16:19 | 128K | |
![[IMG]](/icons/image2.gif) | 1671553271Daisyfish ..> | 2022-12-20 16:21 | 129K | |
![[IMG]](/icons/image2.gif) | 1671553307Daisyfish ..> | 2022-12-20 16:21 | 128K | |
![[IMG]](/icons/image2.gif) | 1671554897Small Acre..> | 2022-12-20 16:48 | 92K | |
![[IMG]](/icons/image2.gif) | 1671558560black_logo..> | 2022-12-20 17:49 | 40K | |
![[IMG]](/icons/image2.gif) | 1671934145GC Logo.jpg | 2022-12-25 02:09 | 180K | |
![[IMG]](/icons/image2.gif) | 1672081534View recen..> | 2022-12-26 19:05 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1672242754Screenshot..> | 2022-12-28 15:52 | 606K | |
![[IMG]](/icons/image2.gif) | 1672254866Dagon+Fami..> | 2022-12-28 19:14 | 67K | |
![[IMG]](/icons/image2.gif) | 1672278154Logo1.jpg | 2022-12-29 01:42 | 387K | |
![[IMG]](/icons/image2.gif) | 1672342743B2E8B6B1-3..> | 2022-12-29 19:39 | 434K | |
![[IMG]](/icons/image2.gif) | 1672364256E628A0F9-9..> | 2022-12-30 01:37 | 333K | |
![[IMG]](/icons/image2.gif) | 1672405012Three+Chee..> | 2022-12-30 12:56 | 274K | |
![[IMG]](/icons/image2.gif) | 1672599664IMG_1577.jpg | 2023-01-01 19:01 | 582K | |
![[IMG]](/icons/image2.gif) | 1672626662AFA Logo S..> | 2023-01-02 02:31 | 68K | |
![[IMG]](/icons/image2.gif) | 1672626787AFA PNG-01..> | 2023-01-02 02:33 | 68K | |
![[IMG]](/icons/image2.gif) | 1672629081Logo_Scree..> | 2023-01-02 03:11 | 64K | |
![[IMG]](/icons/image2.gif) | 1672750806CB03D585-7..> | 2023-01-03 13:00 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1672750827CB03D585-7..> | 2023-01-03 13:00 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1672784746SBC Primar..> | 2023-01-03 22:25 | 284K | |
![[IMG]](/icons/image2.gif) | 1672786014logo_size.jpg | 2023-01-03 22:46 | 107K | |
![[IMG]](/icons/image2.gif) | 1672786433logo_size_..> | 2023-01-03 22:53 | 115K | |
![[IMG]](/icons/image2.gif) | 1672786467logo_size.jpg | 2023-01-03 22:54 | 107K | |
![[IMG]](/icons/image2.gif) | 1672788627frd NEW LO..> | 2023-01-03 23:30 | 34K | |
![[IMG]](/icons/image2.gif) | 1672865470final1.png | 2023-01-04 20:51 | 243K | |
![[IMG]](/icons/image2.gif) | 1672866853Lexingtonp..> | 2023-01-04 21:14 | 172K | |
![[IMG]](/icons/image2.gif) | 1672893623Blank 500 ..> | 2023-01-05 04:40 | 49K | |
![[IMG]](/icons/image2.gif) | 1672960504IMG_5390.PNG | 2023-01-05 23:15 | 16K | |
![[IMG]](/icons/image2.gif) | 1672977264ALternate.png | 2023-01-06 03:54 | 27K | |
![[IMG]](/icons/image2.gif) | 1673139888Screenshot..> | 2023-01-08 01:04 | 879K | |
![[IMG]](/icons/image2.gif) | 1673200270D085EB69-0..> | 2023-01-08 17:51 | 68K | |
![[IMG]](/icons/image2.gif) | 1673311521IMG_6815.jpeg | 2023-01-10 00:45 | 467K | |
![[IMG]](/icons/image2.gif) | 1673389011June logo ..> | 2023-01-10 22:16 | 95K | |
![[IMG]](/icons/image2.gif) | 1673393074kc (1).png | 2023-01-10 23:24 | 618K | |
![[IMG]](/icons/image2.gif) | 1673455932tempImaget..> | 2023-01-11 16:52 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1673458399IMG_202005..> | 2023-01-11 17:33 | 175K | |
![[IMG]](/icons/image2.gif) | 1673458859Black and ..> | 2023-01-11 17:40 | 121K | |
![[IMG]](/icons/image2.gif) | 1673458892IMG_202005..> | 2023-01-11 17:41 | 175K | |
![[IMG]](/icons/image2.gif) | 1673458898IMG_202005..> | 2023-01-11 17:41 | 175K | |
![[IMG]](/icons/image2.gif) | 1673466452RGB Versio..> | 2023-01-11 19:47 | 19K | |
![[IMG]](/icons/image2.gif) | 1673466464RGB Versio..> | 2023-01-11 19:47 | 19K | |
![[IMG]](/icons/image2.gif) | 1673471831ColorfulCo..> | 2023-01-11 21:17 | 365K | |
![[IMG]](/icons/image2.gif) | 1673471910Colorful C..> | 2023-01-11 21:18 | 371K | |
![[IMG]](/icons/image2.gif) | 1673473396basket of ..> | 2023-01-11 21:43 | 2.8M | |
![[IMG]](/icons/image2.gif) | 1673482538FAB43443-C..> | 2023-01-12 00:15 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1673501911Asset 1@4x..> | 2023-01-12 05:38 | 14K | |
![[IMG]](/icons/image2.gif) | 1673534930anderson_l..> | 2023-01-12 14:48 | 245K | |
![[IMG]](/icons/image2.gif) | 1673547964OscarBites..> | 2023-01-12 18:26 | 731K | |
![[IMG]](/icons/image2.gif) | 1673548565profile pi..> | 2023-01-12 18:36 | 432K | |
![[IMG]](/icons/image2.gif) | 1673555672Drawn Logo..> | 2023-01-12 20:34 | 334K | |
![[IMG]](/icons/image2.gif) | 1673555813Drawn Logo..> | 2023-01-12 20:36 | 334K | |
![[IMG]](/icons/image2.gif) | 1673556558Homestead ..> | 2023-01-12 20:49 | 116K | |
![[IMG]](/icons/image2.gif) | 1673609615Mels_round..> | 2023-01-13 11:33 | 331K | |
![[IMG]](/icons/image2.gif) | 1673614506img_1_1667..> | 2023-01-13 12:55 | 203K | |
![[IMG]](/icons/image2.gif) | 1673633325soappic.jpg | 2023-01-13 18:08 | 3.2M | |
![[IMG]](/icons/image2.gif) | 1673637197logosoap.png | 2023-01-13 19:13 | 28K | |
![[IMG]](/icons/image2.gif) | 1673701768sunset 5- ..> | 2023-01-14 13:09 | 502K | |
![[IMG]](/icons/image2.gif) | 1673828402DonnasLogo..> | 2023-01-16 00:20 | 69K | |
![[IMG]](/icons/image2.gif) | 1673831251artisan ba..> | 2023-01-16 01:07 | 428K | |
![[IMG]](/icons/image2.gif) | 1673834851Guiseppes2..> | 2023-01-16 02:07 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1673881144Profile Im..> | 2023-01-16 14:59 | 21K | |
![[IMG]](/icons/image2.gif) | 1673911906Adobe_Expr..> | 2023-01-16 23:31 | 66K | |
![[IMG]](/icons/image2.gif) | 1673971683logo_circl..> | 2023-01-17 16:08 | 198K | |
![[IMG]](/icons/image2.gif) | 1673979320Jacobs Hav..> | 2023-01-17 18:15 | 28K | |
![[IMG]](/icons/image2.gif) | 1673979490Jacobs Hav..> | 2023-01-17 18:18 | 28K | |
![[IMG]](/icons/image2.gif) | 1673990508TeaPot 2.0..> | 2023-01-17 21:21 | 107K | |
![[IMG]](/icons/image2.gif) | 1674056759new innys ..> | 2023-01-18 15:45 | 134K | |
![[IMG]](/icons/image2.gif) | 1674079633Ocho Squar..> | 2023-01-18 22:07 | 88K | |
![[IMG]](/icons/image2.gif) | 1674081017OBO Foods ..> | 2023-01-18 22:30 | 544K | |
![[IMG]](/icons/image2.gif) | 1674086313Odessa's H..> | 2023-01-18 23:58 | 2.5M | |
![[IMG]](/icons/image2.gif) | 1674089625Short Mead..> | 2023-01-19 00:53 | 84K | |
![[IMG]](/icons/image2.gif) | 1674089636Short Mead..> | 2023-01-19 00:53 | 84K | |
![[IMG]](/icons/image2.gif) | 1674146228Nance Farm..> | 2023-01-19 16:37 | 143K | |
![[IMG]](/icons/image2.gif) | 1674162672IMG_0498.jpg | 2023-01-19 21:11 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1674167339Gowin Vall..> | 2023-01-19 22:28 | 188K | |
![[IMG]](/icons/image2.gif) | 1674180719Logo no ba..> | 2023-01-20 02:11 | 432K | |
![[IMG]](/icons/image2.gif) | 1674232479IMG_2347.JPG | 2023-01-20 16:34 | 649K | |
![[IMG]](/icons/image2.gif) | 1674240176Ocho Squar..> | 2023-01-20 18:42 | 211K | |
![[IMG]](/icons/image2.gif) | 1674240383Ocho Squar..> | 2023-01-20 18:46 | 148K | |
![[IMG]](/icons/image2.gif) | 1674240557Ocho Squar..> | 2023-01-20 18:49 | 156K | |
![[IMG]](/icons/image2.gif) | 1674240732Ocho Squar..> | 2023-01-20 18:52 | 160K | |
![[IMG]](/icons/image2.gif) | 1674240750Ocho Squar..> | 2023-01-20 18:52 | 160K | |
![[IMG]](/icons/image2.gif) | 1674241804Cahokia - ..> | 2023-01-20 19:10 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1674245904ATL Dairie..> | 2023-01-20 20:18 | 349K | |
![[IMG]](/icons/image2.gif) | 1674245999Working Co..> | 2023-01-20 20:19 | 656K | |
![[IMG]](/icons/image2.gif) | 1674246014Working Co..> | 2023-01-20 20:20 | 656K | |
![[IMG]](/icons/image2.gif) | 1674246350Snowville ..> | 2023-01-20 20:25 | 297K | |
![[IMG]](/icons/image2.gif) | 1674246356Snowville ..> | 2023-01-20 20:25 | 297K | |
![[IMG]](/icons/image2.gif) | 1674246964JD Country..> | 2023-01-20 20:36 | 401K | |
![[IMG]](/icons/image2.gif) | 1674246969JD Country..> | 2023-01-20 20:36 | 401K | |
![[IMG]](/icons/image2.gif) | 1674247476Sassy Cow ..> | 2023-01-20 20:44 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1674247966The Nut Ho..> | 2023-01-20 20:52 | 302K | |
![[IMG]](/icons/image2.gif) | 1674248635Tomato Bli..> | 2023-01-20 21:03 | 134K | |
![[IMG]](/icons/image2.gif) | 1674249120Tuttles Or..> | 2023-01-20 21:12 | 258K | |
![[IMG]](/icons/image2.gif) | 1674249134Tuttles Or..> | 2023-01-20 21:12 | 258K | |
![[IMG]](/icons/image2.gif) | 1674249992GGEG Teal ..> | 2023-01-20 21:26 | 319K | |
![[IMG]](/icons/image2.gif) | 1674250278IMG_202210..> | 2023-01-20 21:31 | 387K | |
![[IMG]](/icons/image2.gif) | 1674251804goat (2).jpg | 2023-01-20 21:56 | 6.2M | |
![[IMG]](/icons/image2.gif) | 1674256513Apple logo..> | 2023-01-20 23:15 | 815K | |
![[IMG]](/icons/image2.gif) | 1674259093SpiceSiste..> | 2023-01-20 23:58 | 391K | |
![[IMG]](/icons/image2.gif) | 1674268964Colorful C..> | 2023-01-21 02:42 | 387K | |
![[IMG]](/icons/image2.gif) | 1674269172Colorful C..> | 2023-01-21 02:46 | 383K | |
![[IMG]](/icons/image2.gif) | 1674354331sacos de c..> | 2023-01-22 02:25 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1674489888Mana Logo.png | 2023-01-23 16:04 | 283K | |
![[IMG]](/icons/image2.gif) | 1674498492Market Wag..> | 2023-01-23 18:28 | 47K | |
![[IMG]](/icons/image2.gif) | 1674500991Market Wag..> | 2023-01-23 19:09 | 68K | |
![[IMG]](/icons/image2.gif) | 1674501135Screenshot..> | 2023-01-23 19:12 | 43K | |
![[IMG]](/icons/image2.gif) | 1674520787SunEarthLo..> | 2023-01-24 00:39 | 111K | |
![[IMG]](/icons/image2.gif) | 1674576106lbf.jpg | 2023-01-24 16:01 | 796K | |
![[IMG]](/icons/image2.gif) | 1674611867AA4C2A89-9..> | 2023-01-25 01:57 | 286K | |
![[IMG]](/icons/image2.gif) | 1674613503BBCD75D1-2..> | 2023-01-25 02:25 | 177K | |
![[IMG]](/icons/image2.gif) | 1674661853Sakred Ave..> | 2023-01-25 15:50 | 79K | |
![[IMG]](/icons/image2.gif) | 1674679897Wholesale ..> | 2023-01-25 20:51 | 451K | |
![[IMG]](/icons/image2.gif) | 1674679908Wholesale ..> | 2023-01-25 20:51 | 451K | |
![[IMG]](/icons/image2.gif) | 1674746307Logo.png | 2023-01-26 15:18 | 289K | |
![[IMG]](/icons/image2.gif) | 1674746615Logo.png | 2023-01-26 15:23 | 238K | |
![[IMG]](/icons/image2.gif) | 1674748508OBO Foods ..> | 2023-01-26 15:55 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1674824394eggs.png | 2023-01-27 12:59 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1674829380gander cre..> | 2023-01-27 14:23 | 311K | |
![[IMG]](/icons/image2.gif) | 1674857860Mercier Or..> | 2023-01-27 22:17 | 342K | |
![[IMG]](/icons/image2.gif) | 1674874503B2BF7AF7-4..> | 2023-01-28 02:55 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1674930065EmsSourdou..> | 2023-01-28 18:21 | 45K | |
![[IMG]](/icons/image2.gif) | 1674937561Sunrise Da..> | 2023-01-28 20:26 | 358K | |
![[IMG]](/icons/image2.gif) | 1675008014junglejuic..> | 2023-01-29 16:00 | 390K | |
![[IMG]](/icons/image2.gif) | 1675024139Dancing Go..> | 2023-01-29 20:28 | 450K | |
![[IMG]](/icons/image2.gif) | 1675165084Screen Sho..> | 2023-01-31 11:38 | 496K | |
![[IMG]](/icons/image2.gif) | 1675196686biggirlbac..> | 2023-01-31 20:24 | 813K | |
![[IMG]](/icons/image2.gif) | 1675268520IMG_E3577.JPG | 2023-02-01 16:22 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1675291962Blue Logo,..> | 2023-02-01 22:52 | 43K | |
![[IMG]](/icons/image2.gif) | 1675296843logo new.png | 2023-02-02 00:14 | 499K | |
![[IMG]](/icons/image2.gif) | 1675367475In the beg..> | 2023-02-02 19:51 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1675386543logo fb_95..> | 2023-02-03 01:09 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1675568353A10F7600-B..> | 2023-02-05 03:39 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1675568379A10F7600-B..> | 2023-02-05 03:39 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1675619302PXL_202108..> | 2023-02-05 17:48 | 2.1M | |
![[IMG]](/icons/image2.gif) | 1675625779B15EED7C-E..> | 2023-02-05 19:36 | 350K | |
![[IMG]](/icons/image2.gif) | 1675707356D36D2257-1..> | 2023-02-06 18:15 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1675713951AdobeStock..> | 2023-02-06 20:05 | 193K | |
![[IMG]](/icons/image2.gif) | 1675795927sweetgrass..> | 2023-02-07 18:52 | 902K | |
![[IMG]](/icons/image2.gif) | 1675801017Screenshot..> | 2023-02-07 20:16 | 366K | |
![[IMG]](/icons/image2.gif) | 1675801236Screenshot..> | 2023-02-07 20:20 | 207K | |
![[IMG]](/icons/image2.gif) | 1675802025ican.png | 2023-02-07 20:33 | 35K | |
![[IMG]](/icons/image2.gif) | 1675816047Inizio Ita..> | 2023-02-08 00:27 | 86K | |
![[IMG]](/icons/image2.gif) | 1675822841Inizio Ita..> | 2023-02-08 02:20 | 86K | |
![[IMG]](/icons/image2.gif) | 1675865972Beef by Ch..> | 2023-02-08 14:19 | 219K | |
![[IMG]](/icons/image2.gif) | 1675865984Beef by Ch..> | 2023-02-08 14:19 | 219K | |
![[IMG]](/icons/image2.gif) | 1675866115Beef by Ch..> | 2023-02-08 14:21 | 372K | |
![[IMG]](/icons/image2.gif) | 1675867773labelLogo...> | 2023-02-08 14:49 | 13K | |
![[IMG]](/icons/image2.gif) | 1675889485Anna Bell'..> | 2023-02-08 20:51 | 478K | |
![[IMG]](/icons/image2.gif) | 1676073745unnamed(1)..> | 2023-02-11 00:02 | 4.8K | |
![[IMG]](/icons/image2.gif) | 1676073752unnamed(1)..> | 2023-02-11 00:02 | 4.8K | |
![[IMG]](/icons/image2.gif) | 1676139466Moredozens..> | 2023-02-11 18:17 | 2.6M | |
![[IMG]](/icons/image2.gif) | 1676147894IMG_202109..> | 2023-02-11 20:38 | 3.2M | |
![[IMG]](/icons/image2.gif) | 1676148236IMG_202209..> | 2023-02-11 20:43 | 2.6M | |
![[IMG]](/icons/image2.gif) | 1676401844IMG_2672.JPG | 2023-02-14 19:10 | 705K | |
![[IMG]](/icons/image2.gif) | 1676474920BLAU (2).png | 2023-02-15 15:28 | 81K | |
![[IMG]](/icons/image2.gif) | 1676507582cover.jpg | 2023-02-16 00:33 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1676507686cover pic.jpg | 2023-02-16 00:34 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1676508563Really Awe..> | 2023-02-16 00:49 | 116K | |
![[IMG]](/icons/image2.gif) | 1676510344Georgia Gr..> | 2023-02-16 01:19 | 436K | |
![[IMG]](/icons/image2.gif) | 1676513654Feed & See..> | 2023-02-16 02:14 | 119K | |
![[IMG]](/icons/image2.gif) | 1676517155Spotted Tr..> | 2023-02-16 03:12 | 910K | |
![[IMG]](/icons/image2.gif) | 1676586726official L..> | 2023-02-16 22:32 | 160K | |
![[IMG]](/icons/image2.gif) | 1676663919PhotoRoom-..> | 2023-02-17 19:58 | 845K | |
![[IMG]](/icons/image2.gif) | 1676672194Untitled d..> | 2023-02-17 22:16 | 130K | |
![[IMG]](/icons/image2.gif) | 1676750178Janie Klan..> | 2023-02-18 19:56 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1676835357OPF Logo.jpg | 2023-02-19 19:35 | 178K | |
![[IMG]](/icons/image2.gif) | 1676852890Caboola So..> | 2023-02-20 00:28 | 55K | |
![[IMG]](/icons/image2.gif) | 1676936571Small Batc..> | 2023-02-20 23:42 | 63K | |
![[IMG]](/icons/image2.gif) | 1676996613CornbreadS..> | 2023-02-21 16:23 | 721K | |
![[IMG]](/icons/image2.gif) | 1677012015Witcher-2_..> | 2023-02-21 20:40 | 3.8M | |
![[IMG]](/icons/image2.gif) | 1677037503Original L..> | 2023-02-22 03:45 | 102K | |
![[IMG]](/icons/image2.gif) | 1677038465Logo.png | 2023-02-22 04:01 | 91K | |
![[IMG]](/icons/image2.gif) | 1677074741Screenshot..> | 2023-02-22 14:05 | 461K | |
![[IMG]](/icons/image2.gif) | 1677074852GridArt_20..> | 2023-02-22 14:07 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1677075015GridArt_20..> | 2023-02-22 14:10 | 2.3M | |
![[IMG]](/icons/image2.gif) | 1677128343DAE129D6-9..> | 2023-02-23 04:59 | 364K | |
![[IMG]](/icons/image2.gif) | 1677128346DAE129D6-9..> | 2023-02-23 04:59 | 364K | |
![[IMG]](/icons/image2.gif) | 1677164075facebook p..> | 2023-02-23 14:54 | 778K | |
![[IMG]](/icons/image2.gif) | 1677173089fulllogo.jpg | 2023-02-23 17:24 | 130K | |
![[IMG]](/icons/image2.gif) | 1677191274ECEA0808-2..> | 2023-02-23 22:27 | 65K | |
![[IMG]](/icons/image2.gif) | 1677253042received_3..> | 2023-02-24 15:37 | 2.6M | |
![[IMG]](/icons/image2.gif) | 1677258408JewelOsco_..> | 2023-02-24 17:06 | 174K | |
![[IMG]](/icons/image2.gif) | 1677346645IMG_202302..> | 2023-02-25 17:37 | 3.0M | |
![[IMG]](/icons/image2.gif) | 1677378447IMG_Femme_..> | 2023-02-26 02:27 | 233K | |
![[IMG]](/icons/image2.gif) | 1677420357LogoForMar..> | 2023-02-26 14:05 | 597K | |
![[IMG]](/icons/image2.gif) | 1677422184LOGO updat..> | 2023-02-26 14:36 | 3.3K | |
![[IMG]](/icons/image2.gif) | 1677550646F416E6AD-7..> | 2023-02-28 02:17 | 166K | |
![[IMG]](/icons/image2.gif) | 1677600612IMG_4026.jpg | 2023-02-28 16:10 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1677689766KEA_Identi..> | 2023-03-01 16:56 | 314K | |
![[IMG]](/icons/image2.gif) | 1677693383IMG_202212..> | 2023-03-01 17:56 | 723K | |
![[IMG]](/icons/image2.gif) | 1677693432IMG_202212..> | 2023-03-01 17:57 | 723K | |
![[IMG]](/icons/image2.gif) | 1677695093Tomstead F..> | 2023-03-01 18:24 | 630K | |
![[IMG]](/icons/image2.gif) | 1677695649KEA_Identi..> | 2023-03-01 18:34 | 205K | |
![[IMG]](/icons/image2.gif) | 1677695766KEA_Identi..> | 2023-03-01 18:36 | 203K | |
![[IMG]](/icons/image2.gif) | 1677720450PPF LOGO_F..> | 2023-03-02 01:27 | 155K | |
![[IMG]](/icons/image2.gif) | 1677771981GRISTMILLs..> | 2023-03-02 15:46 | 463K | |
![[IMG]](/icons/image2.gif) | 1677776980FH Logo 50..> | 2023-03-02 17:09 | 92K | |
![[IMG]](/icons/image2.gif) | 1677777939FH Logo Pr..> | 2023-03-02 17:25 | 259K | |
![[IMG]](/icons/image2.gif) | 1677781303ebans_logo..> | 2023-03-02 18:21 | 54K | |
![[IMG]](/icons/image2.gif) | 1677798743version=1&..> | 2023-03-02 23:12 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1677809738p10 Foods.jpg | 2023-03-03 02:15 | 369K | |
![[IMG]](/icons/image2.gif) | 1677934672Logo1 2023..> | 2023-03-04 12:57 | 28K | |
![[IMG]](/icons/image2.gif) | 1678035205logo2.jpg | 2023-03-05 16:53 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1678123953Logo.jpg | 2023-03-06 17:32 | 69K | |
![[IMG]](/icons/image2.gif) | 1678215871clyde (2).jpg | 2023-03-07 19:04 | 3.5M | |
![[IMG]](/icons/image2.gif) | 1678220622Signature.gif | 2023-03-07 20:23 | 25K | |
![[IMG]](/icons/image2.gif) | 1678220719Screenshot..> | 2023-03-07 20:25 | 2.2K | |
![[IMG]](/icons/image2.gif) | 1678291398MorelifeLo..> | 2023-03-08 16:03 | 207K | |
![[IMG]](/icons/image2.gif) | 1678296817Coffee Mes..> | 2023-03-08 17:33 | 224K | |
![[IMG]](/icons/image2.gif) | 1678302679me.jpg | 2023-03-08 19:11 | 748K | |
![[IMG]](/icons/image2.gif) | 1678307333sf-logo-03..> | 2023-03-08 20:28 | 128K | |
![[IMG]](/icons/image2.gif) | 1678316379Color logo..> | 2023-03-08 22:59 | 247K | |
![[IMG]](/icons/image2.gif) | 1678371992Anthony&Em..> | 2023-03-09 14:26 | 495K | |
![[IMG]](/icons/image2.gif) | 1678374788HFLM_Logo_..> | 2023-03-09 15:13 | 315K | |
![[IMG]](/icons/image2.gif) | 1678409725Kodiak Rus..> | 2023-03-10 00:55 | 395K | |
![[IMG]](/icons/image2.gif) | 1678479509Wholesale ..> | 2023-03-10 20:18 | 195K | |
![[IMG]](/icons/image2.gif) | 1678486491jpg-01-01.jpg | 2023-03-10 22:14 | 128K | |
![[IMG]](/icons/image2.gif) | 1678544872Soda Guy L..> | 2023-03-11 14:27 | 22K | |
![[IMG]](/icons/image2.gif) | 1678567505Youtube ph..> | 2023-03-11 20:45 | 18K | |
![[IMG]](/icons/image2.gif) | 1678717785Screen Sho..> | 2023-03-13 14:29 | 269K | |
![[IMG]](/icons/image2.gif) | 1678744344IMG_202303..> | 2023-03-13 21:52 | 359K | |
![[IMG]](/icons/image2.gif) | 1678761520Great Morn..> | 2023-03-14 02:38 | 125K | |
![[IMG]](/icons/image2.gif) | 1678813730DEE254A7-2..> | 2023-03-14 17:08 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1678837013FH Logo Fi..> | 2023-03-14 23:36 | 68K | |
![[IMG]](/icons/image2.gif) | 1678899470Logo kuach..> | 2023-03-15 16:57 | 81K | |
![[IMG]](/icons/image2.gif) | 1678971542basket.JPG | 2023-03-16 12:59 | 684K | |
![[IMG]](/icons/image2.gif) | 1678990282LogoMakr-9..> | 2023-03-16 18:11 | 191K | |
![[IMG]](/icons/image2.gif) | 1679060183JPEG Slaug..> | 2023-03-17 13:36 | 285K | |
![[IMG]](/icons/image2.gif) | 1679060205unnamed.png | 2023-03-17 13:36 | 260K | |
![[IMG]](/icons/image2.gif) | 1679167863CA9BD180-E..> | 2023-03-18 19:31 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1679275243Dream Aven..> | 2023-03-20 01:20 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1679440138Yellow Bac..> | 2023-03-21 23:08 | 229K | |
![[IMG]](/icons/image2.gif) | 1679502559Pot Logo -..> | 2023-03-22 16:29 | 20K | |
![[IMG]](/icons/image2.gif) | 1679503717Pot Logo -..> | 2023-03-22 16:48 | 17K | |
![[IMG]](/icons/image2.gif) | 1679504537AngelandAn..> | 2023-03-22 17:02 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1679506608images (1)..> | 2023-03-22 17:36 | 22K | |
![[IMG]](/icons/image2.gif) | 1679589325Mom's logo..> | 2023-03-23 16:35 | 208K | |
![[IMG]](/icons/image2.gif) | 1679596008Profile PI..> | 2023-03-23 18:26 | 902K | |
![[IMG]](/icons/image2.gif) | 1679814529Original.png | 2023-03-26 07:08 | 87K | |
![[IMG]](/icons/image2.gif) | 1679881944The scRUMp..> | 2023-03-27 01:52 | 160K | |
![[IMG]](/icons/image2.gif) | 1679933990RavenHook_..> | 2023-03-27 16:19 | 888K | |
![[IMG]](/icons/image2.gif) | 1680015629Joel White..> | 2023-03-28 15:00 | 246K | |
![[IMG]](/icons/image2.gif) | 1680055182DE35D471-9..> | 2023-03-29 01:59 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1680113450Copy of El..> | 2023-03-29 18:10 | 21K | |
![[IMG]](/icons/image2.gif) | 1680130810Southbound..> | 2023-03-29 23:00 | 432K | |
![[IMG]](/icons/image2.gif) | 1680289821logo.jpg | 2023-03-31 19:10 | 521K | |
![[IMG]](/icons/image2.gif) | 1680299424SBP_Logo_S..> | 2023-03-31 21:50 | 33K | |
![[IMG]](/icons/image2.gif) | 1680299434SBP_Logo_S..> | 2023-03-31 21:50 | 33K | |
![[IMG]](/icons/image2.gif) | 1680299524SBP_Logo_S..> | 2023-03-31 21:52 | 27K | |
![[IMG]](/icons/image2.gif) | 1680299555SBP_Logo_S..> | 2023-03-31 21:52 | 33K | |
![[IMG]](/icons/image2.gif) | 1680305878A2F63F1C-1..> | 2023-03-31 23:37 | 103K | |
![[IMG]](/icons/image2.gif) | 1680361263Sugarwood ..> | 2023-04-01 15:01 | 7.9K | |
![[IMG]](/icons/image2.gif) | 1680361851Sugarwood ..> | 2023-04-01 15:10 | 7.9K | |
![[IMG]](/icons/image2.gif) | 1680456966Facebook P..> | 2023-04-02 17:36 | 79K | |
![[IMG]](/icons/image2.gif) | 1680462619E7B2104B-C..> | 2023-04-02 19:10 | 456K | |
![[IMG]](/icons/image2.gif) | 1680464357logo and t..> | 2023-04-02 19:39 | 235K | |
![[IMG]](/icons/image2.gif) | 1680474317Pilgrim.png | 2023-04-02 22:25 | 394K | |
![[IMG]](/icons/image2.gif) | 1680492334IMG_6095.jpg | 2023-04-03 03:25 | 2.8M | |
![[IMG]](/icons/image2.gif) | 1680528083BCF Logo S..> | 2023-04-03 13:21 | 407K | |
![[IMG]](/icons/image2.gif) | 1680529115lime cocon..> | 2023-04-03 13:38 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1680549606GC_coffee_..> | 2023-04-03 19:20 | 44K | |
![[IMG]](/icons/image2.gif) | 1680710943Screen Sho..> | 2023-04-05 16:09 | 16K | |
![[IMG]](/icons/image2.gif) | 1680733071View recen..> | 2023-04-05 22:17 | 821K | |
![[IMG]](/icons/image2.gif) | 1680792726SugarwoodF..> | 2023-04-06 14:52 | 7.9K | |
![[IMG]](/icons/image2.gif) | 1680799495Screen Sho..> | 2023-04-06 16:44 | 45K | |
![[IMG]](/icons/image2.gif) | 1680828152BBFC5685-1..> | 2023-04-07 00:42 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1680964433GFC Logo w..> | 2023-04-08 14:33 | 473K | |
![[IMG]](/icons/image2.gif) | 1681077007scdc.jpg | 2023-04-09 21:50 | 83K | |
![[IMG]](/icons/image2.gif) | 1681079552Screen Sho..> | 2023-04-09 22:32 | 346K | |
![[IMG]](/icons/image2.gif) | 1681133800RisingMoon..> | 2023-04-10 13:36 | 145K | |
![[IMG]](/icons/image2.gif) | 1681139890IMG_E6039.JPG | 2023-04-10 15:18 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1681150840Copy of ro..> | 2023-04-10 18:20 | 400K | |
![[IMG]](/icons/image2.gif) | 1681159321Untitled-2..> | 2023-04-10 20:42 | 649K | |
![[IMG]](/icons/image2.gif) | 1681160012IMG_2942 2..> | 2023-04-10 20:53 | 22K | |
![[IMG]](/icons/image2.gif) | 1681177359IMG-7380.JPG | 2023-04-11 01:42 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1681197497CEFC83F8-0..> | 2023-04-11 07:18 | 72K | |
![[IMG]](/icons/image2.gif) | 1681221150single ear..> | 2023-04-11 13:52 | 117K | |
![[IMG]](/icons/image2.gif) | 1681414040OG Brand L..> | 2023-04-13 19:27 | 289K | |
![[IMG]](/icons/image2.gif) | 1681485531Oshun_circ..> | 2023-04-14 15:18 | 340K | |
![[IMG]](/icons/image2.gif) | 1681653834OG Brand L..> | 2023-04-16 14:03 | 212K | |
![[IMG]](/icons/image2.gif) | 1681759836IMG_0806.jpeg | 2023-04-17 19:30 | 106K | |
![[IMG]](/icons/image2.gif) | 1681763593Oak&Steel ..> | 2023-04-17 20:33 | 175K | |
![[IMG]](/icons/image2.gif) | 1681826149logo.jpg | 2023-04-18 13:55 | 168K | |
![[IMG]](/icons/image2.gif) | 1681830479milk.jpeg | 2023-04-18 15:07 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1681845026Screenshot..> | 2023-04-18 19:10 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1681850625medsizelog..> | 2023-04-18 20:43 | 187K | |
![[IMG]](/icons/image2.gif) | 1681921635Notes_2304..> | 2023-04-19 16:27 | 517K | |
![[IMG]](/icons/image2.gif) | 1682004910batch22Log..> | 2023-04-20 15:35 | 55K | |
![[IMG]](/icons/image2.gif) | 1682012821Logo white..> | 2023-04-20 17:47 | 81K | |
![[IMG]](/icons/image2.gif) | 1682281618IMG_1588.jpeg | 2023-04-23 20:26 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1682281625IMG_1588.jpeg | 2023-04-23 20:27 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1682306303Heritage B..> | 2023-04-24 03:18 | 47K | |
![[IMG]](/icons/image2.gif) | 1682522262Cheesecake..> | 2023-04-26 15:17 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1682531993Great-Lake..> | 2023-04-26 17:59 | 302K | |
![[IMG]](/icons/image2.gif) | 1682549874Logo Revam..> | 2023-04-26 22:57 | 89K | |
![[IMG]](/icons/image2.gif) | 1682611684Autry Fami..> | 2023-04-27 16:08 | 29K | |
![[IMG]](/icons/image2.gif) | 1682686143CoveyChase..> | 2023-04-28 12:49 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1682718244Logo-01.jpg | 2023-04-28 21:44 | 184K | |
![[IMG]](/icons/image2.gif) | 1682732691Screen Sho..> | 2023-04-29 01:44 | 3.0M | |
![[IMG]](/icons/image2.gif) | 1682781040CBC STICKE..> | 2023-04-29 15:10 | 477K | |
![[IMG]](/icons/image2.gif) | 1682867228a simple l..> | 2023-04-30 15:07 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1682869403FE296E37-9..> | 2023-04-30 15:43 | 565K | |
![[IMG]](/icons/image2.gif) | 1682962382E1BBDFA4-A..> | 2023-05-01 17:33 | 106K | |
![[IMG]](/icons/image2.gif) | 1683074038GREEN VILL..> | 2023-05-03 00:33 | 62K | |
![[IMG]](/icons/image2.gif) | 1683076126Net Wt. 16..> | 2023-05-03 01:08 | 185K | |
![[IMG]](/icons/image2.gif) | 1683076138Net Wt. 16..> | 2023-05-03 01:08 | 185K | |
![[IMG]](/icons/image2.gif) | 1683151626me.JPG | 2023-05-03 22:07 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1683153453new gwr.png | 2023-05-03 22:37 | 690K | |
![[IMG]](/icons/image2.gif) | 1683234325Wholesale ..> | 2023-05-04 21:05 | 208K | |
![[IMG]](/icons/image2.gif) | 1683234331Wholesale ..> | 2023-05-04 21:05 | 208K | |
![[IMG]](/icons/image2.gif) | 1683234489Logo_GVF_H..> | 2023-05-04 21:08 | 24K | |
![[IMG]](/icons/image2.gif) | 1683305022New Logo.png | 2023-05-05 16:43 | 570K | |
![[IMG]](/icons/image2.gif) | 1683305107Untitled d..> | 2023-05-05 16:45 | 275K | |
![[IMG]](/icons/image2.gif) | 1683320021IMG_1259.jpeg | 2023-05-05 20:53 | 160K | |
![[IMG]](/icons/image2.gif) | 1683392269New Pig (2..> | 2023-05-06 16:57 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1683484122facebook_1..> | 2023-05-07 18:28 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1683563246DB2D88BC-8..> | 2023-05-08 16:27 | 31K | |
![[IMG]](/icons/image2.gif) | 1683572616F688AB9D-D..> | 2023-05-08 19:03 | 127K | |
![[IMG]](/icons/image2.gif) | 1683581149cardsmay2.jpg | 2023-05-08 21:25 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1683653657sqr logo.png | 2023-05-09 17:34 | 70K | |
![[IMG]](/icons/image2.gif) | 1683655623D09B6274-9..> | 2023-05-09 18:07 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1683655637D09B6274-9..> | 2023-05-09 18:07 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1683666077BD03B4D7-C..> | 2023-05-09 21:01 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1683666954me082417.jpg | 2023-05-09 21:15 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1683822362PXL_202305..> | 2023-05-11 16:26 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1683822407PXL_202305..> | 2023-05-11 16:26 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1683933543arugala gr..> | 2023-05-12 23:19 | 2.1M | |
![[IMG]](/icons/image2.gif) | 1684256676home-desig..> | 2023-05-16 17:04 | 398K | |
![[IMG]](/icons/image2.gif) | 1684260335IMG_8932.jpeg | 2023-05-16 18:05 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1684268220IMG_8942.jpeg | 2023-05-16 20:17 | 673K | |
![[IMG]](/icons/image2.gif) | 1684268333IMG_8943.jpeg | 2023-05-16 20:18 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1684268440IMG_8944.jpeg | 2023-05-16 20:20 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1684268533IMG_8945.jpeg | 2023-05-16 20:22 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1684272429Dunneback-..> | 2023-05-16 21:27 | 476K | |
![[IMG]](/icons/image2.gif) | 1684338662logo.jpeg | 2023-05-17 15:51 | 307K | |
![[IMG]](/icons/image2.gif) | 1684342120IMG_2960 2..> | 2023-05-17 16:48 | 298K | |
![[IMG]](/icons/image2.gif) | 1684345922profile pi..> | 2023-05-17 17:52 | 89K | |
![[IMG]](/icons/image2.gif) | 1684483557cryoarid-h..> | 2023-05-19 08:05 | 160K | |
![[IMG]](/icons/image2.gif) | 1684541003IMG_5999.jpeg | 2023-05-20 00:03 | 3.2M | |
![[IMG]](/icons/image2.gif) | 1684776326Screen Sho..> | 2023-05-22 17:25 | 307K | |
![[IMG]](/icons/image2.gif) | 1684785998Bonner-Far..> | 2023-05-22 20:06 | 54K | |
![[IMG]](/icons/image2.gif) | 1684874788Bonner-Far..> | 2023-05-23 20:46 | 63K | |
![[IMG]](/icons/image2.gif) | 1685116171LIZ B CAFE..> | 2023-05-26 15:49 | 818K | |
![[IMG]](/icons/image2.gif) | 1685119611Picture1.png | 2023-05-26 16:46 | 46K | |
![[IMG]](/icons/image2.gif) | 1685121725RFMBoothWE..> | 2023-05-26 17:22 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1685122104th_1666796..> | 2023-05-26 17:28 | 100K | |
![[IMG]](/icons/image2.gif) | 1685215470-8u70ha.jpg | 2023-05-27 19:24 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1685308563HoltonLive..> | 2023-05-28 21:16 | 385K | |
![[IMG]](/icons/image2.gif) | 1685572602W&W BeefLo..> | 2023-05-31 22:36 | 102K | |
![[IMG]](/icons/image2.gif) | 1685659083PR-Online-..> | 2023-06-01 22:38 | 500K | |
![[IMG]](/icons/image2.gif) | 1685659095Pride Road..> | 2023-06-01 22:38 | 451K | |
![[IMG]](/icons/image2.gif) | 1685659103Pride Road..> | 2023-06-01 22:38 | 451K | |
![[IMG]](/icons/image2.gif) | 1685741639TTT Logo W..> | 2023-06-02 21:33 | 220K | |
![[IMG]](/icons/image2.gif) | 1685816233FB7BEADF-6..> | 2023-06-03 18:17 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1685898146Iron Frost..> | 2023-06-04 17:02 | 138K | |
![[IMG]](/icons/image2.gif) | 1685995464carlson-gr..> | 2023-06-05 20:04 | 125K | |
![[IMG]](/icons/image2.gif) | 1686065423TG-low-rez..> | 2023-06-06 15:30 | 445K | |
![[IMG]](/icons/image2.gif) | 1686068376Evolve-39c..> | 2023-06-06 16:19 | 374K | |
![[IMG]](/icons/image2.gif) | 1686083483Pot Logo -..> | 2023-06-06 20:31 | 62K | |
![[IMG]](/icons/image2.gif) | 1686087204IMG-0336.PNG | 2023-06-06 21:33 | 27K | |
![[IMG]](/icons/image2.gif) | 1686091750theplanttr..> | 2023-06-06 22:49 | 281K | |
![[IMG]](/icons/image2.gif) | 1686226993Profile Im..> | 2023-06-08 12:23 | 604K | |
![[IMG]](/icons/image2.gif) | 1686231052Pot Logo -..> | 2023-06-08 13:30 | 22K | |
![[IMG]](/icons/image2.gif) | 1686271780Bee Cool H..> | 2023-06-09 00:49 | 45K | |
![[IMG]](/icons/image2.gif) | 1686272668B8F3DF9E-E..> | 2023-06-09 01:04 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1686495754IMG_8406.PNG | 2023-06-11 15:02 | 62K | |
![[IMG]](/icons/image2.gif) | 1686509838canstockph..> | 2023-06-11 18:57 | 739K | |
![[IMG]](/icons/image2.gif) | 1686510033Screenshot..> | 2023-06-11 19:00 | 278K | |
![[IMG]](/icons/image2.gif) | 1686510144Screenshot..> | 2023-06-11 19:02 | 828K | |
![[IMG]](/icons/image2.gif) | 1686542596FSF GRAM.png | 2023-06-12 04:03 | 127K | |
![[IMG]](/icons/image2.gif) | 1686543753windowclin..> | 2023-06-12 04:22 | 610K | |
![[IMG]](/icons/image2.gif) | 1686586992F426195C-7..> | 2023-06-12 16:23 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1686589100shrimp co ..> | 2023-06-12 16:58 | 47K | |
![[IMG]](/icons/image2.gif) | 1686601923kathy_NEW.jpg | 2023-06-12 20:32 | 327K | |
![[IMG]](/icons/image2.gif) | 1686614245IMG_8632.JPG | 2023-06-12 23:57 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1686621594New Label ..> | 2023-06-13 01:59 | 66K | |
![[IMG]](/icons/image2.gif) | 1686695749sliced-llc..> | 2023-06-13 22:35 | 144K | |
![[IMG]](/icons/image2.gif) | 1686706859Photo_2022..> | 2023-06-14 01:40 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1686746045Untitled (..> | 2023-06-14 12:34 | 708K | |
![[IMG]](/icons/image2.gif) | 1686747280Sesame_pou..> | 2023-06-14 12:54 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1686774462SuLu Mini.png | 2023-06-14 20:27 | 72K | |
![[IMG]](/icons/image2.gif) | 1686779777IMG_2018.png | 2023-06-14 21:56 | 399K | |
![[IMG]](/icons/image2.gif) | 1686789218FB72198B-9..> | 2023-06-15 00:33 | 153K | |
![[IMG]](/icons/image2.gif) | 1686789228FB72198B-9..> | 2023-06-15 00:33 | 153K | |
![[IMG]](/icons/image2.gif) | 1686789251DE6F01CD-2..> | 2023-06-15 00:34 | 162K | |
![[IMG]](/icons/image2.gif) | 1686789319FB72198B-9..> | 2023-06-15 00:35 | 153K | |
![[IMG]](/icons/image2.gif) | 1686789356ABE728D0-B..> | 2023-06-15 00:35 | 162K | |
![[IMG]](/icons/image2.gif) | 1686789362ABE728D0-B..> | 2023-06-15 00:36 | 162K | |
![[IMG]](/icons/image2.gif) | 1686835630IMG_0656.jpeg | 2023-06-15 13:27 | 2.4M | |
![[IMG]](/icons/image2.gif) | 1686836007IMG_202306..> | 2023-06-15 13:33 | 536K | |
![[IMG]](/icons/image2.gif) | 1686856584FFB18CBC-7..> | 2023-06-15 19:16 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1686860125Goddie Pam..> | 2023-06-15 20:15 | 153K | |
![[IMG]](/icons/image2.gif) | 1686865432B8F3DF9E-E..> | 2023-06-15 21:43 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1686929644The Freeze..> | 2023-06-16 15:34 | 272K | |
![[IMG]](/icons/image2.gif) | 1687033070MAIN.jpg | 2023-06-17 20:17 | 203K | |
![[IMG]](/icons/image2.gif) | 1687033081MAIN.jpg | 2023-06-17 20:18 | 203K | |
![[IMG]](/icons/image2.gif) | 1687185723SB_green_c..> | 2023-06-19 14:42 | 139K | |
![[IMG]](/icons/image2.gif) | 1687189055Crowther F..> | 2023-06-19 15:37 | 137K | |
![[IMG]](/icons/image2.gif) | 1687202932PPF LOGO_u..> | 2023-06-19 19:28 | 159K | |
![[IMG]](/icons/image2.gif) | 1687279354AIN big lo..> | 2023-06-20 16:42 | 273K | |
![[IMG]](/icons/image2.gif) | 1687311485HungaryCze..> | 2023-06-21 01:38 | 97K | |
![[IMG]](/icons/image2.gif) | 1687454897AIN big lo..> | 2023-06-22 17:28 | 240K | |
![[IMG]](/icons/image2.gif) | 1687472867Lupas Flag..> | 2023-06-22 22:27 | 436K | |
![[IMG]](/icons/image2.gif) | 1687531752JPEG.jpg | 2023-06-23 14:49 | 659K | |
![[IMG]](/icons/image2.gif) | 1687555491Wholesale ..> | 2023-06-23 21:24 | 107K | |
![[IMG]](/icons/image2.gif) | 1687616821IMG_202306..> | 2023-06-24 14:27 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1687638856IMG_202306..> | 2023-06-24 20:34 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1687639655LK Black l..> | 2023-06-24 20:47 | 40K | |
![[IMG]](/icons/image2.gif) | 1687641997Lupas Flag..> | 2023-06-24 21:26 | 436K | |
![[IMG]](/icons/image2.gif) | 1687807343IMG_8191.jpeg | 2023-06-26 19:22 | 878K | |
![[IMG]](/icons/image2.gif) | 1687811187Artisan Ja..> | 2023-06-26 20:26 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1687820694Bulldog Br..> | 2023-06-26 23:04 | 903K | |
![[IMG]](/icons/image2.gif) | 1687834270IMG_0066.jpeg | 2023-06-27 02:51 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1687834273IMG_0066.jpeg | 2023-06-27 02:51 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1687972083newlogo.jpg | 2023-06-28 17:08 | 419K | |
![[IMG]](/icons/image2.gif) | 1687986956GwaR-GirlO..> | 2023-06-28 21:15 | 101K | |
![[IMG]](/icons/image2.gif) | 1688046070HFG_Horizo..> | 2023-06-29 13:41 | 89K | |
![[IMG]](/icons/image2.gif) | 1688070401Monogram L..> | 2023-06-29 20:26 | 152K | |
![[IMG]](/icons/image2.gif) | 1688133617carameltab..> | 2023-06-30 14:00 | 3.8M | |
![[IMG]](/icons/image2.gif) | 1688176652IMG_2390.png | 2023-07-01 01:57 | 170K | |
![[IMG]](/icons/image2.gif) | 1688401691Profile Pi..> | 2023-07-03 16:28 | 68K | |
![[IMG]](/icons/image2.gif) | 1688483770image00000..> | 2023-07-04 15:16 | 391K | |
![[IMG]](/icons/image2.gif) | 1688556402preview1 (..> | 2023-07-05 11:26 | 44K | |
![[IMG]](/icons/image2.gif) | 1688572946Homeskille..> | 2023-07-05 16:02 | 276K | |
![[IMG]](/icons/image2.gif) | 1688581219Homeskille..> | 2023-07-05 18:20 | 238K | |
![[IMG]](/icons/image2.gif) | 1688585164Img_2023_0..> | 2023-07-05 19:26 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1688596079Screenshot..> | 2023-07-05 22:27 | 74K | |
![[IMG]](/icons/image2.gif) | 1688664457faith-hill..> | 2023-07-06 17:27 | 550K | |
![[IMG]](/icons/image2.gif) | 1688669179Michigan P..> | 2023-07-06 18:46 | 2.4M | |
![[IMG]](/icons/image2.gif) | 1688917499IMG_4598.jpeg | 2023-07-09 15:44 | 122K | |
![[IMG]](/icons/image2.gif) | 1688993499IMG_202306..> | 2023-07-10 12:51 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1689026139LushAcresF..> | 2023-07-10 21:55 | 213K | |
![[IMG]](/icons/image2.gif) | 1689037847T5.jpg | 2023-07-11 01:10 | 7.0K | |
![[IMG]](/icons/image2.gif) | 1689093023IMG_1975.jpeg | 2023-07-11 16:30 | 749K | |
![[IMG]](/icons/image2.gif) | 1689093037IMG_1975.jpeg | 2023-07-11 16:30 | 749K | |
![[IMG]](/icons/image2.gif) | 1689117973DSCF8492.jpg | 2023-07-11 23:26 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1689132792Farm tour.jpg | 2023-07-12 03:33 | 4.1M | |
![[IMG]](/icons/image2.gif) | 1689168135Untitled d..> | 2023-07-12 13:22 | 60K | |
![[IMG]](/icons/image2.gif) | 1689182151Logo.jpg | 2023-07-12 17:15 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1689251421Untitled d..> | 2023-07-13 12:30 | 344K | |
![[IMG]](/icons/image2.gif) | 1689354526waygu.png | 2023-07-14 17:08 | 569K | |
![[IMG]](/icons/image2.gif) | 1689354763image.jpg | 2023-07-14 17:12 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1689514476BBC533CE-8..> | 2023-07-16 13:34 | 161K | |
![[IMG]](/icons/image2.gif) | 1689597241JH Logo.png | 2023-07-17 12:34 | 23K | |
![[IMG]](/icons/image2.gif) | 1689607233Buttermilk..> | 2023-07-17 15:20 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1689612412Black and ..> | 2023-07-17 16:46 | 48K | |
![[IMG]](/icons/image2.gif) | 1689613353FACEBOOK P..> | 2023-07-17 17:02 | 238K | |
![[IMG]](/icons/image2.gif) | 1689632143Profile 20..> | 2023-07-17 22:15 | 2.4M | |
![[IMG]](/icons/image2.gif) | 1689634786IMG_1540.jpeg | 2023-07-17 22:59 | 240K | |
![[IMG]](/icons/image2.gif) | 1689644935HEARTY LEA..> | 2023-07-18 01:48 | 43K | |
![[IMG]](/icons/image2.gif) | 1689780406BlueMoon_L..> | 2023-07-19 15:26 | 101K | |
![[IMG]](/icons/image2.gif) | 1689863854flint and ..> | 2023-07-20 14:37 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1689866789DSC00521 (..> | 2023-07-20 15:26 | 4.0M | |
![[IMG]](/icons/image2.gif) | 1689967023Yelp profi..> | 2023-07-21 19:17 | 556K | |
![[IMG]](/icons/image2.gif) | 1689967184Logo - La ..> | 2023-07-21 19:19 | 627K | |
![[IMG]](/icons/image2.gif) | 1690062324Sappho_and..> | 2023-07-22 21:45 | 705K | |
![[IMG]](/icons/image2.gif) | 1690070076Mystic mom..> | 2023-07-22 23:54 | 240K | |
![[IMG]](/icons/image2.gif) | 1690121743GaryLisa P..> | 2023-07-23 14:15 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1690135530Logo.JPG | 2023-07-23 18:05 | 191K | |
![[IMG]](/icons/image2.gif) | 1690135945IMG_9012.jpeg | 2023-07-23 18:12 | 701K | |
![[IMG]](/icons/image2.gif) | 1690376413KB11o.JPG | 2023-07-26 13:00 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1690399342bleufigsqu..> | 2023-07-26 19:22 | 33K | |
![[IMG]](/icons/image2.gif) | 1690400600Logo Small..> | 2023-07-26 19:43 | 63K | |
![[IMG]](/icons/image2.gif) | 1690511286Dana's Del..> | 2023-07-28 02:28 | 31K | |
![[IMG]](/icons/image2.gif) | 1690563863IMG_3498.jpeg | 2023-07-28 17:04 | 821K | |
![[IMG]](/icons/image2.gif) | 1690648666Greenwood ..> | 2023-07-29 16:37 | 165K | |
![[IMG]](/icons/image2.gif) | 1690649199Greenwood ..> | 2023-07-29 16:46 | 165K | |
![[IMG]](/icons/image2.gif) | 1690649557Greenwood ..> | 2023-07-29 16:52 | 165K | |
![[IMG]](/icons/image2.gif) | 1690658542nefevee wh..> | 2023-07-29 19:22 | 82K | |
![[IMG]](/icons/image2.gif) | 1690761408CE441043-6..> | 2023-07-30 23:56 | 79K | |
![[IMG]](/icons/image2.gif) | 1690762229CE441043-6..> | 2023-07-31 00:10 | 79K | |
![[IMG]](/icons/image2.gif) | 1690767560Log_320_32..> | 2023-07-31 01:39 | 80K | |
![[IMG]](/icons/image2.gif) | 1690798702PPF LOGO_3..> | 2023-07-31 10:18 | 33K | |
![[IMG]](/icons/image2.gif) | 1690811450Monster Ba..> | 2023-07-31 13:50 | 130K | |
![[IMG]](/icons/image2.gif) | 1690851651Angelos-4-..> | 2023-08-01 01:00 | 27K | |
![[IMG]](/icons/image2.gif) | 1690916244Untitled d..> | 2023-08-01 18:57 | 90K | |
![[IMG]](/icons/image2.gif) | 1691013942PhotoRoom_..> | 2023-08-02 22:05 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1691188672WRF_logo_h..> | 2023-08-04 22:37 | 30K | |
![[IMG]](/icons/image2.gif) | 1691368844Tractor.jpg | 2023-08-07 00:40 | 4.2M | |
![[IMG]](/icons/image2.gif) | 1691368919field2.jpg | 2023-08-07 00:41 | 2.3M | |
![[IMG]](/icons/image2.gif) | 1691369244field1.jpg | 2023-08-07 00:47 | 3.6M | |
![[IMG]](/icons/image2.gif) | 1691421425BF_LOGO_JP..> | 2023-08-07 15:17 | 348K | |
![[IMG]](/icons/image2.gif) | 1691424083Logo.png | 2023-08-07 16:01 | 64K | |
![[IMG]](/icons/image2.gif) | 1691505901DSCF3688.jpg | 2023-08-08 14:45 | 2.7M | |
![[IMG]](/icons/image2.gif) | 1691525571AALogoNEW.jpg | 2023-08-08 20:12 | 204K | |
![[IMG]](/icons/image2.gif) | 1691605219Sakred Ave..> | 2023-08-09 18:20 | 32K | |
![[IMG]](/icons/image2.gif) | 1691619328Potager A&..> | 2023-08-09 22:15 | 174K | |
![[IMG]](/icons/image2.gif) | 1691666851Green Plai..> | 2023-08-10 11:27 | 398K | |
![[IMG]](/icons/image2.gif) | 1691672205IMG_2782.jpeg | 2023-08-10 12:56 | 8.8K | |
![[IMG]](/icons/image2.gif) | 1691679398Colombia-L..> | 2023-08-10 14:56 | 141K | |
![[IMG]](/icons/image2.gif) | 1691689338FREED_Chic..> | 2023-08-10 17:42 | 652K | |
![[IMG]](/icons/image2.gif) | 1691690668LovelyDayC..> | 2023-08-10 18:04 | 648K | |
![[IMG]](/icons/image2.gif) | 1691691491wrongdescr..> | 2023-08-10 18:18 | 363K | |
![[IMG]](/icons/image2.gif) | 1691693654Beehive 1.png | 2023-08-10 18:54 | 188K | |
![[IMG]](/icons/image2.gif) | 1691702941Lancaster ..> | 2023-08-10 21:29 | 178K | |
![[IMG]](/icons/image2.gif) | 1691704973Nyblad Fam..> | 2023-08-10 22:02 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1691719345received_8..> | 2023-08-11 02:02 | 159K | |
![[IMG]](/icons/image2.gif) | 1691720104Tractor.jpg | 2023-08-11 02:15 | 4.2M | |
![[IMG]](/icons/image2.gif) | 1691769769IMG_202303..> | 2023-08-11 16:02 | 193K | |
![[IMG]](/icons/image2.gif) | 1691801746PhotoRoom-..> | 2023-08-12 00:55 | 2.4M | |
![[IMG]](/icons/image2.gif) | 1692016573C4B327EB-B..> | 2023-08-14 12:36 | 3.0M | |
![[IMG]](/icons/image2.gif) | 1692039082Steve Lutm..> | 2023-08-14 18:51 | 370K | |
![[IMG]](/icons/image2.gif) | 1692221141CSMP Logo.png | 2023-08-16 21:25 | 76K | |
![[IMG]](/icons/image2.gif) | 1692277808KKS Cookie..> | 2023-08-17 13:10 | 184K | |
![[IMG]](/icons/image2.gif) | 1692280181IMG_5779.jpg | 2023-08-17 13:49 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1692290368pnglogo.png | 2023-08-17 16:39 | 124K | |
![[IMG]](/icons/image2.gif) | 1692297541Company Lo..> | 2023-08-17 18:39 | 444K | |
![[IMG]](/icons/image2.gif) | 1692305393Company Lo..> | 2023-08-17 20:49 | 444K | |
![[IMG]](/icons/image2.gif) | 1692306460Wild Rise ..> | 2023-08-17 21:07 | 53K | |
![[IMG]](/icons/image2.gif) | 1692316413Free_Sampl..> | 2023-08-17 23:53 | 23K | |
![[IMG]](/icons/image2.gif) | 1692358083edit logo ..> | 2023-08-18 11:28 | 47K | |
![[IMG]](/icons/image2.gif) | 1692411867FullLogo.jpg | 2023-08-19 02:24 | 133K | |
![[IMG]](/icons/image2.gif) | 1692447855CC56A806-B..> | 2023-08-19 12:24 | 343K | |
![[IMG]](/icons/image2.gif) | 1692475575grannys ki..> | 2023-08-19 20:06 | 171K | |
![[IMG]](/icons/image2.gif) | 1692649448FA7FFA1E-D..> | 2023-08-21 20:24 | 155K | |
![[IMG]](/icons/image2.gif) | 1692649449FA7FFA1E-D..> | 2023-08-21 20:24 | 155K | |
![[IMG]](/icons/image2.gif) | 1692800748Ferry Farm..> | 2023-08-23 14:25 | 477K | |
![[IMG]](/icons/image2.gif) | 1692804766EL1hVcHN-4..> | 2023-08-23 15:32 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1693003425IMG_0568.jpg | 2023-08-25 22:43 | 3.8M | |
![[IMG]](/icons/image2.gif) | 1693030948untitled.png | 2023-08-26 06:22 | 268K | |
![[IMG]](/icons/image2.gif) | 1693234781IMG_5878.jpeg | 2023-08-28 14:59 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1693235569Mor_Profil..> | 2023-08-28 15:12 | 460K | |
![[IMG]](/icons/image2.gif) | 1693236590IMG_8911-E..> | 2023-08-28 15:29 | 2.6M | |
![[IMG]](/icons/image2.gif) | 1693242691IMG_2435.JPG | 2023-08-28 17:11 | 312K | |
![[IMG]](/icons/image2.gif) | 1693247217field full..> | 2023-08-28 18:26 | 69K | |
![[IMG]](/icons/image2.gif) | 1693249719IMG_6076.png | 2023-08-28 19:08 | 800K | |
![[IMG]](/icons/image2.gif) | 1693252236SheedallHa..> | 2023-08-28 19:50 | 25K | |
![[IMG]](/icons/image2.gif) | 1693253060IMG_3076.jpeg | 2023-08-28 20:04 | 456K | |
![[IMG]](/icons/image2.gif) | 1693264149received_8..> | 2023-08-28 23:09 | 148K | |
![[IMG]](/icons/image2.gif) | 1693272632IMG_6076.jpeg | 2023-08-29 01:30 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1693393273Broxonberr..> | 2023-08-30 11:01 | 76K | |
![[IMG]](/icons/image2.gif) | 1693419699hannmade. ..> | 2023-08-30 18:21 | 777K | |
![[IMG]](/icons/image2.gif) | 1693448822LOGO redd ..> | 2023-08-31 02:27 | 2.4M | |
![[IMG]](/icons/image2.gif) | 1693485009Carrot Cro..> | 2023-08-31 12:30 | 30K | |
![[IMG]](/icons/image2.gif) | 1693518415IMG_0246.jpeg | 2023-08-31 21:46 | 223K | |
![[IMG]](/icons/image2.gif) | 1693532589JuiceLogo_..> | 2023-09-01 01:43 | 54K | |
![[IMG]](/icons/image2.gif) | 1693695104Flostead-g..> | 2023-09-02 22:51 | 79K | |
![[IMG]](/icons/image2.gif) | 1693705101Screenshot..> | 2023-09-03 01:38 | 141K | |
![[IMG]](/icons/image2.gif) | 1693705165Screenshot..> | 2023-09-03 01:39 | 248K | |
![[IMG]](/icons/image2.gif) | 1694018955pro2.jpg | 2023-09-06 16:49 | 901K | |
![[IMG]](/icons/image2.gif) | 1694022251IMG_1296.jpeg | 2023-09-06 17:44 | 3.4M | |
![[IMG]](/icons/image2.gif) | 1694022357IMG_0246.jpeg | 2023-09-06 17:45 | 223K | |
![[IMG]](/icons/image2.gif) | 1694030320logo.jpg | 2023-09-06 19:58 | 3.3M | |
![[IMG]](/icons/image2.gif) | 1694030819_MG_9529.jpeg | 2023-09-06 20:06 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1694137993Tiny Crop ..> | 2023-09-08 01:53 | 74K | |
![[IMG]](/icons/image2.gif) | 1694152074IMG_2473.png | 2023-09-08 05:47 | 550K | |
![[IMG]](/icons/image2.gif) | 1694173861White Oak ..> | 2023-09-08 11:51 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1694211149pizza kit.jpg | 2023-09-08 22:12 | 2.6M | |
![[IMG]](/icons/image2.gif) | 1694215666Grounded M..> | 2023-09-08 23:27 | 401K | |
![[IMG]](/icons/image2.gif) | 1694551414Screenshot..> | 2023-09-12 20:43 | 458K | |
![[IMG]](/icons/image2.gif) | 1694551557Profile Pi..> | 2023-09-12 20:45 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1694553649Profile Pi..> | 2023-09-12 21:20 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1694625353Screen Sho..> | 2023-09-13 17:15 | 16K | |
![[IMG]](/icons/image2.gif) | 1694650367Resized_Re..> | 2023-09-14 00:12 | 879K | |
![[IMG]](/icons/image2.gif) | 1694694486KPP_logo.jpg | 2023-09-14 12:28 | 19K | |
![[IMG]](/icons/image2.gif) | 1694700414HDD Logo 6..> | 2023-09-14 14:06 | 204K | |
![[IMG]](/icons/image2.gif) | 1694723139jpg logo w..> | 2023-09-14 20:25 | 243K | |
![[IMG]](/icons/image2.gif) | 1694813634smaller fi..> | 2023-09-15 21:33 | 145K | |
![[IMG]](/icons/image2.gif) | 1694815650insta-dp.jpg | 2023-09-15 22:07 | 17K | |
![[IMG]](/icons/image2.gif) | 1694815669face-book-..> | 2023-09-15 22:07 | 32K | |
![[IMG]](/icons/image2.gif) | 1694958565timshel lo..> | 2023-09-17 13:49 | 515K | |
![[IMG]](/icons/image2.gif) | 1695060048soap.jpeg | 2023-09-18 18:00 | 224K | |
![[IMG]](/icons/image2.gif) | 1695070988Insights_S..> | 2023-09-18 21:03 | 3.4K | |
![[IMG]](/icons/image2.gif) | 1695071463logo 1 (4)..> | 2023-09-18 21:11 | 229K | |
![[IMG]](/icons/image2.gif) | 1695134638Navy Logo ..> | 2023-09-19 14:43 | 53K | |
![[IMG]](/icons/image2.gif) | 1695143025Red Head S..> | 2023-09-19 17:03 | 51K | |
![[IMG]](/icons/image2.gif) | 1695155027Soergel's ..> | 2023-09-19 20:23 | 628K | |
![[IMG]](/icons/image2.gif) | 1695212888IMG_9490.jpeg | 2023-09-20 12:28 | 3.1M | |
![[IMG]](/icons/image2.gif) | 1695225404Navy Logo ..> | 2023-09-20 15:56 | 41K | |
![[IMG]](/icons/image2.gif) | 1695259023Profile Pi..> | 2023-09-21 01:17 | 62K | |
![[IMG]](/icons/image2.gif) | 1695259208Profile Pi..> | 2023-09-21 01:20 | 62K | |
![[IMG]](/icons/image2.gif) | 1695323036Screenshot..> | 2023-09-21 19:03 | 971K | |
![[IMG]](/icons/image2.gif) | 1695435479Ocho Squar..> | 2023-09-23 02:18 | 284K | |
![[IMG]](/icons/image2.gif) | 1695435737Ocho Squar..> | 2023-09-23 02:22 | 285K | |
![[IMG]](/icons/image2.gif) | 1695435753Ocho Squar..> | 2023-09-23 02:22 | 285K | |
![[IMG]](/icons/image2.gif) | 1695604320MarketWago..> | 2023-09-25 01:12 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1695658083Resized_20..> | 2023-09-25 16:08 | 2.6M | |
![[IMG]](/icons/image2.gif) | 1695669026toybox.png | 2023-09-25 19:10 | 492K | |
![[IMG]](/icons/image2.gif) | 1695828055Bratton an..> | 2023-09-27 15:20 | 479K | |
![[IMG]](/icons/image2.gif) | 1695920498SELAH-FARM..> | 2023-09-28 17:01 | 18K | |
![[IMG]](/icons/image2.gif) | 1695935365F008D8D4-3..> | 2023-09-28 21:09 | 337K | |
![[IMG]](/icons/image2.gif) | 1695940156squareLogo..> | 2023-09-28 22:29 | 121K | |
![[IMG]](/icons/image2.gif) | 1695954320IMG_0312.jpeg | 2023-09-29 02:25 | 93K | |
![[IMG]](/icons/image2.gif) | 1696075365IMG_202309..> | 2023-09-30 12:02 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1696105968Cooke Tave..> | 2023-09-30 20:32 | 136K | |
![[IMG]](/icons/image2.gif) | 1696289887received_6..> | 2023-10-02 23:38 | 2.6M | |
![[IMG]](/icons/image2.gif) | 1696364808Chef Nicks..> | 2023-10-03 20:26 | 19K | |
![[IMG]](/icons/image2.gif) | 1696365684Slide6.JPG | 2023-10-03 20:41 | 459K | |
![[IMG]](/icons/image2.gif) | 1696446548HappyThank..> | 2023-10-04 19:09 | 2.9M | |
![[IMG]](/icons/image2.gif) | 1696452499Icon.png | 2023-10-04 20:48 | 102K | |
![[IMG]](/icons/image2.gif) | 1696521108NEYS-op2-0..> | 2023-10-05 15:51 | 48K | |
![[IMG]](/icons/image2.gif) | 1696531615PhotoRoom-..> | 2023-10-05 18:46 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1696609595Sticker fi..> | 2023-10-06 16:26 | 334K | |
![[IMG]](/icons/image2.gif) | 1696695691LBL sign.jpeg | 2023-10-07 16:21 | 170K | |
![[IMG]](/icons/image2.gif) | 1696822566HeritageBa..> | 2023-10-09 03:36 | 126K | |
![[IMG]](/icons/image2.gif) | 1696848251A93491BB-4..> | 2023-10-09 10:44 | 266K | |
![[IMG]](/icons/image2.gif) | 1696871552Vertical-l..> | 2023-10-09 17:12 | 59K | |
![[IMG]](/icons/image2.gif) | 1696874554The Countr..> | 2023-10-09 18:02 | 142K | |
![[IMG]](/icons/image2.gif) | 1696882552logo2023.png | 2023-10-09 20:15 | 265K | |
![[IMG]](/icons/image2.gif) | 1696956867Facebook H..> | 2023-10-10 16:54 | 2.4M | |
![[IMG]](/icons/image2.gif) | 1696968557ASFvarietm..> | 2023-10-10 20:09 | 803K | |
![[IMG]](/icons/image2.gif) | 1696968568ASFvarietm..> | 2023-10-10 20:09 | 803K | |
![[IMG]](/icons/image2.gif) | 1696985759IMG_0703.jpeg | 2023-10-11 00:55 | 4.0M | |
![[IMG]](/icons/image2.gif) | 1696992181FB_IMG_169..> | 2023-10-11 02:43 | 102K | |
![[IMG]](/icons/image2.gif) | 1697043243MarketSpre..> | 2023-10-11 16:54 | 104K | |
![[IMG]](/icons/image2.gif) | 1697047746IMG_202208..> | 2023-10-11 18:09 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1697112014GRO Logo C..> | 2023-10-12 12:00 | 172K | |
![[IMG]](/icons/image2.gif) | 1697131509LAC LOGO.jpg | 2023-10-12 17:25 | 365K | |
![[IMG]](/icons/image2.gif) | 1697236900logo.jpg | 2023-10-13 22:41 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1697237019logo.jpg | 2023-10-13 22:43 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1697330952LHM Logo.png | 2023-10-15 00:49 | 179K | |
![[IMG]](/icons/image2.gif) | 1697376144new logo 2..> | 2023-10-15 13:22 | 82K | |
![[IMG]](/icons/image2.gif) | 1697489029Screenshot..> | 2023-10-16 20:43 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1697556691rs=h-175,m..> | 2023-10-17 15:31 | 38K | |
![[IMG]](/icons/image2.gif) | 1697579051Logo-Tagli..> | 2023-10-17 21:44 | 571K | |
![[IMG]](/icons/image2.gif) | 1697638907logo.png | 2023-10-18 14:21 | 146K | |
![[IMG]](/icons/image2.gif) | 1697648722Screenshot..> | 2023-10-18 17:05 | 493K | |
![[IMG]](/icons/image2.gif) | 1697655359RR_wType.png | 2023-10-18 18:55 | 72K | |
![[IMG]](/icons/image2.gif) | 1697676898IPAD Wall ..> | 2023-10-19 00:54 | 152K | |
![[IMG]](/icons/image2.gif) | 1697742419received_2..> | 2023-10-19 19:06 | 3.3M | |
![[IMG]](/icons/image2.gif) | 1697757281trademark ..> | 2023-10-19 23:14 | 130K | |
![[IMG]](/icons/image2.gif) | 1697827306IMG_4302.jpeg | 2023-10-20 18:41 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1697838831Candies-CO..> | 2023-10-20 21:53 | 922K | |
![[IMG]](/icons/image2.gif) | 1697842788IMG_1364.jpeg | 2023-10-20 22:59 | 189K | |
![[IMG]](/icons/image2.gif) | 1698025857tempImageG..> | 2023-10-23 01:50 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1698093595tempImageB..> | 2023-10-23 20:39 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1698093735tempImaget..> | 2023-10-23 20:42 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1698153272Farmstead ..> | 2023-10-24 13:14 | 184K | |
![[IMG]](/icons/image2.gif) | 1698173629Screen Sho..> | 2023-10-24 18:53 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1698198643Shannon Ha..> | 2023-10-25 01:50 | 124K | |
![[IMG]](/icons/image2.gif) | 1698241410FB_IMG_169..> | 2023-10-25 13:43 | 339K | |
![[IMG]](/icons/image2.gif) | 1698241428FB_IMG_169..> | 2023-10-25 13:43 | 339K | |
![[IMG]](/icons/image2.gif) | 1698247986zoomed in.png | 2023-10-25 15:33 | 199K | |
![[IMG]](/icons/image2.gif) | 1698263403Logo-Best.jpg | 2023-10-25 19:50 | 468K | |
![[IMG]](/icons/image2.gif) | 1698263723Logo-Best.jpg | 2023-10-25 19:55 | 468K | |
![[IMG]](/icons/image2.gif) | 1698363286CLLV3853.PNG | 2023-10-26 23:34 | 442K | |
![[IMG]](/icons/image2.gif) | 1698418331Viking Hat..> | 2023-10-27 14:52 | 552K | |
![[IMG]](/icons/image2.gif) | 1698434013Jess_Fishe..> | 2023-10-27 19:13 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1698454836Logo.PNG | 2023-10-28 01:00 | 835K | |
![[IMG]](/icons/image2.gif) | 1698596706received_6..> | 2023-10-29 16:25 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1698629066D80852CC-7..> | 2023-10-30 01:24 | 122K | |
![[IMG]](/icons/image2.gif) | 1698713498OBO_SKYLIN..> | 2023-10-31 00:51 | 21K | |
![[IMG]](/icons/image2.gif) | 1698713867OBO_SKYLIN..> | 2023-10-31 00:57 | 10K | |
![[IMG]](/icons/image2.gif) | 1698713878OBO_SKYLIN..> | 2023-10-31 00:57 | 10K | |
![[IMG]](/icons/image2.gif) | 1698713917COMPANY_BA..> | 2023-10-31 00:58 | 95K | |
![[IMG]](/icons/image2.gif) | 1698713930COMPANY_BA..> | 2023-10-31 00:58 | 95K | |
![[IMG]](/icons/image2.gif) | 1698773213logo-nobac..> | 2023-10-31 17:26 | 125K | |
![[IMG]](/icons/image2.gif) | 1698773254logo-nobac..> | 2023-10-31 17:27 | 54K | |
![[IMG]](/icons/image2.gif) | 1698776034logo-nobac..> | 2023-10-31 18:13 | 18K | |
![[IMG]](/icons/image2.gif) | 1698811455IMG-5391.jpg | 2023-11-01 04:04 | 866K | |
![[IMG]](/icons/image2.gif) | 1698857909IMG_8605.jpeg | 2023-11-01 16:58 | 269K | |
![[IMG]](/icons/image2.gif) | 1698864189Buttonwood..> | 2023-11-01 18:43 | 226K | |
![[IMG]](/icons/image2.gif) | 1698874994IMG_7607.png | 2023-11-01 21:43 | 402K | |
![[IMG]](/icons/image2.gif) | 1698972280LOGO BEKY ..> | 2023-11-03 00:44 | 149K | |
![[IMG]](/icons/image2.gif) | 1699136066PhotoRoom-..> | 2023-11-04 22:14 | 844K | |
![[IMG]](/icons/image2.gif) | 1699217739Main Logo.png | 2023-11-05 20:55 | 733K | |
![[IMG]](/icons/image2.gif) | 1699291863Farm Logo.jpg | 2023-11-06 17:31 | 420K | |
![[IMG]](/icons/image2.gif) | 1699373077logo 1 (4)..> | 2023-11-07 16:04 | 229K | |
![[IMG]](/icons/image2.gif) | 1699559708truck.jpg | 2023-11-09 19:55 | 880K | |
![[IMG]](/icons/image2.gif) | 1699564665White Clas..> | 2023-11-09 21:17 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1699653610fyf logo c..> | 2023-11-10 22:00 | 47K | |
![[IMG]](/icons/image2.gif) | 1699836745IMG_2223.jpg | 2023-11-13 00:52 | 4.5M | |
![[IMG]](/icons/image2.gif) | 1699897851Squirrel m..> | 2023-11-13 17:50 | 430K | |
![[IMG]](/icons/image2.gif) | 1699923262image00000..> | 2023-11-14 00:54 | 2.9M | |
![[IMG]](/icons/image2.gif) | 1700025380C0474969-2..> | 2023-11-15 05:16 | 116K | |
![[IMG]](/icons/image2.gif) | 1700095989Victorias ..> | 2023-11-16 00:53 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1700305023B57F0D9A-C..> | 2023-11-18 10:57 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1700409810Screenshot..> | 2023-11-19 16:03 | 526K | |
![[IMG]](/icons/image2.gif) | 1700412534favicon-32..> | 2023-11-19 16:48 | 2.8K | |
![[IMG]](/icons/image2.gif) | 1700412731Favicon.png | 2023-11-19 16:52 | 31K | |
![[IMG]](/icons/image2.gif) | 1700439293KC Sunshin..> | 2023-11-20 00:14 | 75K | |
![[IMG]](/icons/image2.gif) | 1700488385F54D6030-7..> | 2023-11-20 13:53 | 98K | |
![[IMG]](/icons/image2.gif) | 1700493477Wallflower..> | 2023-11-20 15:17 | 65K | |
![[IMG]](/icons/image2.gif) | 1700515135Misfit Far..> | 2023-11-20 21:18 | 149K | |
![[IMG]](/icons/image2.gif) | 1700532847Bee Simple..> | 2023-11-21 02:14 | 354K | |
![[IMG]](/icons/image2.gif) | 1700535465eat here y..> | 2023-11-21 02:57 | 69K | |
![[IMG]](/icons/image2.gif) | 1700538030bb8a5c66-f..> | 2023-11-21 03:40 | 847K | |
![[IMG]](/icons/image2.gif) | 1700618666firstlite ..> | 2023-11-22 02:04 | 527K | |
![[IMG]](/icons/image2.gif) | 1700672237fvf.png | 2023-11-22 16:57 | 68K | |
![[IMG]](/icons/image2.gif) | 1700672779firstlite ..> | 2023-11-22 17:06 | 88K | |
![[IMG]](/icons/image2.gif) | 1700673128firstlite ..> | 2023-11-22 17:12 | 88K | |
![[IMG]](/icons/image2.gif) | 1700955903logo202311..> | 2023-11-25 23:45 | 114K | |
![[IMG]](/icons/image2.gif) | 1700956015logo202311..> | 2023-11-25 23:46 | 114K | |
![[IMG]](/icons/image2.gif) | 1701090767IMG_6989.jpeg | 2023-11-27 13:12 | 331K | |
![[IMG]](/icons/image2.gif) | 1701290366FB Profile..> | 2023-11-29 20:39 | 632K | |
![[IMG]](/icons/image2.gif) | 1701291875JJLautz.png | 2023-11-29 21:04 | 82K | |
![[IMG]](/icons/image2.gif) | 1701304385Mister_Han..> | 2023-11-30 00:33 | 137K | |
![[IMG]](/icons/image2.gif) | 1701310321Brown's Lo..> | 2023-11-30 02:12 | 95K | |
![[IMG]](/icons/image2.gif) | 1701370243AEFF142B-2..> | 2023-11-30 18:50 | 177K | |
![[IMG]](/icons/image2.gif) | 1701378019image.png | 2023-11-30 21:00 | 86K | |
![[IMG]](/icons/image2.gif) | 1701389146Downs Farm..> | 2023-12-01 00:05 | 111K | |
![[IMG]](/icons/image2.gif) | 1701469643IMG_1071.jpeg | 2023-12-01 22:27 | 2.1M | |
![[IMG]](/icons/image2.gif) | 1701539472FERRELL FA..> | 2023-12-02 17:51 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1701555623Neutral Bl..> | 2023-12-02 22:20 | 42K | |
![[IMG]](/icons/image2.gif) | 1701705211IMG_0461.jpeg | 2023-12-04 15:53 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1701713150Hidden Vie..> | 2023-12-04 18:05 | 126K | |
![[IMG]](/icons/image2.gif) | 1701773785logo.png | 2023-12-05 10:56 | 10K | |
![[IMG]](/icons/image2.gif) | 1701774233logo.png | 2023-12-05 11:03 | 10K | |
![[IMG]](/icons/image2.gif) | 1701808965Satsuma Co..> | 2023-12-05 20:42 | 446K | |
![[IMG]](/icons/image2.gif) | 1702062505ScottHillF..> | 2023-12-08 19:08 | 133K | |
![[IMG]](/icons/image2.gif) | 1702140653notsosilen..> | 2023-12-09 16:50 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1702142690fine baked..> | 2023-12-09 17:24 | 42K | |
![[IMG]](/icons/image2.gif) | 1702142858Copy of Ge..> | 2023-12-09 17:27 | 23K | |
![[IMG]](/icons/image2.gif) | 1702142984ggbcarrie.jpg | 2023-12-09 17:29 | 80K | |
![[IMG]](/icons/image2.gif) | 1702148762image1 (5)..> | 2023-12-09 19:06 | 367K | |
![[IMG]](/icons/image2.gif) | 1702269229IMG_3635.png | 2023-12-11 04:33 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1702269255IMG_3815.jpeg | 2023-12-11 04:34 | 2.1M | |
![[IMG]](/icons/image2.gif) | 1702269367IMG_3635.jpeg | 2023-12-11 04:36 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1702320337D6074591-D..> | 2023-12-11 18:45 | 667K | |
![[IMG]](/icons/image2.gif) | 1702334850Logo.jpg | 2023-12-11 22:47 | 2.8M | |
![[IMG]](/icons/image2.gif) | 1702507087N2Tfish.jpg | 2023-12-13 22:38 | 517K | |
![[IMG]](/icons/image2.gif) | 1702564196Sprinkle P..> | 2023-12-14 14:29 | 443K | |
![[IMG]](/icons/image2.gif) | 1702608776logo.png | 2023-12-15 02:52 | 9.5K | |
![[IMG]](/icons/image2.gif) | 1702658700logo 1.jpg | 2023-12-15 16:45 | 635K | |
![[IMG]](/icons/image2.gif) | 1702666304Healthy Ha..> | 2023-12-15 18:51 | 213K | |
![[IMG]](/icons/image2.gif) | 1702757580TimberVall..> | 2023-12-16 20:13 | 95K | |
![[IMG]](/icons/image2.gif) | 1702861423IMG_3337 (..> | 2023-12-18 01:03 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1702919214WHITE BACK..> | 2023-12-18 17:06 | 48K | |
![[IMG]](/icons/image2.gif) | 1702986052IMG_1185.jpeg | 2023-12-19 11:40 | 2.1M | |
![[IMG]](/icons/image2.gif) | 1702988502Guac Man O..> | 2023-12-19 12:21 | 195K | |
![[IMG]](/icons/image2.gif) | 1702988735Ocho Tshif..> | 2023-12-19 12:25 | 248K | |
![[IMG]](/icons/image2.gif) | 1702988764Ocho Squar..> | 2023-12-19 12:26 | 88K | |
![[IMG]](/icons/image2.gif) | 1703003127Pie Guy St..> | 2023-12-19 16:25 | 249K | |
![[IMG]](/icons/image2.gif) | 1703048096WHITE BACK..> | 2023-12-20 04:54 | 154K | |
![[IMG]](/icons/image2.gif) | 1703188413Wholesale ..> | 2023-12-21 19:53 | 216K | |
![[IMG]](/icons/image2.gif) | 1703209554nadi yo.png | 2023-12-22 01:45 | 83K | |
![[IMG]](/icons/image2.gif) | 1703209650nadi plate..> | 2023-12-22 01:47 | 147K | |
![[IMG]](/icons/image2.gif) | 1703533297OMG-Logo2.JPG | 2023-12-25 19:41 | 64K | |
![[IMG]](/icons/image2.gif) | 1703533560OMG-Logo3.jpg | 2023-12-25 19:46 | 63K | |
![[IMG]](/icons/image2.gif) | 1703534848OMG-Logo3.jpg | 2023-12-25 20:07 | 53K | |
![[IMG]](/icons/image2.gif) | 1703535635logo_20231..> | 2023-12-25 20:20 | 309K | |
![[IMG]](/icons/image2.gif) | 1703629450Heray Spic..> | 2023-12-26 22:24 | 3.9M | |
![[IMG]](/icons/image2.gif) | 1703629577Drew (46 o..> | 2023-12-26 22:26 | 2.8M | |
![[IMG]](/icons/image2.gif) | 1703629585Drew (46 o..> | 2023-12-26 22:26 | 2.8M | |
![[IMG]](/icons/image2.gif) | 1703629713Drew (46 o..> | 2023-12-26 22:28 | 2.8M | |
![[IMG]](/icons/image2.gif) | 1703653010IMG_4276.jpg | 2023-12-27 04:56 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1703699482Joan with ..> | 2023-12-27 17:51 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1703707198logo_tshir..> | 2023-12-27 19:59 | 80K | |
![[IMG]](/icons/image2.gif) | 1703707352Pie Guy st..> | 2023-12-27 20:02 | 355K | |
![[IMG]](/icons/image2.gif) | 1703797188logo and f..> | 2023-12-28 20:59 | 433K | |
![[IMG]](/icons/image2.gif) | 1703797298logo and f..> | 2023-12-28 21:01 | 658K | |
![[IMG]](/icons/image2.gif) | 1703797457logo and f..> | 2023-12-28 21:04 | 763K | |
![[IMG]](/icons/image2.gif) | 1703814218Copy of PL..> | 2023-12-29 01:43 | 249K | |
![[IMG]](/icons/image2.gif) | 1703884885blip yeah.png | 2023-12-29 21:21 | 134K | |
![[IMG]](/icons/image2.gif) | 1703953144Main Logo ..> | 2023-12-30 16:19 | 425K | |
![[IMG]](/icons/image2.gif) | 1704039397F5BC53E2-4..> | 2023-12-31 16:16 | 461K | |
![[IMG]](/icons/image2.gif) | 1704039543E303EFE9-2..> | 2023-12-31 16:19 | 480K | |
![[IMG]](/icons/image2.gif) | 1704209417IMG_1350.JPG | 2024-01-02 15:30 | 286K | |
![[IMG]](/icons/image2.gif) | 1704212769FVF Logo 2..> | 2024-01-02 16:26 | 28K | |
![[IMG]](/icons/image2.gif) | 1704319018download (..> | 2024-01-03 21:56 | 614K | |
![[IMG]](/icons/image2.gif) | 1704320460Farm1926.jpg | 2024-01-03 22:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1704329067headshot.jpg | 2024-01-04 00:44 | 149K | |
![[IMG]](/icons/image2.gif) | 1704422161SSC BRAND ..> | 2024-01-05 02:36 | 914K | |
![[IMG]](/icons/image2.gif) | 1704425665squoze no ..> | 2024-01-05 03:34 | 602K | |
![[IMG]](/icons/image2.gif) | 1704465722logopp.png | 2024-01-05 14:42 | 50K | |
![[IMG]](/icons/image2.gif) | 1704465825poots.jpg | 2024-01-05 14:43 | 67K | |
![[IMG]](/icons/image2.gif) | 1704471749bATTER'N B..> | 2024-01-05 16:22 | 29K | |
![[IMG]](/icons/image2.gif) | 1704503861Data - Mar..> | 2024-01-06 01:17 | 28K | |
![[IMG]](/icons/image2.gif) | 1704557896IMG_5307.jpeg | 2024-01-06 16:18 | 242K | |
![[IMG]](/icons/image2.gif) | 1704563458Sunset hil..> | 2024-01-06 17:50 | 59K | |
![[IMG]](/icons/image2.gif) | 1704640087Joan with ..> | 2024-01-07 15:08 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1704657403logo.jpeg | 2024-01-07 19:56 | 101K | |
![[IMG]](/icons/image2.gif) | 1704746292Horticultu..> | 2024-01-08 20:38 | 164K | |
![[IMG]](/icons/image2.gif) | 1704815439Sloppys-Lo..> | 2024-01-09 15:50 | 82K | |
![[IMG]](/icons/image2.gif) | 1704831484largergood..> | 2024-01-09 20:18 | 131K | |
![[IMG]](/icons/image2.gif) | 1704908196Bev and An..> | 2024-01-10 17:36 | 2.8M | |
![[IMG]](/icons/image2.gif) | 1704987575Eden Logo.png | 2024-01-11 15:39 | 81K | |
![[IMG]](/icons/image2.gif) | 1704996975FB_IMG_170..> | 2024-01-11 18:16 | 712K | |
![[IMG]](/icons/image2.gif) | 1705017502hawgheaven..> | 2024-01-11 23:58 | 168K | |
![[IMG]](/icons/image2.gif) | 1705068960Unity Acre..> | 2024-01-12 14:16 | 34K | |
![[IMG]](/icons/image2.gif) | 1705163068Nature's T..> | 2024-01-13 16:24 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1705340751Bowmans Fo..> | 2024-01-15 17:45 | 181K | |
![[IMG]](/icons/image2.gif) | 1705340987cropped Bo..> | 2024-01-15 17:49 | 456K | |
![[IMG]](/icons/image2.gif) | 1705593887Sunflower2..> | 2024-01-18 16:04 | 151K | |
![[IMG]](/icons/image2.gif) | 1705593956PeaImage2.png | 2024-01-18 16:05 | 80K | |
![[IMG]](/icons/image2.gif) | 1705689756The Perrys..> | 2024-01-19 18:42 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1705714873Rivers Rid..> | 2024-01-20 01:41 | 252K | |
![[IMG]](/icons/image2.gif) | 1705776056MW main im..> | 2024-01-20 18:40 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1705776098IMG_2678.jpeg | 2024-01-20 18:41 | 2.1M | |
![[IMG]](/icons/image2.gif) | 1705776628Asset 1@3x..> | 2024-01-20 18:50 | 8.4K | |
![[IMG]](/icons/image2.gif) | 1705866831IMG_0618.jpeg | 2024-01-21 19:53 | 560K | |
![[IMG]](/icons/image2.gif) | 1705881440Instagram ..> | 2024-01-21 23:57 | 53K | |
![[IMG]](/icons/image2.gif) | 1705991351IMG_3108.jpeg | 2024-01-23 06:29 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1706130831HAPPYPIGLO..> | 2024-01-24 21:13 | 74K | |
![[IMG]](/icons/image2.gif) | 1706130993HAPPYPIGLO..> | 2024-01-24 21:16 | 239K | |
![[IMG]](/icons/image2.gif) | 1706131038Happypiglo..> | 2024-01-24 21:17 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1706187688iOS-Icon.png | 2024-01-25 13:01 | 283K | |
![[IMG]](/icons/image2.gif) | 1706196905pic4.jpg | 2024-01-25 15:35 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1706314811Final Doug..> | 2024-01-27 00:20 | 209K | |
![[IMG]](/icons/image2.gif) | 1706426308Screenshot..> | 2024-01-28 07:18 | 430K | |
![[IMG]](/icons/image2.gif) | 1706504257IMG_202401..> | 2024-01-29 04:57 | 3.0M | |
![[IMG]](/icons/image2.gif) | 1706555156logonew2.png | 2024-01-29 19:05 | 37K | |
![[IMG]](/icons/image2.gif) | 1706672191IMG_6671.jpeg | 2024-01-31 03:36 | 723K | |
![[IMG]](/icons/image2.gif) | 1706672338IMG_6671.jpeg | 2024-01-31 03:38 | 723K | |
![[IMG]](/icons/image2.gif) | 1706723824Screenshot..> | 2024-01-31 17:57 | 258K | |
![[IMG]](/icons/image2.gif) | 1706726036Chick PIc ..> | 2024-01-31 18:33 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1706741216schwede fa..> | 2024-01-31 22:46 | 887K | |
![[IMG]](/icons/image2.gif) | 1706800768Linkland-c..> | 2024-02-01 15:19 | 139K | |
![[IMG]](/icons/image2.gif) | 1706802670ferraros.jpg | 2024-02-01 15:51 | 83K | |
![[IMG]](/icons/image2.gif) | 1706824000PhotoRoom_..> | 2024-02-01 21:46 | 625K | |
![[IMG]](/icons/image2.gif) | 1706948418C6FF6C8C-5..> | 2024-02-03 08:20 | 708K | |
![[IMG]](/icons/image2.gif) | 1706996102JERI9140.jpg | 2024-02-03 21:35 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1707080272imagejpeg_..> | 2024-02-04 20:57 | 968K | |
![[IMG]](/icons/image2.gif) | 1707163553TheScoop_L..> | 2024-02-05 20:05 | 62K | |
![[IMG]](/icons/image2.gif) | 1707176662FFF logo.png | 2024-02-05 23:44 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1707263018FBD.png | 2024-02-06 23:43 | 151K | |
![[IMG]](/icons/image2.gif) | 1707304057IMG_5698.jpg | 2024-02-07 11:07 | 369K | |
![[IMG]](/icons/image2.gif) | 1707366392Picture.PNG | 2024-02-08 04:26 | 550K | |
![[IMG]](/icons/image2.gif) | 1707370791beeflogocf..> | 2024-02-08 05:39 | 60K | |
![[IMG]](/icons/image2.gif) | 1707442129regenerati..> | 2024-02-09 01:28 | 2.4M | |
![[IMG]](/icons/image2.gif) | 1707447896D6443B80-8..> | 2024-02-09 03:04 | 438K | |
![[IMG]](/icons/image2.gif) | 1707462930Happypiglo..> | 2024-02-09 07:15 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1707509785SC logo.jpg | 2024-02-09 20:16 | 418K | |
![[IMG]](/icons/image2.gif) | 1707585094Your parag..> | 2024-02-10 17:11 | 88K | |
![[IMG]](/icons/image2.gif) | 1707756523triplets.jpg | 2024-02-12 16:48 | 2.5M | |
![[IMG]](/icons/image2.gif) | 1707776229SVF email ..> | 2024-02-12 22:17 | 83K | |
![[IMG]](/icons/image2.gif) | 1707779192RHFC.jpg | 2024-02-12 23:06 | 74K | |
![[IMG]](/icons/image2.gif) | 1707863287lomonaco_s..> | 2024-02-13 22:28 | 2.9M | |
![[IMG]](/icons/image2.gif) | 1707863427lomonaco_l..> | 2024-02-13 22:30 | 2.1M | |
![[IMG]](/icons/image2.gif) | 1707867730cropped-BB..> | 2024-02-13 23:42 | 20K | |
![[IMG]](/icons/image2.gif) | 1707955083IMG_1148.jpeg | 2024-02-14 23:58 | 967K | |
![[IMG]](/icons/image2.gif) | 1708054270Facebook.png | 2024-02-16 03:31 | 153K | |
![[IMG]](/icons/image2.gif) | 1708211765A3A6915D-D..> | 2024-02-17 23:16 | 4.0M | |
![[IMG]](/icons/image2.gif) | 1708377913greatness.png | 2024-02-19 21:25 | 275K | |
![[IMG]](/icons/image2.gif) | 1708379096kuertnet.jpg | 2024-02-19 21:44 | 391K | |
![[IMG]](/icons/image2.gif) | 1708379710Wholesale ..> | 2024-02-19 21:55 | 239K | |
![[IMG]](/icons/image2.gif) | 1708477018Small Batc..> | 2024-02-21 00:56 | 40K | |
![[IMG]](/icons/image2.gif) | 1708548260main page ..> | 2024-02-21 20:44 | 2.6M | |
![[IMG]](/icons/image2.gif) | 1708607561meg logo~2..> | 2024-02-22 13:12 | 79K | |
![[IMG]](/icons/image2.gif) | 1708624613logo .png | 2024-02-22 17:56 | 330K | |
![[IMG]](/icons/image2.gif) | 1708624710logo lower..> | 2024-02-22 17:58 | 332K | |
![[IMG]](/icons/image2.gif) | 1708723922SpartaMush..> | 2024-02-23 21:32 | 72K | |
![[IMG]](/icons/image2.gif) | 1708863828Capricorn ..> | 2024-02-25 12:23 | 227K | |
![[IMG]](/icons/image2.gif) | 1708891026NalasFamil..> | 2024-02-25 19:57 | 40K | |
![[IMG]](/icons/image2.gif) | 1708903925R&A baking..> | 2024-02-25 23:32 | 85K | |
![[IMG]](/icons/image2.gif) | 1708981654KUDA_MilkH..> | 2024-02-26 21:07 | 37K | |
![[IMG]](/icons/image2.gif) | 1709037318ecr.jpg | 2024-02-27 12:35 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1709040836Wholesale ..> | 2024-02-27 13:33 | 375K | |
![[IMG]](/icons/image2.gif) | 1709075757Oak Hazel ..> | 2024-02-27 23:15 | 29K | |
![[IMG]](/icons/image2.gif) | 1709133902hoodzpah-n..> | 2024-02-28 15:25 | 3.3M | |
![[IMG]](/icons/image2.gif) | 1709153691berkshire ..> | 2024-02-28 20:54 | 206K | |
![[IMG]](/icons/image2.gif) | 1709225018market3.JPG | 2024-02-29 16:43 | 734K | |
![[IMG]](/icons/image2.gif) | 1709225583SmallSquar..> | 2024-02-29 16:53 | 37K | |
![[IMG]](/icons/image2.gif) | 1709226717clark yall..> | 2024-02-29 17:11 | 81K | |
![[IMG]](/icons/image2.gif) | 1709242401Photoroom-..> | 2024-02-29 21:33 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1709397972Daily Logo..> | 2024-03-02 16:46 | 128K | |
![[IMG]](/icons/image2.gif) | 1709521207GRF LOGO.png | 2024-03-04 03:00 | 17K | |
![[IMG]](/icons/image2.gif) | 1709582309Sparta A.jpg | 2024-03-04 19:58 | 513K | |
![[IMG]](/icons/image2.gif) | 1709692009GLG Vector..> | 2024-03-06 02:26 | 404K | |
![[IMG]](/icons/image2.gif) | 1709747158MistyMorni..> | 2024-03-06 17:45 | 300K | |
![[IMG]](/icons/image2.gif) | 1709862094IMG_6223.jpeg | 2024-03-08 01:41 | 511K | |
![[IMG]](/icons/image2.gif) | 1709919397SFParent L..> | 2024-03-08 17:36 | 696K | |
![[IMG]](/icons/image2.gif) | 1709920160Cookies.jpg | 2024-03-08 17:49 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1710026296Mountain M..> | 2024-03-09 23:18 | 797K | |
![[IMG]](/icons/image2.gif) | 1710203712Untitled d..> | 2024-03-12 00:35 | 49K | |
![[IMG]](/icons/image2.gif) | 1710347840Photoroom-..> | 2024-03-13 16:37 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1710375729Hub+logo+c..> | 2024-03-14 00:22 | 169K | |
![[IMG]](/icons/image2.gif) | 1710441508Turchettis..> | 2024-03-14 18:38 | 111K | |
![[IMG]](/icons/image2.gif) | 1710774915logo_white..> | 2024-03-18 15:15 | 202K | |
![[IMG]](/icons/image2.gif) | 1710783800Reclaim Ra..> | 2024-03-18 17:43 | 135K | |
![[IMG]](/icons/image2.gif) | 1710783824Reclaim Ra..> | 2024-03-18 17:43 | 156K | |
![[IMG]](/icons/image2.gif) | 1710948149sum love s..> | 2024-03-20 15:22 | 204K | |
![[IMG]](/icons/image2.gif) | 1710964992Logo.jpg | 2024-03-20 20:03 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1711049719IMG_202403..> | 2024-03-21 19:35 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1711052183Rasberry M..> | 2024-03-21 20:16 | 95K | |
![[IMG]](/icons/image2.gif) | 1711139471Wholesale ..> | 2024-03-22 20:31 | 190K | |
![[IMG]](/icons/image2.gif) | 1711238860IMG_202301..> | 2024-03-24 00:07 | 143K | |
![[IMG]](/icons/image2.gif) | 1711378325SASA Samo..> | 2024-03-25 14:52 | 2.7M | |
![[IMG]](/icons/image2.gif) | 1711473886MainLogo_F..> | 2024-03-26 17:24 | 351K | |
![[IMG]](/icons/image2.gif) | 1711639844new logo.png | 2024-03-28 15:30 | 124K | |
![[IMG]](/icons/image2.gif) | 1711746015IMG_0409.jpg | 2024-03-29 21:00 | 145K | |
![[IMG]](/icons/image2.gif) | 1712076300sticker_bi..> | 2024-04-02 16:45 | 557K | |
![[IMG]](/icons/image2.gif) | 1712102022lm logo ne..> | 2024-04-02 23:53 | 69K | |
![[IMG]](/icons/image2.gif) | 1712250920TMJ Logo.jpeg | 2024-04-04 17:15 | 281K | |
![[IMG]](/icons/image2.gif) | 1712252177Screenshot..> | 2024-04-04 17:36 | 568K | |
![[IMG]](/icons/image2.gif) | 1712348594Screenshot..> | 2024-04-05 20:23 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1712357930ZOOM_heads..> | 2024-04-05 22:58 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1712379515Untitled.png | 2024-04-06 04:58 | 82K | |
![[IMG]](/icons/image2.gif) | 1712379523Untitled.png | 2024-04-06 04:58 | 82K | |
![[IMG]](/icons/image2.gif) | 1712379628freeze dri..> | 2024-04-06 05:00 | 198K | |
![[IMG]](/icons/image2.gif) | 1712379632freeze dri..> | 2024-04-06 05:00 | 198K | |
![[IMG]](/icons/image2.gif) | 1712520881breakfast_..> | 2024-04-07 20:14 | 3.7M | |
![[IMG]](/icons/image2.gif) | 1712524475Rosecreek ..> | 2024-04-07 21:14 | 22K | |
![[IMG]](/icons/image2.gif) | 1712772554sharecuter..> | 2024-04-10 18:09 | 2.3M | |
![[IMG]](/icons/image2.gif) | 1712855195tacooso.jpeg | 2024-04-11 17:06 | 137K | |
![[IMG]](/icons/image2.gif) | 1712855317taco oso p..> | 2024-04-11 17:08 | 22K | |
![[IMG]](/icons/image2.gif) | 1712855429taco oso f..> | 2024-04-11 17:10 | 20K | |
![[IMG]](/icons/image2.gif) | 1712866050Wholesale ..> | 2024-04-11 20:07 | 135K | |
![[IMG]](/icons/image2.gif) | 1712867915Watsonia l..> | 2024-04-11 20:38 | 14K | |
![[IMG]](/icons/image2.gif) | 1712885243takek logo..> | 2024-04-12 01:27 | 249K | |
![[IMG]](/icons/image2.gif) | 1713368581melon acre..> | 2024-04-17 15:43 | 49K | |
![[IMG]](/icons/image2.gif) | 1713399291Oak Hazel ..> | 2024-04-18 00:14 | 78K | |
![[IMG]](/icons/image2.gif) | 1713399301Oak Hazel ..> | 2024-04-18 00:15 | 78K | |
![[IMG]](/icons/image2.gif) | 1713549587logo_icon.png | 2024-04-19 17:59 | 8.9K | |
![[IMG]](/icons/image2.gif) | 1713566001Vindicator..> | 2024-04-19 22:33 | 211K | |
![[IMG]](/icons/image2.gif) | 1713566014Vindicator..> | 2024-04-19 22:33 | 211K | |
![[IMG]](/icons/image2.gif) | 1713984672NASTURTIUM..> | 2024-04-24 18:51 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1713984786logo.jpg | 2024-04-24 18:53 | 376K | |
![[IMG]](/icons/image2.gif) | 1714065733PANR4860.JPEG | 2024-04-25 17:22 | 207K | |
![[IMG]](/icons/image2.gif) | 1714067838Sugar Cook..> | 2024-04-25 17:57 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1714069996emailsig2.gif | 2024-04-25 18:33 | 18K | |
![[IMG]](/icons/image2.gif) | 1714085187IMG_5483.png | 2024-04-25 22:46 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1714423692Logo.jpg | 2024-04-29 20:48 | 94K | |
![[IMG]](/icons/image2.gif) | 1714532995Untitled d..> | 2024-05-01 03:09 | 747K | |
![[IMG]](/icons/image2.gif) | 1714581046IMG_1898.PNG | 2024-05-01 16:30 | 266K | |
![[IMG]](/icons/image2.gif) | 1714595903morrow.jpeg | 2024-05-01 20:38 | 573K | |
![[IMG]](/icons/image2.gif) | 1714874055IMG_5037.jpeg | 2024-05-05 01:54 | 3.0M | |
![[IMG]](/icons/image2.gif) | 1714924264IMG_8019.png | 2024-05-05 15:51 | 71K | |
![[IMG]](/icons/image2.gif) | 1715040718IMG_1898.PNG | 2024-05-07 00:11 | 266K | |
![[IMG]](/icons/image2.gif) | 1715042793pep pic.jpg | 2024-05-07 00:46 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1715209780Callahan f..> | 2024-05-08 23:09 | 294K | |
![[IMG]](/icons/image2.gif) | 1715347956Fields of ..> | 2024-05-10 13:32 | 9.8K | |
![[IMG]](/icons/image2.gif) | 1715361601logo.jpg | 2024-05-10 17:20 | 88K | |
![[IMG]](/icons/image2.gif) | 1715486881IMG_3915.jpeg | 2024-05-12 04:08 | 539K | |
![[IMG]](/icons/image2.gif) | 1715702680van an.jpeg | 2024-05-14 16:04 | 225K | |
![[IMG]](/icons/image2.gif) | 1715968156taylor far..> | 2024-05-17 17:49 | 226K | |
![[IMG]](/icons/image2.gif) | 1716149700IMG_8914.jpeg | 2024-05-19 20:15 | 3.3M | |
![[IMG]](/icons/image2.gif) | 1716149952IMG_1947.jpeg | 2024-05-19 20:19 | 3.2M | |
![[IMG]](/icons/image2.gif) | 1716321635IMG_0324.png | 2024-05-21 20:00 | 165K | |
![[IMG]](/icons/image2.gif) | 1716392965Wholesale ..> | 2024-05-22 15:49 | 255K | |
![[IMG]](/icons/image2.gif) | 1716667999Shire_Farm..> | 2024-05-25 20:13 | 154K | |
![[IMG]](/icons/image2.gif) | 1716677062Beige Mini..> | 2024-05-25 22:44 | 305K | |
![[IMG]](/icons/image2.gif) | 1716677850Beige Mini..> | 2024-05-25 22:57 | 455K | |
![[IMG]](/icons/image2.gif) | 1716677928Beige Mini..> | 2024-05-25 22:58 | 405K | |
![[IMG]](/icons/image2.gif) | 1716677981Beige Mini..> | 2024-05-25 22:59 | 353K | |
![[IMG]](/icons/image2.gif) | 1716822227Shady Broo..> | 2024-05-27 15:03 | 259K | |
![[IMG]](/icons/image2.gif) | 1716823293Shady Broo..> | 2024-05-27 15:21 | 327K | |
![[IMG]](/icons/image2.gif) | 1716947812Logo LUH (..> | 2024-05-29 01:56 | 75K | |
![[IMG]](/icons/image2.gif) | 1717104065eSrP8bdJ_4..> | 2024-05-30 21:21 | 23K | |
![[IMG]](/icons/image2.gif) | 1717159673edp.jpg | 2024-05-31 12:47 | 2.4M | |
![[IMG]](/icons/image2.gif) | 1717520959janoskis l..> | 2024-06-04 17:09 | 12K | |
![[IMG]](/icons/image2.gif) | 1717616697Ptashka_lo..> | 2024-06-05 19:44 | 79K | |
![[IMG]](/icons/image2.gif) | 1717620250Untitled-1..> | 2024-06-05 20:44 | 89K | |
![[IMG]](/icons/image2.gif) | 1717620360Capture.PNG | 2024-06-05 20:46 | 100K | |
![[IMG]](/icons/image2.gif) | 1717692215Heritage H..> | 2024-06-06 16:43 | 14K | |
![[IMG]](/icons/image2.gif) | 1718118684Logo.png | 2024-06-11 15:11 | 308K | |
![[IMG]](/icons/image2.gif) | 1718121365Blackberry..> | 2024-06-11 15:56 | 54K | |
![[IMG]](/icons/image2.gif) | 1718204564Screenshot..> | 2024-06-12 15:02 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1718286275jpeg r and..> | 2024-06-13 13:44 | 91K | |
![[IMG]](/icons/image2.gif) | 1718299740invoice lo..> | 2024-06-13 17:29 | 70K | |
![[IMG]](/icons/image2.gif) | 1718677747IMG_3927.png | 2024-06-18 02:29 | 670K | |
![[IMG]](/icons/image2.gif) | 1718677748IMG_3927.png | 2024-06-18 02:29 | 670K | |
![[IMG]](/icons/image2.gif) | 1718985230download.jpg | 2024-06-21 15:53 | 124K | |
![[IMG]](/icons/image2.gif) | 1719167079Screenshot..> | 2024-06-23 18:24 | 109K | |
![[IMG]](/icons/image2.gif) | 1719167129Screenshot..> | 2024-06-23 18:25 | 170K | |
![[IMG]](/icons/image2.gif) | 1719167140Screenshot..> | 2024-06-23 18:25 | 170K | |
![[IMG]](/icons/image2.gif) | 1719167247Screenshot..> | 2024-06-23 18:27 | 105K | |
![[IMG]](/icons/image2.gif) | 1719167259Screenshot..> | 2024-06-23 18:27 | 105K | |
![[IMG]](/icons/image2.gif) | 1719167352Screenshot..> | 2024-06-23 18:29 | 106K | |
![[IMG]](/icons/image2.gif) | 1719167357Screenshot..> | 2024-06-23 18:29 | 106K | |
![[IMG]](/icons/image2.gif) | 1719167595Screenshot..> | 2024-06-23 18:33 | 208K | |
![[IMG]](/icons/image2.gif) | 1719167605Screenshot..> | 2024-06-23 18:33 | 208K | |
![[IMG]](/icons/image2.gif) | 1719168934Screenshot..> | 2024-06-23 18:55 | 109K | |
![[IMG]](/icons/image2.gif) | 1719168941Screenshot..> | 2024-06-23 18:55 | 109K | |
![[IMG]](/icons/image2.gif) | 1719168966Screenshot..> | 2024-06-23 18:56 | 106K | |
![[IMG]](/icons/image2.gif) | 1719168969Screenshot..> | 2024-06-23 18:56 | 106K | |
![[IMG]](/icons/image2.gif) | 1719237898Logo_JPG.jpg | 2024-06-24 14:04 | 308K | |
![[IMG]](/icons/image2.gif) | 1719246426Jawos_Bros..> | 2024-06-24 16:27 | 358K | |
![[IMG]](/icons/image2.gif) | 1719252590logo 1_cro..> | 2024-06-24 18:09 | 277K | |
![[IMG]](/icons/image2.gif) | 1719513528sahms-hosp..> | 2024-06-27 18:38 | 25K | |
![[IMG]](/icons/image2.gif) | 1719605352basil & bl..> | 2024-06-28 20:09 | 211K | |
![[IMG]](/icons/image2.gif) | 1719619834Screenshot..> | 2024-06-29 00:10 | 376K | |
![[IMG]](/icons/image2.gif) | 1719619860Screenshot..> | 2024-06-29 00:11 | 376K | |
![[IMG]](/icons/image2.gif) | 1719620704Handbreadt..> | 2024-06-29 00:25 | 82K | |
![[IMG]](/icons/image2.gif) | 1719852020IMG_0392.png | 2024-07-01 16:40 | 173K | |
![[IMG]](/icons/image2.gif) | 1719950790Wholesale ..> | 2024-07-02 20:06 | 309K | |
![[IMG]](/icons/image2.gif) | 1719951710Greathouse..> | 2024-07-02 20:21 | 166K | |
![[IMG]](/icons/image2.gif) | 1719951907Greathouse..> | 2024-07-02 20:25 | 199K | |
![[IMG]](/icons/image2.gif) | 1720138706Untitled d..> | 2024-07-05 00:18 | 67K | |
![[IMG]](/icons/image2.gif) | 1720315503Hawesome F..> | 2024-07-07 01:25 | 258K | |
![[IMG]](/icons/image2.gif) | 1720442315profile pi..> | 2024-07-08 12:38 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1720527659fat beans ..> | 2024-07-09 12:20 | 22K | |
![[IMG]](/icons/image2.gif) | 1720527710fat beans ..> | 2024-07-09 12:21 | 18K | |
![[IMG]](/icons/image2.gif) | 1720544238Store_Logo..> | 2024-07-09 16:57 | 454K | |
![[IMG]](/icons/image2.gif) | 1720651501Round Blac..> | 2024-07-10 22:45 | 62K | |
![[IMG]](/icons/image2.gif) | 1720736326IMG_1815.jpeg | 2024-07-11 22:18 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1720736358IMG_1815.jpeg | 2024-07-11 22:19 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1720987205IMG_3010.jpg | 2024-07-14 20:00 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1720989961Beige Aest..> | 2024-07-14 20:46 | 240K | |
![[IMG]](/icons/image2.gif) | 1721066593give thank..> | 2024-07-15 18:03 | 60K | |
![[IMG]](/icons/image2.gif) | 1721068538LOW-RES-La..> | 2024-07-15 18:35 | 3.0M | |
![[IMG]](/icons/image2.gif) | 1721069152GreenThing..> | 2024-07-15 18:45 | 590K | |
![[IMG]](/icons/image2.gif) | 1721070057K & J hold..> | 2024-07-15 19:00 | 2.4M | |
![[IMG]](/icons/image2.gif) | 1721074707give thank..> | 2024-07-15 20:18 | 155K | |
![[IMG]](/icons/image2.gif) | 1721221106harmony cr..> | 2024-07-17 12:58 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1721423109IMG-1624.jpg | 2024-07-19 21:05 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1721664827Untitled p..> | 2024-07-22 16:13 | 64K | |
![[IMG]](/icons/image2.gif) | 1721664886Screenshot..> | 2024-07-22 16:14 | 116K | |
![[IMG]](/icons/image2.gif) | 1721665005Screenshot..> | 2024-07-22 16:16 | 124K | |
![[IMG]](/icons/image2.gif) | 1721685449IMG_0122.JPG | 2024-07-22 21:57 | 2.1M | |
![[IMG]](/icons/image2.gif) | 1721687304Simple Roo..> | 2024-07-22 22:28 | 38K | |
![[IMG]](/icons/image2.gif) | 1721746453bauman log..> | 2024-07-23 14:54 | 31K | |
![[IMG]](/icons/image2.gif) | 1721835357IMG_7507.jpg | 2024-07-24 15:35 | 427K | |
![[IMG]](/icons/image2.gif) | 1721842276flexx 2.png | 2024-07-24 17:31 | 9.5K | |
![[IMG]](/icons/image2.gif) | 1721930481Gray and B..> | 2024-07-25 18:01 | 21K | |
![[IMG]](/icons/image2.gif) | 1722568229TheBlissfu..> | 2024-08-02 03:10 | 77K | |
![[IMG]](/icons/image2.gif) | 1722945028Barlow's P..> | 2024-08-06 11:50 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1723396363Good Grief..> | 2024-08-11 17:12 | 273K | |
![[IMG]](/icons/image2.gif) | 1723563503Reece Orch..> | 2024-08-13 15:38 | 16K | |
![[IMG]](/icons/image2.gif) | 1723563585Reece Orch..> | 2024-08-13 15:39 | 17K | |
![[IMG]](/icons/image2.gif) | 1723573607Screen Sho..> | 2024-08-13 18:26 | 22K | |
![[IMG]](/icons/image2.gif) | 1723575886Logo White..> | 2024-08-13 19:04 | 340K | |
![[IMG]](/icons/image2.gif) | 1723576838BreakfastC..> | 2024-08-13 19:20 | 39K | |
![[IMG]](/icons/image2.gif) | 1723604151Untitled d..> | 2024-08-14 02:55 | 226K | |
![[IMG]](/icons/image2.gif) | 1723642667IMG_9732.jpeg | 2024-08-14 13:37 | 179K | |
![[IMG]](/icons/image2.gif) | 1723678872IMG_0681.png | 2024-08-14 23:41 | 829K | |
![[IMG]](/icons/image2.gif) | 1723678977IMG_0324.png | 2024-08-14 23:42 | 165K | |
![[IMG]](/icons/image2.gif) | 1723724405IMG_2186.jpg | 2024-08-15 12:20 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1723751311IMG_0734.jpeg | 2024-08-15 19:48 | 210K | |
![[IMG]](/icons/image2.gif) | 1723754631IMG_0734.jpeg | 2024-08-15 20:43 | 81K | |
![[IMG]](/icons/image2.gif) | 1723826693selfie.jpg | 2024-08-16 16:44 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1723837411TWS Logo.png | 2024-08-16 19:43 | 50K | |
![[IMG]](/icons/image2.gif) | 1723998654DSC_0477NA..> | 2024-08-18 16:30 | 824K | |
![[IMG]](/icons/image2.gif) | 1724000519IMG_5042.png | 2024-08-18 17:01 | 204K | |
![[IMG]](/icons/image2.gif) | 1724122387BraveEssen..> | 2024-08-20 02:53 | 235K | |
![[IMG]](/icons/image2.gif) | 1724170063IMG_1997.jpeg | 2024-08-20 16:07 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1724329109FaltersOhi..> | 2024-08-22 12:18 | 90K | |
![[IMG]](/icons/image2.gif) | 1724350651elcub.png | 2024-08-22 18:17 | 16K | |
![[IMG]](/icons/image2.gif) | 1724351212logo agua ..> | 2024-08-22 18:26 | 871K | |
![[IMG]](/icons/image2.gif) | 1724378618LOGO CROPP..> | 2024-08-23 02:03 | 426K | |
![[IMG]](/icons/image2.gif) | 1724378627LOGO CROPP..> | 2024-08-23 02:03 | 426K | |
![[IMG]](/icons/image2.gif) | 1724427306IMG_1124.jpeg | 2024-08-23 15:35 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1724427501IMG_1123.jpeg | 2024-08-23 15:38 | 2.3M | |
![[IMG]](/icons/image2.gif) | 1724437290OTK_lockup..> | 2024-08-23 18:21 | 389K | |
![[IMG]](/icons/image2.gif) | 1724594652Screenshot..> | 2024-08-25 14:04 | 157K | |
![[IMG]](/icons/image2.gif) | 1724606371Logo_reduc..> | 2024-08-25 17:19 | 448K | |
![[IMG]](/icons/image2.gif) | 1724693495cookiejarl..> | 2024-08-26 17:31 | 47K | |
![[IMG]](/icons/image2.gif) | 1724765652IMG_202310..> | 2024-08-27 13:34 | 246K | |
![[IMG]](/icons/image2.gif) | 1724867755Turtle Cre..> | 2024-08-28 17:55 | 548K | |
![[IMG]](/icons/image2.gif) | 1724872551P&H Logo.png | 2024-08-28 19:15 | 18K | |
![[IMG]](/icons/image2.gif) | 1724878834P&H Logo.png | 2024-08-28 21:00 | 18K | |
![[IMG]](/icons/image2.gif) | 1724886658jenandrew.jpg | 2024-08-28 23:10 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1724946624ic_ELC_400..> | 2024-08-29 15:50 | 56K | |
![[IMG]](/icons/image2.gif) | 1725048232 BeyLo's20..> | 2024-08-30 20:03 | 66K | |
![[IMG]](/icons/image2.gif) | 1725278602Untitled2.png | 2024-09-02 12:03 | 334K | |
![[IMG]](/icons/image2.gif) | 1725476077Social Med..> | 2024-09-04 18:54 | 351K | |
![[IMG]](/icons/image2.gif) | 1725535730Plymouth O..> | 2024-09-05 11:28 | 238K | |
![[IMG]](/icons/image2.gif) | 1725544082Screenshot..> | 2024-09-05 13:48 | 247K | |
![[IMG]](/icons/image2.gif) | 1725559988Etsy profi..> | 2024-09-05 18:13 | 149K | |
![[IMG]](/icons/image2.gif) | 1725628351OG Sassy L..> | 2024-09-06 13:12 | 2.9M | |
![[IMG]](/icons/image2.gif) | 1725646285병셋.JPG | 2024-09-06 18:11 | 2.1M | |
![[IMG]](/icons/image2.gif) | 1725662384Color Corr..> | 2024-09-06 22:39 | 132K | |
![[IMG]](/icons/image2.gif) | 1725662416Color Corr..> | 2024-09-06 22:40 | 247K | |
![[IMG]](/icons/image2.gif) | 1725737995Sourdough ..> | 2024-09-07 19:39 | 139K | |
![[IMG]](/icons/image2.gif) | 1725848582Logo 1.-JP..> | 2024-09-09 02:23 | 158K | |
![[IMG]](/icons/image2.gif) | 1725898787Nashville_..> | 2024-09-09 16:19 | 248K | |
![[IMG]](/icons/image2.gif) | 1725900042donel phot..> | 2024-09-09 16:40 | 232K | |
![[IMG]](/icons/image2.gif) | 1726496854Little Bun..> | 2024-09-16 14:27 | 253K | |
![[IMG]](/icons/image2.gif) | 1726496934Logo XL.png | 2024-09-16 14:28 | 167K | |
![[IMG]](/icons/image2.gif) | 1726669407pureBaklav..> | 2024-09-18 14:23 | 2.5M | |
![[IMG]](/icons/image2.gif) | 1726767220hi (1).png | 2024-09-19 17:33 | 94K | |
![[IMG]](/icons/image2.gif) | 1727126799ForeverAlw..> | 2024-09-23 21:26 | 213K | |
![[IMG]](/icons/image2.gif) | 1727132225Orange cut..> | 2024-09-23 22:57 | 330K | |
![[IMG]](/icons/image2.gif) | 1727186285Harrison F..> | 2024-09-24 13:58 | 616K | |
![[IMG]](/icons/image2.gif) | 1727186807Screenshot..> | 2024-09-24 14:06 | 35K | |
![[IMG]](/icons/image2.gif) | 1727273219Harrison F..> | 2024-09-25 14:06 | 395K | |
![[IMG]](/icons/image2.gif) | 1727282355Untitled d..> | 2024-09-25 16:39 | 226K | |
![[IMG]](/icons/image2.gif) | 1727394248ForeverAlw..> | 2024-09-26 23:44 | 456K | |
![[IMG]](/icons/image2.gif) | 1727394253ForeverAlw..> | 2024-09-26 23:44 | 456K | |
![[IMG]](/icons/image2.gif) | 1727394378ForeverAlw..> | 2024-09-26 23:46 | 456K | |
![[IMG]](/icons/image2.gif) | 1727394383ForeverAlw..> | 2024-09-26 23:46 | 456K | |
![[IMG]](/icons/image2.gif) | 1727635761IIXB9749.jpeg | 2024-09-29 18:49 | 218K | |
![[IMG]](/icons/image2.gif) | 1727662580Untitled (..> | 2024-09-30 02:16 | 312K | |
![[IMG]](/icons/image2.gif) | 1727749053IMG_8622.jpeg | 2024-10-01 02:17 | 2.4M | |
![[IMG]](/icons/image2.gif) | 1727874778Chocolate ..> | 2024-10-02 13:12 | 287K | |
![[IMG]](/icons/image2.gif) | 1728067360Square Log..> | 2024-10-04 18:42 | 180K | |
![[IMG]](/icons/image2.gif) | 1728264533Planted Po..> | 2024-10-07 01:28 | 3.1M | |
![[IMG]](/icons/image2.gif) | 1728312104mw_logo.png | 2024-10-07 14:41 | 85K | |
![[IMG]](/icons/image2.gif) | 1728388162unnamed.jpg | 2024-10-08 11:49 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1728388172unnamed.jpg | 2024-10-08 11:49 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1728399939IMG_202410..> | 2024-10-08 15:05 | 3.0M | |
![[IMG]](/icons/image2.gif) | 1728700385IMG_1449.jpeg | 2024-10-12 02:33 | 894K | |
![[IMG]](/icons/image2.gif) | 1728703263Final Logo..> | 2024-10-12 03:21 | 132K | |
![[IMG]](/icons/image2.gif) | 1728848497homestead ..> | 2024-10-13 19:41 | 171K | |
![[IMG]](/icons/image2.gif) | 1728848707homestead ..> | 2024-10-13 19:45 | 171K | |
![[IMG]](/icons/image2.gif) | 1728920729C3_png_cro..> | 2024-10-14 15:45 | 19K | |
![[IMG]](/icons/image2.gif) | 1728934068logo.png | 2024-10-14 19:27 | 29K | |
![[IMG]](/icons/image2.gif) | 1728934125Logo Agua ..> | 2024-10-14 19:28 | 325K | |
![[IMG]](/icons/image2.gif) | 1728934233AguaBlanca..> | 2024-10-14 19:30 | 398K | |
![[IMG]](/icons/image2.gif) | 1728936112signroad.jpg | 2024-10-14 20:01 | 739K | |
![[IMG]](/icons/image2.gif) | 1728951472website_lo..> | 2024-10-15 00:17 | 134K | |
![[IMG]](/icons/image2.gif) | 1728951560FullLogo.jpg | 2024-10-15 00:19 | 118K | |
![[IMG]](/icons/image2.gif) | 1729004754LoveThy-Lo..> | 2024-10-15 15:05 | 277K | |
![[IMG]](/icons/image2.gif) | 1729094702Final Artw..> | 2024-10-16 16:05 | 201K | |
![[IMG]](/icons/image2.gif) | 1729140163CBF Logo.png | 2024-10-17 04:42 | 225K | |
![[IMG]](/icons/image2.gif) | 1729267947Bmore Poul..> | 2024-10-18 16:12 | 32K | |
![[IMG]](/icons/image2.gif) | 1729448609IMG_2454.jpeg | 2024-10-20 18:23 | 2.1M | |
![[IMG]](/icons/image2.gif) | 1729458468Rustic Flo..> | 2024-10-20 21:07 | 242K | |
![[IMG]](/icons/image2.gif) | 1729536470image_1236..> | 2024-10-21 18:47 | 679K | |
![[IMG]](/icons/image2.gif) | 1729545201Rusticrout..> | 2024-10-21 21:13 | 435K | |
![[IMG]](/icons/image2.gif) | 1729545478Rusticrout..> | 2024-10-21 21:17 | 435K | |
![[IMG]](/icons/image2.gif) | 1729547086Business c..> | 2024-10-21 21:44 | 435K | |
![[IMG]](/icons/image2.gif) | 1729547214Copy of Bu..> | 2024-10-21 21:46 | 371K | |
![[IMG]](/icons/image2.gif) | 1729561913colbe-cake..> | 2024-10-22 01:51 | 173K | |
![[IMG]](/icons/image2.gif) | 1729597174Family Map..> | 2024-10-22 11:39 | 544K | |
![[IMG]](/icons/image2.gif) | 1729612395BSLogo.png | 2024-10-22 15:53 | 43K | |
![[IMG]](/icons/image2.gif) | 1729619047NEWSeaSalt..> | 2024-10-22 17:44 | 143K | |
![[IMG]](/icons/image2.gif) | 1729619101NEWSeaSalt..> | 2024-10-22 17:45 | 22K | |
![[IMG]](/icons/image2.gif) | 1729640066Untitled.png | 2024-10-22 23:34 | 329K | |
![[IMG]](/icons/image2.gif) | 1729692226Jenea-29.jpg | 2024-10-23 14:03 | 2.7M | |
![[IMG]](/icons/image2.gif) | 1729693423Final FMR ..> | 2024-10-23 14:23 | 17K | |
![[IMG]](/icons/image2.gif) | 1729697404Original L..> | 2024-10-23 15:30 | 331K | |
![[IMG]](/icons/image2.gif) | 1729739284Creative B..> | 2024-10-24 03:08 | 82K | |
![[IMG]](/icons/image2.gif) | 1729739369Creative B..> | 2024-10-24 03:09 | 82K | |
![[IMG]](/icons/image2.gif) | 1729811724sign.jpg | 2024-10-24 23:15 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1729811908Franklins ..> | 2024-10-24 23:18 | 68K | |
![[IMG]](/icons/image2.gif) | 1729811973Franklins ..> | 2024-10-24 23:19 | 70K | |
![[IMG]](/icons/image2.gif) | 1729889148Two Color ..> | 2024-10-25 20:45 | 170K | |
![[IMG]](/icons/image2.gif) | 1729912979IMG_9045.jpg | 2024-10-26 03:22 | 3.0M | |
![[IMG]](/icons/image2.gif) | 1729957236deac0075-a..> | 2024-10-26 15:40 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1730230557KellyGreen..> | 2024-10-29 19:35 | 167K | |
![[IMG]](/icons/image2.gif) | 1730246579logo.png | 2024-10-30 00:02 | 39K | |
![[IMG]](/icons/image2.gif) | 1730292380Homestead ..> | 2024-10-30 12:46 | 26K | |
![[IMG]](/icons/image2.gif) | 1730309013SahmsHospG..> | 2024-10-30 17:23 | 56K | |
![[IMG]](/icons/image2.gif) | 1730390403LAC site p..> | 2024-10-31 16:00 | 394K | |
![[IMG]](/icons/image2.gif) | 1730395716Bloomsbury..> | 2024-10-31 17:28 | 453K | |
![[IMG]](/icons/image2.gif) | 1730401570sarah3.jpg | 2024-10-31 19:06 | 276K | |
![[IMG]](/icons/image2.gif) | 1730465948Untitled_A..> | 2024-11-01 12:59 | 231K | |
![[IMG]](/icons/image2.gif) | 1730470273SIJANG_LOG..> | 2024-11-01 14:11 | 140K | |
![[IMG]](/icons/image2.gif) | 1730484169SahmsHospG..> | 2024-11-01 18:02 | 420K | |
![[IMG]](/icons/image2.gif) | 1730485547FB_IMG_170..> | 2024-11-01 18:25 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1730495361WCW logo.png | 2024-11-01 21:09 | 22K | |
![[IMG]](/icons/image2.gif) | 1730500934IMG_0093.jpeg | 2024-11-01 22:42 | 147K | |
![[IMG]](/icons/image2.gif) | 1730672851Ross Farm ..> | 2024-11-03 22:27 | 496K | |
![[IMG]](/icons/image2.gif) | 1730673285Ross Farm ..> | 2024-11-03 22:34 | 496K | |
![[IMG]](/icons/image2.gif) | 1730734987CleveLand-..> | 2024-11-04 15:43 | 277K | |
![[IMG]](/icons/image2.gif) | 1730735030CleveLand-..> | 2024-11-04 15:43 | 350K | |
![[IMG]](/icons/image2.gif) | 1730735034CleveLand-..> | 2024-11-04 15:43 | 350K | |
![[IMG]](/icons/image2.gif) | 1730735117CleveLand ..> | 2024-11-04 15:45 | 532K | |
![[IMG]](/icons/image2.gif) | 1730855900IMG_0225.jpeg | 2024-11-06 01:18 | 64K | |
![[IMG]](/icons/image2.gif) | 1730922633The Sour F..> | 2024-11-06 19:50 | 96K | |
![[IMG]](/icons/image2.gif) | 1730933561sticker de..> | 2024-11-06 22:52 | 387K | |
![[IMG]](/icons/image2.gif) | 1730940920Condor Cho..> | 2024-11-07 00:55 | 16K | |
![[IMG]](/icons/image2.gif) | 1731084709IMG_6202.JPG | 2024-11-08 16:51 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1731160584DR Farms.jpeg | 2024-11-09 13:56 | 335K | |
![[IMG]](/icons/image2.gif) | 1731172228bbblogo.png | 2024-11-09 17:10 | 139K | |
![[IMG]](/icons/image2.gif) | 1731325042Naturally ..> | 2024-11-11 11:37 | 112K | |
![[IMG]](/icons/image2.gif) | 1731356985Shade Tree..> | 2024-11-11 20:29 | 314K | |
![[IMG]](/icons/image2.gif) | 1731374372mesta very..> | 2024-11-12 01:19 | 419K | |
![[IMG]](/icons/image2.gif) | 1731378784clifton pr..> | 2024-11-12 02:33 | 160K | |
![[IMG]](/icons/image2.gif) | 1731433570SD.jpg | 2024-11-12 17:46 | 13K | |
![[IMG]](/icons/image2.gif) | 1731530343Copy of Ho..> | 2024-11-13 20:39 | 771K | |
![[IMG]](/icons/image2.gif) | 1731621868Taylor Fam..> | 2024-11-14 22:04 | 27K | |
![[IMG]](/icons/image2.gif) | 1731622408IMG_2870.jpg | 2024-11-14 22:13 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1731694590IMG_0588.jpeg | 2024-11-15 18:16 | 390K | |
![[IMG]](/icons/image2.gif) | 1731787396AS_Simple_..> | 2024-11-16 20:03 | 678K | |
![[IMG]](/icons/image2.gif) | 1731788532Farm House..> | 2024-11-16 20:22 | 900K | |
![[IMG]](/icons/image2.gif) | 1731788601AS_Simple_..> | 2024-11-16 20:23 | 678K | |
![[IMG]](/icons/image2.gif) | 1731987326Copy of Hi..> | 2024-11-19 03:35 | 449K | |
![[IMG]](/icons/image2.gif) | 1732034435MUSHROOMS ..> | 2024-11-19 16:40 | 20K | |
![[IMG]](/icons/image2.gif) | 1732034549Untitled d..> | 2024-11-19 16:42 | 79K | |
![[IMG]](/icons/image2.gif) | 1732034554Untitled d..> | 2024-11-19 16:42 | 79K | |
![[IMG]](/icons/image2.gif) | 1732047703La Soupe L..> | 2024-11-19 20:21 | 166K | |
![[IMG]](/icons/image2.gif) | 1732149145logo.PNG | 2024-11-21 00:32 | 117K | |
![[IMG]](/icons/image2.gif) | 1732244641lawtons-01..> | 2024-11-22 03:04 | 62K | |
![[IMG]](/icons/image2.gif) | 1732577075IMG_2167.jpeg | 2024-11-25 23:24 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1732981582Screenshot..> | 2024-11-30 15:46 | 596K | |
![[IMG]](/icons/image2.gif) | 1733323391Your parag..> | 2024-12-04 14:43 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1733364056logo2024 2..> | 2024-12-05 02:00 | 157K | |
![[IMG]](/icons/image2.gif) | 1733364280IMG_3191 2..> | 2024-12-05 02:04 | 430K | |
![[IMG]](/icons/image2.gif) | 1734010358SDimage.jpg | 2024-12-12 13:32 | 5.3K | |
![[IMG]](/icons/image2.gif) | 1734010434SDimage.jpg | 2024-12-12 13:33 | 5.3K | |
![[IMG]](/icons/image2.gif) | 1734182828farm sign.jpg | 2024-12-14 13:27 | 636K | |
![[IMG]](/icons/image2.gif) | 1734403993salamat.jpg | 2024-12-17 02:53 | 34K | |
![[IMG]](/icons/image2.gif) | 1734531239White Back..> | 2024-12-18 14:13 | 195K | |
![[IMG]](/icons/image2.gif) | 1734971254el_capitan..> | 2024-12-23 16:27 | 82K | |
![[IMG]](/icons/image2.gif) | 1735231165The Love B..> | 2024-12-26 16:39 | 505K | |
![[IMG]](/icons/image2.gif) | 1735403476Screenshot..> | 2024-12-28 16:31 | 451K | |
![[IMG]](/icons/image2.gif) | 1735615577IMG_2023-5..> | 2024-12-31 03:26 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1735867597FullLogo.jpg | 2025-01-03 01:26 | 81K | |
![[IMG]](/icons/image2.gif) | 1735879500Photoroom_..> | 2025-01-03 04:45 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1735957238JBH ( Blac..> | 2025-01-04 02:20 | 33K | |
![[IMG]](/icons/image2.gif) | 1736031605BB_With Ta..> | 2025-01-04 23:00 | 132K | |
![[IMG]](/icons/image2.gif) | 1736453296Logo.png | 2025-01-09 20:08 | 150K | |
![[IMG]](/icons/image2.gif) | 1736512060BENTOT'S T..> | 2025-01-10 12:27 | 692K | |
![[IMG]](/icons/image2.gif) | 1736636408DR by Carm..> | 2025-01-11 23:00 | 197K | |
![[IMG]](/icons/image2.gif) | 1736690701AS Logo Im..> | 2025-01-12 14:05 | 425K | |
![[IMG]](/icons/image2.gif) | 1736729205beispiel_p..> | 2025-01-13 00:46 | 41K | |
![[TXT]](/icons/text.gif) | 1736729243lab0001_Lo..> | 2025-01-13 00:47 | 7.9K | |
![[IMG]](/icons/image2.gif) | 1736729278lab0001_Lo..> | 2025-01-13 00:47 | 7.9K | |
![[IMG]](/icons/image2.gif) | 1736729394lab0001_Lo..> | 2025-01-13 00:49 | 7.9K | |
![[IMG]](/icons/image2.gif) | 1736729495lab0001_Lo..> | 2025-01-13 00:51 | 7.9K | |
![[IMG]](/icons/image2.gif) | 1736729630icon_messa..> | 2025-01-13 00:53 | 1.5K | |
![[IMG]](/icons/image2.gif) | 1736730195lab0001_Lo..> | 2025-01-13 01:03 | 7.9K | |
![[IMG]](/icons/image2.gif) | 1736730200lab0001_Lo..> | 2025-01-13 01:03 | 7.9K | |
![[IMG]](/icons/image2.gif) | 1736759728lab0001_Lo..> | 2025-01-13 09:15 | 7.9K | |
![[IMG]](/icons/image2.gif) | 1736922341Screenshot..> | 2025-01-15 06:25 | 639K | |
![[IMG]](/icons/image2.gif) | 1736959181WALDIS GRA..> | 2025-01-15 16:39 | 135K | |
![[IMG]](/icons/image2.gif) | 1736994083Logo with ..> | 2025-01-16 02:21 | 495K | |
![[IMG]](/icons/image2.gif) | 1737039255lasagnalog..> | 2025-01-16 14:54 | 498K | |
![[IMG]](/icons/image2.gif) | 1737257397fotor-ai-2..> | 2025-01-19 03:29 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1737405108baked (3).png | 2025-01-20 20:31 | 127K | |
![[IMG]](/icons/image2.gif) | 1737405194baked (2).png | 2025-01-20 20:33 | 114K | |
![[IMG]](/icons/image2.gif) | 1737405226baked (2).png | 2025-01-20 20:33 | 114K | |
![[IMG]](/icons/image2.gif) | 1737563396Wild dough..> | 2025-01-22 16:29 | 100K | |
![[IMG]](/icons/image2.gif) | 1737588265Apple and ..> | 2025-01-22 23:24 | 185K | |
![[IMG]](/icons/image2.gif) | 1737594841LOGO WITHO..> | 2025-01-23 01:14 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1737725418unnamed.jpg | 2025-01-24 13:30 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1737821855IMG_9889.jpeg | 2025-01-25 16:17 | 86K | |
![[IMG]](/icons/image2.gif) | 1738013897Kayak Coff..> | 2025-01-27 21:38 | 144K | |
![[IMG]](/icons/image2.gif) | 1738021614Kayak Coff..> | 2025-01-27 23:46 | 312K | |
![[IMG]](/icons/image2.gif) | 1738030801Screenshot..> | 2025-01-28 02:20 | 255K | |
![[IMG]](/icons/image2.gif) | 1738152342IMG_0598.tiff | 2025-01-29 12:05 | 118K | |
![[IMG]](/icons/image2.gif) | 1738173283LOGO ICON.png | 2025-01-29 17:54 | 103K | |
![[IMG]](/icons/image2.gif) | 1738173473Ambassador..> | 2025-01-29 17:57 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1738190839Jacobs Hav..> | 2025-01-29 22:47 | 60K | |
![[IMG]](/icons/image2.gif) | 1738191860IMG_6007.jpg | 2025-01-29 23:04 | 714K | |
![[IMG]](/icons/image2.gif) | 1738292894IMG_9277.jpeg | 2025-01-31 03:08 | 900K | |
![[IMG]](/icons/image2.gif) | 1738386057Label_Aver..> | 2025-02-01 05:00 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1738447731pig.jpg | 2025-02-01 22:08 | 177K | |
![[IMG]](/icons/image2.gif) | 1738451270IMG_6623.jpeg | 2025-02-01 23:07 | 97K | |
![[IMG]](/icons/image2.gif) | 1738503083Ribeye4.JPG | 2025-02-02 13:31 | 3.1M | |
![[IMG]](/icons/image2.gif) | 1738614195Garden Clu..> | 2025-02-03 20:23 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1738614521logo-png.png | 2025-02-03 20:28 | 295K | |
![[IMG]](/icons/image2.gif) | 1738624619CircleLogo..> | 2025-02-03 23:16 | 310K | |
![[IMG]](/icons/image2.gif) | 1738627949circle log..> | 2025-02-04 00:12 | 104K | |
![[IMG]](/icons/image2.gif) | 1738627972transparen..> | 2025-02-04 00:12 | 79K | |
![[IMG]](/icons/image2.gif) | 1738627994circle log..> | 2025-02-04 00:13 | 104K | |
![[IMG]](/icons/image2.gif) | 1738628138square log..> | 2025-02-04 00:15 | 90K | |
![[IMG]](/icons/image2.gif) | 1738628441circle log..> | 2025-02-04 00:20 | 104K | |
![[IMG]](/icons/image2.gif) | 1738628507circle log..> | 2025-02-04 00:21 | 104K | |
![[IMG]](/icons/image2.gif) | 1738630084Screenshot..> | 2025-02-04 00:48 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1738632088circle log..> | 2025-02-04 01:21 | 104K | |
![[IMG]](/icons/image2.gif) | 1738666404circle log..> | 2025-02-04 10:53 | 104K | |
![[IMG]](/icons/image2.gif) | 1738692207SF_BrandPh..> | 2025-02-04 18:03 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1738698526Screenshot..> | 2025-02-04 19:48 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1738701421(1000 x 10..> | 2025-02-04 20:37 | 853K | |
![[IMG]](/icons/image2.gif) | 1738702634(1000 x 10..> | 2025-02-04 20:57 | 140K | |
![[IMG]](/icons/image2.gif) | 1738702705(1000 x 10..> | 2025-02-04 20:58 | 663K | |
![[IMG]](/icons/image2.gif) | 1738704263square log..> | 2025-02-04 21:24 | 90K | |
![[IMG]](/icons/image2.gif) | 1738704270square log..> | 2025-02-04 21:24 | 90K | |
![[IMG]](/icons/image2.gif) | 1738704292circle log..> | 2025-02-04 21:24 | 104K | |
![[IMG]](/icons/image2.gif) | 1738704297circle log..> | 2025-02-04 21:24 | 104K | |
![[IMG]](/icons/image2.gif) | 1738991687SR Logo bl..> | 2025-02-08 05:14 | 49K | |
![[IMG]](/icons/image2.gif) | 1739122637IMG_6292.png | 2025-02-09 17:37 | 166K | |
![[IMG]](/icons/image2.gif) | 1739131226bakester-l..> | 2025-02-09 20:00 | 184K | |
![[IMG]](/icons/image2.gif) | 1739137100Yoltlayohl..> | 2025-02-09 21:38 | 64K | |
![[IMG]](/icons/image2.gif) | 1739214872GEDC0435.JPG | 2025-02-10 19:14 | 3.6M | |
![[IMG]](/icons/image2.gif) | 1739214923GEDC0526.JPG | 2025-02-10 19:15 | 3.2M | |
![[IMG]](/icons/image2.gif) | 1739287717C57A9B4D-5..> | 2025-02-11 15:28 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1739300745Ziggy's Ba..> | 2025-02-11 19:05 | 171K | |
![[IMG]](/icons/image2.gif) | 1739314661OFFICIAL l..> | 2025-02-11 22:57 | 241K | |
![[IMG]](/icons/image2.gif) | 1739397158Welfore-sa..> | 2025-02-12 21:52 | 255K | |
![[IMG]](/icons/image2.gif) | 1739551807Cone Icon.png | 2025-02-14 16:50 | 66K | |
![[IMG]](/icons/image2.gif) | 1739559577logo for s..> | 2025-02-14 18:59 | 198K | |
![[IMG]](/icons/image2.gif) | 1739565864logo w whi..> | 2025-02-14 20:44 | 99K | |
![[IMG]](/icons/image2.gif) | 1739801956Screenshot..> | 2025-02-17 14:19 | 302K | |
![[IMG]](/icons/image2.gif) | 1739810799EveraeGard..> | 2025-02-17 16:46 | 2.6M | |
![[IMG]](/icons/image2.gif) | 1739824898RachelNewL..> | 2025-02-17 20:41 | 194K | |
![[IMG]](/icons/image2.gif) | 1739825005RachelNewL..> | 2025-02-17 20:43 | 256K | |
![[IMG]](/icons/image2.gif) | 1739846637label logo..> | 2025-02-18 02:43 | 150K | |
![[IMG]](/icons/image2.gif) | 1739896304Profile Pi..> | 2025-02-18 16:31 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1739931096IMG_7668.jpeg | 2025-02-19 02:11 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1739932843IMG_5414.jpeg | 2025-02-19 02:40 | 140K | |
![[IMG]](/icons/image2.gif) | 1740154786IMG_1044.jpeg | 2025-02-21 16:19 | 3.6M | |
![[IMG]](/icons/image2.gif) | 1740428242Festival F..> | 2025-02-24 20:17 | 550K | |
![[IMG]](/icons/image2.gif) | 1740627349SiteIcon_5..> | 2025-02-27 03:35 | 216K | |
![[IMG]](/icons/image2.gif) | 1740677753IMG_0208.png | 2025-02-27 17:35 | 255K | |
![[IMG]](/icons/image2.gif) | 1740677768IMG_0208.png | 2025-02-27 17:36 | 255K | |
![[IMG]](/icons/image2.gif) | 1740803546IMG_2203.png | 2025-03-01 04:32 | 63K | |
![[IMG]](/icons/image2.gif) | 1740803660IMG_2203.jpeg | 2025-03-01 04:34 | 124K | |
![[IMG]](/icons/image2.gif) | 1740846078Updated_Lo..> | 2025-03-01 16:21 | 709K | |
![[IMG]](/icons/image2.gif) | 1741034971IMG_9676.jpeg | 2025-03-03 20:49 | 321K | |
![[IMG]](/icons/image2.gif) | 1741116741IMG_0111.jpeg | 2025-03-04 19:32 | 792K | |
![[IMG]](/icons/image2.gif) | 1741127359White Brow..> | 2025-03-04 22:29 | 49K | |
![[IMG]](/icons/image2.gif) | 1741152679FullLogo.jpg | 2025-03-05 05:31 | 309K | |
![[IMG]](/icons/image2.gif) | 1741199790IMG_5831.jpeg | 2025-03-05 18:36 | 226K | |
![[IMG]](/icons/image2.gif) | 1741228175logo.PNG | 2025-03-06 02:29 | 79K | |
![[IMG]](/icons/image2.gif) | 1741556110IMG_4806.jpeg | 2025-03-09 21:35 | 377K | |
![[IMG]](/icons/image2.gif) | 1741615790Bangkok_Ex..> | 2025-03-10 14:09 | 18K | |
![[IMG]](/icons/image2.gif) | 1741633305blue round..> | 2025-03-10 19:01 | 202K | |
![[IMG]](/icons/image2.gif) | 1741648787round logo..> | 2025-03-10 23:19 | 230K | |
![[IMG]](/icons/image2.gif) | 1741886259PL.jpeg | 2025-03-13 17:17 | 30K | |
![[IMG]](/icons/image2.gif) | 1741889322PL.jpeg | 2025-03-13 18:08 | 30K | |
![[IMG]](/icons/image2.gif) | 1741891563Logo.png | 2025-03-13 18:46 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1741891679Logo.png | 2025-03-13 18:47 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1742239639logo-test.png | 2025-03-17 19:27 | 19K | |
![[IMG]](/icons/image2.gif) | 1742328458IMG_4894.jpeg | 2025-03-18 20:07 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1742328460IMG_4894.jpeg | 2025-03-18 20:07 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1742404242Logo 3 10...> | 2025-03-19 17:10 | 111K | |
![[IMG]](/icons/image2.gif) | 1742510342Market Wag..> | 2025-03-20 22:39 | 185K | |
![[IMG]](/icons/image2.gif) | 1742902372d04057f4-2..> | 2025-03-25 11:32 | 738K | |
![[IMG]](/icons/image2.gif) | 1742902384d04057f4-2..> | 2025-03-25 11:33 | 738K | |
![[IMG]](/icons/image2.gif) | 1742932620villa logo..> | 2025-03-25 19:57 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1742953990IMG_5219.png | 2025-03-26 01:53 | 377K | |
![[IMG]](/icons/image2.gif) | 1743002294Ber-Nell I..> | 2025-03-26 15:18 | 865K | |
![[IMG]](/icons/image2.gif) | 1743014628Mirandas B..> | 2025-03-26 18:43 | 167K | |
![[IMG]](/icons/image2.gif) | 1743173406BETTER OPT..> | 2025-03-28 14:50 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1743432230Watsonia l..> | 2025-03-31 14:43 | 28K | |
![[IMG]](/icons/image2.gif) | 1743535677tgm-bread-..> | 2025-04-01 19:27 | 103K | |
![[IMG]](/icons/image2.gif) | 1743536059TGM Bread ..> | 2025-04-01 19:34 | 103K | |
![[IMG]](/icons/image2.gif) | 1743598883PB logo_or..> | 2025-04-02 13:01 | 139K | |
![[IMG]](/icons/image2.gif) | 1743698766front of b..> | 2025-04-03 16:46 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1743699163Firefly Ga..> | 2025-04-03 16:52 | 80K | |
![[IMG]](/icons/image2.gif) | 1743982900color_logo..> | 2025-04-06 23:41 | 121K | |
![[IMG]](/icons/image2.gif) | 1744817427Untitled d..> | 2025-04-16 15:30 | 206K | |
![[IMG]](/icons/image2.gif) | 1744829115Sanders Fu..> | 2025-04-16 18:45 | 345K | |
![[IMG]](/icons/image2.gif) | 1744830942Social Med..> | 2025-04-16 19:15 | 48K | |
![[IMG]](/icons/image2.gif) | 1745007003me.JPG | 2025-04-18 20:10 | 417K | |
![[IMG]](/icons/image2.gif) | 1745008463round labe..> | 2025-04-18 20:34 | 341K | |
![[IMG]](/icons/image2.gif) | 1745085891image (1).png | 2025-04-19 18:04 | 22K | |
![[IMG]](/icons/image2.gif) | 1745085972herehere.avif | 2025-04-19 18:06 | 28K | |
![[IMG]](/icons/image2.gif) | 1745240967Ad.png | 2025-04-21 13:09 | 97K | |
![[IMG]](/icons/image2.gif) | 1745268590A80212A4-F..> | 2025-04-21 20:49 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1745271779TCM Logo.jpg | 2025-04-21 21:42 | 279K | |
![[IMG]](/icons/image2.gif) | 1745418476Logo.jpg | 2025-04-23 14:27 | 53K | |
![[IMG]](/icons/image2.gif) | 1745523379BoxSweets_..> | 2025-04-24 19:36 | 47K | |
![[IMG]](/icons/image2.gif) | 1745672654Logo Tiend..> | 2025-04-26 13:04 | 98K | |
![[IMG]](/icons/image2.gif) | 1745986317Grey Weste..> | 2025-04-30 04:11 | 24K | |
![[IMG]](/icons/image2.gif) | 1746205835IMG_2576_2..> | 2025-05-02 17:10 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1746285163IMG_5246.png | 2025-05-03 15:12 | 194K | |
![[IMG]](/icons/image2.gif) | 1746484935logo no ba..> | 2025-05-05 22:42 | 242K | |
![[IMG]](/icons/image2.gif) | 1746484941logo no ba..> | 2025-05-05 22:42 | 242K | |
![[IMG]](/icons/image2.gif) | 1746484958FullLogo.png | 2025-05-05 22:42 | 312K | |
![[IMG]](/icons/image2.gif) | 1746484962FullLogo.png | 2025-05-05 22:42 | 312K | |
![[IMG]](/icons/image2.gif) | 1746533033Resizeable..> | 2025-05-06 12:03 | 176K | |
![[IMG]](/icons/image2.gif) | 1746732086PureMemory..> | 2025-05-08 19:21 | 153K | |
![[IMG]](/icons/image2.gif) | 1746732129PureMemory..> | 2025-05-08 19:22 | 153K | |
![[IMG]](/icons/image2.gif) | 1746732329SpaceSquar..> | 2025-05-08 19:25 | 139K | |
![[IMG]](/icons/image2.gif) | 1746732336SpaceSquar..> | 2025-05-08 19:25 | 139K | |
![[IMG]](/icons/image2.gif) | 1746799009IMG_5991.jpeg | 2025-05-09 13:56 | 272K | |
![[IMG]](/icons/image2.gif) | 1746849910DSC01822.jpeg | 2025-05-10 04:05 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1746887168Alons logo..> | 2025-05-10 14:26 | 154K | |
![[IMG]](/icons/image2.gif) | 1746888244Alons logo..> | 2025-05-10 14:44 | 161K | |
![[IMG]](/icons/image2.gif) | 1746981436IMG_7426.jpeg | 2025-05-11 16:37 | 108K | |
![[IMG]](/icons/image2.gif) | 1746983885DSC01822.jpeg | 2025-05-11 17:18 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1747056965GOPR1597.JPG | 2025-05-12 13:36 | 4.1M | |
![[IMG]](/icons/image2.gif) | 1747076155IMG_0824.png | 2025-05-12 18:55 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1747083157Dickey Far..> | 2025-05-12 20:52 | 70K | |
![[IMG]](/icons/image2.gif) | 1747083870Dickey Far..> | 2025-05-12 21:04 | 54K | |
![[IMG]](/icons/image2.gif) | 1747241030White Circ..> | 2025-05-14 16:43 | 74K | |
![[IMG]](/icons/image2.gif) | 1747241035White Circ..> | 2025-05-14 16:43 | 74K | |
![[IMG]](/icons/image2.gif) | 1747241067Earl Gray ..> | 2025-05-14 16:44 | 2.8M | |
![[IMG]](/icons/image2.gif) | 1747253015images.jpeg | 2025-05-14 20:03 | 31K | |
![[IMG]](/icons/image2.gif) | 1747415652IMG_8931.jpeg | 2025-05-16 17:14 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1747415655IMG_8931.jpeg | 2025-05-16 17:14 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1747427716Add a head..> | 2025-05-16 20:35 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1747570812Logo - 500..> | 2025-05-18 12:20 | 60K | |
![[IMG]](/icons/image2.gif) | 1747875005IMG_7084.jpeg | 2025-05-22 00:50 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1747936252Pine STree..> | 2025-05-22 17:50 | 32K | |
![[IMG]](/icons/image2.gif) | 1748351007Kitchen Gi..> | 2025-05-27 13:03 | 379K | |
![[IMG]](/icons/image2.gif) | 1748351048KGF-Sign-1..> | 2025-05-27 13:04 | 294K | |
![[IMG]](/icons/image2.gif) | 1748353398IMG_6657.jpeg | 2025-05-27 13:43 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1748353542IMG_7076.jpeg | 2025-05-27 13:45 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1748359599Screenshot..> | 2025-05-27 15:26 | 296K | |
![[IMG]](/icons/image2.gif) | 1748454177Your parag..> | 2025-05-28 17:42 | 66K | |
![[IMG]](/icons/image2.gif) | 1748470893Minimal El..> | 2025-05-28 22:21 | 29K | |
![[IMG]](/icons/image2.gif) | 1748527976Piedmont B..> | 2025-05-29 14:12 | 87K | |
![[IMG]](/icons/image2.gif) | 1748527987Piedmont B..> | 2025-05-29 14:13 | 87K | |
![[IMG]](/icons/image2.gif) | 1748554896sand hill ..> | 2025-05-29 21:41 | 1.0K | |
![[IMG]](/icons/image2.gif) | 1748635605NGSBANNER.png | 2025-05-30 20:06 | 566K | |
![[IMG]](/icons/image2.gif) | 1748968442info card ..> | 2025-06-03 16:34 | 2.9M | |
![[IMG]](/icons/image2.gif) | 1749334403Finnal .png | 2025-06-07 22:13 | 102K | |
![[IMG]](/icons/image2.gif) | 1749497940bread&Bake..> | 2025-06-09 19:39 | 188K | |
![[IMG]](/icons/image2.gif) | 1749526509IMG_1880.jpeg | 2025-06-10 03:35 | 2.5M | |
![[IMG]](/icons/image2.gif) | 1749577673IMG_3576.jpeg | 2025-06-10 17:47 | 2.6M | |
![[IMG]](/icons/image2.gif) | 1749579427IMG_3576.jpeg | 2025-06-10 18:17 | 2.6M | |
![[IMG]](/icons/image2.gif) | 1749751601VeggieTabl..> | 2025-06-12 18:06 | 195K | |
![[IMG]](/icons/image2.gif) | 1750079695WFSF Logo ..> | 2025-06-16 13:14 | 253K | |
![[IMG]](/icons/image2.gif) | 1750264245Michigan A..> | 2025-06-18 16:30 | 133K | |
![[IMG]](/icons/image2.gif) | 1750360052BCL LOGO L..> | 2025-06-19 19:07 | 376K | |
![[IMG]](/icons/image2.gif) | 1750703311Breadworks..> | 2025-06-23 18:28 | 37K | |
![[IMG]](/icons/image2.gif) | 1750712714breadworks..> | 2025-06-23 21:05 | 33K | |
![[IMG]](/icons/image2.gif) | 1750720201IMG_3105.jpeg | 2025-06-23 23:10 | 512K | |
![[IMG]](/icons/image2.gif) | 1750780185field & Fi..> | 2025-06-24 15:49 | 22K | |
![[IMG]](/icons/image2.gif) | 1750796136lgmpic.png | 2025-06-24 20:15 | 32K | |
![[IMG]](/icons/image2.gif) | 1750820154ChatGPT Im..> | 2025-06-25 02:55 | 2.8M | |
![[IMG]](/icons/image2.gif) | 1750821295Brickhouse..> | 2025-06-25 03:14 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1750886674Sublogo_Tw..> | 2025-06-25 21:24 | 33K | |
![[IMG]](/icons/image2.gif) | 1751243529new card.jpg | 2025-06-30 00:32 | 427K | |
![[IMG]](/icons/image2.gif) | 1751387292farm logo ..> | 2025-07-01 16:28 | 138K | |
![[IMG]](/icons/image2.gif) | 1751387549GJB_vertic..> | 2025-07-01 16:32 | 114K | |
![[IMG]](/icons/image2.gif) | 1751468095Sugarwood.png | 2025-07-02 14:54 | 29K | |
![[IMG]](/icons/image2.gif) | 1751481237UTOPIAN FA..> | 2025-07-02 18:33 | 162K | |
![[IMG]](/icons/image2.gif) | 1751550364Here Here ..> | 2025-07-03 13:46 | 13K | |
![[IMG]](/icons/image2.gif) | 1751550443Here Here ..> | 2025-07-03 13:47 | 12K | |
![[IMG]](/icons/image2.gif) | 1751555291IMG_7951 (..> | 2025-07-03 15:08 | 163K | |
![[IMG]](/icons/image2.gif) | 1751600445IMG_4514.jpeg | 2025-07-04 03:40 | 746K | |
![[IMG]](/icons/image2.gif) | 1751917000Logo FONT ..> | 2025-07-07 19:36 | 81K | |
![[IMG]](/icons/image2.gif) | 1751918772SocialLogo..> | 2025-07-07 20:06 | 220K | |
![[IMG]](/icons/image2.gif) | 1752062269photocolla..> | 2025-07-09 11:57 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1752092656Jardann lo..> | 2025-07-09 20:24 | 157K | |
![[IMG]](/icons/image2.gif) | 1752174178IMG_1289.jpeg | 2025-07-10 19:02 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1752175438IMG_9086.jpg | 2025-07-10 19:23 | 3.5M | |
![[IMG]](/icons/image2.gif) | 1752197297BD047710-D..> | 2025-07-11 01:28 | 1.4M | |
![[IMG]](/icons/image2.gif) | 14563453172x1_WEB_Wh..> | 2016-02-24 00:00 | 4.9K | |
![[IMG]](/icons/image2.gif) | 14936465893 chicks f..> | 2017-05-01 00:00 | 466K | |
![[IMG]](/icons/image2.gif) | 14942859453.jpg | 2017-05-08 00:00 | 150K | |
![[IMG]](/icons/image2.gif) | 15072290493.png | 2017-10-05 00:00 | 75K | |
![[IMG]](/icons/image2.gif) | 15409848676D8FF6A9-D..> | 2018-10-31 00:00 | 336K | |
![[IMG]](/icons/image2.gif) | 15418709325AA9C0EA-D..> | 2018-11-10 00:00 | 1.6M | |
![[IMG]](/icons/image2.gif) | 15444886036FF83BA4-D..> | 2018-12-10 00:00 | 856K | |
![[IMG]](/icons/image2.gif) | 15458294602FF7E467-F..> | 2018-12-26 00:00 | 47K | |
![[IMG]](/icons/image2.gif) | 15507153888E3D9619-9..> | 2019-02-20 00:00 | 381K | |
![[IMG]](/icons/image2.gif) | 15531205265F71F40B-B..> | 2019-03-20 00:00 | 129K | |
![[IMG]](/icons/image2.gif) | 15561342322by2logo.png | 2019-04-24 00:00 | 8.6K | |
![[IMG]](/icons/image2.gif) | 15595942083FF logo.jpg | 2019-06-03 00:00 | 1.2M | |
![[IMG]](/icons/image2.gif) | 15663332751C475E36-2..> | 2019-08-20 00:00 | 156K | |
![[IMG]](/icons/image2.gif) | 15668453211F5C8865-4..> | 2019-08-26 00:00 | 52K | |
![[IMG]](/icons/image2.gif) | 15680368439B2786E9-4..> | 2019-09-09 00:00 | 184K | |
![[IMG]](/icons/image2.gif) | 15681652143dvalley_f..> | 2019-09-10 00:00 | 140K | |
![[IMG]](/icons/image2.gif) | 15683962275BFC1528-D..> | 2019-09-13 00:00 | 435K | |
![[IMG]](/icons/image2.gif) | 15694132415F3B7A10-1..> | 2019-09-25 00:00 | 731K | |
![[IMG]](/icons/image2.gif) | 15726260981.1_FullCo..> | 2019-11-01 00:00 | 681K | |
![[IMG]](/icons/image2.gif) | 15763474164C469012-A..> | 2019-12-14 00:00 | 106K | |
![[IMG]](/icons/image2.gif) | 15817373617ECDDB4B-7..> | 2020-02-14 00:00 | 221K | |
![[IMG]](/icons/image2.gif) | 15844620474birds-hor..> | 2020-03-17 09:20 | 66K | |
![[IMG]](/icons/image2.gif) | 15848396108FFDAA7F-A..> | 2020-03-21 18:13 | 62K | |
![[IMG]](/icons/image2.gif) | 15851605175D3C9900-9..> | 2020-03-25 11:21 | 83K | |
![[IMG]](/icons/image2.gif) | 15854150970FB50FBC-0..> | 2020-03-28 10:04 | 111K | |
![[IMG]](/icons/image2.gif) | 15855130917DD5857F-0..> | 2020-03-29 13:18 | 103K | |
![[IMG]](/icons/image2.gif) | 15856144636BBDD8A7-E..> | 2020-03-30 17:27 | 106K | |
![[IMG]](/icons/image2.gif) | 15873251153 Juniper ..> | 2020-04-19 12:38 | 185K | |
![[IMG]](/icons/image2.gif) | 15876559250.png | 2020-04-23 08:32 | 20K | |
![[IMG]](/icons/image2.gif) | 15880075753R logo.jpg | 2020-04-27 10:12 | 128K | |
![[IMG]](/icons/image2.gif) | 15892300222A74D0EC-C..> | 2020-05-11 13:47 | 893K | |
![[IMG]](/icons/image2.gif) | 15893408100DF8620F-1..> | 2020-05-12 20:33 | 100K | |
![[IMG]](/icons/image2.gif) | 15923448343AFmain.jpg | 2020-06-16 15:00 | 214K | |
![[IMG]](/icons/image2.gif) | 15923656628C1F56F4-2..> | 2020-06-16 20:47 | 25K | |
![[IMG]](/icons/image2.gif) | 15931296541E989A1D-F..> | 2020-06-25 17:00 | 2.0M | |
![[IMG]](/icons/image2.gif) | 15941387001.png | 2020-07-07 09:18 | 1.0M | |
![[IMG]](/icons/image2.gif) | 15963175022.png | 2020-08-01 14:31 | 30K | |
![[IMG]](/icons/image2.gif) | 15973590090F52E482-E..> | 2020-08-13 15:50 | 556K | |
![[IMG]](/icons/image2.gif) | 15974143394boyzfarm ..> | 2020-08-14 07:12 | 81K | |
![[IMG]](/icons/image2.gif) | 15983587075DD3D26B-A..> | 2020-08-25 05:31 | 71K | |
![[IMG]](/icons/image2.gif) | 15995940928CBCBFF8-8..> | 2020-09-08 19:41 | 1.2M | |
![[IMG]](/icons/image2.gif) | 15996657036FB5352D-5..> | 2020-09-09 15:35 | 17K | |
![[IMG]](/icons/image2.gif) | 16019971519DA7BE30-E..> | 2020-10-06 15:12 | 56K | |
![[IMG]](/icons/image2.gif) | 16025302974.jpg | 2020-10-12 19:18 | 383K | |
![[IMG]](/icons/image2.gif) | 16025368887ba7b55b50..> | 2020-10-12 21:08 | 69K | |
![[IMG]](/icons/image2.gif) | 16037488135E30666E-2..> | 2020-10-26 21:46 | 93K | |
![[IMG]](/icons/image2.gif) | 16038265999D38BAC0-2..> | 2020-10-27 19:23 | 453K | |
![[IMG]](/icons/image2.gif) | 16041558808C809B87-3..> | 2020-10-31 14:51 | 0 | |
![[IMG]](/icons/image2.gif) | 16041596132DFD67AC-6..> | 2020-10-31 15:53 | 1.0M | |
![[IMG]](/icons/image2.gif) | 16050161518TrackLogo..> | 2020-11-10 13:49 | 12K | |
![[IMG]](/icons/image2.gif) | 16060668747F799463-4..> | 2020-11-22 17:41 | 132K | |
![[IMG]](/icons/image2.gif) | 16070422927C87B841-6..> | 2020-12-04 00:38 | 755K | |
![[IMG]](/icons/image2.gif) | 16071138946D32BE60-3..> | 2020-12-04 20:31 | 41K | |
![[IMG]](/icons/image2.gif) | 16075450214eleBth.jpg | 2020-12-09 20:17 | 601K | |
![[IMG]](/icons/image2.gif) | 16076268321dozeggs.jpg | 2020-12-10 19:00 | 163K | |
![[IMG]](/icons/image2.gif) | 16078920315A9B5D23-C..> | 2020-12-13 20:40 | 436K | |
![[IMG]](/icons/image2.gif) | 16078920545A9B5D23-C..> | 2020-12-13 20:40 | 436K | |
![[IMG]](/icons/image2.gif) | 16079854371dozeggs.jpg | 2020-12-14 22:37 | 163K | |
![[IMG]](/icons/image2.gif) | 16085160218DD13B2D-0..> | 2020-12-21 02:00 | 1.3M | |
![[IMG]](/icons/image2.gif) | 16097878332C72AB24-8..> | 2021-01-04 19:17 | 229K | |
![[IMG]](/icons/image2.gif) | 16098310316A8B2D83-9..> | 2021-01-05 07:17 | 1.4M | |
![[IMG]](/icons/image2.gif) | 16100248504Corners_S..> | 2021-01-07 13:07 | 73K | |
![[IMG]](/icons/image2.gif) | 16100357008D8CB146-8..> | 2021-01-07 16:08 | 863K | |
![[IMG]](/icons/image2.gif) | 16102963829D16DCEB-D..> | 2021-01-10 16:33 | 802K | |
![[IMG]](/icons/image2.gif) | 16106635970c6af2a7-3..> | 2021-01-14 22:33 | 40K | |
![[IMG]](/icons/image2.gif) | 16111150662.jpg | 2021-01-20 03:57 | 941K | |
![[IMG]](/icons/image2.gif) | 16118876864CFEA9DD-9..> | 2021-01-29 02:34 | 56K | |
![[IMG]](/icons/image2.gif) | 16119337450F43B39D-B..> | 2021-01-29 15:22 | 53K | |
![[IMG]](/icons/image2.gif) | 16121188541EF14666-4..> | 2021-01-31 18:47 | 240K | |
![[IMG]](/icons/image2.gif) | 16121304785A64C7C7-A..> | 2021-01-31 22:01 | 1.9M | |
![[IMG]](/icons/image2.gif) | 16122823182F7EE06F-C..> | 2021-02-02 16:11 | 426K | |
![[IMG]](/icons/image2.gif) | 16122952043dmw.png | 2021-02-02 19:46 | 56K | |
![[IMG]](/icons/image2.gif) | 16128306604C4A4E61-7..> | 2021-02-09 00:31 | 25K | |
![[IMG]](/icons/image2.gif) | 16129075330E0352F3-A..> | 2021-02-09 21:52 | 63K | |
![[IMG]](/icons/image2.gif) | 16129701151BE39C48-D..> | 2021-02-10 15:15 | 19K | |
![[IMG]](/icons/image2.gif) | 16130957450DB3CCE2-F..> | 2021-02-12 02:09 | 139K | |
![[IMG]](/icons/image2.gif) | 16134179583 RH Logo.jpg | 2021-02-15 19:39 | 4.7K | |
![[IMG]](/icons/image2.gif) | 16136970472.png | 2021-02-19 01:10 | 958K | |
![[IMG]](/icons/image2.gif) | 16142788494AFEEC62-4..> | 2021-02-25 18:47 | 1.1M | |
![[IMG]](/icons/image2.gif) | 16143925231FD54122-3..> | 2021-02-27 02:22 | 493K | |
![[IMG]](/icons/image2.gif) | 16146118971C2FE9CB-3..> | 2021-03-01 15:18 | 130K | |
![[IMG]](/icons/image2.gif) | 16146982141. Events_..> | 2021-03-02 15:16 | 190K | |
![[IMG]](/icons/image2.gif) | 16148721227A63AE60-C..> | 2021-03-04 15:35 | 517K | |
![[IMG]](/icons/image2.gif) | 16148767130D7196B6-F..> | 2021-03-04 16:51 | 170K | |
![[IMG]](/icons/image2.gif) | 16154111036DEE8DD0-B..> | 2021-03-10 21:18 | 41K | |
![[IMG]](/icons/image2.gif) | 16161604721D270841-C..> | 2021-03-19 13:27 | 2.0M | |
![[IMG]](/icons/image2.gif) | 16161743677E025AED-B..> | 2021-03-19 17:19 | 49K | |
![[IMG]](/icons/image2.gif) | 16166075352.14 - Car..> | 2021-03-24 17:38 | 45K | |
![[IMG]](/icons/image2.gif) | 16175844611-01.jpg | 2021-04-05 01:01 | 488K | |
![[IMG]](/icons/image2.gif) | 16175849501-01.jpg | 2021-04-05 01:09 | 488K | |
![[IMG]](/icons/image2.gif) | 16176406749A7BFA49-6..> | 2021-04-05 16:37 | 87K | |
![[IMG]](/icons/image2.gif) | 16182628125A82C709-0..> | 2021-04-12 21:26 | 1.4M | |
![[IMG]](/icons/image2.gif) | 16182628195A82C709-0..> | 2021-04-12 21:26 | 1.4M | |
![[IMG]](/icons/image2.gif) | 16183294961.png | 2021-04-13 15:58 | 296K | |
![[IMG]](/icons/image2.gif) | 16183322332.png | 2021-04-13 16:43 | 137K | |
![[IMG]](/icons/image2.gif) | 16183553333CA60071-6..> | 2021-04-13 23:08 | 36K | |
![[IMG]](/icons/image2.gif) | 16183567944C0D446A-5..> | 2021-04-13 23:33 | 172K | |
![[IMG]](/icons/image2.gif) | 16188814209DFF67B2-F..> | 2021-04-20 01:17 | 1.3M | |
![[IMG]](/icons/image2.gif) | 16188817605A775E2E-B..> | 2021-04-20 01:22 | 932K | |
![[IMG]](/icons/image2.gif) | 16189692734BE65DD8-7..> | 2021-04-21 01:41 | 199K | |
![[IMG]](/icons/image2.gif) | 16197876635E984988-A..> | 2021-04-30 13:01 | 228K | |
![[IMG]](/icons/image2.gif) | 16197877525E984988-A..> | 2021-04-30 13:02 | 228K | |
![[IMG]](/icons/image2.gif) | 16197885230BD65E38-7..> | 2021-04-30 13:15 | 87K | |
![[IMG]](/icons/image2.gif) | 16204045744D54D189-4..> | 2021-05-07 16:22 | 151K | |
![[IMG]](/icons/image2.gif) | 16212729185f86ebba79..> | 2021-05-17 17:35 | 192K | |
![[IMG]](/icons/image2.gif) | 16213156407CB46CD0-6..> | 2021-05-18 05:27 | 657K | |
![[IMG]](/icons/image2.gif) | 16215342314B1F4F9A-1..> | 2021-05-20 18:10 | 766K | |
![[IMG]](/icons/image2.gif) | 16219766810E6EAC01-B..> | 2021-05-25 21:04 | 261K | |
![[IMG]](/icons/image2.gif) | 16221373180B85295A-B..> | 2021-05-27 17:41 | 8.8K | |
![[IMG]](/icons/image2.gif) | 16222223139BAF47CA-2..> | 2021-05-28 17:18 | 522K | |
![[IMG]](/icons/image2.gif) | 16224675230B60FCEF-B..> | 2021-05-31 13:25 | 346K | |
![[IMG]](/icons/image2.gif) | 16226748229F64241E-F..> | 2021-06-02 23:00 | 168K | |
![[IMG]](/icons/image2.gif) | 16226926992BC91FA2-D..> | 2021-06-03 03:58 | 139K | |
![[IMG]](/icons/image2.gif) | 16230857428EDFDABA-9..> | 2021-06-07 17:09 | 96K | |
![[IMG]](/icons/image2.gif) | 16231861067Vines Che..> | 2021-06-08 21:01 | 1.6M | |
![[IMG]](/icons/image2.gif) | 16232659868AD2A217-E..> | 2021-06-09 19:13 | 244K | |
![[IMG]](/icons/image2.gif) | 16232677503.125x5.png | 2021-06-09 19:42 | 90K | |
![[IMG]](/icons/image2.gif) | 16240521436B05591D-1..> | 2021-06-18 21:35 | 178K | |
![[IMG]](/icons/image2.gif) | 16242930803-tubs-fac..> | 2021-06-21 16:31 | 594K | |
![[IMG]](/icons/image2.gif) | 16243260188C0001F8-0..> | 2021-06-22 01:40 | 896K | |
![[IMG]](/icons/image2.gif) | 16243262197AC3FE85-E..> | 2021-06-22 01:43 | 253K | |
![[IMG]](/icons/image2.gif) | 16244704901ECAB1EA-A..> | 2021-06-23 17:48 | 110K | |
![[IMG]](/icons/image2.gif) | 16244747988C70F439-0..> | 2021-06-23 18:59 | 1.9M | |
![[IMG]](/icons/image2.gif) | 16249409084FA0E5A7-B..> | 2021-06-29 04:28 | 43K | |
![[IMG]](/icons/image2.gif) | 16251068311F8A5255-8..> | 2021-07-01 02:33 | 38K | |
![[IMG]](/icons/image2.gif) | 16252551369C271161-3..> | 2021-07-02 19:45 | 35K | |
![[IMG]](/icons/image2.gif) | 16253250212A53C49D-2..> | 2021-07-03 15:10 | 1.7M | |
![[IMG]](/icons/image2.gif) | 16253380378B00FA06-A..> | 2021-07-03 18:47 | 38K | |
![[IMG]](/icons/image2.gif) | 16254650158F62A108-C..> | 2021-07-05 06:03 | 118K | |
![[IMG]](/icons/image2.gif) | 16256842938C61F2CE-2..> | 2021-07-07 18:58 | 1.1M | |
![[IMG]](/icons/image2.gif) | 16259236845BA30763-0..> | 2021-07-10 13:28 | 151K | |
![[IMG]](/icons/image2.gif) | 16262837400F8112B4-F..> | 2021-07-14 17:29 | 92K | |
![[IMG]](/icons/image2.gif) | 16266960556A45D34F-B..> | 2021-07-19 12:00 | 58K | |
![[IMG]](/icons/image2.gif) | 16267230756A01FCDF-F..> | 2021-07-19 19:31 | 1.6M | |
![[IMG]](/icons/image2.gif) | 16269662474E9035BD-E..> | 2021-07-22 15:04 | 314K | |
![[IMG]](/icons/image2.gif) | 16273488152 x 2 logo..> | 2021-07-27 01:20 | 17K | |
![[IMG]](/icons/image2.gif) | 16274407339BC780CA-5..> | 2021-07-28 02:52 | 1.4M | |
![[IMG]](/icons/image2.gif) | 16274837996 jar bann..> | 2021-07-28 14:49 | 550K | |
![[IMG]](/icons/image2.gif) | 16275250316A87D76C-8..> | 2021-07-29 02:17 | 160K | |
![[IMG]](/icons/image2.gif) | 16278389061D2C9B7A-E..> | 2021-08-01 17:28 | 70K | |
![[IMG]](/icons/image2.gif) | 16279632984CAEFDFC-1..> | 2021-08-03 04:01 | 97K | |
![[IMG]](/icons/image2.gif) | 16281139611EDBF87F-8..> | 2021-08-04 21:52 | 1.6M | |
![[IMG]](/icons/image2.gif) | 16285510774x4 stamp.jpg | 2021-08-09 23:17 | 565K | |
![[IMG]](/icons/image2.gif) | 16286115102.jpg | 2021-08-10 16:05 | 210K | |
![[IMG]](/icons/image2.gif) | 16286421363C204732-3..> | 2021-08-11 00:35 | 235K | |
![[IMG]](/icons/image2.gif) | 16286421663C204732-3..> | 2021-08-11 00:36 | 235K | |
![[IMG]](/icons/image2.gif) | 16287048427B389CE9-D..> | 2021-08-11 18:00 | 28K | |
![[IMG]](/icons/image2.gif) | 16287932522CBDCE1A-F..> | 2021-08-12 18:34 | 908K | |
![[IMG]](/icons/image2.gif) | 16288736398B661022-F..> | 2021-08-13 16:53 | 50K | |
![[IMG]](/icons/image2.gif) | 16294632756CDB019F-3..> | 2021-08-20 12:41 | 103K | |
![[IMG]](/icons/image2.gif) | 16294704995BBD74D7-1..> | 2021-08-20 14:41 | 35K | |
![[IMG]](/icons/image2.gif) | 16297329883D33B40D-7..> | 2021-08-23 15:36 | 93K | |
![[IMG]](/icons/image2.gif) | 16298101823rd spoon ..> | 2021-08-24 13:03 | 31K | |
![[IMG]](/icons/image2.gif) | 16299162725fd7e053d6..> | 2021-08-25 18:31 | 116K | |
![[IMG]](/icons/image2.gif) | 16299164235fd7e053d6..> | 2021-08-25 18:33 | 116K | |
![[IMG]](/icons/image2.gif) | 16299217532.jpg | 2021-08-25 20:02 | 1.4M | |
![[IMG]](/icons/image2.gif) | 16301629813_Logo.jpg | 2021-08-28 15:03 | 283K | |
![[IMG]](/icons/image2.gif) | 16305099028BE514D1-A..> | 2021-09-01 15:25 | 174K | |
![[IMG]](/icons/image2.gif) | 16305110808BE514D1-A..> | 2021-09-01 15:44 | 174K | |
![[IMG]](/icons/image2.gif) | 16307070310D9DC1A6-F..> | 2021-09-03 22:10 | 625K | |
![[IMG]](/icons/image2.gif) | 16308970453BA983F9-5..> | 2021-09-06 02:57 | 215K | |
![[IMG]](/icons/image2.gif) | 16308970613BA983F9-5..> | 2021-09-06 02:57 | 215K | |
![[IMG]](/icons/image2.gif) | 16309701372CF235CF-A..> | 2021-09-06 23:15 | 40K | |
![[IMG]](/icons/image2.gif) | 16315817631CB3FA52-B..> | 2021-09-14 01:09 | 2.0M | |
![[IMG]](/icons/image2.gif) | 16319138675C2AAB62-F..> | 2021-09-17 21:24 | 335K | |
![[IMG]](/icons/image2.gif) | 16319171382.png | 2021-09-17 22:18 | 32K | |
![[IMG]](/icons/image2.gif) | 16325776332CA904A9-8..> | 2021-09-25 13:47 | 439K | |
![[IMG]](/icons/image2.gif) | 16327712625BEA8268-1..> | 2021-09-27 19:34 | 107K | |
![[IMG]](/icons/image2.gif) | 16336290055B961C96-5..> | 2021-10-07 17:50 | 950K | |
![[IMG]](/icons/image2.gif) | 16336508398D66FDB8-E..> | 2021-10-07 23:53 | 85K | |
![[IMG]](/icons/image2.gif) | 16342321047E4F6283-B..> | 2021-10-14 17:21 | 1.1M | |
![[IMG]](/icons/image2.gif) | 16342562081D7BD89A-0..> | 2021-10-15 00:03 | 133K | |
![[IMG]](/icons/image2.gif) | 16345794771CD96FEB-1..> | 2021-10-18 17:51 | 215K | |
![[IMG]](/icons/image2.gif) | 16346899870C706BB9-B..> | 2021-10-20 00:33 | 115K | |
![[IMG]](/icons/image2.gif) | 16349269062 by 2 Squ..> | 2021-10-22 18:21 | 34K | |
![[IMG]](/icons/image2.gif) | 16353848220C0CAF97-8..> | 2021-10-28 01:33 | 160K | |
![[IMG]](/icons/image2.gif) | 16354187132D84530D-1..> | 2021-10-28 10:58 | 915K | |
![[IMG]](/icons/image2.gif) | 16359472904ED445DC-1..> | 2021-11-03 13:48 | 264K | |
![[IMG]](/icons/image2.gif) | 16360584620C8D5E8A-D..> | 2021-11-04 20:41 | 93K | |
![[IMG]](/icons/image2.gif) | 16363708009B93A4B1-0..> | 2021-11-08 11:26 | 299K | |
![[IMG]](/icons/image2.gif) | 16369362121CD0D9E9-E..> | 2021-11-15 00:30 | 0 | |
![[IMG]](/icons/image2.gif) | 16373431921B01A25A-C..> | 2021-11-19 17:33 | 80K | |
![[IMG]](/icons/image2.gif) | 16377262707ADD20C2-9..> | 2021-11-24 03:57 | 182K | |
![[IMG]](/icons/image2.gif) | 16387243910f25dfd10e..> | 2021-12-05 17:13 | 5.3K | |
![[IMG]](/icons/image2.gif) | 16388302964F66637B-1..> | 2021-12-06 22:38 | 154K | |
![[IMG]](/icons/image2.gif) | 16388487939D7FC0EA-D..> | 2021-12-07 03:46 | 1.0M | |
![[IMG]](/icons/image2.gif) | 16391463730AA03B85-5..> | 2021-12-10 14:26 | 80K | |
![[IMG]](/icons/image2.gif) | 16391584630CA077D8-F..> | 2021-12-10 17:47 | 328K | |
![[IMG]](/icons/image2.gif) | 16395998460DFE5EAF-2..> | 2021-12-15 20:24 | 940K | |
![[IMG]](/icons/image2.gif) | 16396781927FFD35ED-2..> | 2021-12-16 18:09 | 646K | |
![[IMG]](/icons/image2.gif) | 16415030412A81526F-B..> | 2022-01-06 21:04 | 2.7M | |
![[IMG]](/icons/image2.gif) | 16417719396D19A11F-3..> | 2022-01-09 23:45 | 187K | |
![[IMG]](/icons/image2.gif) | 16418073508B97EDE7-4..> | 2022-01-10 09:35 | 1.6M | |
![[IMG]](/icons/image2.gif) | 16418078588B97EDE7-4..> | 2022-01-10 09:44 | 1.6M | |
![[IMG]](/icons/image2.gif) | 16425642644B77148C-D..> | 2022-01-19 03:51 | 205K | |
![[IMG]](/icons/image2.gif) | 16427990902CA1FFD1-4..> | 2022-01-21 21:04 | 395K | |
![[IMG]](/icons/image2.gif) | 16430569708E4FD09C-3..> | 2022-01-24 20:42 | 62K | |
![[IMG]](/icons/image2.gif) | 16432120217FFDFC88-6..> | 2022-01-26 15:47 | 545K | |
![[IMG]](/icons/image2.gif) | 16432470711-01-5.jpg | 2022-01-27 01:31 | 281K | |
![[IMG]](/icons/image2.gif) | 16432470801-01-5.jpg | 2022-01-27 01:31 | 281K | |
![[IMG]](/icons/image2.gif) | 16433374891AFBCEFE-8..> | 2022-01-28 02:38 | 399K | |
![[IMG]](/icons/image2.gif) | 16439000306D630C64-7..> | 2022-02-03 14:53 | 1.1M | |
![[IMG]](/icons/image2.gif) | 16439023273E42E1BE-2..> | 2022-02-03 15:32 | 3.9M | |
![[IMG]](/icons/image2.gif) | 16442521538B0ADD28-8..> | 2022-02-07 16:42 | 241K | |
![[IMG]](/icons/image2.gif) | 16444445982.jpg | 2022-02-09 22:09 | 576K | |
![[IMG]](/icons/image2.gif) | 16447772861FB64F62-2..> | 2022-02-13 18:34 | 423K | |
![[IMG]](/icons/image2.gif) | 16451273940B402DC3-C..> | 2022-02-17 19:49 | 563K | |
![[IMG]](/icons/image2.gif) | 16452995290ACD1343-B..> | 2022-02-19 19:38 | 2.8M | |
![[IMG]](/icons/image2.gif) | 16456709757BC2268C-4..> | 2022-02-24 02:49 | 1.6M | |
![[IMG]](/icons/image2.gif) | 16459038926EA9F461-8..> | 2022-02-26 19:31 | 1.2M | |
![[IMG]](/icons/image2.gif) | 16464384972 lakes Ch..> | 2022-03-05 00:01 | 855K | |
![[IMG]](/icons/image2.gif) | 16464439646A825947-3..> | 2022-03-05 01:32 | 2.9M | |
![[IMG]](/icons/image2.gif) | 16466167587D74E649-F..> | 2022-03-07 01:32 | 1.4M | |
![[IMG]](/icons/image2.gif) | 16466232431E362779-2..> | 2022-03-07 03:20 | 450K | |
![[IMG]](/icons/image2.gif) | 16472759441an-FLG-Lo..> | 2022-03-14 16:39 | 65K | |
![[IMG]](/icons/image2.gif) | 16472759901an-FLG-Lo..> | 2022-03-14 16:39 | 65K | |
![[IMG]](/icons/image2.gif) | 16472834859BC595D1-1..> | 2022-03-14 18:44 | 77K | |
![[IMG]](/icons/image2.gif) | 16472856559BC595D1-1..> | 2022-03-14 19:20 | 77K | |
![[IMG]](/icons/image2.gif) | 16474367331D2E8AF2-4..> | 2022-03-16 13:18 | 65K | |
![[IMG]](/icons/image2.gif) | 16484895787C30A2B3-5..> | 2022-03-28 17:46 | 2.6M | |
![[IMG]](/icons/image2.gif) | 16495183934D715B08-2..> | 2022-04-09 15:33 | 373K | |
![[IMG]](/icons/image2.gif) | 16498072514 - 1 (2).jpg | 2022-04-12 23:47 | 2.2M | |
![[IMG]](/icons/image2.gif) | 16501830778C358B9E-3..> | 2022-04-17 08:11 | 3.2M | |
![[IMG]](/icons/image2.gif) | 16505647359B1E86A3-3..> | 2022-04-21 18:12 | 3.2M | |
![[IMG]](/icons/image2.gif) | 16516334401EBB8049-E..> | 2022-05-04 03:04 | 2.0M | |
![[IMG]](/icons/image2.gif) | 16518346614FB116F3-F..> | 2022-05-06 10:57 | 241K | |
![[IMG]](/icons/image2.gif) | 16518580942EB7A53D-9..> | 2022-05-06 17:28 | 1.0M | |
![[IMG]](/icons/image2.gif) | 16520380170DBB01F9-6..> | 2022-05-08 19:26 | 427K | |
![[IMG]](/icons/image2.gif) | 16521245384EAE9A2F-8..> | 2022-05-09 19:28 | 145K | |
![[IMG]](/icons/image2.gif) | 16521245504EAE9A2F-8..> | 2022-05-09 19:29 | 145K | |
![[IMG]](/icons/image2.gif) | 16527404775N+Pasture..> | 2022-05-16 22:34 | 156K | |
![[IMG]](/icons/image2.gif) | 16536521681 FB Pictu..> | 2022-05-27 11:49 | 234K | |
![[IMG]](/icons/image2.gif) | 16541103071C697D94-7..> | 2022-06-01 19:05 | 2.2M | |
![[IMG]](/icons/image2.gif) | 16547098141.png | 2022-06-08 17:36 | 573K | |
![[IMG]](/icons/image2.gif) | 16547117646.11. 16 F..> | 2022-06-08 18:09 | 2.2M | |
![[IMG]](/icons/image2.gif) | 16547908439A52A47D-3..> | 2022-06-09 16:07 | 227K | |
![[IMG]](/icons/image2.gif) | 16564369122A79AFA8-2..> | 2022-06-28 17:21 | 350K | |
![[IMG]](/icons/image2.gif) | 16578097334F511DED-F..> | 2022-07-14 14:42 | 566K | |
![[IMG]](/icons/image2.gif) | 16580235434D6FDD9D-A..> | 2022-07-17 02:05 | 232K | |
![[IMG]](/icons/image2.gif) | 16580933411.png | 2022-07-17 21:29 | 319K | |
![[IMG]](/icons/image2.gif) | 16581746051B191757-7..> | 2022-07-18 20:03 | 310K | |
![[IMG]](/icons/image2.gif) | 16586126554CC62FE8-6..> | 2022-07-23 21:44 | 873K | |
![[IMG]](/icons/image2.gif) | 16587010040D050F5D-0..> | 2022-07-24 22:16 | 173K | |
![[IMG]](/icons/image2.gif) | 16587033578C7DFB9B-5..> | 2022-07-24 22:55 | 179K | |
![[IMG]](/icons/image2.gif) | 16587658824 Winds Mo..> | 2022-07-25 16:18 | 152K | |
![[IMG]](/icons/image2.gif) | 16587697065EB49B3A-8..> | 2022-07-25 17:21 | 1.8M | |
![[IMG]](/icons/image2.gif) | 16587815091BD149D4-9..> | 2022-07-25 20:38 | 105K | |
![[IMG]](/icons/image2.gif) | 16590408732C400A09-9..> | 2022-07-28 20:41 | 810K | |
![[IMG]](/icons/image2.gif) | 16590505989DC19CE9-5..> | 2022-07-28 23:23 | 253K | |
![[IMG]](/icons/image2.gif) | 16593838682.png | 2022-08-01 19:57 | 172K | |
![[IMG]](/icons/image2.gif) | 16606147813F848AC6-E..> | 2022-08-16 01:53 | 1.6M | |
![[IMG]](/icons/image2.gif) | 16607717307A70F66D-4..> | 2022-08-17 21:28 | 500K | |
![[IMG]](/icons/image2.gif) | 16607898833.png | 2022-08-18 02:31 | 14K | |
![[IMG]](/icons/image2.gif) | 16621260922E4FA766-9..> | 2022-09-02 13:41 | 3.7M | |
![[IMG]](/icons/image2.gif) | 16623141198EEEE9E3-F..> | 2022-09-04 17:55 | 927K | |
![[IMG]](/icons/image2.gif) | 16627499499EEDF562-1..> | 2022-09-09 18:59 | 694K | |
![[IMG]](/icons/image2.gif) | 16633906027AFB20E9-5..> | 2022-09-17 04:56 | 699K | |
![[IMG]](/icons/image2.gif) | 16636920206B47E9B9-3..> | 2022-09-20 16:40 | 247K | |
![[IMG]](/icons/image2.gif) | 16648937352F174F90-0..> | 2022-10-04 14:28 | 2.4M | |
![[IMG]](/icons/image2.gif) | 16650058873_20220531..> | 2022-10-05 21:38 | 21K | |
![[IMG]](/icons/image2.gif) | 16655163384EDAA4F7-D..> | 2022-10-11 19:25 | 1.6M | |
![[IMG]](/icons/image2.gif) | 16655358869FCAA354-2..> | 2022-10-12 00:51 | 3.0M | |
![[IMG]](/icons/image2.gif) | 16658476113d logo pr..> | 2022-10-15 15:26 | 9.5K | |
![[IMG]](/icons/image2.gif) | 16658476423d logo pr..> | 2022-10-15 15:27 | 268K | |
![[IMG]](/icons/image2.gif) | 16662688585EAD7207-4..> | 2022-10-20 12:27 | 150K | |
![[IMG]](/icons/image2.gif) | 16679535203B4AFC77-8..> | 2022-11-09 00:25 | 95K | |
![[IMG]](/icons/image2.gif) | 16680394423AE6E5D2-1..> | 2022-11-10 00:17 | 667K | |
![[IMG]](/icons/image2.gif) | 16683017413BCDB32C-1..> | 2022-11-13 01:09 | 935K | |
![[IMG]](/icons/image2.gif) | 16683018453BCDB32C-1..> | 2022-11-13 01:10 | 935K | |
![[IMG]](/icons/image2.gif) | 16689005358F960833-2..> | 2022-11-19 23:28 | 2.4M | |
![[IMG]](/icons/image2.gif) | 16703953882B46EBC4-7..> | 2022-12-07 06:43 | 2.0M | |
![[IMG]](/icons/image2.gif) | 16711494018d6c4bb1-e..> | 2022-12-16 00:10 | 1.6M | |
![[IMG]](/icons/image2.gif) | 16723429650EA2E09C-B..> | 2022-12-29 19:42 | 560K | |
![[IMG]](/icons/image2.gif) | 16734040542_20230106..> | 2023-01-11 02:27 | 135K | |
![[IMG]](/icons/image2.gif) | 16735318012A06881D-3..> | 2023-01-12 13:56 | 364K | |
![[IMG]](/icons/image2.gif) | 16736339672.png | 2023-01-13 18:19 | 64K | |
![[IMG]](/icons/image2.gif) | 16736342724D178389-7..> | 2023-01-13 18:24 | 3.2M | |
![[IMG]](/icons/image2.gif) | 16740575794FC72C3A-8..> | 2023-01-18 15:59 | 559K | |
![[IMG]](/icons/image2.gif) | 16741502212U7A3057.jpg | 2023-01-19 17:43 | 2.5M | |
![[IMG]](/icons/image2.gif) | 16741528922U7A2935.jpg | 2023-01-19 18:28 | 1.4M | |
![[IMG]](/icons/image2.gif) | 16741529112U7A2935.jpg | 2023-01-19 18:28 | 1.4M | |
![[IMG]](/icons/image2.gif) | 16741529452U7A2937.jpg | 2023-01-19 18:29 | 1.5M | |
![[IMG]](/icons/image2.gif) | 16741800769B9EFCAE-F..> | 2023-01-20 02:01 | 2.3M | |
![[IMG]](/icons/image2.gif) | 16743312920F66873C-7..> | 2023-01-21 20:01 | 1.0M | |
![[IMG]](/icons/image2.gif) | 16753680625 stacked.jpg | 2023-02-02 20:01 | 2.1M | |
![[IMG]](/icons/image2.gif) | 16753680685 stacked.jpg | 2023-02-02 20:01 | 2.1M | |
![[IMG]](/icons/image2.gif) | 16771849262 copy 5.png | 2023-02-23 20:42 | 75K | |
![[IMG]](/icons/image2.gif) | 16775311351_20230126..> | 2023-02-27 20:52 | 279K | |
![[IMG]](/icons/image2.gif) | 16778053923C999DD8-A..> | 2023-03-03 01:03 | 2.8M | |
![[IMG]](/icons/image2.gif) | 16784784331.png | 2023-03-10 20:00 | 114K | |
![[IMG]](/icons/image2.gif) | 16789755217BE14BA2-0..> | 2023-03-16 14:05 | 175K | |
![[IMG]](/icons/image2.gif) | 16791679815FF38FBB-2..> | 2023-03-18 19:33 | 1.3M | |
![[IMG]](/icons/image2.gif) | 16793657065_28_2022,..> | 2023-03-21 02:28 | 1.4M | |
![[IMG]](/icons/image2.gif) | 16795948113B64B840-8..> | 2023-03-23 18:06 | 1.8M | |
![[IMG]](/icons/image2.gif) | 16796018417DE29970-C..> | 2023-03-23 20:04 | 284K | |
![[IMG]](/icons/image2.gif) | 16800216722D64B127-A..> | 2023-03-28 16:41 | 399K | |
![[IMG]](/icons/image2.gif) | 16804392862_20230327..> | 2023-04-02 12:41 | 137K | |
![[IMG]](/icons/image2.gif) | 16820057631.PNG | 2023-04-20 15:49 | 82K | |
![[IMG]](/icons/image2.gif) | 16822749046AD3725A-9..> | 2023-04-23 18:35 | 1.6M | |
![[IMG]](/icons/image2.gif) | 16831412431.png | 2023-05-03 19:14 | 204K | |
![[IMG]](/icons/image2.gif) | 16831693179DE77469-E..> | 2023-05-04 03:01 | 332K | |
![[IMG]](/icons/image2.gif) | 16833196362FF23A3A-B..> | 2023-05-05 20:47 | 157K | |
![[IMG]](/icons/image2.gif) | 16852090196DF4F910-4..> | 2023-05-27 17:36 | 414K | |
![[IMG]](/icons/image2.gif) | 16856310133.png | 2023-06-01 14:50 | 235K | |
![[IMG]](/icons/image2.gif) | 16866258212.jpg | 2023-06-13 03:10 | 1.7M | |
![[IMG]](/icons/image2.gif) | 16890332451.png | 2023-07-10 23:54 | 73K | |
![[IMG]](/icons/image2.gif) | 16900582569dd42198-6..> | 2023-07-22 20:37 | 2.9M | |
![[IMG]](/icons/image2.gif) | 16905509871.png | 2023-07-28 13:29 | 236K | |
![[IMG]](/icons/image2.gif) | 16909048801AF50852-8..> | 2023-08-01 15:48 | 2.4M | |
![[IMG]](/icons/image2.gif) | 16910793769FFABB0B-A..> | 2023-08-03 16:16 | 549K | |
![[IMG]](/icons/image2.gif) | 16928142062D6758AF-E..> | 2023-08-23 18:10 | 1.2M | |
![[IMG]](/icons/image2.gif) | 16933343930EF60EB9-1..> | 2023-08-29 18:39 | 233K | |
![[IMG]](/icons/image2.gif) | 16959538098DC39D69-A..> | 2023-09-29 02:16 | 20K | |
![[IMG]](/icons/image2.gif) | 16959540428DC39D69-A..> | 2023-09-29 02:20 | 92K | |
![[IMG]](/icons/image2.gif) | 16993728393LB Logo -..> | 2023-11-07 16:00 | 8.0K | |
![[IMG]](/icons/image2.gif) | 17040381820FEF3ECD-3..> | 2023-12-31 15:56 | 252K | |
![[IMG]](/icons/image2.gif) | 17047689394E456119-3..> | 2024-01-09 02:55 | 449K | |
![[IMG]](/icons/image2.gif) | 17125892933.png | 2024-04-08 15:14 | 826K | |
![[IMG]](/icons/image2.gif) | 17159683342.png | 2024-05-17 17:52 | 95K | |
![[IMG]](/icons/image2.gif) | 17300781245Alt Stick..> | 2024-10-28 01:15 | 29K | |
![[IMG]](/icons/image2.gif) | 17300792165Alt Stick..> | 2024-10-28 01:33 | 29K | |
![[IMG]](/icons/image2.gif) | 17305191965B4C376B-3..> | 2024-11-02 03:46 | 516K | |
![[IMG]](/icons/image2.gif) | 17315330130DAC66B1-8..> | 2024-11-13 21:23 | 202K | |
![[IMG]](/icons/image2.gif) | 17381532024E80A87E-3..> | 2025-01-29 12:20 | 2.5M | |
![[IMG]](/icons/image2.gif) | 17429407701.jpg | 2025-03-25 22:12 | 1.2M | |
![[IMG]](/icons/image2.gif) | 17447170681.png | 2025-04-15 11:37 | 1.9M | |
![[IMG]](/icons/image2.gif) | 151009865709F6CF5F-5..> | 2017-11-07 00:00 | 64K | |
![[IMG]](/icons/image2.gif) | 152427729048E7EC77-6..> | 2018-04-20 00:00 | 74K | |
![[IMG]](/icons/image2.gif) | 152768318263FB78C9-3..> | 2018-05-30 00:00 | 878K | |
![[IMG]](/icons/image2.gif) | 153477306051F94D82-2..> | 2018-08-20 00:00 | 1.2M | |
![[IMG]](/icons/image2.gif) | 154636123203_HI-RES_..> | 2019-01-01 00:00 | 949K | |
![[IMG]](/icons/image2.gif) | 154673165288C56DC5-2..> | 2019-01-05 00:00 | 225K | |
![[IMG]](/icons/image2.gif) | 155007118533BCC60F-3..> | 2019-02-13 00:00 | 45K | |
![[IMG]](/icons/image2.gif) | 155183260608AE9730-7..> | 2019-03-05 00:00 | 370K | |
![[IMG]](/icons/image2.gif) | 155379802205-01-16 -..> | 2019-03-28 00:00 | 114K | |
![[IMG]](/icons/image2.gif) | 156018476564AEAA9F-3..> | 2019-06-10 00:00 | 48K | |
![[IMG]](/icons/image2.gif) | 156548493902b08e46cc..> | 2019-08-10 00:00 | 20K | |
![[IMG]](/icons/image2.gif) | 157573565980AcresFar..> | 2019-12-07 00:00 | 34K | |
![[IMG]](/icons/image2.gif) | 157875430501ffba2c25..> | 2020-01-11 00:00 | 772K | |
![[IMG]](/icons/image2.gif) | 158489743864ADA15B-8..> | 2020-03-22 10:17 | 13K | |
![[IMG]](/icons/image2.gif) | 158827845605CFC642-D..> | 2020-04-30 13:27 | 155K | |
![[IMG]](/icons/image2.gif) | 158863897714F57076-C..> | 2020-05-04 17:36 | 138K | |
![[IMG]](/icons/image2.gif) | 158871573320.BFFNega..> | 2020-05-05 14:55 | 57K | |
![[IMG]](/icons/image2.gif) | 158885503059DAF925-9..> | 2020-05-07 05:37 | 1.3M | |
![[IMG]](/icons/image2.gif) | 159536316193BEF156-5..> | 2020-07-21 13:26 | 183K | |
![[IMG]](/icons/image2.gif) | 159551253056DFF67C-1..> | 2020-07-23 06:55 | 1.0M | |
![[IMG]](/icons/image2.gif) | 159570721941C602F3-0..> | 2020-07-25 13:00 | 722K | |
![[IMG]](/icons/image2.gif) | 160079509716DBDBB3-0..> | 2020-09-22 17:18 | 685K | |
![[IMG]](/icons/image2.gif) | 160148149851qk-2e6yO..> | 2020-09-30 15:58 | 22K | |
![[IMG]](/icons/image2.gif) | 160199710617ECF26A-A..> | 2020-10-06 15:11 | 56K | |
![[IMG]](/icons/image2.gif) | 160320356361Mc7ZAl58..> | 2020-10-20 14:19 | 52K | |
![[IMG]](/icons/image2.gif) | 160415590429E0884D-0..> | 2020-10-31 14:51 | 84K | |
![[IMG]](/icons/image2.gif) | 160605293784AEFFF6-8..> | 2020-11-22 13:48 | 471K | |
![[IMG]](/icons/image2.gif) | 160902187319.jpg | 2020-12-26 22:31 | 448K | |
![[IMG]](/icons/image2.gif) | 161011175517D2F29F-0..> | 2021-01-08 13:15 | 75K | |
![[IMG]](/icons/image2.gif) | 161011184317D2F29F-0..> | 2021-01-08 13:17 | 75K | |
![[IMG]](/icons/image2.gif) | 161099929089C8C029-B..> | 2021-01-18 19:48 | 281K | |
![[IMG]](/icons/image2.gif) | 161123252985A170DE-B..> | 2021-01-21 12:35 | 206K | |
![[IMG]](/icons/image2.gif) | 161168456444A10233-5..> | 2021-01-26 18:09 | 1.9M | |
![[IMG]](/icons/image2.gif) | 161218681802D40FF9-9..> | 2021-02-01 13:40 | 159K | |
![[IMG]](/icons/image2.gif) | 161258519338EABBF3-D..> | 2021-02-06 04:19 | 75K | |
![[IMG]](/icons/image2.gif) | 161306428517_900x.jpg | 2021-02-11 17:24 | 99K | |
![[IMG]](/icons/image2.gif) | 161446343037C854C1-9..> | 2021-02-27 22:03 | 94K | |
![[IMG]](/icons/image2.gif) | 161462041232A135B1-5..> | 2021-03-01 17:40 | 354K | |
![[IMG]](/icons/image2.gif) | 161512787452D9B351-7..> | 2021-03-07 14:37 | 53K | |
![[IMG]](/icons/image2.gif) | 161557093512ED701C-C..> | 2021-03-12 17:42 | 1.3M | |
![[IMG]](/icons/image2.gif) | 161584328702EA7BE1-8..> | 2021-03-15 21:21 | 1.4M | |
![[IMG]](/icons/image2.gif) | 161633725125E2B1AA-8..> | 2021-03-21 14:34 | 1.0M | |
![[IMG]](/icons/image2.gif) | 161661079580logo_ori..> | 2021-03-24 18:33 | 23K | |
![[IMG]](/icons/image2.gif) | 161661112880logo_ori..> | 2021-03-24 18:38 | 154K | |
![[IMG]](/icons/image2.gif) | 161729084176F5032C-0..> | 2021-04-01 15:27 | 489K | |
![[IMG]](/icons/image2.gif) | 161845785099C378D3-D..> | 2021-04-15 03:37 | 110K | |
![[IMG]](/icons/image2.gif) | 161879371589C409DC-5..> | 2021-04-19 00:55 | 303K | |
![[IMG]](/icons/image2.gif) | 161911380093EED7F8-5..> | 2021-04-22 17:50 | 246K | |
![[IMG]](/icons/image2.gif) | 161911381793EED7F8-5..> | 2021-04-22 17:50 | 246K | |
![[IMG]](/icons/image2.gif) | 161940050585CF6A37-1..> | 2021-04-26 01:28 | 1.2M | |
![[IMG]](/icons/image2.gif) | 161999905991B88E58-6..> | 2021-05-02 23:44 | 67K | |
![[IMG]](/icons/image2.gif) | 162181411359F8F909-7..> | 2021-05-23 23:55 | 150K | |
![[IMG]](/icons/image2.gif) | 162188892088EA1F07-7..> | 2021-05-24 20:42 | 279K | |
![[IMG]](/icons/image2.gif) | 162204451881DF8A38-0..> | 2021-05-26 15:55 | 114K | |
![[IMG]](/icons/image2.gif) | 162371326358C1C9A1-5..> | 2021-06-14 23:27 | 430K | |
![[IMG]](/icons/image2.gif) | 162378772352ED05D4-1..> | 2021-06-15 20:08 | 227K | |
![[IMG]](/icons/image2.gif) | 162423477417A191C4-E..> | 2021-06-21 00:19 | 738K | |
![[IMG]](/icons/image2.gif) | 162440629411B4B7C0-B..> | 2021-06-22 23:58 | 148K | |
![[IMG]](/icons/image2.gif) | 162446421568C45192-F..> | 2021-06-23 16:03 | 23K | |
![[IMG]](/icons/image2.gif) | 162516338551A58464-6..> | 2021-07-01 18:16 | 280K | |
![[IMG]](/icons/image2.gif) | 162558210891AC31A8-7..> | 2021-07-06 14:35 | 625K | |
![[IMG]](/icons/image2.gif) | 162588431997 Circle.jpg | 2021-07-10 02:31 | 759K | |
![[IMG]](/icons/image2.gif) | 162610522925D5719A-F..> | 2021-07-12 15:53 | 598K | |
![[IMG]](/icons/image2.gif) | 162630322113C65883-6..> | 2021-07-14 22:53 | 184K | |
![[IMG]](/icons/image2.gif) | 162681776543BA950A-2..> | 2021-07-20 21:49 | 379K | |
![[IMG]](/icons/image2.gif) | 162743135930E21B85-E..> | 2021-07-28 00:15 | 204K | |
![[IMG]](/icons/image2.gif) | 162743137230E21B85-E..> | 2021-07-28 00:16 | 204K | |
![[IMG]](/icons/image2.gif) | 162941017700 LONG CR..> | 2021-08-19 21:56 | 413K | |
![[IMG]](/icons/image2.gif) | 162941718330C60F76-E..> | 2021-08-19 23:53 | 121K | |
![[IMG]](/icons/image2.gif) | 163041849209D1F50D-8..> | 2021-08-31 14:01 | 287K | |
![[IMG]](/icons/image2.gif) | 163043134911D47610-2..> | 2021-08-31 17:35 | 1.1M | |
![[IMG]](/icons/image2.gif) | 163069844374B0C177-5..> | 2021-09-03 19:47 | 34K | |
![[IMG]](/icons/image2.gif) | 163110894802 Alterna..> | 2021-09-08 13:49 | 262K | |
![[IMG]](/icons/image2.gif) | 163415233719D8AFEC-8..> | 2021-10-13 19:12 | 51K | |
![[IMG]](/icons/image2.gif) | 163417249713A57C5C-C..> | 2021-10-14 00:48 | 118K | |
![[IMG]](/icons/image2.gif) | 163528014112AFC742-C..> | 2021-10-26 20:29 | 915K | |
![[IMG]](/icons/image2.gif) | 163562717390E5C5F0-6..> | 2021-10-30 20:52 | 175K | |
![[IMG]](/icons/image2.gif) | 163562717890E5C5F0-6..> | 2021-10-30 20:52 | 175K | |
![[IMG]](/icons/image2.gif) | 163566167181C2E699-C..> | 2021-10-31 06:27 | 612K | |
![[IMG]](/icons/image2.gif) | 163571594286A25451-3..> | 2021-10-31 21:32 | 470K | |
![[IMG]](/icons/image2.gif) | 163571613586A25451-3..> | 2021-10-31 21:35 | 470K | |
![[IMG]](/icons/image2.gif) | 163716474380AcresFar..> | 2021-11-17 15:59 | 29K | |
![[IMG]](/icons/image2.gif) | 163772112000F75107-D..> | 2021-11-24 02:32 | 2.0M | |
![[IMG]](/icons/image2.gif) | 163772112600F75107-D..> | 2021-11-24 02:32 | 2.0M | |
![[IMG]](/icons/image2.gif) | 163829153953FBA095-9..> | 2021-11-30 16:58 | 307K | |
![[IMG]](/icons/image2.gif) | 163830236377AA8148-C..> | 2021-11-30 19:59 | 1.6M | |
![[IMG]](/icons/image2.gif) | 163830236777AA8148-C..> | 2021-11-30 19:59 | 1.6M | |
![[IMG]](/icons/image2.gif) | 164183857336_crop.jpg | 2022-01-10 18:16 | 680K | |
![[IMG]](/icons/image2.gif) | 164187775303C9465E-0..> | 2022-01-11 05:09 | 4.0M | |
![[IMG]](/icons/image2.gif) | 164384517320D69CDD-C..> | 2022-02-02 23:39 | 1.2M | |
![[IMG]](/icons/image2.gif) | 164398946865C0286D-3..> | 2022-02-04 15:44 | 1.0M | |
![[IMG]](/icons/image2.gif) | 164468652047FF5474-A..> | 2022-02-12 17:22 | 2.0M | |
![[IMG]](/icons/image2.gif) | 164468657247FF5474-A..> | 2022-02-12 17:22 | 2.0M | |
![[IMG]](/icons/image2.gif) | 164478438267C9F503-E..> | 2022-02-13 20:33 | 1.9M | |
![[IMG]](/icons/image2.gif) | 164711001299BF6E93-F..> | 2022-03-12 18:33 | 672K | |
![[IMG]](/icons/image2.gif) | 164727931279E99B27-F..> | 2022-03-14 17:35 | 270K | |
![[IMG]](/icons/image2.gif) | 164729086004D3D692-8..> | 2022-03-14 20:47 | 132K | |
![[IMG]](/icons/image2.gif) | 164872343279E6118F-F..> | 2022-03-31 10:43 | 356K | |
![[IMG]](/icons/image2.gif) | 164908280817BA54F0-7..> | 2022-04-04 14:33 | 264K | |
![[IMG]](/icons/image2.gif) | 164917196563EFBF75-9..> | 2022-04-05 15:19 | 594K | |
![[IMG]](/icons/image2.gif) | 164978878544D4F3F6-4..> | 2022-04-12 18:39 | 320K | |
![[IMG]](/icons/image2.gif) | 165072442541C791DF-A..> | 2022-04-23 14:33 | 517K | |
![[IMG]](/icons/image2.gif) | 165407722958A27B10-7..> | 2022-06-01 09:53 | 1.2M | |
![[IMG]](/icons/image2.gif) | 165414073302.png | 2022-06-02 03:32 | 75K | |
![[IMG]](/icons/image2.gif) | 165488438273EFB82B-B..> | 2022-06-10 18:06 | 853K | |
![[IMG]](/icons/image2.gif) | 165523460531D09338-C..> | 2022-06-14 19:23 | 730K | |
![[IMG]](/icons/image2.gif) | 165566003920C996C7-B..> | 2022-06-19 17:33 | 323K | |
![[IMG]](/icons/image2.gif) | 165645391290E4B54B-C..> | 2022-06-28 22:05 | 184K | |
![[IMG]](/icons/image2.gif) | 165663352623DD0D36-7..> | 2022-06-30 23:58 | 161K | |
![[IMG]](/icons/image2.gif) | 165733081725AA52F6-2..> | 2022-07-09 01:40 | 43K | |
![[IMG]](/icons/image2.gif) | 165757941392F4DC08-5..> | 2022-07-11 22:43 | 151K | |
![[IMG]](/icons/image2.gif) | 165853025924E2864D-5..> | 2022-07-22 22:50 | 2.2M | |
![[IMG]](/icons/image2.gif) | 165863119864C5A7A9-F..> | 2022-07-24 02:53 | 3.2M | |
![[IMG]](/icons/image2.gif) | 165870103431B483C5-9..> | 2022-07-24 22:17 | 271K | |
![[IMG]](/icons/image2.gif) | 165894827805E48818-7..> | 2022-07-27 18:57 | 154K | |
![[IMG]](/icons/image2.gif) | 165895363505E48818-7..> | 2022-07-27 20:27 | 154K | |
![[IMG]](/icons/image2.gif) | 165958101313D028CD-C..> | 2022-08-04 02:43 | 1.0M | |
![[IMG]](/icons/image2.gif) | 166000464511A558BC-3..> | 2022-08-09 00:24 | 810K | |
![[IMG]](/icons/image2.gif) | 166069186041D0FBA9-B..> | 2022-08-16 23:17 | 128K | |
![[IMG]](/icons/image2.gif) | 166190250388D80B9D-4..> | 2022-08-30 23:35 | 122K | |
![[IMG]](/icons/image2.gif) | 166216193986FCA39B-E..> | 2022-09-02 23:38 | 2.1M | |
![[IMG]](/icons/image2.gif) | 166247870204C6CFC6-6..> | 2022-09-06 15:38 | 215K | |
![[IMG]](/icons/image2.gif) | 166393747008D2FD43-5..> | 2022-09-23 12:51 | 76K | |
![[IMG]](/icons/image2.gif) | 166553716481C9091D-0..> | 2022-10-12 01:12 | 2.5M | |
![[IMG]](/icons/image2.gif) | 166636929744AA29A7-B..> | 2022-10-21 16:21 | 175K | |
![[IMG]](/icons/image2.gif) | 166679358284BB2122-3..> | 2022-10-26 14:13 | 692K | |
![[IMG]](/icons/image2.gif) | 167084508466A8DCA8-8..> | 2022-12-12 11:38 | 287K | |
![[IMG]](/icons/image2.gif) | 167084509566A8DCA8-8..> | 2022-12-12 11:38 | 287K | |
![[IMG]](/icons/image2.gif) | 167293438427E98C60-F..> | 2023-01-05 15:59 | 2.8M | |
![[IMG]](/icons/image2.gif) | 167296476307FB84A4-2..> | 2023-01-06 00:26 | 2.0M | |
![[IMG]](/icons/image2.gif) | 167337885097AAEA19-3..> | 2023-01-10 19:27 | 1.7M | |
![[IMG]](/icons/image2.gif) | 167468282730B28D81-6..> | 2023-01-25 21:40 | 3.5M | |
![[IMG]](/icons/image2.gif) | 167573798067EF6847-F..> | 2023-02-07 02:46 | 184K | |
![[IMG]](/icons/image2.gif) | 167573800467EF6847-F..> | 2023-02-07 02:46 | 184K | |
![[IMG]](/icons/image2.gif) | 167630155416A9A35F-F..> | 2023-02-13 15:19 | 72K | |
![[IMG]](/icons/image2.gif) | 167910292241E5DFFE-2..> | 2023-03-18 01:28 | 341K | |
![[IMG]](/icons/image2.gif) | 167962593990C77BA5-F..> | 2023-03-24 02:45 | 117K | |
![[IMG]](/icons/image2.gif) | 168081933726E96C94-A..> | 2023-04-06 22:15 | 198K | |
![[IMG]](/icons/image2.gif) | 168279149930B46365-0..> | 2023-04-29 18:04 | 2.9M | |
![[IMG]](/icons/image2.gif) | 168296479823-05-01 1..> | 2023-05-01 18:13 | 4.2M | |
![[IMG]](/icons/image2.gif) | 168389643511.png | 2023-05-12 13:00 | 90K | |
![[IMG]](/icons/image2.gif) | 168581613359D14667-1..> | 2023-06-03 18:15 | 1.1M | |
![[IMG]](/icons/image2.gif) | 168859616295B919B6-E..> | 2023-07-05 22:29 | 414K | |
![[IMG]](/icons/image2.gif) | 169020422023-IMG_454..> | 2023-07-24 13:10 | 1.3M | |
![[IMG]](/icons/image2.gif) | 169083992987DD113C-E..> | 2023-07-31 21:45 | 119K | |
![[IMG]](/icons/image2.gif) | 169192745612D7C9DD-E..> | 2023-08-13 11:50 | 676K | |
![[IMG]](/icons/image2.gif) | 169505084655DB8DC2-C..> | 2023-09-18 15:27 | 2.8M | |
![[IMG]](/icons/image2.gif) | 169646518844CCFC87-7..> | 2023-10-05 00:19 | 164K | |
![[IMG]](/icons/image2.gif) | 169808750529D1F069-B..> | 2023-10-23 18:58 | 89K | |
![[IMG]](/icons/image2.gif) | 171400660270E4D10E-7..> | 2024-04-25 00:56 | 74K | |
![[IMG]](/icons/image2.gif) | 172403083500C563DA-8..> | 2024-08-19 01:27 | 465K | |
![[IMG]](/icons/image2.gif) | 172993782512EA5D28-7..> | 2024-10-26 10:17 | 249K | |
![[IMG]](/icons/image2.gif) | 173815315002CFBD4D-3..> | 2025-01-29 12:19 | 146K | |
![[IMG]](/icons/image2.gif) | 173817708410.jpg | 2025-01-29 18:58 | 2.7M | |
![[IMG]](/icons/image2.gif) | 173817710910.jpg | 2025-01-29 18:58 | 2.7M | |
![[IMG]](/icons/image2.gif) | 1494286128258sMJTY3Q..> | 2017-05-08 00:00 | 16K | |
![[IMG]](/icons/image2.gif) | 1517434534152B3EC3-C..> | 2018-01-31 00:00 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1536529962651D8969-C..> | 2018-09-09 00:00 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1558370915429E7DF4-E..> | 2019-05-20 00:00 | 825K | |
![[IMG]](/icons/image2.gif) | 1568769604321fd2_501..> | 2019-09-17 00:00 | 226K | |
![[IMG]](/icons/image2.gif) | 1574084151317 Logo.png | 2019-11-18 00:00 | 102K | |
![[IMG]](/icons/image2.gif) | 1576037395015.jpg | 2019-12-10 00:00 | 312K | |
![[IMG]](/icons/image2.gif) | 1577750187525EC132-4..> | 2019-12-30 00:00 | 89K | |
![[IMG]](/icons/image2.gif) | 1580770514335D2003-0..> | 2020-02-03 00:00 | 50K | |
![[IMG]](/icons/image2.gif) | 1586636774084A09FB-A..> | 2020-04-11 13:26 | 19K | |
![[IMG]](/icons/image2.gif) | 1590074332271EDA58-6..> | 2020-05-21 08:18 | 134K | |
![[IMG]](/icons/image2.gif) | 1594134552460C37DA-8..> | 2020-07-07 08:09 | 66K | |
![[IMG]](/icons/image2.gif) | 1595013059001.png | 2020-07-17 12:10 | 188K | |
![[IMG]](/icons/image2.gif) | 1596168687200X20~1.JPG | 2020-07-30 21:11 | 65K | |
![[IMG]](/icons/image2.gif) | 1605215314789C85AD-6..> | 2020-11-12 21:08 | 477K | |
![[IMG]](/icons/image2.gif) | 1606935999866C472A-8..> | 2020-12-02 19:06 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1610294143794DACCC-3..> | 2021-01-10 15:55 | 105K | |
![[IMG]](/icons/image2.gif) | 1610480523280-280108..> | 2021-01-12 19:42 | 89K | |
![[IMG]](/icons/image2.gif) | 1610641933350A3F11-F..> | 2021-01-14 16:32 | 229K | |
![[IMG]](/icons/image2.gif) | 1612896398626B511D-C..> | 2021-02-09 18:46 | 111K | |
![[IMG]](/icons/image2.gif) | 1612976795613BA4CE-1..> | 2021-02-10 17:06 | 23K | |
![[IMG]](/icons/image2.gif) | 1613269139463DB3D9-D..> | 2021-02-14 02:18 | 290K | |
![[IMG]](/icons/image2.gif) | 1614222407850AE349-6..> | 2021-02-25 03:06 | 630K | |
![[IMG]](/icons/image2.gif) | 1614696534864CCF8C-7..> | 2021-03-02 14:48 | 227K | |
![[IMG]](/icons/image2.gif) | 1615436835641FD96D-8..> | 2021-03-11 04:27 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1615857112282FB213-E..> | 2021-03-16 01:11 | 331K | |
![[IMG]](/icons/image2.gif) | 1615857313282FB213-E..> | 2021-03-16 01:15 | 331K | |
![[IMG]](/icons/image2.gif) | 1617641036049C91E8-7..> | 2021-04-05 16:43 | 209K | |
![[IMG]](/icons/image2.gif) | 1617654900319E1924-5..> | 2021-04-05 20:35 | 696K | |
![[IMG]](/icons/image2.gif) | 1617906663400dpiLogo..> | 2021-04-08 18:31 | 286K | |
![[IMG]](/icons/image2.gif) | 1618409830261D440E-6..> | 2021-04-14 14:17 | 167K | |
![[IMG]](/icons/image2.gif) | 1618845605224CD42A-6..> | 2021-04-19 15:20 | 37K | |
![[IMG]](/icons/image2.gif) | 1618931477800 x 651.jpg | 2021-04-20 15:11 | 32K | |
![[IMG]](/icons/image2.gif) | 1619300579400JpgdpiL..> | 2021-04-24 21:42 | 259K | |
![[IMG]](/icons/image2.gif) | 1620248154838F427F-B..> | 2021-05-05 20:55 | 240K | |
![[IMG]](/icons/image2.gif) | 1620311499735C5B96-C..> | 2021-05-06 14:31 | 148K | |
![[IMG]](/icons/image2.gif) | 1620677304945CA9C8-1..> | 2021-05-10 20:08 | 144K | |
![[IMG]](/icons/image2.gif) | 1622132707640C81F9-A..> | 2021-05-27 16:25 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1623335776722BF4D4-3..> | 2021-06-10 14:36 | 109K | |
![[IMG]](/icons/image2.gif) | 1623707270555E42D1-F..> | 2021-06-14 21:47 | 338K | |
![[IMG]](/icons/image2.gif) | 1623760942917BD3C6-1..> | 2021-06-15 12:42 | 27K | |
![[IMG]](/icons/image2.gif) | 1623809841820.jpeg | 2021-06-16 02:17 | 137K | |
![[IMG]](/icons/image2.gif) | 1625103667847EF8C0-C..> | 2021-07-01 01:41 | 68K | |
![[IMG]](/icons/image2.gif) | 1625786134594A1091-A..> | 2021-07-08 23:15 | 36K | |
![[IMG]](/icons/image2.gif) | 1626137790950DC8A7-D..> | 2021-07-13 00:56 | 172K | |
![[IMG]](/icons/image2.gif) | 1626225849123_1(2).jpeg | 2021-07-14 01:24 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1626271256140BA15F-A..> | 2021-07-14 14:00 | 17K | |
![[IMG]](/icons/image2.gif) | 1626310610800E0318-8..> | 2021-07-15 00:56 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1627389100400x400_Tr..> | 2021-07-27 12:31 | 136K | |
![[IMG]](/icons/image2.gif) | 1627389174400x400_WB..> | 2021-07-27 12:32 | 173K | |
![[IMG]](/icons/image2.gif) | 1627389182400x400_WB..> | 2021-07-27 12:33 | 173K | |
![[IMG]](/icons/image2.gif) | 1627474822683BBFFC-4..> | 2021-07-28 12:20 | 298K | |
![[IMG]](/icons/image2.gif) | 1627599416215EC5DC-3..> | 2021-07-29 22:56 | 282K | |
![[IMG]](/icons/image2.gif) | 1627935935032B99F3-6..> | 2021-08-02 20:25 | 118K | |
![[IMG]](/icons/image2.gif) | 1629129139763A6289-F..> | 2021-08-16 15:52 | 676K | |
![[IMG]](/icons/image2.gif) | 1629377613452A5AC9-6..> | 2021-08-19 12:53 | 941K | |
![[IMG]](/icons/image2.gif) | 1629826969831BACB1-3..> | 2021-08-24 17:42 | 87K | |
![[IMG]](/icons/image2.gif) | 1629893477716 Fresh ..> | 2021-08-25 12:11 | 57K | |
![[IMG]](/icons/image2.gif) | 1629894877119 mid.jpg | 2021-08-25 12:34 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1630001405618BDCC8-8..> | 2021-08-26 18:10 | 157K | |
![[IMG]](/icons/image2.gif) | 1630167375164A24A0-F..> | 2021-08-28 16:16 | 90K | |
![[IMG]](/icons/image2.gif) | 1630420614122A100B-D..> | 2021-08-31 14:36 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1630577961507FACEB-0..> | 2021-09-02 10:19 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1631221574563B08A4-6..> | 2021-09-09 21:06 | 434K | |
![[IMG]](/icons/image2.gif) | 1632260286030D3D5A-D..> | 2021-09-21 21:38 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1632405370779B4A2E-C..> | 2021-09-23 13:56 | 577K | |
![[IMG]](/icons/image2.gif) | 1632409335541A9FC3-D..> | 2021-09-23 15:02 | 19K | |
![[IMG]](/icons/image2.gif) | 1632410985541A9FC3-D..> | 2021-09-23 15:29 | 19K | |
![[IMG]](/icons/image2.gif) | 1634676597064C393B-6..> | 2021-10-19 20:49 | 168K | |
![[IMG]](/icons/image2.gif) | 1634676648064C393B-6..> | 2021-10-19 20:50 | 168K | |
![[IMG]](/icons/image2.gif) | 1634683434582DE2B6-6..> | 2021-10-19 22:43 | 116K | |
![[IMG]](/icons/image2.gif) | 1635304505690e94aea3..> | 2021-10-27 03:15 | 4.8K | |
![[IMG]](/icons/image2.gif) | 1636080321765EACA4-F..> | 2021-11-05 02:45 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1640740618570F5EF2-2..> | 2021-12-29 01:16 | 154K | |
![[IMG]](/icons/image2.gif) | 1641579935062D8BDF-B..> | 2022-01-07 18:25 | 615K | |
![[IMG]](/icons/image2.gif) | 1643987659356B6C25-0..> | 2022-02-04 15:14 | 2.8M | |
![[IMG]](/icons/image2.gif) | 1645227875400dpiLogo..> | 2022-02-18 23:44 | 170K | |
![[IMG]](/icons/image2.gif) | 1649788887639CC816-8..> | 2022-04-12 18:41 | 313K | |
![[IMG]](/icons/image2.gif) | 1653785176586FBBEB-F..> | 2022-05-29 00:46 | 2.1M | |
![[IMG]](/icons/image2.gif) | 1657647221211C5C30-0..> | 2022-07-12 17:33 | 123K | |
![[IMG]](/icons/image2.gif) | 1658254607245F8D03-8..> | 2022-07-19 18:16 | 3.1M | |
![[IMG]](/icons/image2.gif) | 1658590597152C142E-A..> | 2022-07-23 15:36 | 162K | |
![[IMG]](/icons/image2.gif) | 1658631010107E07A1-7..> | 2022-07-24 02:50 | 3.2M | |
![[IMG]](/icons/image2.gif) | 1659050286391FC7D9-C..> | 2022-07-28 23:18 | 810K | |
![[IMG]](/icons/image2.gif) | 1659325500104F0DD0-7..> | 2022-08-01 03:45 | 302K | |
![[IMG]](/icons/image2.gif) | 1661195792279D5072-D..> | 2022-08-22 19:16 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1662661952316C0BE7-9..> | 2022-09-08 18:32 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1664933297618CCC1C-C..> | 2022-10-05 01:28 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1666703710123_1(4).jpeg | 2022-10-25 13:15 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1668097896832C3F89-B..> | 2022-11-10 16:31 | 959K | |
![[IMG]](/icons/image2.gif) | 1669837930104F8197-D..> | 2022-11-30 19:52 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1672343283438F684B-6..> | 2022-12-29 19:48 | 141K | |
![[IMG]](/icons/image2.gif) | 1672751347733B2DEB-2..> | 2023-01-03 13:09 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1673612612123_1_22.jpeg | 2023-01-13 12:23 | 35K | |
![[IMG]](/icons/image2.gif) | 1675568261733F35AD-F..> | 2023-02-05 03:37 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1675568272733F35AD-F..> | 2023-02-05 03:37 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1676828004958A4408-C..> | 2023-02-19 17:33 | 260K | |
![[IMG]](/icons/image2.gif) | 1678196507752EABD5-6..> | 2023-03-07 13:41 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1679196931257B2EB6-B..> | 2023-03-19 03:35 | 2.3M | |
![[IMG]](/icons/image2.gif) | 1680529769991F1B67-5..> | 2023-04-03 13:49 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1686936349411CDBBF-2..> | 2023-06-16 17:25 | 3.5M | |
![[IMG]](/icons/image2.gif) | 1689982487774E7867-D..> | 2023-07-21 23:34 | 105K | |
![[IMG]](/icons/image2.gif) | 1693305572400JpgdpiL..> | 2023-08-29 10:39 | 285K | |
![[IMG]](/icons/image2.gif) | 1696452462512.png | 2023-10-04 20:47 | 78K | |
![[IMG]](/icons/image2.gif) | 1703185196596 Market..> | 2023-12-21 18:59 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1714069984250x250.jpg | 2024-04-25 18:33 | 37K | |
![[IMG]](/icons/image2.gif) | 1730139485177D6F15-B..> | 2024-10-28 18:18 | 124K | |
![[IMG]](/icons/image2.gif) | 1730519114083BD5FA-6..> | 2024-11-02 03:45 | 1.3M | |
![[IMG]](/icons/image2.gif) | 14606486732014-10-01..> | 2016-04-14 00:00 | 1.7M | |
![[IMG]](/icons/image2.gif) | 14611800442016 logo ..> | 2016-04-20 00:00 | 71K | |
![[IMG]](/icons/image2.gif) | 14670309512016-06-27..> | 2016-06-27 00:00 | 25K | |
![[IMG]](/icons/image2.gif) | 14845772032017-01-16..> | 2017-01-16 00:00 | 96K | |
![[IMG]](/icons/image2.gif) | 15296341092018-06-21..> | 2018-06-21 00:00 | 227K | |
![[IMG]](/icons/image2.gif) | 15303236419281AA83-7..> | 2018-06-29 00:00 | 461K | |
![[IMG]](/icons/image2.gif) | 15364234249961B3C5-3..> | 2018-09-08 00:00 | 401K | |
![[IMG]](/icons/image2.gif) | 15409128032018-10-29..> | 2018-10-30 00:00 | 128K | |
![[IMG]](/icons/image2.gif) | 15426011127966DB42-E..> | 2018-11-18 00:00 | 651K | |
![[IMG]](/icons/image2.gif) | 15524956942019-03-06..> | 2019-03-13 00:00 | 235K | |
![[IMG]](/icons/image2.gif) | 15833781852017 Avon ..> | 2020-03-04 00:00 | 573K | |
![[IMG]](/icons/image2.gif) | 15898341582019grando..> | 2020-05-18 13:35 | 30K | |
![[IMG]](/icons/image2.gif) | 15905195653600d13a-f..> | 2020-05-26 11:59 | 16K | |
![[IMG]](/icons/image2.gif) | 15923214186974B845-9..> | 2020-06-16 08:30 | 67K | |
![[IMG]](/icons/image2.gif) | 15952564363243_Flour..> | 2020-07-20 07:47 | 788K | |
![[IMG]](/icons/image2.gif) | 15994056012018_GM_lo..> | 2020-09-06 15:20 | 23K | |
![[IMG]](/icons/image2.gif) | 16012260102019 Circa..> | 2020-09-27 17:00 | 589K | |
![[IMG]](/icons/image2.gif) | 16019191392020-10-05..> | 2020-10-05 17:32 | 256K | |
![[IMG]](/icons/image2.gif) | 16033005313747DF02-5..> | 2020-10-21 17:15 | 74K | |
![[IMG]](/icons/image2.gif) | 16041231701275EAF7-9..> | 2020-10-31 05:46 | 53K | |
![[IMG]](/icons/image2.gif) | 16046384772020 Logo.png | 2020-11-06 04:54 | 64K | |
![[IMG]](/icons/image2.gif) | 16071118572020_Smile..> | 2020-12-04 19:57 | 9.1K | |
![[IMG]](/icons/image2.gif) | 16095522974750BE61-8..> | 2021-01-02 01:51 | 1.6M | |
![[IMG]](/icons/image2.gif) | 16106335412020-10-05..> | 2021-01-14 14:12 | 256K | |
![[IMG]](/icons/image2.gif) | 16111005910001.jpg | 2021-01-19 23:56 | 135K | |
![[IMG]](/icons/image2.gif) | 16112384752020-10-05..> | 2021-01-21 14:14 | 256K | |
![[IMG]](/icons/image2.gif) | 16116259822021-01-25..> | 2021-01-26 01:53 | 770K | |
![[IMG]](/icons/image2.gif) | 16117038405516A9DB-A..> | 2021-01-26 23:30 | 362K | |
![[IMG]](/icons/image2.gif) | 16118677534303FDF3-5..> | 2021-01-28 21:02 | 533K | |
![[IMG]](/icons/image2.gif) | 16122168218896CC49-5..> | 2021-02-01 22:00 | 696K | |
![[IMG]](/icons/image2.gif) | 16122730312020 Moyer..> | 2021-02-02 13:37 | 536K | |
![[IMG]](/icons/image2.gif) | 16122864396147.jpg | 2021-02-02 17:20 | 1.2M | |
![[IMG]](/icons/image2.gif) | 16125723520310F5C8-D..> | 2021-02-06 00:45 | 608K | |
![[IMG]](/icons/image2.gif) | 16127205066057.jpeg | 2021-02-07 17:55 | 195K | |
![[IMG]](/icons/image2.gif) | 16130691634301A580-B..> | 2021-02-11 18:46 | 68K | |
![[IMG]](/icons/image2.gif) | 16130925717261AB40-A..> | 2021-02-12 01:16 | 119K | |
![[IMG]](/icons/image2.gif) | 16131412982021 Logo ..> | 2021-02-12 14:48 | 46K | |
![[IMG]](/icons/image2.gif) | 16136010790003.jpg | 2021-02-17 22:31 | 288K | |
![[IMG]](/icons/image2.gif) | 16154888512020 MoJos..> | 2021-03-11 18:54 | 309K | |
![[IMG]](/icons/image2.gif) | 16157290285006BA1D-5..> | 2021-03-14 13:37 | 104K | |
![[IMG]](/icons/image2.gif) | 16158688272019 bitty..> | 2021-03-16 04:27 | 83K | |
![[IMG]](/icons/image2.gif) | 16163371655422DE30-C..> | 2021-03-21 14:32 | 415K | |
![[IMG]](/icons/image2.gif) | 16179729202021farmsi..> | 2021-04-09 12:55 | 234K | |
![[IMG]](/icons/image2.gif) | 16201379044526B1F4-B..> | 2021-05-04 14:18 | 106K | |
![[IMG]](/icons/image2.gif) | 16203008152018-08-10..> | 2021-05-06 11:33 | 160K | |
![[IMG]](/icons/image2.gif) | 16219667498978AFFC-5..> | 2021-05-25 18:19 | 42K | |
![[IMG]](/icons/image2.gif) | 16226789820001 (1).jpg | 2021-06-03 00:09 | 47K | |
![[IMG]](/icons/image2.gif) | 16240376141200x1200-..> | 2021-06-18 17:33 | 1.3M | |
![[IMG]](/icons/image2.gif) | 16249791627592DAA2-E..> | 2021-06-29 15:06 | 207K | |
![[IMG]](/icons/image2.gif) | 16249791637592DAA2-E..> | 2021-06-29 15:06 | 207K | |
![[IMG]](/icons/image2.gif) | 16264395379251AC28-3..> | 2021-07-16 12:45 | 278K | |
![[IMG]](/icons/image2.gif) | 16276046127491 tom b..> | 2021-07-30 00:23 | 336K | |
![[IMG]](/icons/image2.gif) | 16279997506282CD31-2..> | 2021-08-03 14:09 | 513K | |
![[IMG]](/icons/image2.gif) | 16297720929898A522-9..> | 2021-08-24 02:28 | 618K | |
![[IMG]](/icons/image2.gif) | 16297777652021-04-21..> | 2021-08-24 04:02 | 74K | |
![[IMG]](/icons/image2.gif) | 16298960129273B106-1..> | 2021-08-25 12:53 | 455K | |
![[IMG]](/icons/image2.gif) | 16301136542108C080-2..> | 2021-08-28 01:20 | 375K | |
![[IMG]](/icons/image2.gif) | 16301857200128FE44-3..> | 2021-08-28 21:22 | 43K | |
![[IMG]](/icons/image2.gif) | 16306982506153CD4C-9..> | 2021-09-03 19:44 | 1.9M | |
![[IMG]](/icons/image2.gif) | 16306983626153CD4C-9..> | 2021-09-03 19:46 | 1.9M | |
![[IMG]](/icons/image2.gif) | 16312791952774AB16-6..> | 2021-09-10 13:06 | 972K | |
![[IMG]](/icons/image2.gif) | 16324903439028EF44-6..> | 2021-09-24 13:32 | 48K | |
![[IMG]](/icons/image2.gif) | 16355128984103EB4B-F..> | 2021-10-29 13:08 | 730K | |
![[IMG]](/icons/image2.gif) | 16391455081609A566-F..> | 2021-12-10 14:11 | 87K | |
![[IMG]](/icons/image2.gif) | 16430507682013 362 b..> | 2022-01-24 18:59 | 2.3M | |
![[IMG]](/icons/image2.gif) | 16440810946125FCCB-1..> | 2022-02-05 17:11 | 115K | |
![[IMG]](/icons/image2.gif) | 16440815492017 12 11..> | 2022-02-05 17:19 | 733K | |
![[IMG]](/icons/image2.gif) | 16440850416125FCCB-1..> | 2022-02-05 18:17 | 115K | |
![[IMG]](/icons/image2.gif) | 16447005906286F166-8..> | 2022-02-12 21:16 | 1.4M | |
![[IMG]](/icons/image2.gif) | 16450644482021 sunfl..> | 2022-02-17 02:20 | 3.6M | |
![[IMG]](/icons/image2.gif) | 16451101892021 Falls..> | 2022-02-17 15:03 | 2.7M | |
![[IMG]](/icons/image2.gif) | 16468340253769E802-8..> | 2022-03-09 13:53 | 132K | |
![[IMG]](/icons/image2.gif) | 16472866203324E8C3-9..> | 2022-03-14 19:37 | 380K | |
![[IMG]](/icons/image2.gif) | 16481310364325AC68-D..> | 2022-03-24 14:10 | 316K | |
![[IMG]](/icons/image2.gif) | 16482257762022-03-25..> | 2022-03-25 16:29 | 299K | |
![[IMG]](/icons/image2.gif) | 16509817455655DC62-E..> | 2022-04-26 14:02 | 338K | |
![[IMG]](/icons/image2.gif) | 16511499148369DD42-F..> | 2022-04-28 12:45 | 643K | |
![[IMG]](/icons/image2.gif) | 16518478372014-07-23..> | 2022-05-06 14:37 | 2.8M | |
![[IMG]](/icons/image2.gif) | 16524958211836 - 300..> | 2022-05-14 02:37 | 822K | |
![[IMG]](/icons/image2.gif) | 16547032503339A8A1-5..> | 2022-06-08 15:47 | 2.0M | |
![[IMG]](/icons/image2.gif) | 16551475257302F049-B..> | 2022-06-13 19:12 | 460K | |
![[IMG]](/icons/image2.gif) | 16574064142022 HCR l..> | 2022-07-09 22:40 | 64K | |
![[IMG]](/icons/image2.gif) | 16578588937330E307-7..> | 2022-07-15 04:21 | 3.0M | |
![[IMG]](/icons/image2.gif) | 16582549436676A3CA-5..> | 2022-07-19 18:22 | 2.9M | |
![[IMG]](/icons/image2.gif) | 16588586442020 Logo_..> | 2022-07-26 18:04 | 254K | |
![[IMG]](/icons/image2.gif) | 16621442641397B9D9-A..> | 2022-09-02 18:44 | 80K | |
![[IMG]](/icons/image2.gif) | 16633663417445FEA9-4..> | 2022-09-16 22:12 | 2.3M | |
![[IMG]](/icons/image2.gif) | 16673490152323C2E4-B..> | 2022-11-02 00:30 | 201K | |
![[IMG]](/icons/image2.gif) | 16680374551835F92C-B..> | 2022-11-09 23:44 | 2.0M | |
![[IMG]](/icons/image2.gif) | 16703934178755F881-5..> | 2022-12-07 06:10 | 214K | |
![[IMG]](/icons/image2.gif) | 16723431600086FB9D-5..> | 2022-12-29 19:46 | 20K | |
![[IMG]](/icons/image2.gif) | 16734765321963 Layto..> | 2023-01-11 22:35 | 3.2M | |
![[IMG]](/icons/image2.gif) | 16736690736562CC30-6..> | 2023-01-14 04:04 | 1.0M | |
![[IMG]](/icons/image2.gif) | 16758140276034FE93-4..> | 2023-02-07 23:53 | 1.0M | |
![[IMG]](/icons/image2.gif) | 16769069680001-83712..> | 2023-02-20 15:29 | 954K | |
![[IMG]](/icons/image2.gif) | 16779561371145DEF3-B..> | 2023-03-04 18:55 | 1.9M | |
![[IMG]](/icons/image2.gif) | 16791680115672ED76-B..> | 2023-03-18 19:33 | 1.3M | |
![[IMG]](/icons/image2.gif) | 16812191371724c4c7-b..> | 2023-04-11 13:18 | 26K | |
![[IMG]](/icons/image2.gif) | 16817410505409A8A4-9..> | 2023-04-17 14:17 | 82K | |
![[IMG]](/icons/image2.gif) | 16926669692022 QCF L..> | 2023-08-22 01:16 | 97K | |
![[IMG]](/icons/image2.gif) | 16956531420819_wrigh..> | 2023-09-25 14:45 | 446K | |
![[IMG]](/icons/image2.gif) | 16956549850819_wrigh..> | 2023-09-25 15:16 | 36K | |
![[IMG]](/icons/image2.gif) | 16956550000819_wrigh..> | 2023-09-25 15:16 | 36K | |
![[IMG]](/icons/image2.gif) | 16976882328496.jpg | 2023-10-19 04:03 | 630K | |
![[IMG]](/icons/image2.gif) | 16986649052023_FOX_0..> | 2023-10-30 11:21 | 1.3M | |
![[IMG]](/icons/image2.gif) | 17013578851889Produc..> | 2023-11-30 15:24 | 257K | |
![[IMG]](/icons/image2.gif) | 17018304046294E822-4..> | 2023-12-06 02:40 | 350K | |
![[IMG]](/icons/image2.gif) | 17040382877031FD7B-8..> | 2023-12-31 15:58 | 317K | |
![[IMG]](/icons/image2.gif) | 17201463652024TheSun..> | 2024-07-05 02:26 | 346K | |
![[IMG]](/icons/image2.gif) | 17257587029692 Latis..> | 2024-09-08 01:25 | 1.7M | |
![[IMG]](/icons/image2.gif) | 17310834572012-06-15..> | 2024-11-08 16:30 | 835K | |
![[IMG]](/icons/image2.gif) | 153439215945940D5A-C..> | 2018-08-15 00:00 | 171K | |
![[IMG]](/icons/image2.gif) | 153498791147581D31-D..> | 2018-08-22 00:00 | 350K | |
![[IMG]](/icons/image2.gif) | 157652742137106F82-4..> | 2019-12-16 00:00 | 263K | |
![[IMG]](/icons/image2.gif) | 160005380147608_1759..> | 2020-09-14 03:23 | 10K | |
![[IMG]](/icons/image2.gif) | 160251740232585B7A-E..> | 2020-10-12 15:43 | 253K | |
![[IMG]](/icons/image2.gif) | 160503347816431.jpeg | 2020-11-10 18:37 | 300K | |
![[IMG]](/icons/image2.gif) | 160798968524978EC1-1..> | 2020-12-14 23:48 | 1.9M | |
![[IMG]](/icons/image2.gif) | 160804323475481C6D-F..> | 2020-12-15 14:40 | 129K | |
![[IMG]](/icons/image2.gif) | 160856571717546B8E-E..> | 2020-12-21 15:48 | 249K | |
![[IMG]](/icons/image2.gif) | 160934585810382.png | 2020-12-30 16:30 | 592K | |
![[IMG]](/icons/image2.gif) | 161176891566009B83-A..> | 2021-01-27 17:35 | 69K | |
![[IMG]](/icons/image2.gif) | 161667055143781.jpeg | 2021-03-25 11:09 | 401K | |
![[IMG]](/icons/image2.gif) | 162016467958881BA5-E..> | 2021-05-04 21:44 | 110K | |
![[IMG]](/icons/image2.gif) | 162204440130421D94-7..> | 2021-05-26 15:53 | 189K | |
![[IMG]](/icons/image2.gif) | 162368360012403.jpg | 2021-06-14 15:13 | 183K | |
![[IMG]](/icons/image2.gif) | 162507015251579.jpg | 2021-06-30 16:22 | 316K | |
![[IMG]](/icons/image2.gif) | 162562185700925EC4-F..> | 2021-07-07 01:37 | 33K | |
![[IMG]](/icons/image2.gif) | 162713261134142D6C-A..> | 2021-07-24 13:16 | 655K | |
![[IMG]](/icons/image2.gif) | 163554252940251-logo..> | 2021-10-29 21:22 | 16K | |
![[IMG]](/icons/image2.gif) | 163582177528969_Elev..> | 2021-11-02 02:56 | 71K | |
![[IMG]](/icons/image2.gif) | 163675303088984F77-D..> | 2021-11-12 21:37 | 490K | |
![[IMG]](/icons/image2.gif) | 163703919148771A79-2..> | 2021-11-16 05:06 | 698K | |
![[IMG]](/icons/image2.gif) | 163829447929264D96-2..> | 2021-11-30 17:47 | 307K | |
![[IMG]](/icons/image2.gif) | 164615118948009.jpeg | 2022-03-01 16:13 | 722K | |
![[IMG]](/icons/image2.gif) | 164841419069019DAF-D..> | 2022-03-27 20:49 | 478K | |
![[IMG]](/icons/image2.gif) | 165264070639128C30-4..> | 2022-05-15 18:51 | 860K | |
![[IMG]](/icons/image2.gif) | 165531147372388FF5-C..> | 2022-06-15 16:44 | 1.7M | |
![[IMG]](/icons/image2.gif) | 165543868437365B7A-C..> | 2022-06-17 04:04 | 2.8M | |
![[IMG]](/icons/image2.gif) | 165620850566423FB3-C..> | 2022-06-26 01:55 | 2.7M | |
![[IMG]](/icons/image2.gif) | 166128639529789-joll..> | 2022-08-23 20:26 | 217K | |
![[IMG]](/icons/image2.gif) | 166189578116868 Redr..> | 2022-08-30 21:43 | 534K | |
![[IMG]](/icons/image2.gif) | 166190149276565C62-6..> | 2022-08-30 23:18 | 122K | |
![[IMG]](/icons/image2.gif) | 166626938347536A7D-1..> | 2022-10-20 12:36 | 164K | |
![[IMG]](/icons/image2.gif) | 166758845222223D66-6..> | 2022-11-04 19:00 | 552K | |
![[IMG]](/icons/image2.gif) | 167276357328636_JPsQ..> | 2023-01-03 16:32 | 102K | |
![[IMG]](/icons/image2.gif) | 167276999828636_JPsQ..> | 2023-01-03 18:19 | 102K | |
![[IMG]](/icons/image2.gif) | 167277001028636_JPsQ..> | 2023-01-03 18:20 | 102K | |
![[IMG]](/icons/image2.gif) | 167277055430792_JPsQ..> | 2023-01-03 18:29 | 133K | |
![[IMG]](/icons/image2.gif) | 168181346453271A11-8..> | 2023-04-18 10:24 | 127K | |
![[IMG]](/icons/image2.gif) | 169054439960473B8F-3..> | 2023-07-28 11:39 | 2.4M | |
![[IMG]](/icons/image2.gif) | 169487094419906.jpeg | 2023-09-16 13:29 | 1.9M | |
![[IMG]](/icons/image2.gif) | 170129637300100lrPOR..> | 2023-11-29 22:19 | 3.0M | |
![[IMG]](/icons/image2.gif) | 170690719919781.jpeg | 2024-02-02 20:53 | 511K | |
![[IMG]](/icons/image2.gif) | 174611758852382fcc-b..> | 2025-05-01 16:39 | 515K | |
![[IMG]](/icons/image2.gif) | 1499607887457766_460..> | 2017-07-09 00:00 | 25K | |
![[IMG]](/icons/image2.gif) | 1591983272474366F1-0..> | 2020-06-12 10:34 | 971K | |
![[IMG]](/icons/image2.gif) | 1602644058246061DF-8..> | 2020-10-14 02:54 | 175K | |
![[IMG]](/icons/image2.gif) | 1604240538077367A4-C..> | 2020-11-01 14:22 | 245K | |
![[IMG]](/icons/image2.gif) | 1604595707211314B7-3..> | 2020-11-05 17:01 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1605667643710651F0-8..> | 2020-11-18 02:47 | 462K | |
![[IMG]](/icons/image2.gif) | 1610673724218495_Wei..> | 2021-01-15 01:22 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1612307943089604A6-F..> | 2021-02-02 23:19 | 304K | |
![[IMG]](/icons/image2.gif) | 1618247961202770DF-E..> | 2021-04-12 17:19 | 81K | |
![[IMG]](/icons/image2.gif) | 1621204570005306DC-8..> | 2021-05-16 22:36 | 264K | |
![[IMG]](/icons/image2.gif) | 1623110829018968EE-2..> | 2021-06-08 00:07 | 124K | |
![[IMG]](/icons/image2.gif) | 1624310158995913CF-7..> | 2021-06-21 21:15 | 934K | |
![[IMG]](/icons/image2.gif) | 1626267812543768_590..> | 2021-07-14 13:03 | 9.4K | |
![[IMG]](/icons/image2.gif) | 1626957320267932_178..> | 2021-07-22 12:35 | 56K | |
![[IMG]](/icons/image2.gif) | 1632335949138464D4-2..> | 2021-09-22 18:39 | 114K | |
![[IMG]](/icons/image2.gif) | 1638820199917920FF-F..> | 2021-12-06 19:49 | 69K | |
![[IMG]](/icons/image2.gif) | 1666045038175938A4-C..> | 2022-10-17 22:17 | 171K | |
![[IMG]](/icons/image2.gif) | 1670865698220920 TM ..> | 2022-12-12 17:21 | 302K | |
![[ ]](/icons/layout.gif) | 1672638997181220 Lad..> | 2023-01-02 05:56 | 121K | |
![[IMG]](/icons/image2.gif) | 1675919076172188BA-2..> | 2023-02-09 05:04 | 712K | |
![[IMG]](/icons/image2.gif) | 1689893382189992 Col..> | 2023-07-20 22:49 | 288K | |
![[IMG]](/icons/image2.gif) | 1690544856288347B3-0..> | 2023-07-28 11:47 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1704038396827332A1-D..> | 2023-12-31 15:59 | 422K | |
![[IMG]](/icons/image2.gif) | 1707687918101823-102..> | 2024-02-11 21:45 | 3.1M | |
![[IMG]](/icons/image2.gif) | 1734186963755902c340..> | 2024-12-14 14:36 | 657K | |
![[IMG]](/icons/image2.gif) | 14936509841925997_80..> | 2017-05-01 00:00 | 109K | |
![[IMG]](/icons/image2.gif) | 14955612241111111.jpg | 2017-05-23 00:00 | 629K | |
![[IMG]](/icons/image2.gif) | 15102690001901287_14..> | 2017-11-09 00:00 | 49K | |
![[IMG]](/icons/image2.gif) | 15366797321238785_24..> | 2018-09-11 00:00 | 69K | |
![[IMG]](/icons/image2.gif) | 15934711217615191C-0..> | 2020-06-29 15:52 | 64K | |
![[IMG]](/icons/image2.gif) | 16143867571025532 (1..> | 2021-02-27 00:45 | 4.6K | |
![[IMG]](/icons/image2.gif) | 16251481671619771A-1..> | 2021-07-01 14:02 | 219K | |
![[IMG]](/icons/image2.gif) | 16299286354398661A-B..> | 2021-08-25 21:57 | 246K | |
![[IMG]](/icons/image2.gif) | 16310631834835338E-2..> | 2021-09-08 01:06 | 198K | |
![[IMG]](/icons/image2.gif) | 16346832359222777C-7..> | 2021-10-19 22:40 | 116K | |
![[IMG]](/icons/image2.gif) | 16515040961619025.jpg | 2022-05-02 15:08 | 241K | |
![[IMG]](/icons/image2.gif) | 16655033374319254D-4..> | 2022-10-11 15:48 | 1.6M | |
![[IMG]](/icons/image2.gif) | 16757119682071982F-F..> | 2023-02-06 19:32 | 169K | |
![[IMG]](/icons/image2.gif) | 16757123482071982F-F..> | 2023-02-06 19:39 | 169K | |
![[IMG]](/icons/image2.gif) | 16896421887337275.jpg | 2023-07-18 01:03 | 737K | |
![[IMG]](/icons/image2.gif) | 145149549420150707_0..> | 2016-01-28 00:00 | 7.3K | |
![[IMG]](/icons/image2.gif) | 145161228812049642_1..> | 2016-01-28 00:00 | 54K | |
![[IMG]](/icons/image2.gif) | 145436104520151214_1..> | 2016-02-01 00:00 | 1.5M | |
![[IMG]](/icons/image2.gif) | 145943837910982479_6..> | 2016-03-31 00:00 | 77K | |
![[IMG]](/icons/image2.gif) | 145952880910356017_1..> | 2016-04-01 00:00 | 141K | |
![[IMG]](/icons/image2.gif) | 150548901812814757_1..> | 2017-09-15 00:00 | 31K | |
![[IMG]](/icons/image2.gif) | 150680091620150426_1..> | 2017-09-30 00:00 | 300K | |
![[IMG]](/icons/image2.gif) | 150764159022407737_2..> | 2017-10-10 00:00 | 124K | |
![[IMG]](/icons/image2.gif) | 151630845424852192_5..> | 2018-01-18 00:00 | 99K | |
![[IMG]](/icons/image2.gif) | 151666533816300183_1..> | 2018-01-22 00:00 | 507K | |
![[IMG]](/icons/image2.gif) | 151717498712909692_9..> | 2018-01-28 00:00 | 629K | |
![[IMG]](/icons/image2.gif) | 151795384521366899_1..> | 2018-02-06 00:00 | 182K | |
![[IMG]](/icons/image2.gif) | 152045582520170719_1..> | 2018-03-07 00:00 | 1.2M | |
![[IMG]](/icons/image2.gif) | 152099670413668925_1..> | 2018-03-13 00:00 | 379K | |
![[IMG]](/icons/image2.gif) | 152156482112195985_1..> | 2018-03-20 00:00 | 13K | |
![[IMG]](/icons/image2.gif) | 152374811020689723_1..> | 2018-04-14 00:00 | 749K | |
![[IMG]](/icons/image2.gif) | 153427005129511046_7..> | 2018-08-14 00:00 | 166K | |
![[IMG]](/icons/image2.gif) | 153487720520180815_1..> | 2018-08-21 00:00 | 104K | |
![[IMG]](/icons/image2.gif) | 153661370531890704_1..> | 2018-09-10 00:00 | 101K | |
![[IMG]](/icons/image2.gif) | 153739244111187259_4..> | 2018-09-19 00:00 | 247K | |
![[IMG]](/icons/image2.gif) | 153927104022713586_1..> | 2018-10-11 00:00 | 236K | |
![[IMG]](/icons/image2.gif) | 153939490319223043_2..> | 2018-10-12 00:00 | 177K | |
![[IMG]](/icons/image2.gif) | 153970434727331768_7..> | 2018-10-16 00:00 | 51K | |
![[IMG]](/icons/image2.gif) | 154350601735062494_1..> | 2018-11-29 00:00 | 155K | |
![[IMG]](/icons/image2.gif) | 154792655920190116_1..> | 2019-01-19 00:00 | 1.9M | |
![[IMG]](/icons/image2.gif) | 156985332552373491_3..> | 2019-09-30 00:00 | 185K | |
![[IMG]](/icons/image2.gif) | 157607200750192578_1..> | 2019-12-11 00:00 | 47K | |
![[IMG]](/icons/image2.gif) | 157920434620181213_1..> | 2020-01-16 00:00 | 967K | |
![[IMG]](/icons/image2.gif) | 158437168412789676-8..> | 2020-03-16 08:14 | 1.7M | |
![[IMG]](/icons/image2.gif) | 158455451320190923_1..> | 2020-03-18 11:01 | 2.0M | |
![[IMG]](/icons/image2.gif) | 158847775820200302_2..> | 2020-05-02 20:49 | 1.0M | |
![[IMG]](/icons/image2.gif) | 158933845120200512_2..> | 2020-05-12 19:54 | 61K | |
![[IMG]](/icons/image2.gif) | 158982414276974937_2..> | 2020-05-18 10:49 | 129K | |
![[IMG]](/icons/image2.gif) | 159127182820200516.jpg | 2020-06-04 04:57 | 1.4M | |
![[IMG]](/icons/image2.gif) | 159174550326239036_1..> | 2020-06-09 16:31 | 1.2M | |
![[IMG]](/icons/image2.gif) | 159188787120200611_1..> | 2020-06-11 08:04 | 1.7M | |
![[IMG]](/icons/image2.gif) | 159261738920190502_1..> | 2020-06-19 18:43 | 780K | |
![[IMG]](/icons/image2.gif) | 159302365515232331_1..> | 2020-06-24 11:34 | 12K | |
![[IMG]](/icons/image2.gif) | 159421821278821348_2..> | 2020-07-08 07:23 | 136K | |
![[IMG]](/icons/image2.gif) | 159524258410202014tb..> | 2020-07-20 03:56 | 156K | |
![[IMG]](/icons/image2.gif) | 159591081820200717_1..> | 2020-07-27 21:33 | 1.6M | |
![[IMG]](/icons/image2.gif) | 159677662520200521_2..> | 2020-08-06 22:03 | 21K | |
![[IMG]](/icons/image2.gif) | 159684621020161017_1..> | 2020-08-07 17:23 | 1.1M | |
![[IMG]](/icons/image2.gif) | 159723370720200111_1..> | 2020-08-12 05:01 | 81K | |
![[IMG]](/icons/image2.gif) | 159725853820190523_1..> | 2020-08-12 11:55 | 1.2M | |
![[IMG]](/icons/image2.gif) | 159733560767539984_2..> | 2020-08-13 09:20 | 16K | |
![[IMG]](/icons/image2.gif) | 159750042720200811_1..> | 2020-08-15 07:07 | 1.1M | |
![[IMG]](/icons/image2.gif) | 159768397339221426_1..> | 2020-08-17 10:06 | 71K | |
![[IMG]](/icons/image2.gif) | 159976167024838949_2..> | 2020-09-10 18:14 | 5.2K | |
![[IMG]](/icons/image2.gif) | 159985756520200217_1..> | 2020-09-11 20:52 | 116K | |
![[IMG]](/icons/image2.gif) | 160011371793994536-B..> | 2020-09-14 20:01 | 1.3M | |
![[IMG]](/icons/image2.gif) | 160151917728061677_8..> | 2020-10-01 02:26 | 126K | |
![[IMG]](/icons/image2.gif) | 160259452420201013_0..> | 2020-10-13 13:08 | 216K | |
![[IMG]](/icons/image2.gif) | 160355873820201024_1..> | 2020-10-24 16:58 | 538K | |
![[IMG]](/icons/image2.gif) | 160372130820190712_2..> | 2020-10-26 14:08 | 1.3M | |
![[IMG]](/icons/image2.gif) | 160384192824838949_2..> | 2020-10-27 23:38 | 5.2K | |
![[IMG]](/icons/image2.gif) | 160392472561758275_1..> | 2020-10-28 22:38 | 89K | |
![[IMG]](/icons/image2.gif) | 160473723320201107_0..> | 2020-11-07 08:20 | 361K | |
![[IMG]](/icons/image2.gif) | 160521628120190705_1..> | 2020-11-12 21:24 | 213K | |
![[IMG]](/icons/image2.gif) | 160530547766272990_7..> | 2020-11-13 22:11 | 11K | |
![[IMG]](/icons/image2.gif) | 160563897420201116_0..> | 2020-11-17 18:49 | 1.9M | |
![[IMG]](/icons/image2.gif) | 160640804820200414_1..> | 2020-11-26 16:27 | 1.5M | |
![[IMG]](/icons/image2.gif) | 160771635790814566_1..> | 2020-12-11 19:52 | 28K | |
![[IMG]](/icons/image2.gif) | 160792063120201213_2..> | 2020-12-14 04:37 | 186K | |
![[IMG]](/icons/image2.gif) | 160795886216788919_2..> | 2020-12-14 15:14 | 75K | |
![[IMG]](/icons/image2.gif) | 160818218420200108_2..> | 2020-12-17 05:16 | 95K | |
![[IMG]](/icons/image2.gif) | 160851616735587175-8..> | 2020-12-21 02:02 | 1.1M | |
![[IMG]](/icons/image2.gif) | 160882357956371094_1..> | 2020-12-24 15:26 | 85K | |
![[IMG]](/icons/image2.gif) | 160939909281344098_3..> | 2020-12-31 07:18 | 56K | |
![[IMG]](/icons/image2.gif) | 161098555220191204_0..> | 2021-01-18 15:59 | 80K | |
![[IMG]](/icons/image2.gif) | 161098560920191204_0..> | 2021-01-18 16:00 | 80K | |
![[IMG]](/icons/image2.gif) | 161124079450784621_6..> | 2021-01-21 14:53 | 22K | |
![[IMG]](/icons/image2.gif) | 161238462217425148_1..> | 2021-02-03 20:37 | 26K | |
![[IMG]](/icons/image2.gif) | 161256517157200769_1..> | 2021-02-05 22:46 | 306K | |
![[IMG]](/icons/image2.gif) | 161298320332191874_1..> | 2021-02-10 18:53 | 115K | |
![[IMG]](/icons/image2.gif) | 161392973620200826_1..> | 2021-02-21 17:48 | 92K | |
![[IMG]](/icons/image2.gif) | 161401593011228532_1..> | 2021-02-22 17:45 | 243K | |
![[IMG]](/icons/image2.gif) | 161438968120210202_1..> | 2021-02-27 01:34 | 1.9M | |
![[IMG]](/icons/image2.gif) | 161454737261158685-6..> | 2021-02-28 21:22 | 346K | |
![[IMG]](/icons/image2.gif) | 161455984167766973_1..> | 2021-03-01 00:50 | 232K | |
![[IMG]](/icons/image2.gif) | 161496372588205495_1..> | 2021-03-05 17:02 | 49K | |
![[IMG]](/icons/image2.gif) | 161531787020190603_0..> | 2021-03-09 19:24 | 1.9M | |
![[IMG]](/icons/image2.gif) | 161558126748358419_2..> | 2021-03-12 20:34 | 359K | |
![[IMG]](/icons/image2.gif) | 161577573620190624_2..> | 2021-03-15 02:35 | 1.4M | |
![[IMG]](/icons/image2.gif) | 161577575920190624_2..> | 2021-03-15 02:35 | 1.4M | |
![[IMG]](/icons/image2.gif) | 161594925037958674_1..> | 2021-03-17 02:47 | 70K | |
![[IMG]](/icons/image2.gif) | 161659467620210205_1..> | 2021-03-24 14:04 | 1.8M | |
![[IMG]](/icons/image2.gif) | 161729155053408364_2..> | 2021-04-01 15:39 | 65K | |
![[IMG]](/icons/image2.gif) | 161750068420201221_1..> | 2021-04-04 01:44 | 420K | |
![[IMG]](/icons/image2.gif) | 161826698120210412_1..> | 2021-04-12 22:36 | 311K | |
![[IMG]](/icons/image2.gif) | 161853108291648483_1..> | 2021-04-15 23:58 | 92K | |
![[IMG]](/icons/image2.gif) | 161854947624993429_1..> | 2021-04-16 05:04 | 55K | |
![[IMG]](/icons/image2.gif) | 161854948424993429_1..> | 2021-04-16 05:04 | 55K | |
![[IMG]](/icons/image2.gif) | 161857743820210411_1..> | 2021-04-16 12:50 | 1.9M | |
![[IMG]](/icons/image2.gif) | 161897224720210420_1..> | 2021-04-21 02:30 | 227K | |
![[IMG]](/icons/image2.gif) | 161901778120210421_1..> | 2021-04-21 15:09 | 110K | |
![[IMG]](/icons/image2.gif) | 161927944920181113_2..> | 2021-04-24 15:50 | 77K | |
![[IMG]](/icons/image2.gif) | 162019285920210330_1..> | 2021-05-05 05:34 | 25K | |
![[IMG]](/icons/image2.gif) | 162040635147394745_2..> | 2021-05-07 16:52 | 69K | |
![[IMG]](/icons/image2.gif) | 162189720810073715-D..> | 2021-05-24 23:00 | 1.9M | |
![[IMG]](/icons/image2.gif) | 162224227773231402-A..> | 2021-05-28 22:51 | 1.5M | |
![[IMG]](/icons/image2.gif) | 162225614120201028_1..> | 2021-05-29 02:42 | 1.5M | |
![[IMG]](/icons/image2.gif) | 162230708220210516_1..> | 2021-05-29 16:51 | 708K | |
![[IMG]](/icons/image2.gif) | 162243255562206469_2..> | 2021-05-31 03:42 | 2.4K | |
![[IMG]](/icons/image2.gif) | 162309438774428609_1..> | 2021-06-07 19:33 | 77K | |
![[IMG]](/icons/image2.gif) | 162334699820201108_1..> | 2021-06-10 17:43 | 1.4M | |
![[IMG]](/icons/image2.gif) | 162423911061956798_1..> | 2021-06-21 01:31 | 35K | |
![[IMG]](/icons/image2.gif) | 162429703186729975_2..> | 2021-06-21 17:37 | 214K | |
![[IMG]](/icons/image2.gif) | 162448039820210520_1..> | 2021-06-23 20:33 | 897K | |
![[IMG]](/icons/image2.gif) | 162465311470419666_2..> | 2021-06-25 20:31 | 171K | |
![[IMG]](/icons/image2.gif) | 162504896120191019_0..> | 2021-06-30 10:29 | 1.2M | |
![[IMG]](/icons/image2.gif) | 162618909920210713_1..> | 2021-07-13 15:11 | 758K | |
![[IMG]](/icons/image2.gif) | 162638469520210508_0..> | 2021-07-15 21:31 | 1.4M | |
![[IMG]](/icons/image2.gif) | 162638470820210508_0..> | 2021-07-15 21:31 | 1.4M | |
![[IMG]](/icons/image2.gif) | 162669971820210719_0..> | 2021-07-19 13:01 | 339K | |
![[IMG]](/icons/image2.gif) | 162731960420200911_1..> | 2021-07-26 17:13 | 802K | |
![[IMG]](/icons/image2.gif) | 162856480220191102_1..> | 2021-08-10 03:06 | 1.7M | |
![[IMG]](/icons/image2.gif) | 162896222720210520_1..> | 2021-08-14 17:30 | 897K | |
![[IMG]](/icons/image2.gif) | 162916784320210520_1..> | 2021-08-17 02:37 | 897K | |
![[IMG]](/icons/image2.gif) | 162939672820210520_0..> | 2021-08-19 18:12 | 148K | |
![[IMG]](/icons/image2.gif) | 162939752120210520_0..> | 2021-08-19 18:25 | 148K | |
![[IMG]](/icons/image2.gif) | 162949260883914457_1..> | 2021-08-20 20:50 | 734K | |
![[IMG]](/icons/image2.gif) | 162958792058132115-F..> | 2021-08-21 23:18 | 242K | |
![[IMG]](/icons/image2.gif) | 162991836220210520_1..> | 2021-08-25 19:06 | 897K | |
![[IMG]](/icons/image2.gif) | 163066713310440881_1..> | 2021-09-03 11:05 | 1.0K | |
![[IMG]](/icons/image2.gif) | 163105666120210611_2..> | 2021-09-07 23:17 | 199K | |
![[IMG]](/icons/image2.gif) | 163116043574292748-4..> | 2021-09-09 04:07 | 26K | |
![[IMG]](/icons/image2.gif) | 163206471520210520_1..> | 2021-09-19 15:18 | 897K | |
![[IMG]](/icons/image2.gif) | 163217720120210806_2..> | 2021-09-20 22:33 | 1.9M | |
![[IMG]](/icons/image2.gif) | 163220874580186708_2..> | 2021-09-21 07:19 | 51K | |
![[IMG]](/icons/image2.gif) | 163242567911958109_8..> | 2021-09-23 19:34 | 99K | |
![[IMG]](/icons/image2.gif) | 163267167720210520_1..> | 2021-09-26 15:54 | 897K | |
![[IMG]](/icons/image2.gif) | 163284289920210920_0..> | 2021-09-28 15:28 | 175K | |
![[IMG]](/icons/image2.gif) | 163285298320210920_1..> | 2021-09-28 18:16 | 165K | |
![[IMG]](/icons/image2.gif) | 163328537620211003_1..> | 2021-10-03 18:22 | 35K | |
![[IMG]](/icons/image2.gif) | 163337506114188119_1..> | 2021-10-04 19:17 | 163K | |
![[IMG]](/icons/image2.gif) | 163431341020201011_1..> | 2021-10-15 15:56 | 121K | |
![[IMG]](/icons/image2.gif) | 163469372820200525_2..> | 2021-10-20 01:35 | 0 | |
![[IMG]](/icons/image2.gif) | 163469378820200525_2..> | 2021-10-20 01:36 | 0 | |
![[IMG]](/icons/image2.gif) | 163478205682664621-8..> | 2021-10-21 02:07 | 100K | |
![[IMG]](/icons/image2.gif) | 163487156320210216_1..> | 2021-10-22 02:59 | 1.6M | |
![[IMG]](/icons/image2.gif) | 163513016369021801-C..> | 2021-10-25 02:49 | 289K | |
![[IMG]](/icons/image2.gif) | 163553271020181103_0..> | 2021-10-29 18:38 | 566K | |
![[IMG]](/icons/image2.gif) | 163553289920211029_1..> | 2021-10-29 18:41 | 124K | |
![[IMG]](/icons/image2.gif) | 163725444720211115_2..> | 2021-11-18 16:54 | 225K | |
![[IMG]](/icons/image2.gif) | 163822488720210717_1..> | 2021-11-29 22:28 | 1.1M | |
![[IMG]](/icons/image2.gif) | 164178907176102647-D..> | 2022-01-10 04:31 | 3.4M | |
![[IMG]](/icons/image2.gif) | 164178914076102647-D..> | 2022-01-10 04:32 | 3.4M | |
![[IMG]](/icons/image2.gif) | 164178930776102647-D..> | 2022-01-10 04:35 | 3.4M | |
![[IMG]](/icons/image2.gif) | 164178943476102647-D..> | 2022-01-10 04:37 | 3.4M | |
![[IMG]](/icons/image2.gif) | 164188338974384940_2..> | 2022-01-11 06:43 | 74K | |
![[IMG]](/icons/image2.gif) | 164191741167722370_2..> | 2022-01-11 16:10 | 896K | |
![[IMG]](/icons/image2.gif) | 164251107320220113_1..> | 2022-01-18 13:04 | 1.8M | |
![[IMG]](/icons/image2.gif) | 164253923820220110_2..> | 2022-01-18 20:53 | 1.8M | |
![[IMG]](/icons/image2.gif) | 164512981620210827_1..> | 2022-02-17 20:30 | 1.3M | |
![[IMG]](/icons/image2.gif) | 164550089220201216_1..> | 2022-02-22 03:34 | 112K | |
![[IMG]](/icons/image2.gif) | 164589485420210808_1..> | 2022-02-26 17:00 | 2.0M | |
![[IMG]](/icons/image2.gif) | 164617751860829521_3..> | 2022-03-01 23:31 | 23K | |
![[IMG]](/icons/image2.gif) | 164703012520220131_1..> | 2022-03-11 20:22 | 1.5M | |
![[IMG]](/icons/image2.gif) | 164726860220220220_1..> | 2022-03-14 14:36 | 2.3M | |
![[IMG]](/icons/image2.gif) | 164764792120191110_1..> | 2022-03-18 23:58 | 2.4M | |
![[IMG]](/icons/image2.gif) | 164843071120201221_1..> | 2022-03-28 01:25 | 604K | |
![[IMG]](/icons/image2.gif) | 164876830220211127_1..> | 2022-03-31 23:11 | 747K | |
![[IMG]](/icons/image2.gif) | 165031591920220307_0..> | 2022-04-18 21:05 | 2.0M | |
![[IMG]](/icons/image2.gif) | 165220347220170126_1..> | 2022-05-10 17:24 | 2.3M | |
![[IMG]](/icons/image2.gif) | 165238556820220512_1..> | 2022-05-12 19:59 | 1.6M | |
![[IMG]](/icons/image2.gif) | 165238609220220512_1..> | 2022-05-12 20:08 | 1.6M | |
![[IMG]](/icons/image2.gif) | 165250081213308047-E..> | 2022-05-14 04:00 | 46K | |
![[IMG]](/icons/image2.gif) | 165275367420210609_1..> | 2022-05-17 02:14 | 2.5M | |
![[IMG]](/icons/image2.gif) | 165299087120220517_1..> | 2022-05-19 20:07 | 1.6M | |
![[IMG]](/icons/image2.gif) | 165300937120220208_1..> | 2022-05-20 01:16 | 1.5M | |
![[IMG]](/icons/image2.gif) | 165316894123395756-3..> | 2022-05-21 21:35 | 287K | |
![[IMG]](/icons/image2.gif) | 165419332446100647_3..> | 2022-06-02 18:08 | 588K | |
![[IMG]](/icons/image2.gif) | 165419337771597036_2..> | 2022-06-02 18:09 | 530K | |
![[IMG]](/icons/image2.gif) | 165463993420220607_1..> | 2022-06-07 22:12 | 1.6M | |
![[IMG]](/icons/image2.gif) | 165522664020220527_1..> | 2022-06-14 17:10 | 3.0M | |
![[IMG]](/icons/image2.gif) | 165584679680861296_8..> | 2022-06-21 21:26 | 1.4M | |
![[IMG]](/icons/image2.gif) | 165630161220220424_1..> | 2022-06-27 03:46 | 3.5M | |
![[IMG]](/icons/image2.gif) | 165634474259285447_2..> | 2022-06-27 15:45 | 946K | |
![[IMG]](/icons/image2.gif) | 165690040574238384_1..> | 2022-07-04 02:06 | 135K | |
![[IMG]](/icons/image2.gif) | 165707428420220126_1..> | 2022-07-06 02:24 | 117K | |
![[IMG]](/icons/image2.gif) | 165769803020220615_1..> | 2022-07-13 07:40 | 43K | |
![[IMG]](/icons/image2.gif) | 165781629920201128_1..> | 2022-07-14 16:31 | 2.2M | |
![[IMG]](/icons/image2.gif) | 165815444420210923_1..> | 2022-07-18 14:27 | 4.3M | |
![[IMG]](/icons/image2.gif) | 165818007020220616_1..> | 2022-07-18 21:34 | 1.2M | |
![[IMG]](/icons/image2.gif) | 165877510220220522_1..> | 2022-07-25 18:51 | 42K | |
![[IMG]](/icons/image2.gif) | 165919336720220510_1..> | 2022-07-30 15:02 | 586K | |
![[IMG]](/icons/image2.gif) | 165975113520220317_2..> | 2022-08-06 01:58 | 148K | |
![[IMG]](/icons/image2.gif) | 165997687620220710_0..> | 2022-08-08 16:41 | 3.2M | |
![[IMG]](/icons/image2.gif) | 165997690520220701_1..> | 2022-08-08 16:41 | 41K | |
![[IMG]](/icons/image2.gif) | 166000735261265998-2..> | 2022-08-09 01:09 | 810K | |
![[IMG]](/icons/image2.gif) | 166118147294891773_1..> | 2022-08-22 15:17 | 194K | |
![[IMG]](/icons/image2.gif) | 166177646620220829_0..> | 2022-08-29 12:34 | 2.5M | |
![[IMG]](/icons/image2.gif) | 166187277320180329_1..> | 2022-08-30 15:19 | 3.5M | |
![[IMG]](/icons/image2.gif) | 166239441520220418_1..> | 2022-09-05 16:13 | 43K | |
![[IMG]](/icons/image2.gif) | 166257044820220903_0..> | 2022-09-07 17:07 | 3.7M | |
![[IMG]](/icons/image2.gif) | 166311717920220913_2..> | 2022-09-14 00:59 | 167K | |
![[IMG]](/icons/image2.gif) | 166535016520220930_1..> | 2022-10-09 21:16 | 80K | |
![[IMG]](/icons/image2.gif) | 166691382440917483-6..> | 2022-10-27 23:37 | 523K | |
![[IMG]](/icons/image2.gif) | 166691429040917483-6..> | 2022-10-27 23:44 | 523K | |
![[IMG]](/icons/image2.gif) | 166698862720221020_1..> | 2022-10-28 20:23 | 1.6M | |
![[IMG]](/icons/image2.gif) | 166830739948370333_1..> | 2022-11-13 02:43 | 1.6M | |
![[IMG]](/icons/image2.gif) | 166968890820200525_1..> | 2022-11-29 02:28 | 399K | |
![[IMG]](/icons/image2.gif) | 167007987220221105_0..> | 2022-12-03 15:04 | 3.7M | |
![[IMG]](/icons/image2.gif) | 167121435920221215_1..> | 2022-12-16 18:12 | 2.0M | |
![[IMG]](/icons/image2.gif) | 167224330920220912_1..> | 2022-12-28 16:01 | 2.2M | |
![[IMG]](/icons/image2.gif) | 167355111720230102_1..> | 2023-01-12 19:18 | 1.4M | |
![[IMG]](/icons/image2.gif) | 167364665310906109_1..> | 2023-01-13 21:50 | 475K | |
![[IMG]](/icons/image2.gif) | 167466572320210420_1..> | 2023-01-25 16:55 | 1.7M | |
![[IMG]](/icons/image2.gif) | 167476151020200619_1..> | 2023-01-26 19:31 | 2.4M | |
![[IMG]](/icons/image2.gif) | 167504817620230118_0..> | 2023-01-30 03:09 | 2.1M | |
![[IMG]](/icons/image2.gif) | 167563454678164824_1..> | 2023-02-05 22:02 | 4.6M | |
![[IMG]](/icons/image2.gif) | 167563456678164824_1..> | 2023-02-05 22:02 | 4.6M | |
![[IMG]](/icons/image2.gif) | 167599411220230205_1..> | 2023-02-10 01:55 | 4.1M | |
![[IMG]](/icons/image2.gif) | 167599464020220714_0..> | 2023-02-10 02:04 | 2.9M | |
![[IMG]](/icons/image2.gif) | 167605689520210223_1..> | 2023-02-10 19:21 | 3.5M | |
![[IMG]](/icons/image2.gif) | 167650344818069546-1..> | 2023-02-15 23:24 | 205K | |
![[IMG]](/icons/image2.gif) | 167650352418069546-1..> | 2023-02-15 23:25 | 205K | |
![[IMG]](/icons/image2.gif) | 167836546720230226_0..> | 2023-03-09 12:37 | 356K | |
![[IMG]](/icons/image2.gif) | 167971413420230324_2..> | 2023-03-25 03:15 | 24K | |
![[IMG]](/icons/image2.gif) | 168374299422183850-0..> | 2023-05-10 18:23 | 243K | |
![[IMG]](/icons/image2.gif) | 168434697422280728_2..> | 2023-05-17 18:09 | 45K | |
![[IMG]](/icons/image2.gif) | 168439009320230407_1..> | 2023-05-18 06:08 | 2.1M | |
![[IMG]](/icons/image2.gif) | 168865725720230426_2..> | 2023-07-06 15:27 | 113K | |
![[IMG]](/icons/image2.gif) | 169090481420230801_1..> | 2023-08-01 15:46 | 2.6M | |
![[IMG]](/icons/image2.gif) | 169188553920230811_1..> | 2023-08-13 00:12 | 2.8M | |
![[IMG]](/icons/image2.gif) | 169188564720230811_1..> | 2023-08-13 00:14 | 2.8M | |
![[IMG]](/icons/image2.gif) | 169282702320230626_1..> | 2023-08-23 21:43 | 2.1M | |
![[IMG]](/icons/image2.gif) | 169546456239188265_1..> | 2023-09-23 10:22 | 3.8M | |
![[IMG]](/icons/image2.gif) | 169684975720231006_1..> | 2023-10-09 11:09 | 2.7M | |
![[IMG]](/icons/image2.gif) | 169759189220231013_2..> | 2023-10-18 01:18 | 2.6M | |
![[IMG]](/icons/image2.gif) | 169774866420231004_1..> | 2023-10-19 20:51 | 2.1M | |
![[IMG]](/icons/image2.gif) | 169832329639188265_1..> | 2023-10-26 12:28 | 3.8M | |
![[IMG]](/icons/image2.gif) | 170112684620231120_1..> | 2023-11-27 23:14 | 2.8M | |
![[IMG]](/icons/image2.gif) | 170430913711428697.png | 2024-01-03 19:12 | 33K | |
![[IMG]](/icons/image2.gif) | 170481310720231227_1..> | 2024-01-09 15:11 | 88K | |
![[IMG]](/icons/image2.gif) | 170601846420230718_1..> | 2024-01-23 14:01 | 1.9M | |
![[IMG]](/icons/image2.gif) | 170601850520230521_1..> | 2024-01-23 14:01 | 1.7M | |
![[IMG]](/icons/image2.gif) | 170601858420230521_1..> | 2024-01-23 14:03 | 1.7M | |
![[IMG]](/icons/image2.gif) | 170610572320240124_0..> | 2024-01-24 14:15 | 464K | |
![[IMG]](/icons/image2.gif) | 170708060220231216_0..> | 2024-02-04 21:03 | 2.1M | |
![[IMG]](/icons/image2.gif) | 171487133520230628_0..> | 2024-05-05 01:08 | 1.2M | |
![[IMG]](/icons/image2.gif) | 171796003720240609_1..> | 2024-06-09 19:07 | 2.6M | |
![[IMG]](/icons/image2.gif) | 171816492820240610_1..> | 2024-06-12 04:02 | 2.0M | |
![[IMG]](/icons/image2.gif) | 172227838020220930_1..> | 2024-07-29 18:39 | 3.5M | |
![[IMG]](/icons/image2.gif) | 174454968348743742-e..> | 2025-04-13 13:08 | 322K | |
![[IMG]](/icons/image2.gif) | 174474698020250415_1..> | 2025-04-15 19:56 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1591749823101817373_..> | 2020-06-09 17:43 | 56K | |
![[IMG]](/icons/image2.gif) | 1596497259116348139_..> | 2020-08-03 16:27 | 21K | |
![[IMG]](/icons/image2.gif) | 1605233473121317212_..> | 2020-11-13 02:11 | 678K | |
![[IMG]](/icons/image2.gif) | 1611021442121683114_..> | 2021-01-19 01:57 | 240K | |
![[IMG]](/icons/image2.gif) | 1613675360148620588_..> | 2021-02-18 19:09 | 34K | |
![[IMG]](/icons/image2.gif) | 1613701876125926689_..> | 2021-02-19 02:31 | 73K | |
![[IMG]](/icons/image2.gif) | 1614096086118083648_..> | 2021-02-23 16:01 | 6.4K | |
![[IMG]](/icons/image2.gif) | 1618549360123653189_..> | 2021-04-16 05:02 | 404K | |
![[IMG]](/icons/image2.gif) | 1618946834128647317_..> | 2021-04-20 19:27 | 394K | |
![[IMG]](/icons/image2.gif) | 1621301618183367196_..> | 2021-05-18 01:33 | 91K | |
![[IMG]](/icons/image2.gif) | 1623260951175974211_..> | 2021-06-09 17:49 | 4.6K | |
![[IMG]](/icons/image2.gif) | 1623503767122862871_..> | 2021-06-12 13:16 | 494K | |
![[IMG]](/icons/image2.gif) | 1623504240122862871_..> | 2021-06-12 13:24 | 359K | |
![[IMG]](/icons/image2.gif) | 1623958767125485227_..> | 2021-06-17 19:39 | 54K | |
![[IMG]](/icons/image2.gif) | 1624297143187530921_..> | 2021-06-21 17:39 | 53K | |
![[IMG]](/icons/image2.gif) | 1624571799199716237_..> | 2021-06-24 21:56 | 586K | |
![[IMG]](/icons/image2.gif) | 1626979724183115664_..> | 2021-07-22 18:48 | 386K | |
![[IMG]](/icons/image2.gif) | 1627392748220801299_..> | 2021-07-27 13:32 | 166K | |
![[IMG]](/icons/image2.gif) | 1627995881204815912_..> | 2021-08-03 13:04 | 46K | |
![[IMG]](/icons/image2.gif) | 1629146122137289241_..> | 2021-08-16 20:35 | 66K | |
![[IMG]](/icons/image2.gif) | 1629648144185737670_..> | 2021-08-22 16:02 | 47K | |
![[IMG]](/icons/image2.gif) | 1630000553230485405_..> | 2021-08-26 17:55 | 103K | |
![[IMG]](/icons/image2.gif) | 1630374370121309343_..> | 2021-08-31 01:46 | 105K | |
![[IMG]](/icons/image2.gif) | 1630374491121309343_..> | 2021-08-31 01:48 | 105K | |
![[IMG]](/icons/image2.gif) | 1631660832183490711_..> | 2021-09-14 23:07 | 323K | |
![[IMG]](/icons/image2.gif) | 1631723552236536208_..> | 2021-09-15 16:32 | 225K | |
![[IMG]](/icons/image2.gif) | 1631898376130272933_..> | 2021-09-17 17:06 | 197K | |
![[IMG]](/icons/image2.gif) | 1632341491127280806_..> | 2021-09-22 20:11 | 50K | |
![[IMG]](/icons/image2.gif) | 1632953221156911648_..> | 2021-09-29 22:07 | 137K | |
![[IMG]](/icons/image2.gif) | 1633974752122137798_..> | 2021-10-11 17:52 | 142K | |
![[IMG]](/icons/image2.gif) | 1635468648118604452_..> | 2021-10-29 00:50 | 97K | |
![[IMG]](/icons/image2.gif) | 1636132159241468358_..> | 2021-11-05 17:09 | 248K | |
![[IMG]](/icons/image2.gif) | 1636918169256209983_..> | 2021-11-14 19:29 | 69K | |
![[IMG]](/icons/image2.gif) | 1637357118253704699_..> | 2021-11-19 21:25 | 124K | |
![[IMG]](/icons/image2.gif) | 1637502792211749178_..> | 2021-11-21 13:53 | 121K | |
![[IMG]](/icons/image2.gif) | 1641849330197145886_..> | 2022-01-10 21:15 | 2.4M | |
![[IMG]](/icons/image2.gif) | 1642772454267460439_..> | 2022-01-21 13:40 | 3.7M | |
![[IMG]](/icons/image2.gif) | 1642772827267460439_..> | 2022-01-21 13:47 | 3.7M | |
![[IMG]](/icons/image2.gif) | 1643648473243236618_..> | 2022-01-31 17:01 | 458K | |
![[IMG]](/icons/image2.gif) | 1644586383129546963_..> | 2022-02-11 13:33 | 11K | |
![[IMG]](/icons/image2.gif) | 1645588154245209212_..> | 2022-02-23 03:49 | 2.3M | |
![[IMG]](/icons/image2.gif) | 1647363838274724491_..> | 2022-03-15 17:03 | 792K | |
![[IMG]](/icons/image2.gif) | 1648226896124781542_..> | 2022-03-25 16:48 | 285K | |
![[IMG]](/icons/image2.gif) | 1651326140262924474_..> | 2022-04-30 13:42 | 870K | |
![[IMG]](/icons/image2.gif) | 1656630721290574219_..> | 2022-06-30 23:12 | 67K | |
![[IMG]](/icons/image2.gif) | 1656903583106521101_..> | 2022-07-04 02:59 | 195K | |
![[IMG]](/icons/image2.gif) | 1658938792149694435_..> | 2022-07-27 16:19 | 880K | |
![[IMG]](/icons/image2.gif) | 1659469035125990521_..> | 2022-08-02 19:37 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1661124098299616455_..> | 2022-08-21 23:21 | 68K | |
![[IMG]](/icons/image2.gif) | 1661141463297593981_..> | 2022-08-22 04:11 | 7.7K | |
![[IMG]](/icons/image2.gif) | 1661988612153540107_..> | 2022-08-31 23:30 | 834K | |
![[IMG]](/icons/image2.gif) | 1662162538269048877_..> | 2022-09-02 23:48 | 539K | |
![[IMG]](/icons/image2.gif) | 1663857677261124465_..> | 2022-09-22 14:41 | 179K | |
![[IMG]](/icons/image2.gif) | 1663947770288992081_..> | 2022-09-23 15:42 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1675772328329569922_..> | 2023-02-07 12:18 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1676640217308644583_..> | 2023-02-17 13:23 | 652K | |
![[IMG]](/icons/image2.gif) | 1677075839308567351_..> | 2023-02-22 14:23 | 362K | |
![[IMG]](/icons/image2.gif) | 1677810152327171371_..> | 2023-03-03 02:22 | 37K | |
![[IMG]](/icons/image2.gif) | 1678397646287241003_..> | 2023-03-09 21:34 | 96K | |
![[IMG]](/icons/image2.gif) | 1679584525256493461_..> | 2023-03-23 15:15 | 28K | |
![[IMG]](/icons/image2.gif) | 1680806869168437402_..> | 2023-04-06 18:47 | 80K | |
![[IMG]](/icons/image2.gif) | 1682980601344335318_..> | 2023-05-01 22:36 | 285K | |
![[IMG]](/icons/image2.gif) | 1685464257295012014_..> | 2023-05-30 16:30 | 73K | |
![[IMG]](/icons/image2.gif) | 1689796257342371807_..> | 2023-07-19 19:50 | 208K | |
![[IMG]](/icons/image2.gif) | 1690470725294047356_..> | 2023-07-27 15:12 | 2.9M | |
![[IMG]](/icons/image2.gif) | 1695927534218122667_..> | 2023-09-28 18:58 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1696520299193251790_..> | 2023-10-05 15:38 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1707096164355693128_..> | 2024-02-05 01:22 | 954K | |
![[IMG]](/icons/image2.gif) | 1707768935422954534_..> | 2024-02-12 20:15 | 331K | |
![[IMG]](/icons/image2.gif) | 1711135595326260968_..> | 2024-03-22 19:26 | 31K | |
![[IMG]](/icons/image2.gif) | 1712708803432479416_..> | 2024-04-10 00:26 | 101K | |
![[IMG]](/icons/image2.gif) | 1712708810432479416_..> | 2024-04-10 00:26 | 101K | |
![[IMG]](/icons/image2.gif) | 1721692746293526122_..> | 2024-07-22 23:59 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1724198055436240507_..> | 2024-08-20 23:54 | 657K | |
![[IMG]](/icons/image2.gif) | 1736985260461971601_..> | 2025-01-15 23:54 | 423K | |
![[IMG]](/icons/image2.gif) | 1748548131427761059_..> | 2025-05-29 19:48 | 1.4M | |
![[IMG]](/icons/image2.gif) | 15175848271506334368..> | 2018-02-02 00:00 | 9.6K | |
![[IMG]](/icons/image2.gif) | 15240512031521643550..> | 2018-04-18 00:00 | 79K | |
![[IMG]](/icons/image2.gif) | 15254594981525096337..> | 2018-05-04 00:00 | 168K | |
![[IMG]](/icons/image2.gif) | 15924013241591801881..> | 2020-06-17 06:42 | 374K | |
![[IMG]](/icons/image2.gif) | 15979308331027181530..> | 2020-08-20 06:40 | 551K | |
![[IMG]](/icons/image2.gif) | 16159329111615932829..> | 2021-03-16 22:15 | 77K | |
![[IMG]](/icons/image2.gif) | 16364862551101211558..> | 2021-11-09 19:30 | 1.6M | |
![[IMG]](/icons/image2.gif) | 16500530651631894068..> | 2022-04-15 20:04 | 314K | |
![[IMG]](/icons/image2.gif) | 16600781051127191858..> | 2022-08-09 20:48 | 1.8M | |
![[IMG]](/icons/image2.gif) | 16801236561599762347..> | 2023-03-29 21:00 | 2.0K | |
![[IMG]](/icons/image2.gif) | 16892757861000012056..> | 2023-07-13 19:16 | 254K | |
![[IMG]](/icons/image2.gif) | 16899683061000004075..> | 2023-07-21 19:38 | 386K | |
![[IMG]](/icons/image2.gif) | 16918491151000007375..> | 2023-08-12 14:05 | 505K | |
![[IMG]](/icons/image2.gif) | 16918491801000007375..> | 2023-08-12 14:06 | 505K | |
![[IMG]](/icons/image2.gif) | 17039496431000004846..> | 2023-12-30 15:20 | 201K | |
![[IMG]](/icons/image2.gif) | 17039509791000004842..> | 2023-12-30 15:42 | 134K | |
![[IMG]](/icons/image2.gif) | 17074623541000000853..> | 2024-02-09 07:05 | 213K | |
![[IMG]](/icons/image2.gif) | 17086153711000002542..> | 2024-02-22 15:22 | 1.9M | |
![[IMG]](/icons/image2.gif) | 17090024631574260365..> | 2024-02-27 02:54 | 1.7M | |
![[IMG]](/icons/image2.gif) | 17101296171000001182..> | 2024-03-11 04:00 | 103K | |
![[IMG]](/icons/image2.gif) | 17131160291000001489..> | 2024-04-14 17:33 | 1.2M | |
![[IMG]](/icons/image2.gif) | 17131161831000001490..> | 2024-04-14 17:36 | 909K | |
![[IMG]](/icons/image2.gif) | 17145336991000000601..> | 2024-05-01 03:21 | 190K | |
![[IMG]](/icons/image2.gif) | 17182824061000006221..> | 2024-06-13 12:40 | 195K | |
![[IMG]](/icons/image2.gif) | 17189068471000007679..> | 2024-06-20 18:07 | 104K | |
![[IMG]](/icons/image2.gif) | 17209077201000004287..> | 2024-07-13 21:55 | 2.1M | |
![[IMG]](/icons/image2.gif) | 17246232311000007236..> | 2024-08-25 22:00 | 75K | |
![[IMG]](/icons/image2.gif) | 17246486881000017122..> | 2024-08-26 05:04 | 794K | |
![[IMG]](/icons/image2.gif) | 17288608171000028039..> | 2024-10-13 23:06 | 302K | |
![[IMG]](/icons/image2.gif) | 17343638271000016188..> | 2024-12-16 15:43 | 456K | |
![[IMG]](/icons/image2.gif) | 17355193331000007915..> | 2024-12-30 00:42 | 783K | |
![[IMG]](/icons/image2.gif) | 17367942521000020850..> | 2025-01-13 18:50 | 133K | |
![[IMG]](/icons/image2.gif) | 17380171081000018656..> | 2025-01-27 22:31 | 2.3M | |
![[IMG]](/icons/image2.gif) | 17388869281000008525..> | 2025-02-07 00:08 | 67K | |
![[IMG]](/icons/image2.gif) | 17396252141000036600..> | 2025-02-15 13:13 | 265K | |
![[IMG]](/icons/image2.gif) | 17442796021000004129..> | 2025-04-10 10:06 | 470K | |
![[IMG]](/icons/image2.gif) | 17442802621000000885..> | 2025-04-10 10:17 | 72K | |
![[IMG]](/icons/image2.gif) | 17507228691000000072..> | 2025-06-23 23:54 | 136K | |
![[IMG]](/icons/image2.gif) | 17510419321000016165..> | 2025-06-27 16:32 | 593K | |
![[IMG]](/icons/image2.gif) | 17518136571000007574..> | 2025-07-06 14:54 | 109K | |
![[IMG]](/icons/image2.gif) | 17518139431000007574..> | 2025-07-06 14:59 | 109K | |
![[IMG]](/icons/image2.gif) | 16773613371614872122..> | 2023-02-25 21:42 | 685K | |
![[IMG]](/icons/image2.gif) | 14594381661389124523..> | 2016-03-31 00:00 | 18K | |
![[IMG]](/icons/image2.gif) | 15347947161466170681..> | 2018-08-20 00:00 | 38K | |
![[IMG]](/icons/image2.gif) | 16215420651595622150..> | 2021-05-20 20:21 | 120K | |
![[IMG]](/icons/image2.gif) | 16221548471616368090..> | 2021-05-27 22:34 | 551K | |
![[IMG]](/icons/image2.gif) | 16233735541621555638..> | 2021-06-11 01:05 | 954K | |
![[IMG]](/icons/image2.gif) | 16353752771606398502..> | 2021-10-27 22:54 | 606K | |
![[IMG]](/icons/image2.gif) | 16556599151655659798..> | 2022-06-19 17:31 | 1.9M | |
![[IMG]](/icons/image2.gif) | 16422849912022011516..> | 2022-01-15 22:16 | 2.1M | |
![[IMG]](/icons/image2.gif) | 15000528366363288022..> | 2017-07-14 00:00 | 55K | |
![[IMG]](/icons/image2.gif) | 16748242381674761510..> | 2023-01-27 12:57 | 2.5M | |
![[IMG]](/icons/image2.gif) | 17323169195923769950..> | 2024-11-22 23:08 | 724K | |
![[IMG]](/icons/image2.gif) | 16771052221650053065..> | 2023-02-22 22:33 | 314K | |
![[IMG]](/icons/image2.gif) | 14546091421454609113..> | 2016-02-04 00:00 | 42K | |
![[IMG]](/icons/image2.gif) | 16331047981633104601..> | 2021-10-01 16:13 | 1.9M | |
![[IMG]](/icons/image2.gif) | 16813415541681341330..> | 2023-04-12 23:19 | 1.5M | |
![[IMG]](/icons/image2.gif) | 16866832571686683054..> | 2023-06-13 19:07 | 1.2M | |
![[IMG]](/icons/image2.gif) | lab0001_Logo.png | 2025-01-13 01:04 | 7.9K | |
![[IMG]](/icons/image2.gif) | no_photo.jpg | 2020-10-27 12:49 | 17K | |
|